| Release Notes for OpenPower Firmware v1.22-rc1 |
| ============================================== |
| |
| Please note that this is a RELEASE CANDIDATE and not the final v1.22 |
| release. We expect to do a final v1.21 tagged release before the |
| first week of April is done. |
| |
| This release (including the final v1.21) is NOT intended for GA POWER9 |
| platforms. For that, you will need the (future) op-build v2.0. |
| |
| Known Issues |
| ------------ |
| |
| The following stop states are disabled: 4,5,11. We believe all the bugs |
| have been shaken out of stop4 and stop5, and they will be enabled immediately |
| after v1.22. |
| |
| New platforms |
| ------------- |
| |
| - vesnin |
| |
| A 4 socket 2U POWER8 system with up to 8TB of memory from YADRO. |
| There are still some outstanding hostboot patches that are currently |
| being reviewed in order to have full Vesnin support upstream. |
| |
| Updated Packages |
| ---------------- |
| |
| +------+----------------+----------------+---------------------------------------+ |
| | Pack | Old Version | New Version | Platforms | |
| | age | | | | |
| +======+================+================+=======================================+ |
| | glib | glibc-2.26-73- | glibc-2.26-107 | barreleye, firenze, firestone, | |
| | c | g4b692dffb95ac | -g73a92363619e | garrison, habanero, openpower\_mambo, | |
| | | 4812b161eb6a16 | 52c458146e903d | openpower\_p9\_mambo, p9dsu, | |
| | | 113d7e824982e | fb9b1ba823aa40 | palmetto, pseries, romulus, | |
| | | | | witherspoon, zaius, zz | |
| +------+----------------+----------------+---------------------------------------+ |
| | host | 28927a78ca4144 | 6eaa4575c95a2a | p9dsu, romulus, witherspoon, zaius | |
| | boot | aa8214d35b7ad7 | 5bccfad3e861a8 | | |
| | | e2ddba5ada4e | 55ffd8446aa3 | | |
| +------+----------------+----------------+---------------------------------------+ |
| | host | 6924d6b711ba7b | 2657e58ac28a32 | barreleye, firestone, garrison, | |
| | boot | 1d4c47346c9a8d | c73a3002c715b6 | habanero, p9dsu, palmetto, romulus, | |
| | -bin | ff88cfaaf4c8 | ea9d8880f112 | witherspoon, zaius | |
| | arie | | | | |
| | s | | | | |
| +------+----------------+----------------+---------------------------------------+ |
| | ima- | 01b26a136da16a | 90237254664cad | barreleye, firestone, garrison, | |
| | cata | 87c0b6b3c4d9f2 | ab529a39796508 | habanero, p9dsu, palmetto, romulus, | |
| | log | 7555dca104dc | 3e38806d92e6 | witherspoon, zaius | |
| +------+----------------+----------------+---------------------------------------+ |
| | libf | v5.9-166-g70f1 | v5.10.1 | barreleye, firenze, firestone, | |
| | lash | 4f4dd86e | | garrison, habanero, p9dsu, palmetto, | |
| | | | | pseries, romulus, witherspoon, zaius, | |
| | | | | zz | |
| +------+----------------+----------------+---------------------------------------+ |
| | linu | 4.14.20 | 4.15.9 | barreleye, firenze, firestone, | |
| | x | | | garrison, habanero, openpower\_mambo, | |
| | | | | openpower\_p9\_mambo, p9dsu, | |
| | | | | palmetto, pseries, romulus, | |
| | | | | witherspoon, zaius, zz | |
| +------+----------------+----------------+---------------------------------------+ |
| | linu | 4.14.20 | 4.15.9 | barreleye, firenze, firestone, | |
| | x-he | | | garrison, habanero, openpower\_mambo, | |
| | ader | | | openpower\_p9\_mambo, p9dsu, | |
| | s | | | palmetto, pseries, romulus, | |
| | | | | witherspoon, zaius, zz | |
| +------+----------------+----------------+---------------------------------------+ |
| | mach | 58554bfabd7f35 | c10638fa2a834c | witherspoon | |
| | ine- | 6bc9db3e493816 | 216f28da7705da | | |
| | xml | 2acd445fc559 | 331bc0bad4bf | | |
| +------+----------------+----------------+---------------------------------------+ |
| | mach | b0884b3032df60 | 4b012a3d1da538 | zaius | |
| | ine- | e49eff4b212719 | b3fb97c332b6fc | | |
| | xml | f8d49a5d6be7 | e51a6cffaf9a | | |
| +------+----------------+----------------+---------------------------------------+ |
| | occ | f72f857b7e5ab2 | 768466b31e853c | p9dsu, romulus, witherspoon, zaius | |
| | | 5a5616b1655005 | b11dfa90dbfc15 | | |
| | | b963405eb350 | 65a21ee9646e | | |
| +------+----------------+----------------+---------------------------------------+ |
| | open | b210f15c69933e | 824b1bf91c6f03 | barreleye, firestone, garrison, | |
| | powe | 21494323a8f501 | 0e696c1a4d72b7 | habanero, p9dsu, palmetto, romulus, | |
| | r-pn | 7501e7b2c1de | 311985006705 | witherspoon, zaius | |
| | or | | | | |
| +------+----------------+----------------+---------------------------------------+ |
| | peti | v1.6.6 | v1.7.1 | barreleye, firenze, firestone, | |
| | tboo | | | garrison, habanero, openpower\_mambo, | |
| | t | | | openpower\_p9\_mambo, p9dsu, | |
| | | | | palmetto, pseries, romulus, | |
| | | | | witherspoon, zaius, zz | |
| +------+----------------+----------------+---------------------------------------+ |
| | sbe | 0aae9a8e68abb5 | 5c0363924c7d71 | p9dsu, romulus, witherspoon, zaius | |
| | | 5110bee2d7bd2f | 0146155b3354b2 | | |
| | | be49a4a11e70 | 36012372dd24 | | |
| +------+----------------+----------------+---------------------------------------+ |
| | skib | v5.10 | v5.11-rc1 | barreleye, firenze, firestone, | |
| | oot | | | garrison, habanero, openpower\_mambo, | |
| | | | | openpower\_p9\_mambo, p9dsu, | |
| | | | | palmetto, pseries, romulus, | |
| | | | | witherspoon, zaius, zz | |
| +------+----------------+----------------+---------------------------------------+ |
| |
| New Packages |
| ------------ |
| |
| +-----------+-----------+-------------+ |
| | Package | Version | Platforms | |
| +===========+===========+=============+ |
| +-----------+-----------+-------------+ |
| |
| Removed Packages |
| ---------------- |
| |
| +-----------+--------------------------------------------+-------------+ |
| | Package | Version | Platforms | |
| +===========+============================================+=============+ |
| | sbe | 0aae9a8e68abb55110bee2d7bd2fbe49a4a11e70 | zz | |
| +-----------+--------------------------------------------+-------------+ |
| |
| Package: barreleye-xml |
| ---------------------- |
| |
| `Repository <https://github.com/open-power/barreleye-xml>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| Commits |
| ~~~~~~~ |
| |
| No changes. |
| |
| Package: firestone-xml |
| ---------------------- |
| |
| `Repository <https://github.com/open-power/firestone-xml>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| Commits |
| ~~~~~~~ |
| |
| No changes. |
| |
| Package: garrison-xml |
| --------------------- |
| |
| `Repository <https://github.com/open-power/garrison-xml>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| Commits |
| ~~~~~~~ |
| |
| No changes. |
| |
| Package: habanero-xml |
| --------------------- |
| |
| `Repository <https://github.com/open-power/habanero-xml>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| Commits |
| ~~~~~~~ |
| |
| No changes. |
| |
| Package: hostboot |
| ----------------- |
| |
| `Repository <https://github.com/open-power/hostboot>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| Commits |
| ~~~~~~~ |
| |
| Abhishek Agarwal (1): |
| |
| - `fdbb8517ab31 <https://github.com/open-power/hostboot/commit/fdbb8517ab31>`__ |
| ATTR\_CHIP\_EC\_FEATURE\_HW406337 support for Axone |
| |
| Alex Taft (4): |
| |
| - `c078ed5d8667 <https://github.com/open-power/hostboot/commit/c078ed5d8667>`__ |
| New dummy pulse pok bits (for L2/L3) |
| - `da32698522da <https://github.com/open-power/hostboot/commit/da32698522da>`__ |
| HW405413 : NCU sends data out of order |
| - `e8c20a22ad09 <https://github.com/open-power/hostboot/commit/e8c20a22ad09>`__ |
| L3 initfile updates |
| - `7dea31a9b0b0 <https://github.com/open-power/hostboot/commit/7dea31a9b0b0>`__ |
| L3 Initfile: Qualify divide\_minor setting |
| |
| Alpana Kumari (1): |
| |
| - `bd85928cb6ab <https://github.com/open-power/hostboot/commit/bd85928cb6ab>`__ |
| Fix enum in dimmConsts.H |
| |
| Amit Tendolkar (3): |
| |
| - `a2c708da6e1a <https://github.com/open-power/hostboot/commit/a2c708da6e1a>`__ |
| Add PGPE XIRs to Special Wakeup Failure FFDC |
| - `def84fb4f740 <https://github.com/open-power/hostboot/commit/def84fb4f740>`__ |
| Enable setting the stop recovery enabled/disable policy in SGPE Init |
| - `18d91f4a458f <https://github.com/open-power/hostboot/commit/18d91f4a458f>`__ |
| Update p9\_collect\_ppe\_state to dynamically collect PPE FFDC |
| |
| Andre Marin (14): |
| |
| - `f595ecf7f9d0 <https://github.com/open-power/hostboot/commit/f595ecf7f9d0>`__ |
| Add address translation (xlate) support for 4Gbx8 and unit tests |
| - `443282a786ee <https://github.com/open-power/hostboot/commit/443282a786ee>`__ |
| Fixes memdiags broadcast mode address check bug |
| - `c50ad6201b4a <https://github.com/open-power/hostboot/commit/c50ad6201b4a>`__ |
| Add base spd decoder to share among controllers |
| - `157d87dcea5a <https://github.com/open-power/hostboot/commit/157d87dcea5a>`__ |
| Change base decoder, add ddr4 namespace, and common API btw modules |
| - `b0eb26a290f0 <https://github.com/open-power/hostboot/commit/b0eb26a290f0>`__ |
| Add const to the end of spd decoder methods to denote unchanged mem |
| vars |
| - `e1e78b687d15 <https://github.com/open-power/hostboot/commit/e1e78b687d15>`__ |
| Add Connector to SDRAM Bit Mapping to the SPD decoder and unit tests |
| - `b6de6f7655df <https://github.com/open-power/hostboot/commit/b6de6f7655df>`__ |
| Split SPD Connector to SDRAM fields, add unit tests |
| - `d9cde7352d62 <https://github.com/open-power/hostboot/commit/d9cde7352d62>`__ |
| Remove override flag for ATTR\_MSS\_MRW\_ALLOW\_UNSUPPORTED\_RCW, |
| deconfig update |
| - `3ffad4a09011 <https://github.com/open-power/hostboot/commit/3ffad4a09011>`__ |
| Remove mss::c\_str dependency for SPD decoder for future reuse |
| - `71987fc9ba5a <https://github.com/open-power/hostboot/commit/71987fc9ba5a>`__ |
| Add DLL workaround and unit tests |
| - `3eb1f8ab1705 <https://github.com/open-power/hostboot/commit/3eb1f8ab1705>`__ |
| Disable mem clk stop when in STR for DD2.\* only |
| - `e9b81f6e0311 <https://github.com/open-power/hostboot/commit/e9b81f6e0311>`__ |
| Remove reset\_dll from scominit, enable delay line tap points |
| - `04088f2ddf58 <https://github.com/open-power/hostboot/commit/04088f2ddf58>`__ |
| Modified gen\_accessors script for greater support |
| - `ab7f5582fdba <https://github.com/open-power/hostboot/commit/ab7f5582fdba>`__ |
| Remove logic to disable memory clocks in STR if in |
| PD\_AND\_STR\_CLK\_STOP mode |
| |
| Anusha Reddy Rangareddygari (7): |
| |
| - `37f1636463ec <https://github.com/open-power/hostboot/commit/37f1636463ec>`__ |
| Ec\_level attribute support for DD1 attributes |
| - `b722a87509e1 <https://github.com/open-power/hostboot/commit/b722a87509e1>`__ |
| DD2 updates:p9\_sbe\_arrayinit,p9\_sbe\_tp\_arrayinit |
| - `9194b0c4c0cc <https://github.com/open-power/hostboot/commit/9194b0c4c0cc>`__ |
| VITAL cleaning for DD2 |
| - `313d850ed60d <https://github.com/open-power/hostboot/commit/313d850ed60d>`__ |
| p9\_start\_cbs updates |
| - `37f0ec3dddbd <https://github.com/open-power/hostboot/commit/37f0ec3dddbd>`__ |
| p9\_sbe\_chiplet\_reset,p9\_sbe\_arrayinit |
| - `5ac11d13ae61 <https://github.com/open-power/hostboot/commit/5ac11d13ae61>`__ |
| Cumulus proc updates |
| - `156a0bd71156 <https://github.com/open-power/hostboot/commit/156a0bd71156>`__ |
| Axone Update |
| |
| Ben Gass (15): |
| |
| - `5ebf782126ac <https://github.com/open-power/hostboot/commit/5ebf782126ac>`__ |
| Add support for p9c 1.2 |
| - `a8bf720f6890 <https://github.com/open-power/hostboot/commit/a8bf720f6890>`__ |
| Turn off 64byte checkbit inversion for simulation in |
| centaur.mbs.scom.initfile |
| - `ef607c81e101 <https://github.com/open-power/hostboot/commit/ef607c81e101>`__ |
| Axone MC uses same pll/clock setup as in Cumulus. |
| - `3877eeac3ff3 <https://github.com/open-power/hostboot/commit/3877eeac3ff3>`__ |
| Remove PROC\_FABRIC\_LINK\_ACTIVE from OBUS\_FBC\_ENABLED in |
| p9.obus.scom.initfile |
| - `8aefe57f98f5 <https://github.com/open-power/hostboot/commit/8aefe57f98f5>`__ |
