| Stewart Smith | 8de140f | 2018-04-06 13:24:08 +1000 | [diff] [blame] | 1 | Release Notes for OpenPower Firmware v1.22 |
| 2 | ========================================== |
| 3 | |
| 4 | This release is NOT intended for GA POWER9 platforms. For that, you will |
| 5 | need the (future) op-build v2.0. |
| 6 | |
| 7 | Due to the proximity to op-build v2.0, it's best to think of v1.22 as |
| 8 | a late beta release for v2.0. |
| 9 | |
| 10 | Known Issues |
| 11 | ------------ |
| 12 | |
| 13 | The following stop states are disabled: 4,5,11. We believe all the bugs |
| 14 | have been shaken out of stop4 and stop5, and they will be enabled immediately |
| 15 | after v1.22. |
| 16 | |
| 17 | New platforms |
| 18 | ------------- |
| 19 | |
| 20 | - vesnin |
| 21 | |
| 22 | A 4 socket 2U POWER8 system with up to 8TB of memory from YADRO. |
| 23 | There are still some outstanding hostboot patches that are currently |
| 24 | being reviewed in order to have full Vesnin support upstream. |
| 25 | |
| 26 | Updated Packages |
| 27 | ---------------- |
| 28 | |
| 29 | +------+----------------+----------------+---------------------------------------+ |
| 30 | | Pack | Old Version | New Version | Platforms | |
| 31 | | age | | | | |
| 32 | +======+================+================+=======================================+ |
| 33 | | glib | glibc-2.26-73- | glibc-2.26-107 | barreleye, firenze, firestone, | |
| 34 | | c | g4b692dffb95ac | -g73a92363619e | garrison, habanero, openpower\_mambo, | |
| 35 | | | 4812b161eb6a16 | 52c458146e903d | openpower\_p9\_mambo, p9dsu, | |
| 36 | | | 113d7e824982e | fb9b1ba823aa40 | palmetto, pseries, romulus, | |
| 37 | | | | | witherspoon, zaius, zz | |
| 38 | +------+----------------+----------------+---------------------------------------+ |
| 39 | | host | 28927a78ca4144 | b51298075aee40 | p9dsu, romulus, witherspoon, zaius | |
| 40 | | boot | aa8214d35b7ad7 | 2dbcef485088cf | | |
| 41 | | | e2ddba5ada4e | a71a6ca61725 | | |
| 42 | +------+----------------+----------------+---------------------------------------+ |
| 43 | | host | 6924d6b711ba7b | b339e05c57725c | barreleye, firestone, garrison, | |
| 44 | | boot | 1d4c47346c9a8d | f09b867d665269 | habanero, p9dsu, palmetto, romulus, | |
| 45 | | -bin | ff88cfaaf4c8 | 8aa2e3ab5f6a | witherspoon, zaius | |
| 46 | | arie | | | | |
| 47 | | s | | | | |
| 48 | +------+----------------+----------------+---------------------------------------+ |
| 49 | | ima- | 01b26a136da16a | 90237254664cad | barreleye, firestone, garrison, | |
| 50 | | cata | 87c0b6b3c4d9f2 | ab529a39796508 | habanero, p9dsu, palmetto, romulus, | |
| 51 | | log | 7555dca104dc | 3e38806d92e6 | witherspoon, zaius | |
| 52 | +------+----------------+----------------+---------------------------------------+ |
| 53 | | libf | v5.9-166-g70f1 | v5.10.1 | barreleye, firenze, firestone, | |
| 54 | | lash | 4f4dd86e | | garrison, habanero, p9dsu, palmetto, | |
| 55 | | | | | pseries, romulus, witherspoon, zaius, | |
| 56 | | | | | zz | |
| 57 | +------+----------------+----------------+---------------------------------------+ |
| 58 | | linu | 4.14.20 | 4.15.14 | barreleye, firenze, firestone, | |
| 59 | | x | | | garrison, habanero, openpower\_mambo, | |
| 60 | | | | | openpower\_p9\_mambo, p9dsu, | |
| 61 | | | | | palmetto, pseries, romulus, | |
| 62 | | | | | witherspoon, zaius, zz | |
| 63 | +------+----------------+----------------+---------------------------------------+ |
| 64 | | linu | 4.14.20 | 4.15.14 | barreleye, firenze, firestone, | |
| 65 | | x-he | | | garrison, habanero, openpower\_mambo, | |
| 66 | | ader | | | openpower\_p9\_mambo, p9dsu, | |
| 67 | | s | | | palmetto, pseries, romulus, | |
| 68 | | | | | witherspoon, zaius, zz | |
| 69 | +------+----------------+----------------+---------------------------------------+ |
| 70 | | mach | 58554bfabd7f35 | 18591a3eba4fc4 | witherspoon | |
| 71 | | ine- | 6bc9db3e493816 | 345daf630aaf44 | | |
| 72 | | xml | 2acd445fc559 | 12f1554a24cd | | |
| 73 | +------+----------------+----------------+---------------------------------------+ |
| 74 | | mach | b0884b3032df60 | 4b012a3d1da538 | zaius | |
| 75 | | ine- | e49eff4b212719 | b3fb97c332b6fc | | |
| 76 | | xml | f8d49a5d6be7 | e51a6cffaf9a | | |
| 77 | +------+----------------+----------------+---------------------------------------+ |
| 78 | | occ | f72f857b7e5ab2 | 768466b31e853c | p9dsu, romulus, witherspoon, zaius | |
| 79 | | | 5a5616b1655005 | b11dfa90dbfc15 | | |
| 80 | | | b963405eb350 | 65a21ee9646e | | |
| 81 | +------+----------------+----------------+---------------------------------------+ |
| 82 | | open | b210f15c69933e | dafcab48658b4d | barreleye, firestone, garrison, | |
| 83 | | powe | 21494323a8f501 | e48e70c929b036 | habanero, p9dsu, palmetto, romulus, | |
| 84 | | r-pn | 7501e7b2c1de | 985dac7ef7b8 | witherspoon, zaius | |
| 85 | | or | | | | |
| 86 | +------+----------------+----------------+---------------------------------------+ |
| 87 | | peti | v1.6.6 | v1.7.1 | barreleye, firenze, firestone, | |
| 88 | | tboo | | | garrison, habanero, openpower\_mambo, | |
| 89 | | t | | | openpower\_p9\_mambo, p9dsu, | |
| 90 | | | | | palmetto, pseries, romulus, | |
| 91 | | | | | witherspoon, zaius, zz | |
| 92 | +------+----------------+----------------+---------------------------------------+ |
| 93 | | sbe | 0aae9a8e68abb5 | 5c0363924c7d71 | p9dsu, romulus, witherspoon, zaius | |
| 94 | | | 5110bee2d7bd2f | 0146155b3354b2 | | |
| 95 | | | be49a4a11e70 | 36012372dd24 | | |
| 96 | +------+----------------+----------------+---------------------------------------+ |
| 97 | | skib | v5.10 | v5.11 | barreleye, firenze, firestone, | |
| 98 | | oot | | | garrison, habanero, openpower\_mambo, | |
| 99 | | | | | openpower\_p9\_mambo, p9dsu, | |
| 100 | | | | | palmetto, pseries, romulus, | |
| 101 | | | | | witherspoon, zaius, zz | |
| 102 | +------+----------------+----------------+---------------------------------------+ |
| 103 | |
| 104 | New Packages |
| 105 | ------------ |
| 106 | |
| 107 | +-----------+-----------+-------------+ |
| 108 | | Package | Version | Platforms | |
| 109 | +===========+===========+=============+ |
| 110 | +-----------+-----------+-------------+ |
| 111 | |
| 112 | Removed Packages |
| 113 | ---------------- |
| 114 | |
| 115 | +-----------+--------------------------------------------+-------------+ |
| 116 | | Package | Version | Platforms | |
| 117 | +===========+============================================+=============+ |
| 118 | | sbe | 0aae9a8e68abb55110bee2d7bd2fbe49a4a11e70 | zz | |
| 119 | +-----------+--------------------------------------------+-------------+ |
| 120 | |
| 121 | Package: barreleye-xml |
| 122 | ---------------------- |
| 123 | |
| 124 | `Repository <https://github.com/open-power/barreleye-xml>`__ |
| 125 | |
| 126 | Patches |
| 127 | ~~~~~~~ |
| 128 | |
| 129 | Commits |
| 130 | ~~~~~~~ |
| 131 | |
| 132 | No changes. |
| 133 | |
| 134 | Package: firestone-xml |
| 135 | ---------------------- |
| 136 | |
| 137 | `Repository <https://github.com/open-power/firestone-xml>`__ |
| 138 | |
| 139 | Patches |
| 140 | ~~~~~~~ |
| 141 | |
| 142 | Commits |
| 143 | ~~~~~~~ |
| 144 | |
| 145 | No changes. |
| 146 | |
| 147 | Package: garrison-xml |
| 148 | --------------------- |
| 149 | |
| 150 | `Repository <https://github.com/open-power/garrison-xml>`__ |
| 151 | |
| 152 | Patches |
| 153 | ~~~~~~~ |
| 154 | |
| 155 | Commits |
| 156 | ~~~~~~~ |
| 157 | |
| 158 | No changes. |
| 159 | |
| 160 | Package: habanero-xml |
| 161 | --------------------- |
| 162 | |
| 163 | `Repository <https://github.com/open-power/habanero-xml>`__ |
| 164 | |
| 165 | Patches |
| 166 | ~~~~~~~ |
| 167 | |
| 168 | Commits |
| 169 | ~~~~~~~ |
| 170 | |
| 171 | No changes. |
| 172 | |
| 173 | Package: hostboot |
| 174 | ----------------- |
| 175 | |
| 176 | `Repository <https://github.com/open-power/hostboot>`__ |
| 177 | |
| 178 | Patches |
| 179 | ~~~~~~~ |
| 180 | |
| 181 | Commits |
| 182 | ~~~~~~~ |
| 183 | |
| 184 | Abhishek Agarwal (1): |
| 185 | |
| 186 | - `fdbb8517ab31 <https://github.com/open-power/hostboot/commit/fdbb8517ab31>`__ |
| 187 | ATTR\_CHIP\_EC\_FEATURE\_HW406337 support for Axone |
| 188 | |
| 189 | Alex Taft (4): |
| 190 | |
| 191 | - `c078ed5d8667 <https://github.com/open-power/hostboot/commit/c078ed5d8667>`__ |
| 192 | New dummy pulse pok bits (for L2/L3) |
| 193 | - `da32698522da <https://github.com/open-power/hostboot/commit/da32698522da>`__ |
| 194 | HW405413 : NCU sends data out of order |
| 195 | - `e8c20a22ad09 <https://github.com/open-power/hostboot/commit/e8c20a22ad09>`__ |
| 196 | L3 initfile updates |
| 197 | - `7dea31a9b0b0 <https://github.com/open-power/hostboot/commit/7dea31a9b0b0>`__ |
| 198 | L3 Initfile: Qualify divide\_minor setting |
| 199 | |
| 200 | Alpana Kumari (1): |
| 201 | |
| 202 | - `bd85928cb6ab <https://github.com/open-power/hostboot/commit/bd85928cb6ab>`__ |
| 203 | Fix enum in dimmConsts.H |
| 204 | |
| 205 | Amit Tendolkar (3): |
| 206 | |
| 207 | - `a2c708da6e1a <https://github.com/open-power/hostboot/commit/a2c708da6e1a>`__ |
| 208 | Add PGPE XIRs to Special Wakeup Failure FFDC |
| 209 | - `def84fb4f740 <https://github.com/open-power/hostboot/commit/def84fb4f740>`__ |
| 210 | Enable setting the stop recovery enabled/disable policy in SGPE Init |
| 211 | - `18d91f4a458f <https://github.com/open-power/hostboot/commit/18d91f4a458f>`__ |
| 212 | Update p9\_collect\_ppe\_state to dynamically collect PPE FFDC |
| 213 | |
| 214 | Andre Marin (14): |
| 215 | |
| 216 | - `f595ecf7f9d0 <https://github.com/open-power/hostboot/commit/f595ecf7f9d0>`__ |
| 217 | Add address translation (xlate) support for 4Gbx8 and unit tests |