| Adding chip\_ec\_feature attributes for dd2 build |
| - `21200ba766f3 <https://github.com/open-power/hostboot/commit/21200ba766f3>`__ |
| Set NDL IOValids based on configured NV links. |
| - `7375de1dcebd <https://github.com/open-power/hostboot/commit/7375de1dcebd>`__ |
| Update filter pll settings as per HW407180 |
| - `749693530aed <https://github.com/open-power/hostboot/commit/749693530aed>`__ |
| Use obus p9ndd1 spy name attribute for obus initfile |
| - `f52bb2280385 <https://github.com/open-power/hostboot/commit/f52bb2280385>`__ |
| Create dmi.pll.scan.initfile |
| - `a69039374bbe <https://github.com/open-power/hostboot/commit/a69039374bbe>`__ |
| Updates for HW416934 and HW417233 |
| - `0844be4f3967 <https://github.com/open-power/hostboot/commit/0844be4f3967>`__ |
| Adding p9a support. |
| - `5b9b993f082c <https://github.com/open-power/hostboot/commit/5b9b993f082c>`__ |
| Re-submit Axone updates |
| - `d3594cc4abcb <https://github.com/open-power/hostboot/commit/d3594cc4abcb>`__ |
| Add support for p9c 1.2 |
| - `277e5d2085cd <https://github.com/open-power/hostboot/commit/277e5d2085cd>`__ |
| Axone MC uses same pll/clock setup as in Cumulus. |
| - `9bea281bae99 <https://github.com/open-power/hostboot/commit/9bea281bae99>`__ |
| Add p9n 2.3 to p9\_frequency\_buckets.H |
| |
| Benjamin Weisenbeck (1): |
| |
| - `24bcf5732469 <https://github.com/open-power/hostboot/commit/24bcf5732469>`__ |
| PRD: Fix data storage exception in PLL analysis |
| |
| Bill Hoffa (5): |
| |
| - `014e0ae7136c <https://github.com/open-power/hostboot/commit/014e0ae7136c>`__ |
| Add Kernel Debug Trace for Out of Memory condition |
| - `ddb2012f39d5 <https://github.com/open-power/hostboot/commit/ddb2012f39d5>`__ |
| Enable Cumulus CDIMM Config |
| - `a2dc8952afa9 <https://github.com/open-power/hostboot/commit/a2dc8952afa9>`__ |
| Deliver cumulus\_cdimm pnor image to fips for Simics regression |
| testing |
| - `9de67e525158 <https://github.com/open-power/hostboot/commit/9de67e525158>`__ |
| Update Bbuild to b0316a\_1813.920 |
| - `425eb895f440 <https://github.com/open-power/hostboot/commit/425eb895f440>`__ |
| Add ATTR\_ prefix to attributes missing it in |
| hb\_customized\_attrs.xml |
| |
| Brian Bakke (2): |
| |
| - `3403445e2f75 <https://github.com/open-power/hostboot/commit/3403445e2f75>`__ |
| Fix and codify how system and node targets are handled by attribute |
| overrides |
| - `bb0dc7d71263 <https://github.com/open-power/hostboot/commit/bb0dc7d71263>`__ |
| Add common XSCOM error literals to HBRT |
| |
| Brian Silver (3): |
| |
| - `57808f6af451 <https://github.com/open-power/hostboot/commit/57808f6af451>`__ |
| Add EC feature levels to MSS workarounds |
| - `b76592c3358c <https://github.com/open-power/hostboot/commit/b76592c3358c>`__ |
| Add EC workaround for PHY training bad bit processing |
| - `8ccd1b475062 <https://github.com/open-power/hostboot/commit/8ccd1b475062>`__ |
| Add Memory Subsystem FIR support |
| |
| Brian Stegmiller (3): |
| |
| - `2993c5b32a67 <https://github.com/open-power/hostboot/commit/2993c5b32a67>`__ |
| PRD: Add regs to capture list for NVLINK analysis |
| - `8cf2925f7e01 <https://github.com/open-power/hostboot/commit/8cf2925f7e01>`__ |
| Monitor threads for HB TI to work |
| - `0e69501ebe5b <https://github.com/open-power/hostboot/commit/0e69501ebe5b>`__ |
| Simics: Skip mem diag due to intermittent action file issues |
| |
| Brian Vanderpool (1): |
| |
| - `551d7e678a8e <https://github.com/open-power/hostboot/commit/551d7e678a8e>`__ |
| PM: Ignore allow\_reg\_wakeup in cache contained mode |
| |
| CHRISTINA L. GRAVES (3): |
| |
| - `316f190cdeac <https://github.com/open-power/hostboot/commit/316f190cdeac>`__ |
| p9\_sbe\_lpc\_init fix with GPIO reset |
| - `a7f98e8fe346 <https://github.com/open-power/hostboot/commit/a7f98e8fe346>`__ |
| Fix for HW397129-set bit 52 in the ALTD\_OPTION reg to keep MC |
| fastpath enabled |
| - `6567fe47ef12 <https://github.com/open-power/hostboot/commit/6567fe47ef12>`__ |
| p9\_setup\_bars -- support DD2 NPU SCOM address changes |
| |
| Caleb Palmer (6): |
| |
| - `1467cbcb8be5 <https://github.com/open-power/hostboot/commit/1467cbcb8be5>`__ |
| Fix target type check in bad dq helper function |
| - `18a73baccdc2 <https://github.com/open-power/hostboot/commit/18a73baccdc2>`__ |
| PRD: Don't skip TPS after failed MemDealloc calls |
| - `d2fd055febb7 <https://github.com/open-power/hostboot/commit/d2fd055febb7>`__ |
| Free mem and fix dimm trgt in bad dq accessors |
| - `83933bedd3ce <https://github.com/open-power/hostboot/commit/83933bedd3ce>`__ |
| MDIA: Cut mdia patterns from 9 to 4 |
| - `8f68014a90f6 <https://github.com/open-power/hostboot/commit/8f68014a90f6>`__ |
| MDIA: ensure full MBA target support for P9 |
| - `4bc416f75e08 <https://github.com/open-power/hostboot/commit/4bc416f75e08>`__ |
| MDIA: command cleanup support |
| |
| Chris Cain (1): |
| |
| - `24780f003a4b <https://github.com/open-power/hostboot/commit/24780f003a4b>`__ |
| HTMGT: Cache user power limit from BMC and add proc callout for 2AEx |
| errors |
| |
| Chris Hanudel (1): |
| |
| - `8dba9b43bdc9 <https://github.com/open-power/hostboot/commit/8dba9b43bdc9>`__ |
| Updates for P9 NX DD2 initfiles |
| |
| Christian Geddes (8): |
| |
| - `8d28433bcc3c <https://github.com/open-power/hostboot/commit/8d28433bcc3c>`__ |
| Fix bugs in FSP->HBRT message path for SBE errors |
| - `4a60925ef57e <https://github.com/open-power/hostboot/commit/4a60925ef57e>`__ |
| Fix trace bug for error path in rt\_fwnotify |
| - `2c4b416ae0cf <https://github.com/open-power/hostboot/commit/2c4b416ae0cf>`__ |
| Remove if that was catching SBE chipop err logs and forcing reboot |
| - `c5983ddc3585 <https://github.com/open-power/hostboot/commit/c5983ddc3585>`__ |
| Skip attempting sbe\_retry when HBRT receives SBE\_ERR from HWSV |
| - `10aa31b32fc0 <https://github.com/open-power/hostboot/commit/10aa31b32fc0>`__ |
| Re-order sbex calls in presimsetup to get paths updated correctly |
| - `04ba8e387d32 <https://github.com/open-power/hostboot/commit/04ba8e387d32>`__ |
| Update autocitest to collect all hostboot dump info prior to failure |
| - `74156401d2fb <https://github.com/open-power/hostboot/commit/74156401d2fb>`__ |
| Don't include duplicate connections when looking up xbus mapping |
| - `05cda10a435a <https://github.com/open-power/hostboot/commit/05cda10a435a>`__ |
| Update backing build to be b0222a\_1810.911 |
| |
| Christopher Riedl (1): |
| |
| - `8d3671f0c224 <https://github.com/open-power/hostboot/commit/8d3671f0c224>`__ |
| PPM reg collision (HW389511) work-around: Special Wake-up |
| |
| Claus Michael Olsen (4): |
| |
| - `3fbe556d9d69 <https://github.com/open-power/hostboot/commit/3fbe556d9d69>`__ |
| Additional risk level support - (step 2) Updating the image w/RL2 |
| - `a563b914d6dc <https://github.com/open-power/hostboot/commit/a563b914d6dc>`__ |
| xip\_customize: GPTR/overlays stage 1 support |
| - `50a391ac5965 <https://github.com/open-power/hostboot/commit/50a391ac5965>`__ |
| HW425038 INT ARX timeout workaround - Updated initfiles to 49241 |
| - `68f67bd7aab5 <https://github.com/open-power/hostboot/commit/68f67bd7aab5>`__ |
| Update to putRingUtils to proper scanning of perv\_pll\_bndy\_flt |
| rings |
| |
| Corey Swenson (4): |
| |
| - `4cf79f8dc40b <https://github.com/open-power/hostboot/commit/4cf79f8dc40b>`__ |
| Changes to Inband SCOM MMIO ranges for Cumulus |
| - `53635aee4925 <https://github.com/open-power/hostboot/commit/53635aee4925>`__ |
| Delete ATTR\_DMI\_INBAND\_BAR\_ENABLE when processing MRW attributes |
| - `ed84b08afa87 <https://github.com/open-power/hostboot/commit/ed84b08afa87>`__ |
| Inband SCOM clean up |
| - `b4699ae10c2a <https://github.com/open-power/hostboot/commit/b4699ae10c2a>`__ |
| Add inband bar address to simics xml |
| |
| Dan Crowell (16): |
| |
| - `b47f658c6e96 <https://github.com/open-power/hostboot/commit/b47f658c6e96>`__ |
| Pull ATTR\_MSS\_MRW\_FORCE\_BCMODE\_OFF from MRW if it exists |
| - `431a3cc0aa10 <https://github.com/open-power/hostboot/commit/431a3cc0aa10>`__ |
| Bug fixes for concurrent update of HBRT |
| - `4a0eb030e761 <https://github.com/open-power/hostboot/commit/4a0eb030e761>`__ |
| Mirror fixup - spd\_decoder\_base.H |
| - `36766721c030 <https://github.com/open-power/hostboot/commit/36766721c030>`__ |
| Disable WOF for Cumulus DD1.0 |
| - `4f43040cb271 <https://github.com/open-power/hostboot/commit/4f43040cb271>`__ |
| Enable WOF\_VRATIO on ZZ |
| - `f5d2c874d072 <https://github.com/open-power/hostboot/commit/f5d2c874d072>`__ |
| Removing old TODO for dropped requirement |
| - `309422a68f39 <https://github.com/open-power/hostboot/commit/309422a68f39>`__ |
| Fix EID range for HBRT logs |
| - `586b8b1e6088 <https://github.com/open-power/hostboot/commit/586b8b1e6088>`__ |
| Do not elevate severity of reconfig error log |
| - `e4a7de38d08d <https://github.com/open-power/hostboot/commit/e4a7de38d08d>`__ |
| No longer include BAR attributes in ServerWiz2 export |
| - `5683e4887711 <https://github.com/open-power/hostboot/commit/5683e4887711>`__ |
| Remirror chip\_ec\_attributes.xml |
| - `7b96070e5a1f <https://github.com/open-power/hostboot/commit/7b96070e5a1f>`__ |
| Disabling WOF and VDM for Nimbus DD2.0 |
| - `eb7c0e1f8327 <https://github.com/open-power/hostboot/commit/eb7c0e1f8327>`__ |
| Disable WOF for Cumulus DD1.0 |
| - `945553cc05cf <https://github.com/open-power/hostboot/commit/945553cc05cf>`__ |
| Force single-threaded access to HWPs in PRD |
| - `54d16a1476fe <https://github.com/open-power/hostboot/commit/54d16a1476fe>`__ |
| Add proc huid to PSU trace |
| - `bbe9dd41d809 <https://github.com/open-power/hostboot/commit/bbe9dd41d809>`__ |
| Fix FFDC for FW Request Errors |
| - `4d755323a660 <https://github.com/open-power/hostboot/commit/4d755323a660>`__ |
| Completely hide attributes that have no value |
| |
| Daniel Howe (3): |
| |
| - `928dab2ae2c2 <https://github.com/open-power/hostboot/commit/928dab2ae2c2>`__ |
| Allow lpc\_ed for p9n 2.2 per HW418117 fix |
| - `55b4dac7353b <https://github.com/open-power/hostboot/commit/55b4dac7353b>`__ |
| update data token init to use scans on p9c 1.1 |
| - `acd49fe41045 <https://github.com/open-power/hostboot/commit/acd49fe41045>`__ |
| dd1.1+ DL training procedure updates |
| |
| Daniel M. Crowell (1): |
| |
| - `2fd3b08eed59 <https://github.com/open-power/hostboot/commit/2fd3b08eed59>`__ |
| Revert "Adds self time refresh entry and exit helper functions" |
| |
| David Kauer (4): |
| |
| - `112c8bd6e114 <https://github.com/open-power/hostboot/commit/112c8bd6e114>`__ |
| Update INT DD2 initfiles |
| - `e53b287b70c0 <https://github.com/open-power/hostboot/commit/e53b287b70c0>`__ |
| Added Nimbus & Cumulus attributes for INT initfiles |
| - `128afcc6737f <https://github.com/open-power/hostboot/commit/128afcc6737f>`__ |
| HW425038 INT ARX timeout workaround |
| - `240defa5f9b2 <https://github.com/open-power/hostboot/commit/240defa5f9b2>`__ |
| Modify INT FIR configuration settings |
| |
| Dean Sanner (2): |
| |
| - `2414e7c8e5de <https://github.com/open-power/hostboot/commit/2414e7c8e5de>`__ |
| Support sending chip info to SBEs on multinode |
| - `d6f9a2206311 <https://github.com/open-power/hostboot/commit/d6f9a2206311>`__ |
| Force 25G Nvlink speed on P9N DD2.1 |
| |
| Elizabeth Liner (3): |
| |
| - `8f1ef46890d9 <https://github.com/open-power/hostboot/commit/8f1ef46890d9>`__ |
| Adding visible error once we know that the SBE is erroring |
| - `c142eb850380 <https://github.com/open-power/hostboot/commit/c142eb850380>`__ |
| Adding attribute to detect which processor we can use for alt-memory |
| - `4761f0cf880a <https://github.com/open-power/hostboot/commit/4761f0cf880a>`__ |
| Updating HWP's to use PROC\_CHIP\_MEM\_TO\_USE attribute |
| |
| Emmanuel Sacristan (1): |
| |
| - `7a09b00b1558 <https://github.com/open-power/hostboot/commit/7a09b00b1558>`__ |
| NMMU Nimbus dd2 scom/scan updates, updated comments |
| |
| Greg Still (7): |
| |
| - `f9b500d310ee <https://github.com/open-power/hostboot/commit/f9b500d310ee>`__ |
| PM: GPE timer fix (HW389045 - Update Shadow copy of TSEL) |