| 218 | - `443282a786ee <https://github.com/open-power/hostboot/commit/443282a786ee>`__ |
| 219 | Fixes memdiags broadcast mode address check bug |
| 220 | - `c50ad6201b4a <https://github.com/open-power/hostboot/commit/c50ad6201b4a>`__ |
| 221 | Add base spd decoder to share among controllers |
| 222 | - `157d87dcea5a <https://github.com/open-power/hostboot/commit/157d87dcea5a>`__ |
| 223 | Change base decoder, add ddr4 namespace, and common API btw modules |
| 224 | - `b0eb26a290f0 <https://github.com/open-power/hostboot/commit/b0eb26a290f0>`__ |
| 225 | Add const to the end of spd decoder methods to denote unchanged mem |
| 226 | vars |
| 227 | - `e1e78b687d15 <https://github.com/open-power/hostboot/commit/e1e78b687d15>`__ |
| 228 | Add Connector to SDRAM Bit Mapping to the SPD decoder and unit tests |
| 229 | - `b6de6f7655df <https://github.com/open-power/hostboot/commit/b6de6f7655df>`__ |
| 230 | Split SPD Connector to SDRAM fields, add unit tests |
| 231 | - `d9cde7352d62 <https://github.com/open-power/hostboot/commit/d9cde7352d62>`__ |
| 232 | Remove override flag for ATTR\_MSS\_MRW\_ALLOW\_UNSUPPORTED\_RCW, |
| 233 | deconfig update |
| 234 | - `3ffad4a09011 <https://github.com/open-power/hostboot/commit/3ffad4a09011>`__ |
| 235 | Remove mss::c\_str dependency for SPD decoder for future reuse |
| 236 | - `71987fc9ba5a <https://github.com/open-power/hostboot/commit/71987fc9ba5a>`__ |
| 237 | Add DLL workaround and unit tests |
| 238 | - `3eb1f8ab1705 <https://github.com/open-power/hostboot/commit/3eb1f8ab1705>`__ |
| 239 | Disable mem clk stop when in STR for DD2.\* only |
| 240 | - `e9b81f6e0311 <https://github.com/open-power/hostboot/commit/e9b81f6e0311>`__ |
| 241 | Remove reset\_dll from scominit, enable delay line tap points |
| 242 | - `04088f2ddf58 <https://github.com/open-power/hostboot/commit/04088f2ddf58>`__ |
| 243 | Modified gen\_accessors script for greater support |
| 244 | - `ab7f5582fdba <https://github.com/open-power/hostboot/commit/ab7f5582fdba>`__ |
| 245 | Remove logic to disable memory clocks in STR if in |
| 246 | PD\_AND\_STR\_CLK\_STOP mode |
| 247 | |
| 248 | Anusha Reddy Rangareddygari (7): |
| 249 | |
| 250 | - `37f1636463ec <https://github.com/open-power/hostboot/commit/37f1636463ec>`__ |
| 251 | Ec\_level attribute support for DD1 attributes |
| 252 | - `b722a87509e1 <https://github.com/open-power/hostboot/commit/b722a87509e1>`__ |
| 253 | DD2 updates:p9\_sbe\_arrayinit,p9\_sbe\_tp\_arrayinit |
| 254 | - `9194b0c4c0cc <https://github.com/open-power/hostboot/commit/9194b0c4c0cc>`__ |
| 255 | VITAL cleaning for DD2 |
| 256 | - `313d850ed60d <https://github.com/open-power/hostboot/commit/313d850ed60d>`__ |
| 257 | p9\_start\_cbs updates |
| 258 | - `37f0ec3dddbd <https://github.com/open-power/hostboot/commit/37f0ec3dddbd>`__ |
| 259 | p9\_sbe\_chiplet\_reset,p9\_sbe\_arrayinit |
| 260 | - `5ac11d13ae61 <https://github.com/open-power/hostboot/commit/5ac11d13ae61>`__ |
| 261 | Cumulus proc updates |
| 262 | - `156a0bd71156 <https://github.com/open-power/hostboot/commit/156a0bd71156>`__ |
| 263 | Axone Update |
| 264 | |
| 265 | Ben Gass (15): |
| 266 | |
| 267 | - `5ebf782126ac <https://github.com/open-power/hostboot/commit/5ebf782126ac>`__ |
| 268 | Add support for p9c 1.2 |
| 269 | - `a8bf720f6890 <https://github.com/open-power/hostboot/commit/a8bf720f6890>`__ |
| 270 | Turn off 64byte checkbit inversion for simulation in |
| 271 | centaur.mbs.scom.initfile |
| 272 | - `ef607c81e101 <https://github.com/open-power/hostboot/commit/ef607c81e101>`__ |
| 273 | Axone MC uses same pll/clock setup as in Cumulus. |
| 274 | - `3877eeac3ff3 <https://github.com/open-power/hostboot/commit/3877eeac3ff3>`__ |
| 275 | Remove PROC\_FABRIC\_LINK\_ACTIVE from OBUS\_FBC\_ENABLED in |
| 276 | p9.obus.scom.initfile |
| 277 | - `8aefe57f98f5 <https://github.com/open-power/hostboot/commit/8aefe57f98f5>`__ |
| 278 | Adding chip\_ec\_feature attributes for dd2 build |
| 279 | - `21200ba766f3 <https://github.com/open-power/hostboot/commit/21200ba766f3>`__ |
| 280 | Set NDL IOValids based on configured NV links. |
| 281 | - `7375de1dcebd <https://github.com/open-power/hostboot/commit/7375de1dcebd>`__ |
| 282 | Update filter pll settings as per HW407180 |
| 283 | - `749693530aed <https://github.com/open-power/hostboot/commit/749693530aed>`__ |
| 284 | Use obus p9ndd1 spy name attribute for obus initfile |
| 285 | - `f52bb2280385 <https://github.com/open-power/hostboot/commit/f52bb2280385>`__ |
| 286 | Create dmi.pll.scan.initfile |
| 287 | - `a69039374bbe <https://github.com/open-power/hostboot/commit/a69039374bbe>`__ |
| 288 | Updates for HW416934 and HW417233 |
| 289 | - `0844be4f3967 <https://github.com/open-power/hostboot/commit/0844be4f3967>`__ |
| 290 | Adding p9a support. |