| - `420c26669087 <https://github.com/open-power/hostboot/commit/420c26669087>`__ |
| PM: refine enablement attributes for advanced functions |
| (VDM,RESCLK,WOF,IVRM) |
| - `52074db64a3d <https://github.com/open-power/hostboot/commit/52074db64a3d>`__ |
| PM: Move to chip EC based #V validity checking in |
| p9\_pstate\_parameter\_block |
| - `a2a54161270c <https://github.com/open-power/hostboot/commit/a2a54161270c>`__ |
| VDM: p9\_pstate\_parameter\_block check for VDM Large threshold < |
| -32mV |
| - `cbcd27d3a629 <https://github.com/open-power/hostboot/commit/cbcd27d3a629>`__ |
| PM: p9\_setup\_evid steps voltage to avoid Fleetwood VRM limitations |
| - `c3364dfd2650 <https://github.com/open-power/hostboot/commit/c3364dfd2650>`__ |
| PM: p9\_setup\_evid - deal with attribute clearing during MPIPL |
| - `9b5cfe7260ef <https://github.com/open-power/hostboot/commit/9b5cfe7260ef>`__ |
| PM: Enhance p9\_pm\_pss\_init for reset error logging |
| |
| Ilya Smirnov (5): |
| |
| - `a681d519d4dc <https://github.com/open-power/hostboot/commit/a681d519d4dc>`__ |
| Pass i\_skipComm to \_buildOccs |
| - `299023edd66f <https://github.com/open-power/hostboot/commit/299023edd66f>`__ |
| Reload OCC and HCODE LIDs in OCC Reload Path |
| - `95c3ddc9290b <https://github.com/open-power/hostboot/commit/95c3ddc9290b>`__ |
| Insert Debug Data Into hb prime Code Path |
| - `c82b626e6ea1 <https://github.com/open-power/hostboot/commit/c82b626e6ea1>`__ |
| Check the Section Headers in Non-Secure Mode |
| - `ec645465cdae <https://github.com/open-power/hostboot/commit/ec645465cdae>`__ |
| Flush TMP Daemon Traces Prior to Shutdown |
| |
| Jacob Harvey (3): |
| |
| - `052142a41cd0 <https://github.com/open-power/hostboot/commit/052142a41cd0>`__ |
| Add in RCD attributes for DD2 debug |
| - `e5ca1ace470e <https://github.com/open-power/hostboot/commit/e5ca1ace470e>`__ |
| Change RD\_CTR workaround val and update attr name |
| - `9abf780c9305 <https://github.com/open-power/hostboot/commit/9abf780c9305>`__ |
| Increment red\_waterfall for low vdn fix |
| |
| Jaymes Wilks (4): |
| |
| - `8ea7d7ed5db4 <https://github.com/open-power/hostboot/commit/8ea7d7ed5db4>`__ |
| Change FCO distribution to ensure master chip has at least one core |
| - `13dd75dd4dc3 <https://github.com/open-power/hostboot/commit/13dd75dd4dc3>`__ |
| Support TPM in CUMULUS standalone SIMICS boot |
| - `4f5c0b932724 <https://github.com/open-power/hostboot/commit/4f5c0b932724>`__ |
| Add TPM to the CUMULUS CDIMM model |
| - `4eaf644dbf1b <https://github.com/open-power/hostboot/commit/4eaf644dbf1b>`__ |
| Remove code flows that use non-open signing tools |
| |
| Jennifer A. Stofer (1): |
| |
| - `7728cc84c782 <https://github.com/open-power/hostboot/commit/7728cc84c782>`__ |
| Revert "Adding p9a support." |
| |
| Jenny Huynh (12): |
| |
| - `3d8051b7b2e7 <https://github.com/open-power/hostboot/commit/3d8051b7b2e7>`__ |
| Reset L3 error status register for next CE/UE capture |
| - `c27a8bd5fb97 <https://github.com/open-power/hostboot/commit/c27a8bd5fb97>`__ |
| Adding workaround for HW930007 and HW386013 |
| - `793f58e194db <https://github.com/open-power/hostboot/commit/793f58e194db>`__ |
| Adding in defect HW395947,HW930007 to INT initfiles |
| - `d0d88fcce2d4 <https://github.com/open-power/hostboot/commit/d0d88fcce2d4>`__ |
| Adding HW363780 to NPU scom initfiles |
| - `a42eb15a2cc9 <https://github.com/open-power/hostboot/commit/a42eb15a2cc9>`__ |
| Reducing rng pace rate from 2000 -> 300 for HW403701 |
| - `4b6b29be4ff5 <https://github.com/open-power/hostboot/commit/4b6b29be4ff5>`__ |
| HW406130: Reduce dma read requests from 16->8 in NX inits |
| - `6ec839acf46f <https://github.com/open-power/hostboot/commit/6ec839acf46f>`__ |
| HW407123: Slow down xlink command rate for Nimbus DD1/2 |
| - `a1635526313e <https://github.com/open-power/hostboot/commit/a1635526313e>`__ |
| INT scan initfile change to add workaround for HW408972 |
| - `e7db59ec919d <https://github.com/open-power/hostboot/commit/e7db59ec919d>`__ |
| Adding HW401552 to cxa initfile to workaround clockgating bug |
| - `9b84a7e90001 <https://github.com/open-power/hostboot/commit/9b84a7e90001>`__ |
| Adding HW414702 workaround to INT scan initfiles |
| - `ddf01705dda7 <https://github.com/open-power/hostboot/commit/ddf01705dda7>`__ |
| Workaround for Quaint Gate, Angry Reindeer |
| - `b79417a6c766 <https://github.com/open-power/hostboot/commit/b79417a6c766>`__ |
| Updating HW414700 to also apply to Cumulus DD10 |
| |
| Joachim Fenkes (6): |
| |
| - `c0967b7fb152 <https://github.com/open-power/hostboot/commit/c0967b7fb152>`__ |
| LPC: Add empty files for mirroring to HB, PPE, HWSV |
| - `1141d3f0a51e <https://github.com/open-power/hostboot/commit/1141d3f0a51e>`__ |
| FFDC: Add empty new helper procedure for mirroring to HB, HWSV |
| - `d4ea0e36be37 <https://github.com/open-power/hostboot/commit/d4ea0e36be37>`__ |
| Add p9\_proc\_gettracearray procedure |
| - `6f16f1f33d3e <https://github.com/open-power/hostboot/commit/6f16f1f33d3e>`__ |
| p9\_sbe\_tracearray: Nimbus DD2 updates |
| - `d61bf78fca7d <https://github.com/open-power/hostboot/commit/d61bf78fca7d>`__ |
| HW415692: Make workaround permanent |
| - `efc02485efbd <https://github.com/open-power/hostboot/commit/efc02485efbd>`__ |
| HDCT: Remove core trace arrays, permanent P9 erratum |
| |
| Joe McGill (40): |
| |
| - `90a2c95eb96c <https://github.com/open-power/hostboot/commit/90a2c95eb96c>`__ |
| p9\_tod\_move\_tod\_to\_tb -- correct TOD state checks |
| - `4d23f6873114 <https://github.com/open-power/hostboot/commit/4d23f6873114>`__ |
| p9\_sbe\_tracearray -- satsify PRD calls to manage core trace arrays |
| - `ac0c8f0e7bdb <https://github.com/open-power/hostboot/commit/ac0c8f0e7bdb>`__ |
| resolve Zeppelin DMI channel framelock issues |
| - `c0fce11639f7 <https://github.com/open-power/hostboot/commit/c0fce11639f7>`__ |
| enforce strict 512 GB per socket limit on Witherspoon memory map |
| (part2) |
| - `92f6bd045cb1 <https://github.com/open-power/hostboot/commit/92f6bd045cb1>`__ |
| HW388878 VCS workaround |
| - `9c189e8e26a7 <https://github.com/open-power/hostboot/commit/9c189e8e26a7>`__ |
| p9.fbc.scan.initfile -- create initfile, add workaround for HW376651 |
| - `5ba30ede4f3a <https://github.com/open-power/hostboot/commit/5ba30ede4f3a>`__ |
| p9\_psi\_init -- parametrize link speed (half/full) |
| - `398408a979d7 <https://github.com/open-power/hostboot/commit/398408a979d7>`__ |
| p9.fbc.scan.initfile -- clock off MCSYNC staging latches |
| - `12ea45b365cf <https://github.com/open-power/hostboot/commit/12ea45b365cf>`__ |
| Add MSS customization support from CRP0 Lx MVPD |
| - `b02210a00b1e <https://github.com/open-power/hostboot/commit/b02210a00b1e>`__ |
| p9\_getecid -- set PCIE DD1.0x workaround attributes |
| - `65076c196163 <https://github.com/open-power/hostboot/commit/65076c196163>`__ |
| add SS PLL settings to support 94 MHz PCI operation |
| - `a2c5ab1977ee <https://github.com/open-power/hostboot/commit/a2c5ab1977ee>`__ |
| FBC updates for HW383616, HW384245 |
| - `ee3924e0c243 <https://github.com/open-power/hostboot/commit/ee3924e0c243>`__ |
| p9\_sbe\_tp\_chiplet\_init3 -- disable TP TOD hang pulse |
| - `4bdb5fa7a80f <https://github.com/open-power/hostboot/commit/4bdb5fa7a80f>`__ |
| p9.core.scan.initfile -- mask local error from CC in EC perv LFIR |
| - `c526478a6ce3 <https://github.com/open-power/hostboot/commit/c526478a6ce3>`__ |
| adjust SRAM timings |
| - `8d707e8c9223 <https://github.com/open-power/hostboot/commit/8d707e8c9223>`__ |
| update DPLL and IVRM inits |
| - `d615502799c0 <https://github.com/open-power/hostboot/commit/d615502799c0>`__ |
| derate NVLINK frequency for Nimbus DD1 |
| - `40c1bf0cfb1b <https://github.com/open-power/hostboot/commit/40c1bf0cfb1b>`__ |
| p9.xbus.pll.scan.initfile -- restore full frequency settings for |
| Nimbus DD2+ |
| - `8c2cd3174256 <https://github.com/open-power/hostboot/commit/8c2cd3174256>`__ |
| p9.int.scan.initfile -- init PSIHB to LSI mode |
| - `527165381939 <https://github.com/open-power/hostboot/commit/527165381939>`__ |
| L3 updates -- p9\_build\_smp, p9\_fbc\_utils |
| - `3a26100f62ca <https://github.com/open-power/hostboot/commit/3a26100f62ca>`__ |
| future proof EC feature attributes, add missing P9N DD2 inits |
| - `78bf7f9a76b2 <https://github.com/open-power/hostboot/commit/78bf7f9a76b2>`__ |
| L3 update -- p9\_pcie\_config |
| - `4831e12ea20e <https://github.com/open-power/hostboot/commit/4831e12ea20e>`__ |
| p9.core.scan.initfile -- set disable 241 for Nimbus DD2 |
| - `e4229a61632a <https://github.com/open-power/hostboot/commit/e4229a61632a>`__ |
| PCIe updates for Nimbus DD2 GEN4 operation |
| - `ddefc592366e <https://github.com/open-power/hostboot/commit/ddefc592366e>`__ |
| p9.pci.scan.initfile -- initial release |
| - `6752509378f2 <https://github.com/open-power/hostboot/commit/6752509378f2>`__ |
| p9.npu.scom.initfile -- Nimbus DD2 updates |
| - `02e1726c4962 <https://github.com/open-power/hostboot/commit/02e1726c4962>`__ |
| TP, Nest FIR updates -- DD2 updates to match RAS XML |
| - `3ce08029e577 <https://github.com/open-power/hostboot/commit/3ce08029e577>`__ |
| p9.npu.scom.initfile -- FIR updates to align with RAS XML |
| documentation |
| - `7f0a49f50d87 <https://github.com/open-power/hostboot/commit/7f0a49f50d87>`__ |
| p9.int.scom.initfile -- mask SUE FIR for Nimbus DD2 |
| - `a0df90732994 <https://github.com/open-power/hostboot/commit/a0df90732994>`__ |
| resolve Zeppelin DMI channel framelock issues |
| - `e5e2af0f5eed <https://github.com/open-power/hostboot/commit/e5e2af0f5eed>`__ |
| updates for NPU errata |
| - `8e0f3a8ad787 <https://github.com/open-power/hostboot/commit/8e0f3a8ad787>`__ |
| PLL updates for filter BG, BW including OBUS tank coreqs |
| - `3d3f11dbddd5 <https://github.com/open-power/hostboot/commit/3d3f11dbddd5>`__ |
| IO, FBC updates to enable ABUS for Fleetwood |
| - `75c7fd666460 <https://github.com/open-power/hostboot/commit/75c7fd666460>`__ |
| p9.filter.pll.scan.intifile -- set 0 BGoffset for P9C DD1.1 |
| - `f20b37d483c4 <https://github.com/open-power/hostboot/commit/f20b37d483c4>`__ |
| remove NV iovalid assertion from FW and add scan inits to resolve |
| glsmux xstate |
| - `f0d08f111980 <https://github.com/open-power/hostboot/commit/f0d08f111980>`__ |
| Chip address extension workaround for HW423589 (option2), part1 |
| - `a94bc7eedf31 <https://github.com/open-power/hostboot/commit/a94bc7eedf31>`__ |
| disable ECC bypass for Cumulus DD1.0 |
| - `01a6a43e9020 <https://github.com/open-power/hostboot/commit/01a6a43e9020>`__ |
| MCD disable workaround for HW423589 (option1) |
| - `7221c41d5f7f <https://github.com/open-power/hostboot/commit/7221c41d5f7f>`__ |
| Disable read data delay for Cumulus DD1.0, enable for DD1.1 |
| - `e07cb2f93ac8 <https://github.com/open-power/hostboot/commit/e07cb2f93ac8>`__ |
| p9.npu.scom.initfile -- limit DCP0 credits for HW437173 |
| |
| John Rell (4): |
| |
| - `366a4efdf50b <https://github.com/open-power/hostboot/commit/366a4efdf50b>`__ |
| jgr18022000 Fix for typo in changes for HW430958 |
| - `d12852b6fa1a <https://github.com/open-power/hostboot/commit/d12852b6fa1a>`__ |
| jgr17050500 Added Centaur and DMI IO SCOM initfiles |
| - `55e4a228b65f <https://github.com/open-power/hostboot/commit/55e4a228b65f>`__ |
| jgr17082300 Setting changes for HW41801 HW419305 |
| - `9af3fc295e1e <https://github.com/open-power/hostboot/commit/9af3fc295e1e>`__ |
| jgr171017 Setting changes for Obus boardwire vs cable |
| |
| Joshua Hannan (1): |
| |
| - `4c9b0d832610 <https://github.com/open-power/hostboot/commit/4c9b0d832610>`__ |
| adding insert for soft fail threshold for dd1 and dd2 |
| |
| Juan Medina (2): |
| |
| - `727e9397fd73 <https://github.com/open-power/hostboot/commit/727e9397fd73>`__ |
| reverting FIRs to master values, setting only bit 8 |
| - `ca235d62a2fe <https://github.com/open-power/hostboot/commit/ca235d62a2fe>`__ |
| Scrubbing needs to stay off for DD2, bug HW405443 |
| |
| Lennard Streat (6): |
| |
| - `d3593cc766ca <https://github.com/open-power/hostboot/commit/d3593cc766ca>`__ |
| Temporary workaround for HW412197 |
| - `75823b14fb47 <https://github.com/open-power/hostboot/commit/75823b14fb47>`__ |
| HW439321 - Trusty Birthday Alternative Workaround |
| - `968b1746f9e7 <https://github.com/open-power/hostboot/commit/968b1746f9e7>`__ |
| HW439321 - Disable CRC Performance Degradation |
| - `77309f6630fa <https://github.com/open-power/hostboot/commit/77309f6630fa>`__ |
| Expanding MCU tag fifo settings to be freq dependent. |
| - `3d12277f2397 <https://github.com/open-power/hostboot/commit/3d12277f2397>`__ |
| Workaround for Warlike Parasite (HW430546) |
| - `f24037b86d27 <https://github.com/open-power/hostboot/commit/f24037b86d27>`__ |
| Protect Firmware from exposure to HW423533 |
| |
| Louis Stermole (3): |
| |
| - `9900129f86ae <https://github.com/open-power/hostboot/commit/9900129f86ae>`__ |
| Fix command gap calculation for MSS scrub to prevent truncation |
| - `d64041888fed <https://github.com/open-power/hostboot/commit/d64041888fed>`__ |
| Add callout for when the DIMM to NEST freq ratio exceeds 1.5 |
| - `e4ed25ed886c <https://github.com/open-power/hostboot/commit/e4ed25ed886c>`__ |
| Add workaround for DDRPHY ODT config register erratum (ODT2, ODT3 |
| bits swapped) |
| |
| Luke C. Murray (7): |
| |
| - `908eda4b3845 <https://github.com/open-power/hostboot/commit/908eda4b3845>`__ |
| Disabling LVext for all P9 parts |
| - `2921d0d9066c <https://github.com/open-power/hostboot/commit/2921d0d9066c>`__ |
| HW414700 checkstop on UEs and disable core ECC counter |
| - `15d21760fbaa <https://github.com/open-power/hostboot/commit/15d21760fbaa>`__ |
| Workaround for HW421347 Scandalous Pie |
| - `b5b8ae989e51 <https://github.com/open-power/hostboot/commit/b5b8ae989e51>`__ |
| Updating L2 re-request jitter settings for Cumulus |
| - `1b1226daa961 <https://github.com/open-power/hostboot/commit/1b1226daa961>`__ |
| Turning on NCU tlbie pacing by default |
| - `fb21d847fbea <https://github.com/open-power/hostboot/commit/fb21d847fbea>`__ |
| Adding attribute to turn memory early data on |
| - `f5759559a60d <https://github.com/open-power/hostboot/commit/f5759559a60d>`__ |
| Enabling L2 64B store prediction |
| |
| Luke Murray (8): |
| |
| - `0964a5b2fd09 <https://github.com/open-power/hostboot/commit/0964a5b2fd09>`__ |
| Adding skip group dials for cache when chip=group |
| - `f5bc1a24f10a <https://github.com/open-power/hostboot/commit/f5bc1a24f10a>`__ |
| Updating P9 L2 scan initfile to use attributes |
| - `7d0c68704298 <https://github.com/open-power/hostboot/commit/7d0c68704298>`__ |
| Adding good LCO settings to initfile |
| - `54067398177d <https://github.com/open-power/hostboot/commit/54067398177d>`__ |
| Updating L3 LCO watermarks for HW406803 |
| - `0c1a9c38bba5 <https://github.com/open-power/hostboot/commit/0c1a9c38bba5>`__ |
| Updating optimal larx/stcx dials for performance |
| - `2e3a8e66a7f7 <https://github.com/open-power/hostboot/commit/2e3a8e66a7f7>`__ |
| Disable cp\_me from the L3 for Nimbus DD1 and DD2.0. |
| - `f44af3ce268c <https://github.com/open-power/hostboot/commit/f44af3ce268c>`__ |
| Updating HW363605 workaround to be applied to all chips |
| - `340b1d5748c8 <https://github.com/open-power/hostboot/commit/340b1d5748c8>`__ |
| Performance updates for HW409069 |
| |
| Markus Dobler (1): |
| |
| - `ce033a30cb69 <https://github.com/open-power/hostboot/commit/ce033a30cb69>`__ |
| p9\_abist: Support for p9ndd2 |
| |
| Marty Gloff (4): |
| |
| - `d01ca15eccee <https://github.com/open-power/hostboot/commit/d01ca15eccee>`__ |
| Support multiple nodes in HBRT - Add Node Container |
| - `40c3350ff928 <https://github.com/open-power/hostboot/commit/40c3350ff928>`__ |
| Support multiple nodes in HBRT - Support Multiple Nodes in |
| TargetService |
| - `27755fae1059 <https://github.com/open-power/hostboot/commit/27755fae1059>`__ |
| Support multiple nodes in HBRT - Attribute Overrides |
| - `5fc3b529c692 <https://github.com/open-power/hostboot/commit/5fc3b529c692>`__ |
| Support multiple nodes in HBRT - VPD Image |
| |
| Matt Derksen (9): |
| |
| - `80819cf5302b <https://github.com/open-power/hostboot/commit/80819cf5302b>`__ |
| Fix rollover of PLID numbers |
| - `d6d402588868 <https://github.com/open-power/hostboot/commit/d6d402588868>`__ |
| Cleanup hbrt msg code to be easier to understand and update |
| - `3b5f10fdf6a7 <https://github.com/open-power/hostboot/commit/3b5f10fdf6a7>`__ |
| Include WOF power mode explicitly inside tables |
| - `b31ac249651c <https://github.com/open-power/hostboot/commit/b31ac249651c>`__ |
| Trace cleanup: do not look for parent chip on non-parent chip targets |
| - `843b9e02e55d <https://github.com/open-power/hostboot/commit/843b9e02e55d>`__ |
| Initialize FIRDATA section and ErrlManager just incase BMC resets |
| - `647eb6eae52c <https://github.com/open-power/hostboot/commit/647eb6eae52c>`__ |
| Only call PNOR::init() on systems with BMC |
| - `75c7aea07bcb <https://github.com/open-power/hostboot/commit/75c7aea07bcb>`__ |
| Fix setting plid to the lastest one available at hbrt start |
| - `8692b24a1ec0 <https://github.com/open-power/hostboot/commit/8692b24a1ec0>`__ |
| Include WOF power mode explicitly inside tables |
| - `6eaa4575c95a <https://github.com/open-power/hostboot/commit/6eaa4575c95a>`__ |
| Handle new version of WOF tables that includes power mode |
| |
| Matt K. Light (1): |
| |
| - `288ca88910b6 <https://github.com/open-power/hostboot/commit/288ca88910b6>`__ |
| adding fapi2::putSpyWithCare() |
| |
| Matthew Hickman (4): |
| |
| - `1b11547e01a8 <https://github.com/open-power/hostboot/commit/1b11547e01a8>`__ |
| Fixed Maint IUE unmasked with mnfg flags |
| - `f6b7234d960a <https://github.com/open-power/hostboot/commit/f6b7234d960a>`__ |
| Fixed port fail SUE bug for DD2 modules |
| - `48d464158bc3 <https://github.com/open-power/hostboot/commit/48d464158bc3>`__ |
| Fixed MNFG Attribute handing for TCE Corrections |
| - `90ef1f6dbd59 <https://github.com/open-power/hostboot/commit/90ef1f6dbd59>`__ |
| Fixed unmasking of BRODCAST\_OUT\_OF\_SYNC fir after memdiags |
| handling |
| |
| Michael Koch (1): |
| |
| - `8b34665d2794 <https://github.com/open-power/hostboot/commit/8b34665d2794>`__ |
| Implementing Michael Floyds improvements. |
| |
| Mike Baiocchi (2): |
| |
| - `eeadfb7bf985 <https://github.com/open-power/hostboot/commit/eeadfb7bf985>`__ |
| Add Reset to TPM's I2C Bus for MPIPLs |
| - `234ef44536ae <https://github.com/open-power/hostboot/commit/234ef44536ae>`__ |
| Add FFDC to 'No Functional TPM' Fails |
| |
| Nick Bofferding (9): |
| |
| - `55e51a61f985 <https://github.com/open-power/hostboot/commit/55e51a61f985>`__ |
| Delayed deconfig any DIMM on a failing voltage domain |
| - `afc4bd08c5bf <https://github.com/open-power/hostboot/commit/afc4bd08c5bf>`__ |
| Documentation: Stop withholding various SRCs from pubs |
| - `24bc6a1bee51 <https://github.com/open-power/hostboot/commit/24bc6a1bee51>`__ |
| Secure Boot: On get jumper state error path, save PLID before |
| committing |
| - `a8b0039d4e3a <https://github.com/open-power/hostboot/commit/a8b0039d4e3a>`__ |
| Clear FCO deconfigures before applying gard records |
| - `bd1cd3c7d1fb <https://github.com/open-power/hostboot/commit/bd1cd3c7d1fb>`__ |
| Secure Boot: Detach secure PNOR provider task |
| - `0b02cc8314be <https://github.com/open-power/hostboot/commit/0b02cc8314be>`__ |
| Secure Boot: Check integrity of dynamically sized secure header |
| copies |
| - `24929fd8ab96 <https://github.com/open-power/hostboot/commit/24929fd8ab96>`__ |
| Secure Boot: Dynamically set TPM I2C master path in MRW parser |
| - `aa5d9565d0d1 <https://github.com/open-power/hostboot/commit/aa5d9565d0d1>`__ |
| Secure Boot: Mark redundant TPM not present until SMP is enabled |
| - `5660e6b0e4a2 <https://github.com/open-power/hostboot/commit/5660e6b0e4a2>`__ |
| Secure Boot: Populate master node TPM info in HDAT until multinode |
| supported |
| |
| Nick Klazynski (35): |
| |
| - `07fd08d22744 <https://github.com/open-power/hostboot/commit/07fd08d22744>`__ |
| Add Cumulus DD1.1 inits |
| - `36573c1d29c9 <https://github.com/open-power/hostboot/commit/36573c1d29c9>`__ |
| Enable risklevel2, match v44 of security wiki |
| - `d78c726ee7c2 <https://github.com/open-power/hostboot/commit/d78c726ee7c2>`__ |
| workarounds for HW399919 HW400898 HW398269 HW398269 HW399765 |
| - `9388b61a676d <https://github.com/open-power/hostboot/commit/9388b61a676d>`__ |
| WAs for HW401811 HW402145 HW403465; DIS\_MULTIPLE\_TBLW on all modes |
| - `fc03d06f35ac <https://github.com/open-power/hostboot/commit/fc03d06f35ac>`__ |
| Add three WATs, remove IMC2, replace stop2 workaround |
| - `633abb448897 <https://github.com/open-power/hostboot/commit/633abb448897>`__ |
| Add risklevel for HW399624 due to perf penalty; Add HW405851 |
| - `5db603045222 <https://github.com/open-power/hostboot/commit/5db603045222>`__ |
| Update core inits for DD2 |
| - `6914d4009233 <https://github.com/open-power/hostboot/commit/6914d4009233>`__ |
| Add core workaround for HW407136 |
| - `0fd907828b92 <https://github.com/open-power/hostboot/commit/0fd907828b92>`__ |
| Workarounds for HW407385 HW408629 HW410389 HW408901 |
| - `1a54f8f27c08 <https://github.com/open-power/hostboot/commit/1a54f8f27c08>`__ |
| Add WAs for HW413799 HW413853 HW413917 HW414249 HW414375 HW414871 |
| HW414829 |
| - `c4b31c72c8c9 <https://github.com/open-power/hostboot/commit/c4b31c72c8c9>`__ |
| Add Workarounds for HW415114 HW415013 HW413853 HW414384 |
| - `ffbc1b8d89b0 <https://github.com/open-power/hostboot/commit/ffbc1b8d89b0>`__ |
| Add WA for HW415236 |
| - `7627769e5c9f <https://github.com/open-power/hostboot/commit/7627769e5c9f>`__ |
| Add WA for HW415988 |
| - `b69116dcd8d6 <https://github.com/open-power/hostboot/commit/b69116dcd8d6>`__ |
| Add additional dials to risklevel |
| - `8d360860742b <https://github.com/open-power/hostboot/commit/8d360860742b>`__ |
| Update core initfiles for Cumulus DD1.0 |
| - `fe20d009372f <https://github.com/open-power/hostboot/commit/fe20d009372f>`__ |
| Reverting chickenswitches for issues fixed in Cumulus DD1.0 |
| - `efda1e06c616 <https://github.com/open-power/hostboot/commit/efda1e06c616>`__ |
| Mistakenly pulled workaround for HW410212 - readd for CDD1.0 |
| - `f6df718a76fb <https://github.com/open-power/hostboot/commit/f6df718a76fb>`__ |
| Add perf inits: HW418850,HW418789; Add clockgate issue HW418738 |
| - `3883490ddec9 <https://github.com/open-power/hostboot/commit/3883490ddec9>`__ |
| Add updates for NDD2.1, Serialize TB, Perf workarounds |
| - `14f465d741f8 <https://github.com/open-power/hostboot/commit/14f465d741f8>`__ |
| HW415528 and HW419742 |
| - `78801d7a4ae7 <https://github.com/open-power/hostboot/commit/78801d7a4ae7>`__ |
| Core workarounds for multiple issues. |
| - `647eee8c1825 <https://github.com/open-power/hostboot/commit/647eee8c1825>`__ |
| Add workarounds for HW421426 and HW422629, Swap IMCs around |
| - `3df6589cb9fb <https://github.com/open-power/hostboot/commit/3df6589cb9fb>`__ |
| HW415883 applies to NDD2.1, Add JellyVector WAT, add HW422495, add |
| HW421831 |
| - `90a3867252a8 <https://github.com/open-power/hostboot/commit/90a3867252a8>`__ |
| Add HW425526 and HW425027 |
| - `0e5d5b750aba <https://github.com/open-power/hostboot/commit/0e5d5b750aba>`__ |
| HW403465 applies to all chips; Revert NDD2.1 RL; add SW406970 |
| - `4c248c90a305 <https://github.com/open-power/hostboot/commit/4c248c90a305>`__ |
| Nimbus DD2.2 core chickenswitches |
| - `a55bc817001f <https://github.com/open-power/hostboot/commit/a55bc817001f>`__ |
| Large update for security |
| - `db5f940f71b4 <https://github.com/open-power/hostboot/commit/db5f940f71b4>`__ |
| Fix three NDD2.1 dials and add new NDD2.2 workarounds |
| - `9deb5fc4a4f7 <https://github.com/open-power/hostboot/commit/9deb5fc4a4f7>`__ |
| Add new TM IMC, Add TLBIE hangbuster |
| - `2cdaf3a7743f <https://github.com/open-power/hostboot/commit/2cdaf3a7743f>`__ |
| Implement security IMCs, based on v29 of wiki |
| - `029552241239 <https://github.com/open-power/hostboot/commit/029552241239>`__ |
| Two LTPTR workarounds, remove LTPTR serialization, Fix TB IMC |