| 291 | - `5b9b993f082c <https://github.com/open-power/hostboot/commit/5b9b993f082c>`__ |
| 292 | Re-submit Axone updates |
| 293 | - `d3594cc4abcb <https://github.com/open-power/hostboot/commit/d3594cc4abcb>`__ |
| 294 | Add support for p9c 1.2 |
| 295 | - `277e5d2085cd <https://github.com/open-power/hostboot/commit/277e5d2085cd>`__ |
| 296 | Axone MC uses same pll/clock setup as in Cumulus. |
| 297 | - `9bea281bae99 <https://github.com/open-power/hostboot/commit/9bea281bae99>`__ |
| 298 | Add p9n 2.3 to p9\_frequency\_buckets.H |
| 299 | |
| 300 | Benjamin Weisenbeck (1): |
| 301 | |
| 302 | - `24bcf5732469 <https://github.com/open-power/hostboot/commit/24bcf5732469>`__ |
| 303 | PRD: Fix data storage exception in PLL analysis |
| 304 | |
| 305 | Bill Hoffa (6): |
| 306 | |
| 307 | - `014e0ae7136c <https://github.com/open-power/hostboot/commit/014e0ae7136c>`__ |
| 308 | Add Kernel Debug Trace for Out of Memory condition |
| 309 | - `ddb2012f39d5 <https://github.com/open-power/hostboot/commit/ddb2012f39d5>`__ |
| 310 | Enable Cumulus CDIMM Config |
| 311 | - `a2dc8952afa9 <https://github.com/open-power/hostboot/commit/a2dc8952afa9>`__ |
| 312 | Deliver cumulus\_cdimm pnor image to fips for Simics regression |
| 313 | testing |
| 314 | - `9de67e525158 <https://github.com/open-power/hostboot/commit/9de67e525158>`__ |
| 315 | Update Bbuild to b0316a\_1813.920 |
| 316 | - `425eb895f440 <https://github.com/open-power/hostboot/commit/425eb895f440>`__ |
| 317 | Add ATTR\_ prefix to attributes missing it in |
| 318 | hb\_customized\_attrs.xml |
| 319 | - `a17b84a6678f <https://github.com/open-power/hostboot/commit/a17b84a6678f>`__ |
| 320 | Enable FAPI Cumulus test cases |
| 321 | |
| 322 | Brian Bakke (2): |
| 323 | |
| 324 | - `3403445e2f75 <https://github.com/open-power/hostboot/commit/3403445e2f75>`__ |
| 325 | Fix and codify how system and node targets are handled by attribute |
| 326 | overrides |
| 327 | - `bb0dc7d71263 <https://github.com/open-power/hostboot/commit/bb0dc7d71263>`__ |
| 328 | Add common XSCOM error literals to HBRT |
| 329 | |
| 330 | Brian Silver (3): |
| 331 | |
| 332 | - `57808f6af451 <https://github.com/open-power/hostboot/commit/57808f6af451>`__ |
| 333 | Add EC feature levels to MSS workarounds |
| 334 | - `b76592c3358c <https://github.com/open-power/hostboot/commit/b76592c3358c>`__ |
| 335 | Add EC workaround for PHY training bad bit processing |
| 336 | - `8ccd1b475062 <https://github.com/open-power/hostboot/commit/8ccd1b475062>`__ |
| 337 | Add Memory Subsystem FIR support |
| 338 | |
| 339 | Brian Stegmiller (3): |
| 340 | |
| 341 | - `2993c5b32a67 <https://github.com/open-power/hostboot/commit/2993c5b32a67>`__ |
| 342 | PRD: Add regs to capture list for NVLINK analysis |
| 343 | - `8cf2925f7e01 <https://github.com/open-power/hostboot/commit/8cf2925f7e01>`__ |
| 344 | Monitor threads for HB TI to work |
| 345 | - `0e69501ebe5b <https://github.com/open-power/hostboot/commit/0e69501ebe5b>`__ |
| 346 | Simics: Skip mem diag due to intermittent action file issues |
| 347 | |
| 348 | Brian Vanderpool (1): |
| 349 | |
| 350 | - `551d7e678a8e <https://github.com/open-power/hostboot/commit/551d7e678a8e>`__ |
| 351 | PM: Ignore allow\_reg\_wakeup in cache contained mode |
| 352 | |
| 353 | CHRISTINA L. GRAVES (3): |
| 354 | |
| 355 | - `316f190cdeac <https://github.com/open-power/hostboot/commit/316f190cdeac>`__ |
| 356 | p9\_sbe\_lpc\_init fix with GPIO reset |
| 357 | - `a7f98e8fe346 <https://github.com/open-power/hostboot/commit/a7f98e8fe346>`__ |
| 358 | Fix for HW397129-set bit 52 in the ALTD\_OPTION reg to keep MC |
| 359 | fastpath enabled |
| 360 | - `6567fe47ef12 <https://github.com/open-power/hostboot/commit/6567fe47ef12>`__ |
| 361 | p9\_setup\_bars -- support DD2 NPU SCOM address changes |
| 362 | |
| 363 | Caleb Palmer (10): |
| 364 | |
| 365 | - `1467cbcb8be5 <https://github.com/open-power/hostboot/commit/1467cbcb8be5>`__ |
| 366 | Fix target type check in bad dq helper function |
| 367 | - `18a73baccdc2 <https://github.com/open-power/hostboot/commit/18a73baccdc2>`__ |
| 368 | PRD: Don't skip TPS after failed MemDealloc calls |
| 369 | - `d2fd055febb7 <https://github.com/open-power/hostboot/commit/d2fd055febb7>`__ |
| 370 | Free mem and fix dimm trgt in bad dq accessors |
| 371 | - `83933bedd3ce <https://github.com/open-power/hostboot/commit/83933bedd3ce>`__ |
| 372 | MDIA: Cut mdia patterns from 9 to 4 |
| 373 | - `8f68014a90f6 <https://github.com/open-power/hostboot/commit/8f68014a90f6>`__ |
| 374 | MDIA: ensure full MBA target support for P9 |
| 375 | - `4bc416f75e08 <https://github.com/open-power/hostboot/commit/4bc416f75e08>`__ |
| 376 | MDIA: command cleanup support |
| 377 | - `92069bbfeb10 <https://github.com/open-power/hostboot/commit/92069bbfeb10>`__ |
| 378 | Add get/set functionality for row repair attr |