| - `3a66a14710fe <https://github.com/open-power/hostboot/commit/3a66a14710fe>`__ |
| Enable mixed core xlate; Enable xlate protection feature; Disable LSU |
| clockgate |
| - `0bb20d099e65 <https://github.com/open-power/hostboot/commit/0bb20d099e65>`__ |
| Add TM WAT workaround; NDD2.2 and CDD1.1 only |
| - `368e3ac318fa <https://github.com/open-power/hostboot/commit/368e3ac318fa>`__ |
| Add Cumulus DD1.1 inits |
| - `2c08db3b8536 <https://github.com/open-power/hostboot/commit/2c08db3b8536>`__ |
| Enable risklevel2, match v44 of security wiki |
| |
| Prachi Gupta (8): |
| |
| - `5c78bbd873e9 <https://github.com/open-power/hostboot/commit/5c78bbd873e9>`__ |
| checkHbResMemLimit -- change to check correctly on multi-node |
| - `33725d24db91 <https://github.com/open-power/hostboot/commit/33725d24db91>`__ |
| hbfw makefile changes to add p9c dd1.1 sbe to pnor |
| - `5ca1d497141a <https://github.com/open-power/hostboot/commit/5ca1d497141a>`__ |
| changes to move configureHbrt target type to IPC path to run on slave |
| nodes |
| - `fdbf7156982e <https://github.com/open-power/hostboot/commit/fdbf7156982e>`__ |
| HBRT: Fix targeting to work on multi-node |
| - `b98f4c6b59fa <https://github.com/open-power/hostboot/commit/b98f4c6b59fa>`__ |
| ATTR\_PBAX\_GROUPID: add global tag |
| - `54cc57dd329e <https://github.com/open-power/hostboot/commit/54cc57dd329e>`__ |
| add global tag to EI\_BUS\_TX\_MSBSWAP for serverwiz2 consumption |
| - `7ce93122ca1e <https://github.com/open-power/hostboot/commit/7ce93122ca1e>`__ |
| ATTR\_CEN\_VPD\_DRAM\_ADDRESS\_MIRRORING: Remove writable tag |
| - `3f639460a8f1 <https://github.com/open-power/hostboot/commit/3f639460a8f1>`__ |
| ATTR\_CEN\_VPD\_DRAM\_ADDRESS\_MIRRORING: add function backed to this |
| attribute |
| |
| Prasad Bg Ranganath (4): |
| |
| - `0d7e62667706 <https://github.com/open-power/hostboot/commit/0d7e62667706>`__ |
| PM: Fix Global Parameter Block and PGPE size checks in |
| p9\_hcode\_image\_build |
| - `e80082e3a96a <https://github.com/open-power/hostboot/commit/e80082e3a96a>`__ |
| SBE:Putring: Added more debug information |
| - `e86fa9f6d5a9 <https://github.com/open-power/hostboot/commit/e86fa9f6d5a9>`__ |
| PSTATE\_PARAMETER\_BLOCK structure alignment and error handling |
| - `3bb61aa58087 <https://github.com/open-power/hostboot/commit/3bb61aa58087>`__ |
| Zepplin:Remove dd level check for cumulus under PPB code |
| |
| Prem Shanker Jha (1): |
| |
| - `2e0c75fb9d8c <https://github.com/open-power/hostboot/commit/2e0c75fb9d8c>`__ |
| PM: Added support for HWP p9\_pm\_callout. |
| |
| Raja Das (1): |
| |
| - `338fce09ddad <https://github.com/open-power/hostboot/commit/338fce09ddad>`__ |
| Workaround to fix issue where Powerbus loses track of EQs in DD1 |
| |
| Ricardo Mata (1): |
| |
| - `b5986b2c0d1a <https://github.com/open-power/hostboot/commit/b5986b2c0d1a>`__ |
| Added CI throttling support, HW init updates, and fixed a bug with |
| tce arb. |
| |
| Richard J. Knight (5): |
| |
| - `221f05613499 <https://github.com/open-power/hostboot/commit/221f05613499>`__ |
| Introduce new shared library for image processing fucntions |
| - `48235812776d <https://github.com/open-power/hostboot/commit/48235812776d>`__ |
| SW414905: Mcs, Mba and L4 targets are not displayed in gard --gc mem |
| output |
| - `b456c82ad820 <https://github.com/open-power/hostboot/commit/b456c82ad820>`__ |
| Modify putrRing code to pull rings from centaur hw image |
| - `967e9a084bbe <https://github.com/open-power/hostboot/commit/967e9a084bbe>`__ |
| Wait for responses from all nodes for IPC\_POPULATE\_ATTRIBUTES msg |
| - `d72d87900b44 <https://github.com/open-power/hostboot/commit/d72d87900b44>`__ |
| Procedure crashes when trying to query an EC feature |
| |
| Rick Ward (1): |
| |
| - `a48f950445f1 <https://github.com/open-power/hostboot/commit/a48f950445f1>`__ |
| Dump collection should only be run on the master node and skipped on |
| slaves. |
| |
| Roland Veloz (4): |
| |
| - `b6e41fc3329e <https://github.com/open-power/hostboot/commit/b6e41fc3329e>`__ |
| Force an SBE update upon boot failure as well as break out common |
| data |
| - `0dbb06308565 <https://github.com/open-power/hostboot/commit/0dbb06308565>`__ |
| Fixed both NIMBUS and CUMULUS. They are now making the call to |
| mss\_thermal\_init |
| - `5a9355062b71 <https://github.com/open-power/hostboot/commit/5a9355062b71>`__ |
| Created individual update flags for both SEEPROM 0 and SEEPROM 1 |
| - `3d7aee811e82 <https://github.com/open-power/hostboot/commit/3d7aee811e82>`__ |
| Inform OPAL of the state of the SBE after an attempt to restart |
| |
| Ryan Black (3): |
| |
| - `63c767d5679c <https://github.com/open-power/hostboot/commit/63c767d5679c>`__ |
| reduce number of non-zero npu error collection registers |
| - `1b4fa572716e <https://github.com/open-power/hostboot/commit/1b4fa572716e>`__ |
| NPU scan/scom init updates |
| - `17165d955d01 <https://github.com/open-power/hostboot/commit/17165d955d01>`__ |
| p9.npu.scom.initfile -- fix cq\_sm allocation issue at low water mark |
| |
| Sachin Gupta (2): |
| |
| - `899054484ef2 <https://github.com/open-power/hostboot/commit/899054484ef2>`__ |
| Support cumulus 1.1 getPllBucket |
| - `4340a6da7949 <https://github.com/open-power/hostboot/commit/4340a6da7949>`__ |
| Remove workaround for DD1 SW reset for XIVE |
| |
| Sameer Veer (2): |
| |
| - `25e991e8b352 <https://github.com/open-power/hostboot/commit/25e991e8b352>`__ |
| New functions added for automating mustfix releases |
| - `2ae2bffe88b5 <https://github.com/open-power/hostboot/commit/2ae2bffe88b5>`__ |
| Added cmvcCheckinForceFlag to break links for new releases |
| |
| Shelton Leung (9): |
| |
| - `44bd1c4678da <https://github.com/open-power/hostboot/commit/44bd1c4678da>`__ |
| scan inits for lab workaround for DI bug HW392781 |
| - `be9b22ecd3fc <https://github.com/open-power/hostboot/commit/be9b22ecd3fc>`__ |
| dd1 workaround for hw400075 coherency error |
| - `c40f090b3c4e <https://github.com/open-power/hostboot/commit/c40f090b3c4e>`__ |
| workaround for hw400932 atag corruptin in presp |
| - `c3869410785b <https://github.com/open-power/hostboot/commit/c3869410785b>`__ |
| amo cache disabled for dd1 for HW401780 |
| - `bce1c27699b3 <https://github.com/open-power/hostboot/commit/bce1c27699b3>`__ |
| enable prefetch drop for better MC fairness |
| - `2aad82e12497 <https://github.com/open-power/hostboot/commit/2aad82e12497>`__ |
| disable noise window for DD1 HW406577 |
| - `ad8cf02d85d0 <https://github.com/open-power/hostboot/commit/ad8cf02d85d0>`__ |
| dd2 inits |
| - `e3f6f99840e4 <https://github.com/open-power/hostboot/commit/e3f6f99840e4>`__ |
| adjusted mem 2400 nest 1600 workaround and make dd1 only |
| - `125f42a04372 <https://github.com/open-power/hostboot/commit/125f42a04372>`__ |
| dd2 phy scom inits |
| |
| Soma BhanuTej (7): |
| |
| - `a41ddc53f979 <https://github.com/open-power/hostboot/commit/a41ddc53f979>`__ |
| Axone support to TP stopclocks |
| - `91d24ca4cc09 <https://github.com/open-power/hostboot/commit/91d24ca4cc09>`__ |
| Change chip to unsecure always for DD1 chips |
| - `ed093a87011d <https://github.com/open-power/hostboot/commit/ed093a87011d>`__ |
| Security control override disable support - p9\_setup\_sbe\_config |
| - `8f803dfea438 <https://github.com/open-power/hostboot/commit/8f803dfea438>`__ |
| Cumulus initfile update for OBUS & XBUS PLLs |
| - `c586a6b41c0f <https://github.com/open-power/hostboot/commit/c586a6b41c0f>`__ |
| Additional checks to p9\_extract\_sbe\_rc |
| - `00c3e73d16ee <https://github.com/open-power/hostboot/commit/00c3e73d16ee>`__ |
| Axone support to TP stopclocks |
| - `c09c372348bd <https://github.com/open-power/hostboot/commit/c09c372348bd>`__ |
| Change TP FIR bits 38, 39, 40 as recoverable & Masked |
| |
| Stephen Glancy (18): |
| |
| - `000f358355b2 <https://github.com/open-power/hostboot/commit/000f358355b2>`__ |
| Updates broadcast mode attributes |
| - `2674db2b85b4 <https://github.com/open-power/hostboot/commit/2674db2b85b4>`__ |
| Adds blank NVDIMM utility files for HB to mirror |
| - `b5c57afe40a8 <https://github.com/open-power/hostboot/commit/b5c57afe40a8>`__ |
| Fixes tDLLK timing for 2666 |
| - `c03b84b93467 <https://github.com/open-power/hostboot/commit/c03b84b93467>`__ |
| Fixes broadcast mode address check for deconfigured ports |
| - `719c8a64fb72 <https://github.com/open-power/hostboot/commit/719c8a64fb72>`__ |
| Adds DDR4 hybrid NV-RDIMM support |
| - `7b475151599d <https://github.com/open-power/hostboot/commit/7b475151599d>`__ |
| Removes overrideonly in a broadcast mode MRW attribute |
| - `a61200c516f7 <https://github.com/open-power/hostboot/commit/a61200c516f7>`__ |
| Adds power control access functions for NVDIMM |
| - `5e42a73c3de9 <https://github.com/open-power/hostboot/commit/5e42a73c3de9>`__ |
| Added periodic cal fix - fixes bad delays |
| - `ad869ece5cae <https://github.com/open-power/hostboot/commit/ad869ece5cae>`__ |
| Updates to run HW VREF cal by default |
| - `556caf56c9ec <https://github.com/open-power/hostboot/commit/556caf56c9ec>`__ |
| Added read ctr bad delay workaround |
| - `4e9ff980c520 <https://github.com/open-power/hostboot/commit/4e9ff980c520>`__ |
| Added DQS alignment workaround |
| - `ad43d96deda9 <https://github.com/open-power/hostboot/commit/ad43d96deda9>`__ |
| Adds DCD calibration control attributes |
| - `4b9d8a1bd726 <https://github.com/open-power/hostboot/commit/4b9d8a1bd726>`__ |
| Updated memory DD1 vs DD2 attribute |
| - `edca64c2b22b <https://github.com/open-power/hostboot/commit/edca64c2b22b>`__ |
| Fixed DLL workarounds to always run |
| - `b1e597ec9bdb <https://github.com/open-power/hostboot/commit/b1e597ec9bdb>`__ |
| Adds blank files for centaur secure mode boot |
| - `013207df79b3 <https://github.com/open-power/hostboot/commit/013207df79b3>`__ |
| Updates p9c SPD read to include DDR3 |
| - `43904dc3b8a4 <https://github.com/open-power/hostboot/commit/43904dc3b8a4>`__ |
| Adds dynamic voltage blank files for HB |
| - `218a4862f0d0 <https://github.com/open-power/hostboot/commit/218a4862f0d0>`__ |
| Adds secure mode boot for memory buffer chips |
| |
| Steven Janssen (1): |
| |
| - `6d57e7720db9 <https://github.com/open-power/hostboot/commit/6d57e7720db9>`__ |
| Change memory cleanup to use correct method |
| |
| Sumit Kumar (1): |
| |
| - `00c730b5ebef <https://github.com/open-power/hostboot/commit/00c730b5ebef>`__ |
| GPTR/Overlays stage-2 support |
| |
| Sunil.Kumar (1): |
| |
| - `8240f5a4c1e0 <https://github.com/open-power/hostboot/commit/8240f5a4c1e0>`__ |
| Procedures modified for DD1 changes |
| |
| Swathi Madhuri Bhattiprolu (1): |
| |
| - `2958d02ae126 <https://github.com/open-power/hostboot/commit/2958d02ae126>`__ |
| Create Initial Cumulus CDIMM sim configuration |
| |
| Thi Tran (5): |
| |
| - `231f4e404b04 <https://github.com/open-power/hostboot/commit/231f4e404b04>`__ |
| Add ec\_abst ring to p9n.hw\_image |
| - `71fc3db015e6 <https://github.com/open-power/hostboot/commit/71fc3db015e6>`__ |
| Attribute support of customization of Nimbus DD1 PCI reference clock |
| speed. |
| - `2764678bf004 <https://github.com/open-power/hostboot/commit/2764678bf004>`__ |
| P9 Cumulus InitCompiler supportis - Part 3 |
| - `227a32f926d3 <https://github.com/open-power/hostboot/commit/227a32f926d3>`__ |
| Undo some p9 Cumulus spy workarounds in initfiles |
| - `cc1ac14babe2 <https://github.com/open-power/hostboot/commit/cc1ac14babe2>`__ |
| Fix MFG P9 ZZ: BC70E540 (MCFIR[8]) command list timeout |
| |
| Tsung Yeung (1): |
| |
| - `1d2a73892341 <https://github.com/open-power/hostboot/commit/1d2a73892341>`__ |
| Adds self time refresh entry and exit helper functions |
| |
| Venkatesh Sainath (2): |
| |
| - `44087e0148ad <https://github.com/open-power/hostboot/commit/44087e0148ad>`__ |
| Enabling FSP-B IPL as primary |
| - `13de75c05e7d <https://github.com/open-power/hostboot/commit/13de75c05e7d>`__ |
| Fixing flipport attribute for processors |
| |
| Yue Du (5): |
| |
| - `3afac7911fa4 <https://github.com/open-power/hostboot/commit/3afac7911fa4>`__ |
| STOP: Support Suspend Entry/Exit and Fix Pig Collision |