| 379 | - `08b8dd518da9 <https://github.com/open-power/hostboot/commit/08b8dd518da9>`__ |
| 380 | Add accessor functions for row repair attr |
| 381 | - `39489bc4e96c <https://github.com/open-power/hostboot/commit/39489bc4e96c>`__ |
| 382 | PRD: Continue looking for attns after SCOM fail on mask/act regs |
| 383 | - `ae7ba42544d4 <https://github.com/open-power/hostboot/commit/ae7ba42544d4>`__ |
| 384 | PRD: Enable threshold for IPL RCD parity err |
| 385 | |
| 386 | Chris Cain (1): |
| 387 | |
| 388 | - `24780f003a4b <https://github.com/open-power/hostboot/commit/24780f003a4b>`__ |
| 389 | HTMGT: Cache user power limit from BMC and add proc callout for 2AEx |
| 390 | errors |
| 391 | |
| 392 | Chris Hanudel (1): |
| 393 | |
| 394 | - `8dba9b43bdc9 <https://github.com/open-power/hostboot/commit/8dba9b43bdc9>`__ |
| 395 | Updates for P9 NX DD2 initfiles |
| 396 | |
| 397 | Chris Steffen (2): |
| 398 | |
| 399 | - `f9039019de5a <https://github.com/open-power/hostboot/commit/f9039019de5a>`__ |
| 400 | Initial Abus Commit |
| 401 | - `e507de12bf45 <https://github.com/open-power/hostboot/commit/e507de12bf45>`__ |
| 402 | I/O Metadata Cleanup |
| 403 | |
| 404 | Christian Geddes (10): |
| 405 | |
| 406 | - `8d28433bcc3c <https://github.com/open-power/hostboot/commit/8d28433bcc3c>`__ |
| 407 | Fix bugs in FSP->HBRT message path for SBE errors |
| 408 | - `4a60925ef57e <https://github.com/open-power/hostboot/commit/4a60925ef57e>`__ |
| 409 | Fix trace bug for error path in rt\_fwnotify |
| 410 | - `2c4b416ae0cf <https://github.com/open-power/hostboot/commit/2c4b416ae0cf>`__ |
| 411 | Remove if that was catching SBE chipop err logs and forcing reboot |
| 412 | - `c5983ddc3585 <https://github.com/open-power/hostboot/commit/c5983ddc3585>`__ |
| 413 | Skip attempting sbe\_retry when HBRT receives SBE\_ERR from HWSV |
| 414 | - `10aa31b32fc0 <https://github.com/open-power/hostboot/commit/10aa31b32fc0>`__ |
| 415 | Re-order sbex calls in presimsetup to get paths updated correctly |
| 416 | - `04ba8e387d32 <https://github.com/open-power/hostboot/commit/04ba8e387d32>`__ |
| 417 | Update autocitest to collect all hostboot dump info prior to failure |
| 418 | - `74156401d2fb <https://github.com/open-power/hostboot/commit/74156401d2fb>`__ |
| 419 | Don't include duplicate connections when looking up xbus mapping |
| 420 | - `05cda10a435a <https://github.com/open-power/hostboot/commit/05cda10a435a>`__ |
| 421 | Update backing build to be b0222a\_1810.911 |
| 422 | - `a6bd3b6514e0 <https://github.com/open-power/hostboot/commit/a6bd3b6514e0>`__ |
| 423 | Allow platHwasErrorAddHWCollout now that FSP supports it |
| 424 | - `fc2a04496b84 <https://github.com/open-power/hostboot/commit/fc2a04496b84>`__ |
| 425 | Ensure all hbmutex attributes get re-initialized on MPIPL |
| 426 | |
| 427 | Christopher Riedl (1): |
| 428 | |
| 429 | - `8d3671f0c224 <https://github.com/open-power/hostboot/commit/8d3671f0c224>`__ |
| 430 | PPM reg collision (HW389511) work-around: Special Wake-up |
| 431 | |
| 432 | Claus Michael Olsen (4): |
| 433 | |
| 434 | - `3fbe556d9d69 <https://github.com/open-power/hostboot/commit/3fbe556d9d69>`__ |
| 435 | Additional risk level support - (step 2) Updating the image w/RL2 |
| 436 | - `a563b914d6dc <https://github.com/open-power/hostboot/commit/a563b914d6dc>`__ |
| 437 | xip\_customize: GPTR/overlays stage 1 support |
| 438 | - `50a391ac5965 <https://github.com/open-power/hostboot/commit/50a391ac5965>`__ |
| 439 | HW425038 INT ARX timeout workaround - Updated initfiles to 49241 |
| 440 | - `68f67bd7aab5 <https://github.com/open-power/hostboot/commit/68f67bd7aab5>`__ |
| 441 | Update to putRingUtils to proper scanning of perv\_pll\_bndy\_flt |
| 442 | rings |
| 443 | |
| 444 | Corey Swenson (7): |
| 445 | |
| 446 | - `4cf79f8dc40b <https://github.com/open-power/hostboot/commit/4cf79f8dc40b>`__ |
| 447 | Changes to Inband SCOM MMIO ranges for Cumulus |
| 448 | - `53635aee4925 <https://github.com/open-power/hostboot/commit/53635aee4925>`__ |
| 449 | Delete ATTR\_DMI\_INBAND\_BAR\_ENABLE when processing MRW attributes |
| 450 | - `ed84b08afa87 <https://github.com/open-power/hostboot/commit/ed84b08afa87>`__ |
| 451 | Inband SCOM clean up |
| 452 | - `b4699ae10c2a <https://github.com/open-power/hostboot/commit/b4699ae10c2a>`__ |
| 453 | Add inband bar address to simics xml |
| 454 | - `8a783ea89563 <https://github.com/open-power/hostboot/commit/8a783ea89563>`__ |
| 455 | Move runtime scoms to common function |
| 456 | - `579e63b60e50 <https://github.com/open-power/hostboot/commit/579e63b60e50>`__ |
| 457 | Add support for ATTR\_FREQ\_MCA\_MHZ |
| 458 | - `b51298075aee <https://github.com/open-power/hostboot/commit/b51298075aee>`__ |
| 459 | Add ibscom runtime support |
| 460 | |
| 461 | Dan Crowell (20): |
| 462 | |
| 463 | - `b47f658c6e96 <https://github.com/open-power/hostboot/commit/b47f658c6e96>`__ |
| 464 | Pull ATTR\_MSS\_MRW\_FORCE\_BCMODE\_OFF from MRW if it exists |
| 465 | - `431a3cc0aa10 <https://github.com/open-power/hostboot/commit/431a3cc0aa10>`__ |
| 466 | Bug fixes for concurrent update of HBRT |
| 467 | - `4a0eb030e761 <https://github.com/open-power/hostboot/commit/4a0eb030e761>`__ |
| 468 | Mirror fixup - spd\_decoder\_base.H |
| 469 | - `36766721c030 <https://github.com/open-power/hostboot/commit/36766721c030>`__ |
| 470 | Disable WOF for Cumulus DD1.0 |
| 471 | - `4f43040cb271 <https://github.com/open-power/hostboot/commit/4f43040cb271>`__ |
| 472 | Enable WOF\_VRATIO on ZZ |
| 473 | - `f5d2c874d072 <https://github.com/open-power/hostboot/commit/f5d2c874d072>`__ |
| 474 | Removing old TODO for dropped requirement |
| 475 | - `309422a68f39 <https://github.com/open-power/hostboot/commit/309422a68f39>`__ |
| 476 | Fix EID range for HBRT logs |
| 477 | - `586b8b1e6088 <https://github.com/open-power/hostboot/commit/586b8b1e6088>`__ |
| 478 | Do not elevate severity of reconfig error log |
| 479 | - `e4a7de38d08d <https://github.com/open-power/hostboot/commit/e4a7de38d08d>`__ |
| 480 | No longer include BAR attributes in ServerWiz2 export |
| 481 | - `5683e4887711 <https://github.com/open-power/hostboot/commit/5683e4887711>`__ |
| 482 | Remirror chip\_ec\_attributes.xml |
| 483 | - `7b96070e5a1f <https://github.com/open-power/hostboot/commit/7b96070e5a1f>`__ |
| 484 | Disabling WOF and VDM for Nimbus DD2.0 |
| 485 | - `eb7c0e1f8327 <https://github.com/open-power/hostboot/commit/eb7c0e1f8327>`__ |
| 486 | Disable WOF for Cumulus DD1.0 |
| 487 | - `945553cc05cf <https://github.com/open-power/hostboot/commit/945553cc05cf>`__ |
| 488 | Force single-threaded access to HWPs in PRD |
| 489 | - `54d16a1476fe <https://github.com/open-power/hostboot/commit/54d16a1476fe>`__ |
| 490 | Add proc huid to PSU trace |
| 491 | - `bbe9dd41d809 <https://github.com/open-power/hostboot/commit/bbe9dd41d809>`__ |
| 492 | Fix FFDC for FW Request Errors |
| 493 | - `4d755323a660 <https://github.com/open-power/hostboot/commit/4d755323a660>`__ |
| 494 | Completely hide attributes that have no value |
| 495 | - `a4d47c4e68cc <https://github.com/open-power/hostboot/commit/a4d47c4e68cc>`__ |
| 496 | Support Nimbus DD2.3 and Cumulus 1.2 PLL Buckets |
| 497 | - `b2bffd27478b <https://github.com/open-power/hostboot/commit/b2bffd27478b>`__ |
| 498 | Ensure ATTR\_EC\_GARD and ATTR\_EQ\_GARD are updated before SBE |
| 499 | update |
| 500 | - `90eaed6f430c <https://github.com/open-power/hostboot/commit/90eaed6f430c>`__ |
| 501 | Force checkstops for unhandled machine checks |
| 502 | - `711723bcb25f <https://github.com/open-power/hostboot/commit/711723bcb25f>`__ |
| 503 | Ignore dummy files when parsing error log data |
| 504 | |
| 505 | Daniel Howe (3): |
| 506 | |
| 507 | - `928dab2ae2c2 <https://github.com/open-power/hostboot/commit/928dab2ae2c2>`__ |
| 508 | Allow lpc\_ed for p9n 2.2 per HW418117 fix |
| 509 | - `55b4dac7353b <https://github.com/open-power/hostboot/commit/55b4dac7353b>`__ |
| 510 | update data token init to use scans on p9c 1.1 |
| 511 | - `acd49fe41045 <https://github.com/open-power/hostboot/commit/acd49fe41045>`__ |
| 512 | dd1.1+ DL training procedure updates |
| 513 | |
| 514 | Daniel M. Crowell (1): |
| 515 | |
| 516 | - `2fd3b08eed59 <https://github.com/open-power/hostboot/commit/2fd3b08eed59>`__ |
| 517 | Revert "Adds self time refresh entry and exit helper functions" |
| 518 | |
| 519 | David Kauer (4): |
| 520 | |
| 521 | - `112c8bd6e114 <https://github.com/open-power/hostboot/commit/112c8bd6e114>`__ |
| 522 | Update INT DD2 initfiles |
| 523 | - `e53b287b70c0 <https://github.com/open-power/hostboot/commit/e53b287b70c0>`__ |
| 524 | Added Nimbus & Cumulus attributes for INT initfiles |
| 525 | - `128afcc6737f <https://github.com/open-power/hostboot/commit/128afcc6737f>`__ |
| 526 | HW425038 INT ARX timeout workaround |
| 527 | - `240defa5f9b2 <https://github.com/open-power/hostboot/commit/240defa5f9b2>`__ |
| 528 | Modify INT FIR configuration settings |
| 529 | |
| 530 | Dean Sanner (2): |
| 531 | |
| 532 | - `2414e7c8e5de <https://github.com/open-power/hostboot/commit/2414e7c8e5de>`__ |
| 533 | Support sending chip info to SBEs on multinode |
| 534 | - `d6f9a2206311 <https://github.com/open-power/hostboot/commit/d6f9a2206311>`__ |
| 535 | Force 25G Nvlink speed on P9N DD2.1 |
| 536 | |
| 537 | Elizabeth Liner (3): |
| 538 | |
| 539 | - `8f1ef46890d9 <https://github.com/open-power/hostboot/commit/8f1ef46890d9>`__ |
| 540 | Adding visible error once we know that the SBE is erroring |
| 541 | - `c142eb850380 <https://github.com/open-power/hostboot/commit/c142eb850380>`__ |
| 542 | Adding attribute to detect which processor we can use for alt-memory |
| 543 | - `4761f0cf880a <https://github.com/open-power/hostboot/commit/4761f0cf880a>`__ |