| - `40121d5b91e6 <https://github.com/open-power/hostboot/commit/40121d5b91e6>`__ |
| Cache HWP: DD1 VCS Workaround |
| - `89135c06eabc <https://github.com/open-power/hostboot/commit/89135c06eabc>`__ |
| Istep4: Enable poll for DPLL lock in p9\_hcd\_cache\_dpll\_setup |
| - `1db94c26ffaa <https://github.com/open-power/hostboot/commit/1db94c26ffaa>`__ |
| HW396520: DD1 workaround skip flushmode inhibit drop in cache hwp |
| - `ee172729c85d <https://github.com/open-power/hostboot/commit/ee172729c85d>`__ |
| STOP: Fix Wakeup terminate prematurely with mixed stop2 and stop4 |
| |
| Zane Shelley (13): |
| |
| - `1275d064b04f <https://github.com/open-power/hostboot/commit/1275d064b04f>`__ |
| PRD: Fixed address translation for Dynamic Memory Deallocation |
| - `5324435b6d27 <https://github.com/open-power/hostboot/commit/5324435b6d27>`__ |
| PRD: initializing MemTdCtlr variables for broadcast mode |
| - `fed203b290c1 <https://github.com/open-power/hostboot/commit/fed203b290c1>`__ |
| PRD: added full IPL config support into getHwConfig() |
| - `0c2ad40218ec <https://github.com/open-power/hostboot/commit/0c2ad40218ec>`__ |
| PRD: removed NPUFIR workaround for DD1.0 to enable default capture |
| - `9aa046413267 <https://github.com/open-power/hostboot/commit/9aa046413267>`__ |
| PRD: NPU0FIR checkstop isolation issue |
| - `9abf4f390cca <https://github.com/open-power/hostboot/commit/9abf4f390cca>`__ |
| PRD: getConnectedParent() issue in MemDealloc::dimmList() |
| - `5aa7128d4aaa <https://github.com/open-power/hostboot/commit/5aa7128d4aaa>`__ |
| PRD: add DMD support for 3 and 6 MC channels per group |
| - `82aaa7df696a <https://github.com/open-power/hostboot/commit/82aaa7df696a>`__ |
| PRD: initialize PRD objects for Restore DRAM Repairs |
| - `f10101dc6c7e <https://github.com/open-power/hostboot/commit/f10101dc6c7e>`__ |
| PRD: DMD address translation bug. |
| - `08379ab81944 <https://github.com/open-power/hostboot/commit/08379ab81944>`__ |
| PRD: extra FFDC for NPU0FIR |
| - `5353bb457253 <https://github.com/open-power/hostboot/commit/5353bb457253>`__ |
| PRD: remove some NPUFIR bits from cs\_root\_cause list |
| - `d69704d2fd07 <https://github.com/open-power/hostboot/commit/d69704d2fd07>`__ |
| PRD: updates to XBUS interface callouts |
| - `87e454859985 <https://github.com/open-power/hostboot/commit/87e454859985>`__ |
| PRD: add c\_err\_rpt registers for INTCQFIR |
| |
| aravnair-in (1): |
| |
| - `8e01c68dc70d <https://github.com/open-power/hostboot/commit/8e01c68dc70d>`__ |
| Fix a couple of EKB files to prevent CMVC quirk |
| |
| crgeddes (1): |
| |
| - `345c40eb09f2 <https://github.com/open-power/hostboot/commit/345c40eb09f2>`__ |
| Use DD1 SW reset for XIVE unit until we get HW reset working in DD2 |
| |
| dchowe (4): |
| |
| - `666e095a50be <https://github.com/open-power/hostboot/commit/666e095a50be>`__ |
| Initfile updates for FBC DD2 |
| - `fdb995c8d77c <https://github.com/open-power/hostboot/commit/fdb995c8d77c>`__ |
| DD2 updated scan overrides, Cumulus DD1 initfile updates |
| - `281b63f10d73 <https://github.com/open-power/hostboot/commit/281b63f10d73>`__ |
| Update FBC cd\_hp initfile to reference serial mode spys directly |
| - `8711f1044943 <https://github.com/open-power/hostboot/commit/8711f1044943>`__ |
| disable lpc\_ed in fbc to match mc setting |
| |
| Package: occ |
| ------------ |
| |
| `Repository <https://github.com/open-power/occ>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| Commits |
| ~~~~~~~ |
| |
| Andres Lugo-Reyes (4): |
| |
| - `fca494dbdcf9 <https://github.com/open-power/occ/commit/fca494dbdcf9>`__ |
| Replace Firmware Level with FClip History in error log |
| - `bf6e716d3289 <https://github.com/open-power/occ/commit/bf6e716d3289>`__ |
| Look at OCCFLG[30] to see if PGPE needs a new VFRT |
| - `cb3f5cf6a5b9 <https://github.com/open-power/occ/commit/cb3f5cf6a5b9>`__ |
| WOF: Phase 2 Vratio calculation correction |
| - `1c7b23cc6b8f <https://github.com/open-power/occ/commit/1c7b23cc6b8f>`__ |
| WOF: Force ceff\_ratio to 0% if voltage component is 0 |
| |
| William Bryan (3): |
| |
| - `2fe8f2c01e62 <https://github.com/open-power/occ/commit/2fe8f2c01e62>`__ |
| Buildname 3/1 |
| - `81196c350c52 <https://github.com/open-power/occ/commit/81196c350c52>`__ |
| Try to PCAP GPU again after busy failure CQ:SW414846 |
| - `768466b31e85 <https://github.com/open-power/occ/commit/768466b31e85>`__ |
| GPE1 Binary 3/8 |
| |
| mbroyles (5): |
| |
| - `c9954444fc8d <https://github.com/open-power/occ/commit/c9954444fc8d>`__ |
| Calculate Pstate from a frequency starting at max frequency instead |
| of min |
| - `ccdb19fba8c7 <https://github.com/open-power/occ/commit/ccdb19fba8c7>`__ |
| Enable 24x7 on FSP systems |
| - `919b78927d26 <https://github.com/open-power/occ/commit/919b78927d26>`__ |
| Characterization state meltbox support |
| - `e4bc12d978ab <https://github.com/open-power/occ/commit/e4bc12d978ab>`__ |
| Correct ASM WOF enable adjusted value |
| - `c44bd0f660c7 <https://github.com/open-power/occ/commit/c44bd0f660c7>`__ |
| Support set data length command to improve AMESTER performance with |
| Open BMC |
| |
| Package: op-build |
| ----------------- |
| |
| `Repository <https://github.com/open-power/op-build>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| Commits |
| ~~~~~~~ |
| |
| No changes. |
| |
| Package: p9dsu-xml |
| ------------------ |
| |
| `Repository <https://github.com/open-power/p9dsu-xml>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| Commits |
| ~~~~~~~ |
| |
| No changes. |
| |
| Package: palmetto-xml |
| --------------------- |
| |
| `Repository <https://github.com/open-power/palmetto-xml>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| Commits |
| ~~~~~~~ |
| |
| No changes. |
| |
| Package: petitboot |
| ------------------ |
| |
| `Repository <https://github.com/open-power/petitboot>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| - `petitboot-01-autotools-Add-autopoint-generated-files.patch <https://github.com/open-power/op-build/tree/v1.22-rc1/openpower/package/petitboot/petitboot-01-autotools-Add-autopoint-generated-files.patch>`__ |
| |
| Commits |
| ~~~~~~~ |
| |
| Brett Grandbois (7): |
| |
| - `8f09986340e6 <https://github.com/open-power/petitboot/commit/8f09986340e6>`__ |
| discover/pb-discover: #include <locale.h> for musl libc |
| - `44ab15ff671f <https://github.com/open-power/petitboot/commit/44ab15ff671f>`__ |
| ncurses/nc-cui: musl libc fixes |
| - `b63b778e7feb <https://github.com/open-power/petitboot/commit/b63b778e7feb>`__ |
| ncurses/nc-cui: fix unreferenced assertion variable |
| - `a80b3cac1053 <https://github.com/open-power/petitboot/commit/a80b3cac1053>`__ |
| grub2/grub2-parser: accept no whitespace in grub menuentry |
| - `b6e83bb17299 <https://github.com/open-power/petitboot/commit/b6e83bb17299>`__ |
| grub2/grub2: add Yocto paths to default grub2 conf search paths |
| - `c8ba7b32759f <https://github.com/open-power/petitboot/commit/c8ba7b32759f>`__ |
| test/parser: test no whitespace on grub menuentry |
| - `02af1caf9df8 <https://github.com/open-power/petitboot/commit/02af1caf9df8>`__ |
| syslinux: add syslinux parser support |
| |
| Cyril Bur (7): |
| |
| - `b2bc013b1413 <https://github.com/open-power/petitboot/commit/b2bc013b1413>`__ |
| configure.ac: Fix unmatched brackets |
| - `817e6698bcbb <https://github.com/open-power/petitboot/commit/817e6698bcbb>`__ |
| Fix bootstrap warning: noinst\_PROGRAMS was already defined |
| - `117a75f95ec3 <https://github.com/open-power/petitboot/commit/117a75f95ec3>`__ |
| Better recognition of ncurses header files |
| - `3a76e4214d5c <https://github.com/open-power/petitboot/commit/3a76e4214d5c>`__ |
| discover/pxe-parser: Fine grained proxy control |
| - `eb9c570fa13b <https://github.com/open-power/petitboot/commit/eb9c570fa13b>`__ |
| configure.ac: Fix unmatched brackets |
| - `17f04cb4d3d8 <https://github.com/open-power/petitboot/commit/17f04cb4d3d8>`__ |
| Fix bootstrap warning: noinst\_PROGRAMS was already defined |
| - `bc8b183fbea6 <https://github.com/open-power/petitboot/commit/bc8b183fbea6>`__ |
| Better recognition of ncurses header files |
| |
| Daniel Axtens (2): |
| |
| - `591b8b6d39b2 <https://github.com/open-power/petitboot/commit/591b8b6d39b2>`__ |
| Use --no-location instead of --add-location=never |
| - `865097ff2cbb <https://github.com/open-power/petitboot/commit/865097ff2cbb>`__ |
| Test with .travis.yml |
| |
| Geoff Levand (4): |
| |
| - `7aa2d8a3aefc <https://github.com/open-power/petitboot/commit/7aa2d8a3aefc>`__ |
| bootstrap: Add dependency checks |
| - `e3f78333a2a1 <https://github.com/open-power/petitboot/commit/e3f78333a2a1>`__ |
| configure: Add check for lex, yacc |
| - `c462aa6f8e46 <https://github.com/open-power/petitboot/commit/c462aa6f8e46>`__ |
| configure: Update AC\_PACKAGE\_BUGREPORT |
| - `41caf09e98b1 <https://github.com/open-power/petitboot/commit/41caf09e98b1>`__ |
| printf: Fix format type warnings |
| |
| Joel Stanley (5): |
| |
| - `a5f80e0a9a40 <https://github.com/open-power/petitboot/commit/a5f80e0a9a40>`__ |
| discover: Fix bad check of version string |
| - `352f5c2729dc <https://github.com/open-power/petitboot/commit/352f5c2729dc>`__ |
| ncurses: Fix bad strncmp |
| - `2b86765dfa37 <https://github.com/open-power/petitboot/commit/2b86765dfa37>`__ |
| discover: Fix unused function warning |
| - `2c97f136757b <https://github.com/open-power/petitboot/commit/2c97f136757b>`__ |
| test/parser: Fixed uninitialized variable warning |
| - `47d0601affe8 <https://github.com/open-power/petitboot/commit/47d0601affe8>`__ |
| discover: pxe: Avoid dereferencing null pointer |
| |
| Samuel Mendoza-Jonas (17): |
| |
| - `33a0f544151f <https://github.com/open-power/petitboot/commit/33a0f544151f>`__ |
| ui/ncurses: Handle arrow key variants |
| - `3af2c04787af <https://github.com/open-power/petitboot/commit/3af2c04787af>`__ |
| ui/ncurses: Handle arrow key variants |
| - `c916e1333676 <https://github.com/open-power/petitboot/commit/c916e1333676>`__ |
| ui/ncurses: Always cancel autoboot on exit |
| - `f18998f6aac3 <https://github.com/open-power/petitboot/commit/f18998f6aac3>`__ |
| ui/ncurses: Always cancel autoboot on exit |
| - `a2d5a3e3cb55 <https://github.com/open-power/petitboot/commit/a2d5a3e3cb55>`__ |
| discover/pxe-parser: Fix relative parsing for manual config files |
| - `1ad12fe5b75e <https://github.com/open-power/petitboot/commit/1ad12fe5b75e>`__ |
| discover/pxe-parser: Fix relative parsing for manual config files |
| - `2dfbd9811d1e <https://github.com/open-power/petitboot/commit/2dfbd9811d1e>`__ |
| ui/ncurses: Allow multiple hot key handlers per pmenu |
| - `11c43508e436 <https://github.com/open-power/petitboot/commit/11c43508e436>`__ |
| ui/ncurses: Clear remaining space when drawing help line |
| - `ef13876e9fea <https://github.com/open-power/petitboot/commit/ef13876e9fea>`__ |
| discover/device-handler: Treat empty boot order as 'boot any' |
| - `aa23987dd043 <https://github.com/open-power/petitboot/commit/aa23987dd043>`__ |
| discover/syslinux-parser: Fix missing comma in ignored names. |
| - `dc85de97c79c <https://github.com/open-power/petitboot/commit/dc85de97c79c>`__ |
| discover: Allow load\_async\_url() to call callback for local paths |
| - `d63bacef37d6 <https://github.com/open-power/petitboot/commit/d63bacef37d6>`__ |
| ui/ncurses: Fix boot editor segfault on update |
| - `7e0b9da2ae2f <https://github.com/open-power/petitboot/commit/7e0b9da2ae2f>`__ |
| discover/platform-powerpc: Avoid confusing gateway and URL |
| - `fb8dbd274b4b <https://github.com/open-power/petitboot/commit/fb8dbd274b4b>`__ |
| ui/ncurses: Validate URL field |
| - `e6407ab0ae61 <https://github.com/open-power/petitboot/commit/e6407ab0ae61>`__ |
| lib: Fix gpg.h path |
| - `526d4b3d959d <https://github.com/open-power/petitboot/commit/526d4b3d959d>`__ |
| utils/hooks: Set stdout-path property |
| - `c208aa42024f <https://github.com/open-power/petitboot/commit/c208aa42024f>`__ |
| discover/boot: Fix stale boot cancellation code |
| |
| Package: pnor |
| ------------- |
| |
| `Repository <https://github.com/open-power/pnor>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| Commits |