| 544 | Updating HWP's to use PROC\_CHIP\_MEM\_TO\_USE attribute |
| 545 | |
| 546 | Emmanuel Sacristan (1): |
| 547 | |
| 548 | - `7a09b00b1558 <https://github.com/open-power/hostboot/commit/7a09b00b1558>`__ |
| 549 | NMMU Nimbus dd2 scom/scan updates, updated comments |
| 550 | |
| 551 | Greg Still (7): |
| 552 | |
| 553 | - `f9b500d310ee <https://github.com/open-power/hostboot/commit/f9b500d310ee>`__ |
| 554 | PM: GPE timer fix (HW389045 - Update Shadow copy of TSEL) |
| 555 | - `420c26669087 <https://github.com/open-power/hostboot/commit/420c26669087>`__ |
| 556 | PM: refine enablement attributes for advanced functions |
| 557 | (VDM,RESCLK,WOF,IVRM) |
| 558 | - `52074db64a3d <https://github.com/open-power/hostboot/commit/52074db64a3d>`__ |
| 559 | PM: Move to chip EC based #V validity checking in |
| 560 | p9\_pstate\_parameter\_block |
| 561 | - `a2a54161270c <https://github.com/open-power/hostboot/commit/a2a54161270c>`__ |
| 562 | VDM: p9\_pstate\_parameter\_block check for VDM Large threshold < |
| 563 | -32mV |
| 564 | - `cbcd27d3a629 <https://github.com/open-power/hostboot/commit/cbcd27d3a629>`__ |
| 565 | PM: p9\_setup\_evid steps voltage to avoid Fleetwood VRM limitations |
| 566 | - `c3364dfd2650 <https://github.com/open-power/hostboot/commit/c3364dfd2650>`__ |
| 567 | PM: p9\_setup\_evid - deal with attribute clearing during MPIPL |
| 568 | - `9b5cfe7260ef <https://github.com/open-power/hostboot/commit/9b5cfe7260ef>`__ |
| 569 | PM: Enhance p9\_pm\_pss\_init for reset error logging |
| 570 | |
| 571 | Ilya Smirnov (6): |
| 572 | |
| 573 | - `a681d519d4dc <https://github.com/open-power/hostboot/commit/a681d519d4dc>`__ |
| 574 | Pass i\_skipComm to \_buildOccs |
| 575 | - `299023edd66f <https://github.com/open-power/hostboot/commit/299023edd66f>`__ |
| 576 | Reload OCC and HCODE LIDs in OCC Reload Path |
| 577 | - `95c3ddc9290b <https://github.com/open-power/hostboot/commit/95c3ddc9290b>`__ |
| 578 | Insert Debug Data Into hb prime Code Path |
| 579 | - `c82b626e6ea1 <https://github.com/open-power/hostboot/commit/c82b626e6ea1>`__ |
| 580 | Check the Section Headers in Non-Secure Mode |
| 581 | - `ec645465cdae <https://github.com/open-power/hostboot/commit/ec645465cdae>`__ |
| 582 | Flush TMP Daemon Traces Prior to Shutdown |
| 583 | - `713f7f024c45 <https://github.com/open-power/hostboot/commit/713f7f024c45>`__ |
| 584 | Secure Boot: Close SBE Security Backdoor |
| 585 | |
| 586 | Jacob Harvey (3): |
| 587 | |
| 588 | - `052142a41cd0 <https://github.com/open-power/hostboot/commit/052142a41cd0>`__ |
| 589 | Add in RCD attributes for DD2 debug |
| 590 | - `e5ca1ace470e <https://github.com/open-power/hostboot/commit/e5ca1ace470e>`__ |
| 591 | Change RD\_CTR workaround val and update attr name |
| 592 | - `9abf780c9305 <https://github.com/open-power/hostboot/commit/9abf780c9305>`__ |
| 593 | Increment red\_waterfall for low vdn fix |
| 594 | |
| 595 | Jaymes Wilks (4): |
| 596 | |
| 597 | - `8ea7d7ed5db4 <https://github.com/open-power/hostboot/commit/8ea7d7ed5db4>`__ |
| 598 | Change FCO distribution to ensure master chip has at least one core |
| 599 | - `13dd75dd4dc3 <https://github.com/open-power/hostboot/commit/13dd75dd4dc3>`__ |
| 600 | Support TPM in CUMULUS standalone SIMICS boot |
| 601 | - `4f5c0b932724 <https://github.com/open-power/hostboot/commit/4f5c0b932724>`__ |
| 602 | Add TPM to the CUMULUS CDIMM model |
| 603 | - `4eaf644dbf1b <https://github.com/open-power/hostboot/commit/4eaf644dbf1b>`__ |
| 604 | Remove code flows that use non-open signing tools |
| 605 | |
| 606 | Jennifer A. Stofer (1): |
| 607 | |
| 608 | - `7728cc84c782 <https://github.com/open-power/hostboot/commit/7728cc84c782>`__ |
| 609 | Revert "Adding p9a support." |
| 610 | |
| 611 | Jenny Huynh (13): |
| 612 | |
| 613 | - `3d8051b7b2e7 <https://github.com/open-power/hostboot/commit/3d8051b7b2e7>`__ |
| 614 | Reset L3 error status register for next CE/UE capture |
| 615 | - `c27a8bd5fb97 <https://github.com/open-power/hostboot/commit/c27a8bd5fb97>`__ |
| 616 | Adding workaround for HW930007 and HW386013 |
| 617 | - `793f58e194db <https://github.com/open-power/hostboot/commit/793f58e194db>`__ |
| 618 | Adding in defect HW395947,HW930007 to INT initfiles |
| 619 | - `d0d88fcce2d4 <https://github.com/open-power/hostboot/commit/d0d88fcce2d4>`__ |
| 620 | Adding HW363780 to NPU scom initfiles |
| 621 | - `a42eb15a2cc9 <https://github.com/open-power/hostboot/commit/a42eb15a2cc9>`__ |
| 622 | Reducing rng pace rate from 2000 -> 300 for HW403701 |
| 623 | - `4b6b29be4ff5 <https://github.com/open-power/hostboot/commit/4b6b29be4ff5>`__ |
| 624 | HW406130: Reduce dma read requests from 16->8 in NX inits |
| 625 | - `6ec839acf46f <https://github.com/open-power/hostboot/commit/6ec839acf46f>`__ |
| 626 | HW407123: Slow down xlink command rate for Nimbus DD1/2 |