| ~~~~~~~ |
| |
| No changes. |
| |
| Package: romulus-xml |
| -------------------- |
| |
| `Repository <https://github.com/open-power/romulus-xml>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| Commits |
| ~~~~~~~ |
| |
| No changes. |
| |
| Package: sbe |
| ------------ |
| |
| `Repository <https://github.com/open-power/sbe>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| Commits |
| ~~~~~~~ |
| |
| Amit Tendolkar (3): |
| |
| - `731439265743 <https://github.com/open-power/sbe/commit/731439265743>`__ |
| Extend PM Reset flow to collect PM FFDC to HOMER |
| - `8b75ed9d8f43 <https://github.com/open-power/sbe/commit/8b75ed9d8f43>`__ |
| Add EQ ATOMIC LOCK SCOM to security write whitelist for FFDC |
| - `1384ebc764ac <https://github.com/open-power/sbe/commit/1384ebc764ac>`__ |
| Update p9\_collect\_ppe\_state to dynamically collect PPE FFDC |
| |
| Andre Marin (2): |
| |
| - `92ababe68288 <https://github.com/open-power/sbe/commit/92ababe68288>`__ |
| Add initial p9c ddr\_phy\_reset, dimmBadDqBitmapAccessHwp, slew, & |
| unmask\_errors |
| - `0ac911461767 <https://github.com/open-power/sbe/commit/0ac911461767>`__ |
| Modified gen\_accessors script for greater support |
| |
| Anusha Reddy Rangareddygari (1): |
| |
| - `3a8884d192b1 <https://github.com/open-power/sbe/commit/3a8884d192b1>`__ |
| Adding output\_path option for sbe-debug.py |
| |
| Ben Gass (5): |
| |
| - `9f5ce40fd271 <https://github.com/open-power/sbe/commit/9f5ce40fd271>`__ |
| Re-submit Axone updates |
| - `75ddac2a41a9 <https://github.com/open-power/sbe/commit/75ddac2a41a9>`__ |
| Add support for p9c 1.2 |
| - `2b432b15cbe8 <https://github.com/open-power/sbe/commit/2b432b15cbe8>`__ |
| Axone MC uses same pll/clock setup as in Cumulus. |
| - `1410d7f9ee83 <https://github.com/open-power/sbe/commit/1410d7f9ee83>`__ |
| Add p9n 2.3 to p9\_frequency\_buckets.H |
| - `a347254a3aec <https://github.com/open-power/sbe/commit/a347254a3aec>`__ |
| Removing trailing comma in system\_attributes.xml |
| |
| Brian Silver (1): |
| |
| - `da9b63d6c024 <https://github.com/open-power/sbe/commit/da9b63d6c024>`__ |
| Change p9\_mss\_freq\_system to write attributes, errors for Cronus |
| |
| Brian Vanderpool (1): |
| |
| - `2a438c9dd4b2 <https://github.com/open-power/sbe/commit/2a438c9dd4b2>`__ |
| Improve power and clock checking when checking for stop states |
| |
| CHRISTINA L. GRAVES (1): |
| |
| - `b65fd5bcb57d <https://github.com/open-power/sbe/commit/b65fd5bcb57d>`__ |
| p9\_query\_cache\_access\_state L2 |
| |
| Christian Geddes (1): |
| |
| - `f058c9945a4f <https://github.com/open-power/sbe/commit/f058c9945a4f>`__ |
| Add attribute to give platform more control over PM\_RESET |
| |
| Claus Michael Olsen (2): |
| |
| - `b82c9d49c743 <https://github.com/open-power/sbe/commit/b82c9d49c743>`__ |
| Additional risk level support - (step 2) Updating the image w/RL2 |
| - `54f0bc5c31d3 <https://github.com/open-power/sbe/commit/54f0bc5c31d3>`__ |
| Update to putRingUtils to proper scanning of perv\_pll\_bndy\_flt |
| rings |
| |
| Dan Crowell (2): |
| |
| - `ba6f0c6d234e <https://github.com/open-power/sbe/commit/ba6f0c6d234e>`__ |
| Disabling WOF and VDM for Nimbus DD2.0 |
| - `c821b84e4ff5 <https://github.com/open-power/sbe/commit/c821b84e4ff5>`__ |
| Disable WOF for Cumulus DD1.0 |
| |
| Dean Sanner (2): |
| |
| - `d50cc1394696 <https://github.com/open-power/sbe/commit/d50cc1394696>`__ |
| Run lpc\_init on all processors |
| - `e962f1e8c736 <https://github.com/open-power/sbe/commit/e962f1e8c736>`__ |
| Honor STOP Gated bit when checking access states |
| |
| Elizabeth Liner (1): |
| |
| - `29b11603626f <https://github.com/open-power/sbe/commit/29b11603626f>`__ |
| Adding attribute to detect which processor we can use for alt-memory |
| |
| Greg Still (2): |
| |
| - `b1386622238e <https://github.com/open-power/sbe/commit/b1386622238e>`__ |
| PM\_SPWKUP: Clear wakeup notify select bit to enable auto special |
| wakeup |
| - `cc59dcd72f9d <https://github.com/open-power/sbe/commit/cc59dcd72f9d>`__ |
| PM: p9\_setup\_evid steps voltage to avoid Fleetwood VRM limitations |
| |
| Joachim Fenkes (3): |
| |
| - `cce76062ef2f <https://github.com/open-power/sbe/commit/cce76062ef2f>`__ |
| hwpErrors: Use wildcard instead of explicit list |
| - `d1da43c4e54d <https://github.com/open-power/sbe/commit/d1da43c4e54d>`__ |
| LPC: Add empty files for mirroring to HB, PPE, HWSV |
| - `da13fade1742 <https://github.com/open-power/sbe/commit/da13fade1742>`__ |
| p9\_sbe\_lpc\_init: Fix timeout setup |
| |
| Joe McGill (3): |
| |
| - `d2a0b0c1617c <https://github.com/open-power/sbe/commit/d2a0b0c1617c>`__ |
| FIR + RAS XML updates |
| - `4d30a3d9b261 <https://github.com/open-power/sbe/commit/4d30a3d9b261>`__ |
| p9\_sbe\_tracearray -- satsify PRD calls to manage core trace arrays |
| - `9da1175ad43a <https://github.com/open-power/sbe/commit/9da1175ad43a>`__ |
| Add base FAPI2 attribute definitions |
| |
| Lennard Streat (1): |
| |
| - `ffd086397fb0 <https://github.com/open-power/sbe/commit/ffd086397fb0>`__ |
| Protect Firmware from exposure to HW423533 |
| |
| Luke C. Murray (1): |
| |
| - `c955a5c32115 <https://github.com/open-power/sbe/commit/c955a5c32115>`__ |
| Updating NCU tlbie pacing dials |
| |
| Luke Mulkey (2): |
| |
| - `e275751a409c <https://github.com/open-power/sbe/commit/e275751a409c>`__ |
| Existing code changes for ddr\_phy\_reset HB mirror |
| - `2cd7837eb2ec <https://github.com/open-power/sbe/commit/2cd7837eb2ec>`__ |
| p9c\_mss\_memdiags and p9c\_mss\_maint\_cmds |
| |
| Matt K. Light (1): |
| |
| - `efcd5ec67072 <https://github.com/open-power/sbe/commit/efcd5ec67072>`__ |
| adding fapi2::putSpyWithCare() |
| |
| Matthew Hickman (1): |
| |
| - `8e7dbfd13ce4 <https://github.com/open-power/sbe/commit/8e7dbfd13ce4>`__ |
| Added RCD Protect time and MNFG Flag check to unmask function |
| |
| Nick Klazynski (4): |
| |
| - `ace31fa4b8c6 <https://github.com/open-power/sbe/commit/ace31fa4b8c6>`__ |
| Add TM WAT workaround; NDD2.2 and CDD1.1 only |
| - `1fb2cb5cb795 <https://github.com/open-power/sbe/commit/1fb2cb5cb795>`__ |
| Add Cumulus DD1.1 inits |
| - `b51252885ec6 <https://github.com/open-power/sbe/commit/b51252885ec6>`__ |
| Enable risklevel2, match v44 of security wiki |
| - `00bb7b34d2a8 <https://github.com/open-power/sbe/commit/00bb7b34d2a8>`__ |
| Remove CDD1.1 security IMC; Apply indirect branch serialization to |
| HV=0 only |
| |
| Oliver Morlok (1): |
| |
| - `56e408e085ca <https://github.com/open-power/sbe/commit/56e408e085ca>`__ |
| Get a z compile working |
| |
| Prasad Bg Ranganath (1): |
| |
| - `69bc840ab99a <https://github.com/open-power/sbe/commit/69bc840ab99a>`__ |
| Fix bug in cache query state procedure |
| |
| Raja Das (2): |
| |
| - `2dce1d2d7fbb <https://github.com/open-power/sbe/commit/2dce1d2d7fbb>`__ |
| SBE Space optimisation |
| - `9b7838172f0b <https://github.com/open-power/sbe/commit/9b7838172f0b>`__ |
| SBE Regression |
| |
| Sachin Gupta (5): |
| |
| - `d27218491dda <https://github.com/open-power/sbe/commit/d27218491dda>`__ |
| Retry multicast chiplet offline errors. |
| - `ab0fc4ba6ffb <https://github.com/open-power/sbe/commit/ab0fc4ba6ffb>`__ |
| Update backing build |
| - `967fefdf8af1 <https://github.com/open-power/sbe/commit/967fefdf8af1>`__ |
| Fix test sequence |
| - `321de657b979 <https://github.com/open-power/sbe/commit/321de657b979>`__ |
| Update backing build |
| - `5c0363924c7d <https://github.com/open-power/sbe/commit/5c0363924c7d>`__ |
| Handle race condition between PSU/FIFO interface. |
| |
| Soma BhanuTej (3): |
| |
| - `55603147cd5b <https://github.com/open-power/sbe/commit/55603147cd5b>`__ |
| Mask TP LFIR for non PPE mode - p9\_sbe\_common |
| - `ace2c563f607 <https://github.com/open-power/sbe/commit/ace2c563f607>`__ |
| Axone support to TP stopclocks |
| - `4e41a9415858 <https://github.com/open-power/sbe/commit/4e41a9415858>`__ |
| Change TP FIR bits 38, 39, 40 as recoverable & Masked |
| |
| Sumit Kumar (1): |
| |
| - `2b29de060c3e <https://github.com/open-power/sbe/commit/2b29de060c3e>`__ |
| Erepair HWP p9\_io\_erepair procedure |
| |
| Yue Du (2): |
| |
| - `20c449a70cde <https://github.com/open-power/sbe/commit/20c449a70cde>`__ |
| STOP: Support Suspend Entry/Exit and Fix Pig Collision |
| - `148a8c9278b9 <https://github.com/open-power/sbe/commit/148a8c9278b9>`__ |
| STOP: Fix Wakeup terminate prematurely with mixed stop2 and stop4 |
| |
| aravnair-in (1): |
| |
| - `160637c9e837 <https://github.com/open-power/sbe/commit/160637c9e837>`__ |
| Fix a couple of EKB files to prevent CMVC quirk |
| |
| crgeddes (3): |
| |
| - `7808b4fe065e <https://github.com/open-power/sbe/commit/7808b4fe065e>`__ |
| Update p9\_query\_cache\_access\_state to use the correct scom |
| register |
| - `49613ee7ed9e <https://github.com/open-power/sbe/commit/49613ee7ed9e>`__ |
| Skip EQ\_CLOCK\_STAT\_SL scom is we are in stop 11 or greater |
| - `2c07fd2bbb9d <https://github.com/open-power/sbe/commit/2c07fd2bbb9d>`__ |
| Add RCD\_PARITY\_ERROR enum value to ATTR\_RECONFIGURE\_LOOP |
| |
| spashabk-in (7): |
| |
| - `ffa97b5fd9ff <https://github.com/open-power/sbe/commit/ffa97b5fd9ff>`__ |
| Fix missing sbe traces in errorlog |
| - `6526984e4ae4 <https://github.com/open-power/sbe/commit/6526984e4ae4>`__ |
| Extend sbe-debug.py to get ppe register ffdc |
| - `8e9d92bf3c8f <https://github.com/open-power/sbe/commit/8e9d92bf3c8f>`__ |
| Check for disable scom filtering bit |
| - `9355a3505c0a <https://github.com/open-power/sbe/commit/9355a3505c0a>`__ |
| Cleanup generic chipop files |
| - `6699e49f885f <https://github.com/open-power/sbe/commit/6699e49f885f>`__ |
| Dump transition during continuous ipl |
| - `9e30f6413207 <https://github.com/open-power/sbe/commit/9e30f6413207>`__ |
| Check for checkstop during mpipl |
| - `26fbcbed7c36 <https://github.com/open-power/sbe/commit/26fbcbed7c36>`__ |
| Restructure sbe-debug.py |
| |
| whs (1): |
| |
| - `90316ae6f36a <https://github.com/open-power/sbe/commit/90316ae6f36a>`__ |
| Changes related to packaging of memory vpd on Nimbus |
| |
| Package: skiboot |
| ---------------- |
| |
| `Repository <https://github.com/open-power/skiboot>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| Commits |
| ~~~~~~~ |
| |
| Akshay Adiga (1): |
| |
| - `87f33f499061 <https://github.com/open-power/skiboot/commit/87f33f499061>`__ |
| SLW: Increase stop4-5 residency by 10x |
| |
| Alistair Popple (1): |
| |
| - `759c23acb4b6 <https://github.com/open-power/skiboot/commit/759c23acb4b6>`__ |
| hw/npu2: Assign a unique LPARSHORTID per GPU |
| |
| Andrew Donnellan (12): |
| |
| - `399151e1425e <https://github.com/open-power/skiboot/commit/399151e1425e>`__ |
| npu2: Split out common helper functions into separate file |
| - `11b46291111a <https://github.com/open-power/skiboot/commit/11b46291111a>`__ |
| npu2: Rework NPU data structures for OpenCAPI |
| - `3603f474e566 <https://github.com/open-power/skiboot/commit/3603f474e566>`__ |
| platform: Add fields for OpenCAPI platform data |
| - `b5f1fd30ef56 <https://github.com/open-power/skiboot/commit/b5f1fd30ef56>`__ |
| npu2-opencapi: Configure NPU for OpenCAPI |
| - `9db58b1e5c03 <https://github.com/open-power/skiboot/commit/9db58b1e5c03>`__ |
| npu2-hw-procedures: Add support for OpenCAPI PHY link training |
| - `6b1cdedcef1d <https://github.com/open-power/skiboot/commit/6b1cdedcef1d>`__ |
| npu2-opencapi: Train OpenCAPI links and setup devices |
| - `5b72a43c59cb <https://github.com/open-power/skiboot/commit/5b72a43c59cb>`__ |
| platforms: Add OpenCAPI platform data and device tree nodes |
| - `f2e637b802e3 <https://github.com/open-power/skiboot/commit/f2e637b802e3>`__ |
| doc/device-tree: Add PCI bindings stub |
| - `bd6194f5a864 <https://github.com/open-power/skiboot/commit/bd6194f5a864>`__ |
| doc/device-tree: Add OpenCAPI device tree bindings |
| - `9972229b6b11 <https://github.com/open-power/skiboot/commit/9972229b6b11>`__ |
| gitignore: Add \*.a |
| - `d8c596368279 <https://github.com/open-power/skiboot/commit/d8c596368279>`__ |
| npu2: Remove unused fields in struct npu2 |
| - `87145c6bad5b <https://github.com/open-power/skiboot/commit/87145c6bad5b>`__ |
| npu2: Remove DD1 support |
| |
| Artem Senichev (1): |
| |
| - `bfdf5787b9d8 <https://github.com/open-power/skiboot/commit/bfdf5787b9d8>`__ |
| Add VESNIN platform support |
| |
| Christophe Lombard (1): |
| |
| - `0180de29859b <https://github.com/open-power/skiboot/commit/0180de29859b>`__ |
| capp: Add lid definition for P9 DD-2.2 |
| |
| Cyril Bur (10): |
| |
| - `682e196627a0 <https://github.com/open-power/skiboot/commit/682e196627a0>`__ |
| libflash/blocklevel: Correct miscalculation in |
| blocklevel\_smart\_erase() |
| - `70166b34238e <https://github.com/open-power/skiboot/commit/70166b34238e>`__ |
| mbox: Harden against BMC daemon errors |
| - `8c0224322650 <https://github.com/open-power/skiboot/commit/8c0224322650>`__ |
| mbox: Reduce default BMC timeouts |
| - `5630c819b3cb <https://github.com/open-power/skiboot/commit/5630c819b3cb>`__ |
| occ-sensors: Remove NULL checks after dereference |
| - `f4f88196aec7 <https://github.com/open-power/skiboot/commit/f4f88196aec7>`__ |
| npu2: Fix possible NULL dereference |
| - `4599a8bdf9de <https://github.com/open-power/skiboot/commit/4599a8bdf9de>`__ |
| npu2-opencapi: Fix memory leak |
| - `3c3b809cb8ba <https://github.com/open-power/skiboot/commit/3c3b809cb8ba>`__ |
| libstb/create-container: munmap() signature file address |
| - `7598ed90a670 <https://github.com/open-power/skiboot/commit/7598ed90a670>`__ |
| fast-reboot: occ: Only delete /ibm, opal/power-mgt nodes if they |
| exist |
| - `35f003a01174 <https://github.com/open-power/skiboot/commit/35f003a01174>`__ |
| hw/imc: Don't dereference possible NULL |
| - `351b05be3d40 <https://github.com/open-power/skiboot/commit/351b05be3d40>`__ |
| dts: Zero struct to avoid using uninitialised value |
| |
| Cédric Le Goater (1): |
| |
| - `dcbf18c1f0e1 <https://github.com/open-power/skiboot/commit/dcbf18c1f0e1>`__ |
| xive: fix opal\_xive\_set\_vp\_info() error path |
| |
| Dan Crowell (1): |
| |
| - `4fcf4549d168 <https://github.com/open-power/skiboot/commit/4fcf4549d168>`__ |
| Make gard display show that a record is cleared |
| |
| Frederic Barrat (2): |
| |
| - `cd8b82a8e83e <https://github.com/open-power/skiboot/commit/cd8b82a8e83e>`__ |
| npu2-opencapi: Add OpenCAPI OPAL API calls |
| - `48dd5f7b9fbb <https://github.com/open-power/skiboot/commit/48dd5f7b9fbb>`__ |
| npu2-opencapi: Fix assert on link reset during init |
| |
| Joel Stanley (1): |
| |
| - `0df891697d24 <https://github.com/open-power/skiboot/commit/0df891697d24>`__ |
| README: document output files |
| |
| Mahesh Salgaonkar (1): |
| |
| - `603beb4500f5 <https://github.com/open-power/skiboot/commit/603beb4500f5>`__ |
| Reserve OPAL API number for opal\_handle\_hmi2 function. |
| |
| Matt Brown (3): |
| |
| - `2d4c774c2a3a <https://github.com/open-power/skiboot/commit/2d4c774c2a3a>`__ |
| core/lock: Add deadlock detection |
| - `84186ef0944c <https://github.com/open-power/skiboot/commit/84186ef0944c>`__ |
| core/lock: Add lock timeout warnings |
| - `8d0f41e021b3 <https://github.com/open-power/skiboot/commit/8d0f41e021b3>`__ |
| gcov: Add gcov data struct to sysfs |
| |
| Michael Ellerman (1): |
| |
| - `f30286c49431 <https://github.com/open-power/skiboot/commit/f30286c49431>`__ |
| mambo: Add fw-feature flags for security related settings |
| |
| Michael Neuling (6): |
| |
| - `bb3348c865a8 <https://github.com/open-power/skiboot/commit/bb3348c865a8>`__ |
| core/pci-dt-slot: Fix booting with no slot map |
| - `fa03921a9aa6 <https://github.com/open-power/skiboot/commit/fa03921a9aa6>`__ |
| pci: Move code around |
| - `fe6d86b92a00 <https://github.com/open-power/skiboot/commit/fe6d86b92a00>`__ |
| pci: Make fast reboot creset PHBs in parallel |
| - `18d7ee718bef <https://github.com/open-power/skiboot/commit/18d7ee718bef>`__ |
| core/init: Assert when kernel not found |
| - `730bccbbb615 <https://github.com/open-power/skiboot/commit/730bccbbb615>`__ |
| Tie tm-suspend fw-feature and opal\_reinit\_cpus() together |
| - `75a89e61c9d9 <https://github.com/open-power/skiboot/commit/75a89e61c9d9>`__ |
| pci: Reduce log level of error message |
| |
| Murilo Opsfelder Araujo (1): |
| |
| - `f23240f50653 <https://github.com/open-power/skiboot/commit/f23240f50653>`__ |
| skiboot.spec: Update to v5.10 release |
| |
| Nicholas Piggin (12): |
| |
| - `8cbd3880c321 <https://github.com/open-power/skiboot/commit/8cbd3880c321>`__ |
| direct-controls: mambo fix for multiple chips |
| - `f6159cff5d91 <https://github.com/open-power/skiboot/commit/f6159cff5d91>`__ |
| build: use thin archives rather than incremental linking |
| - `56a85b41d231 <https://github.com/open-power/skiboot/commit/56a85b41d231>`__ |
| core/hmi: report processor recovery reason from core FIR bits on P9 |
| - `884f97b25b49 <https://github.com/open-power/skiboot/commit/884f97b25b49>`__ |
| core/opal: abort in case of re-entrant OPAL call |
| - `82fd5d06beee <https://github.com/open-power/skiboot/commit/82fd5d06beee>`__ |
| core/opal: allow some re-entrant calls |
| - `1f53f9fa766f <https://github.com/open-power/skiboot/commit/1f53f9fa766f>`__ |
| core/fast-reboot: disable fast reboot upon fundamental |
| entry/exit/locking errors |
| - `8cabd06243ac <https://github.com/open-power/skiboot/commit/8cabd06243ac>`__ |
| core/fast-reboot: verify mem regions before fast reboot |
| - `336f306555d0 <https://github.com/open-power/skiboot/commit/336f306555d0>`__ |
| mem-map: Use a symbolic constant for exception vector size |
| - `c32943bfc1e2 <https://github.com/open-power/skiboot/commit/c32943bfc1e2>`__ |
| core/fast-reboot: zero memory after fast reboot |
| - `a1c3dcca81ce <https://github.com/open-power/skiboot/commit/a1c3dcca81ce>`__ |
| nvram: run nvram\_validate() after nvram\_reformat() |
| - `103f67fe83f1 <https://github.com/open-power/skiboot/commit/103f67fe83f1>`__ |
| hw/imc: don't access homer memory if it was not initialised |
| - `90d53934c2da <https://github.com/open-power/skiboot/commit/90d53934c2da>`__ |
| core/cpu: discover stack region size before initialising memory |
| regions |
| |
| Oliver O'Halloran (1): |
| |
| - `3e74805702f6 <https://github.com/open-power/skiboot/commit/3e74805702f6>`__ |
| phb\*: Remove the state field in the various phb structures |
| |
| Philippe Bergheaud (2): |
| |
| - `a8cfb0906643 <https://github.com/open-power/skiboot/commit/a8cfb0906643>`__ |
| phb4: set PHB CMPM registers for tunneled operations |
| - `0f3584d84662 <https://github.com/open-power/skiboot/commit/0f3584d84662>`__ |
| phb4: set PBCQ Tunnel BAR for tunneled operations |
| |
| Pridhiviraj Paidipeddi (5): |
| |
| - `f24db9e5c8c4 <https://github.com/open-power/skiboot/commit/f24db9e5c8c4>`__ |
| libstb/secureboot: Fix logging of secure verify messages. |
| - `20f685a3627a <https://github.com/open-power/skiboot/commit/20f685a3627a>`__ |
| console(lpc/fsp-console): Use only stdout-path property on P9 and |
| above |
| - `28a414b3e4c5 <https://github.com/open-power/skiboot/commit/28a414b3e4c5>`__ |
| doc/opal-api: Document using stdout-path property |
| - `f69d2ac579b6 <https://github.com/open-power/skiboot/commit/f69d2ac579b6>`__ |
| core/ipmi-opal: Add interrupt-parent property for ipmi node on P9 and |
| above. |
| - `8ea3ac76137b <https://github.com/open-power/skiboot/commit/8ea3ac76137b>`__ |
| doc/opal-api: Document changes of adding interrupt-parent property |
| under /ibm, opal/ipmi node on POWER9 and above. |
| |
| Reza Arbab (3): |
| |
| - `105d80f85b07 <https://github.com/open-power/skiboot/commit/105d80f85b07>`__ |
| npu2: Use unfiltered mode in XTS tables |
| - `773836f3424d <https://github.com/open-power/skiboot/commit/773836f3424d>`__ |
| npu2: Disable fast reboot |
| - `0ce7482fb650 <https://github.com/open-power/skiboot/commit/0ce7482fb650>`__ |
| npu2: Add performance tuning SCOM inits |
| |
| Shilpasri G Bhat (2): |
| |
| - `ac4272bf5e73 <https://github.com/open-power/skiboot/commit/ac4272bf5e73>`__ |
| fast-reboot: occ: Delete OCC child nodes in /ibm, opal/power-mgt |
| - `b5c9d09d0677 <https://github.com/open-power/skiboot/commit/b5c9d09d0677>`__ |
| dts: spl\_wakeup: Remove all workarounds in the spl wakeup logic |
| |
| Stewart Smith (16): |
| |
| - `fbdc91e693fc <https://github.com/open-power/skiboot/commit/fbdc91e693fc>`__ |
| NPU2 HMIs: dump out a *LOT* of npu2 registers for debugging |
| - `fa1eeea2e987 <https://github.com/open-power/skiboot/commit/fa1eeea2e987>`__ |
| doc: skiboot 5.10.1 release notes |
| - `785b35d18808 <https://github.com/open-power/skiboot/commit/785b35d18808>`__ |
| fast-reboot: enable by default for POWER9 |
| - `5ba69bb62ca2 <https://github.com/open-power/skiboot/commit/5ba69bb62ca2>`__ |
| skiboot 5.10.2 release notes |
| - `217f74b0c40e <https://github.com/open-power/skiboot/commit/217f74b0c40e>`__ |
| Revert "console(lpc/fsp-console): Use only stdout-path property on P9 |
| and above" |
| - `b71db454f703 <https://github.com/open-power/skiboot/commit/b71db454f703>`__ |
| Keep constructors with priorities |
| - `2d75b9439f66 <https://github.com/open-power/skiboot/commit/2d75b9439f66>`__ |
| gcov: Another GCC, another gcov tweak |
| - `f88ffa66d1b4 <https://github.com/open-power/skiboot/commit/f88ffa66d1b4>`__ |
| cpu\_idle\_job: relax a bit |
| - `a8e6cc3f4752 <https://github.com/open-power/skiboot/commit/a8e6cc3f4752>`__ |
| Don't detect lock timeouts when timebase is invalid |
| - `1090f346713a <https://github.com/open-power/skiboot/commit/1090f346713a>`__ |
| Revert "platforms/astbmc/slots.c: Allow comparison of bus numbers |
| when matching slots" |
| - `547377ddcd93 <https://github.com/open-power/skiboot/commit/547377ddcd93>`__ |
| occ: Set up OCC messaging even if we fail to setup pstates |
| - `80452d2cf2ce <https://github.com/open-power/skiboot/commit/80452d2cf2ce>`__ |
| Revert "NPU2 HMIs: dump out a *LOT* of npu2 registers for debugging" |
| - `215a7ce1f186 <https://github.com/open-power/skiboot/commit/215a7ce1f186>`__ |
| NPU2: dump NPU2 registers on npu2 HMI |
| - `c05a8178dffa <https://github.com/open-power/skiboot/commit/c05a8178dffa>`__ |
| Fix 'make check' compile for mem\_clear\_range |
| - `5771b85b1bc2 <https://github.com/open-power/skiboot/commit/5771b85b1bc2>`__ |
| skiboot 5.10.3 release notes |
| - `0a1d25fbae1a <https://github.com/open-power/skiboot/commit/0a1d25fbae1a>`__ |
| skiboot 5.11-rc1 release notes |
| |
| Vaibhav Jain (3): |
| |
| - `53c4553dd767 <https://github.com/open-power/skiboot/commit/53c4553dd767>`__ |
| capp: Disable fast-reboot when capp is enabled |
| - `a72d055d9337 <https://github.com/open-power/skiboot/commit/a72d055d9337>`__ |
| capp: Make error in capp timebase sync a non-fatal error |
| - `b1190f403248 <https://github.com/open-power/skiboot/commit/b1190f403248>`__ |
| capp: Disable fast-reboot whenever enable\_capi\_mode() is called |
| |
| Vasant Hegde (1): |
| |
| - `1dacecd2b28b <https://github.com/open-power/skiboot/commit/1dacecd2b28b>`__ |
| core: Fix 'opal-runtime-size' property |
| |
| Package: witherspoon-xml |
| ------------------------ |
| |
| `Repository <https://github.com/open-power/witherspoon-xml>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| Commits |
| ~~~~~~~ |
| |
| Erich Hauptli (2): |
| |
| - `6ca015dbd3e1 <https://github.com/open-power/witherspoon-xml/commit/6ca015dbd3e1>`__ |
| Syncing MRW with op-release |
| - `c10638fa2a83 <https://github.com/open-power/witherspoon-xml/commit/c10638fa2a83>`__ |
| Switching back to OBus bucket 1 |
| |
| Package: zaius-xml |
| ------------------ |
| |
| `Repository <https://github.com/open-power/zaius-xml>`__ |
| |
| Patches |
| ~~~~~~~ |
| |
| Commits |
| ~~~~~~~ |
| |
| Adrian Barrera (4): |
| |
| - `ca689febb5a6 <https://github.com/open-power/zaius-xml/commit/ca689febb5a6>`__ |
| Update EREPAIR attributes |
| - `5e48835aacb1 <https://github.com/open-power/zaius-xml/commit/5e48835aacb1>`__ |
| Update Obus PLL bucket to 25G |
| - `a426841eeba2 <https://github.com/open-power/zaius-xml/commit/a426841eeba2>`__ |
| Set Obus channel type to cable |
| - `4b012a3d1da5 <https://github.com/open-power/zaius-xml/commit/4b012a3d1da5>`__ |
| Add new 23c WOF table |