| 627 | - `a1635526313e <https://github.com/open-power/hostboot/commit/a1635526313e>`__ |
| 628 | INT scan initfile change to add workaround for HW408972 |
| 629 | - `e7db59ec919d <https://github.com/open-power/hostboot/commit/e7db59ec919d>`__ |
| 630 | Adding HW401552 to cxa initfile to workaround clockgating bug |
| 631 | - `9b84a7e90001 <https://github.com/open-power/hostboot/commit/9b84a7e90001>`__ |
| 632 | Adding HW414702 workaround to INT scan initfiles |
| 633 | - `ddf01705dda7 <https://github.com/open-power/hostboot/commit/ddf01705dda7>`__ |
| 634 | Workaround for Quaint Gate, Angry Reindeer |
| 635 | - `b79417a6c766 <https://github.com/open-power/hostboot/commit/b79417a6c766>`__ |
| 636 | Updating HW414700 to also apply to Cumulus DD10 |
| 637 | - `a5fb7125def7 <https://github.com/open-power/hostboot/commit/a5fb7125def7>`__ |
| 638 | HW438727 Disable clockgate to allow correct ODL error reporting |
| 639 | |
| 640 | Joachim Fenkes (7): |
| 641 | |
| 642 | - `c0967b7fb152 <https://github.com/open-power/hostboot/commit/c0967b7fb152>`__ |
| 643 | LPC: Add empty files for mirroring to HB, PPE, HWSV |
| 644 | - `1141d3f0a51e <https://github.com/open-power/hostboot/commit/1141d3f0a51e>`__ |
| 645 | FFDC: Add empty new helper procedure for mirroring to HB, HWSV |
| 646 | - `d4ea0e36be37 <https://github.com/open-power/hostboot/commit/d4ea0e36be37>`__ |
| 647 | Add p9\_proc\_gettracearray procedure |
| 648 | - `6f16f1f33d3e <https://github.com/open-power/hostboot/commit/6f16f1f33d3e>`__ |
| 649 | p9\_sbe\_tracearray: Nimbus DD2 updates |
| 650 | - `d61bf78fca7d <https://github.com/open-power/hostboot/commit/d61bf78fca7d>`__ |
| 651 | HW415692: Make workaround permanent |
| 652 | - `efc02485efbd <https://github.com/open-power/hostboot/commit/efc02485efbd>`__ |
| 653 | HDCT: Remove core trace arrays, permanent P9 erratum |
| 654 | - `b8da2d84dff3 <https://github.com/open-power/hostboot/commit/b8da2d84dff3>`__ |
| 655 | p9\_sbe\_lpc\_init: Fix timeout setup |
| 656 | |
| 657 | Joe McGill (43): |
| 658 | |
| 659 | - `90a2c95eb96c <https://github.com/open-power/hostboot/commit/90a2c95eb96c>`__ |
| 660 | p9\_tod\_move\_tod\_to\_tb -- correct TOD state checks |
| 661 | - `4d23f6873114 <https://github.com/open-power/hostboot/commit/4d23f6873114>`__ |
| 662 | p9\_sbe\_tracearray -- satsify PRD calls to manage core trace arrays |
| 663 | - `ac0c8f0e7bdb <https://github.com/open-power/hostboot/commit/ac0c8f0e7bdb>`__ |
| 664 | resolve Zeppelin DMI channel framelock issues |
| 665 | - `c0fce11639f7 <https://github.com/open-power/hostboot/commit/c0fce11639f7>`__ |
| 666 | enforce strict 512 GB per socket limit on Witherspoon memory map |
| 667 | (part2) |
| 668 | - `92f6bd045cb1 <https://github.com/open-power/hostboot/commit/92f6bd045cb1>`__ |
| 669 | HW388878 VCS workaround |
| 670 | - `9c189e8e26a7 <https://github.com/open-power/hostboot/commit/9c189e8e26a7>`__ |
| 671 | p9.fbc.scan.initfile -- create initfile, add workaround for HW376651 |
| 672 | - `5ba30ede4f3a <https://github.com/open-power/hostboot/commit/5ba30ede4f3a>`__ |
| 673 | p9\_psi\_init -- parametrize link speed (half/full) |
| 674 | - `398408a979d7 <https://github.com/open-power/hostboot/commit/398408a979d7>`__ |
| 675 | p9.fbc.scan.initfile -- clock off MCSYNC staging latches |
| 676 | - `12ea45b365cf <https://github.com/open-power/hostboot/commit/12ea45b365cf>`__ |
| 677 | Add MSS customization support from CRP0 Lx MVPD |
| 678 | - `b02210a00b1e <https://github.com/open-power/hostboot/commit/b02210a00b1e>`__ |
| 679 | p9\_getecid -- set PCIE DD1.0x workaround attributes |
| 680 | - `65076c196163 <https://github.com/open-power/hostboot/commit/65076c196163>`__ |
| 681 | add SS PLL settings to support 94 MHz PCI operation |
| 682 | - `a2c5ab1977ee <https://github.com/open-power/hostboot/commit/a2c5ab1977ee>`__ |
| 683 | FBC updates for HW383616, HW384245 |
| 684 | - `ee3924e0c243 <https://github.com/open-power/hostboot/commit/ee3924e0c243>`__ |
| 685 | p9\_sbe\_tp\_chiplet\_init3 -- disable TP TOD hang pulse |
| 686 | - `4bdb5fa7a80f <https://github.com/open-power/hostboot/commit/4bdb5fa7a80f>`__ |
| 687 | p9.core.scan.initfile -- mask local error from CC in EC perv LFIR |
| 688 | - `c526478a6ce3 <https://github.com/open-power/hostboot/commit/c526478a6ce3>`__ |
| 689 | adjust SRAM timings |
| 690 | - `8d707e8c9223 <https://github.com/open-power/hostboot/commit/8d707e8c9223>`__ |
| 691 | update DPLL and IVRM inits |
| 692 | - `d615502799c0 <https://github.com/open-power/hostboot/commit/d615502799c0>`__ |
| 693 | derate NVLINK frequency for Nimbus DD1 |
| 694 | - `40c1bf0cfb1b <https://github.com/open-power/hostboot/commit/40c1bf0cfb1b>`__ |
| 695 | p9.xbus.pll.scan.initfile -- restore full frequency settings for |
| 696 | Nimbus DD2+ |
| 697 | - `8c2cd3174256 <https://github.com/open-power/hostboot/commit/8c2cd3174256>`__ |
| 698 | p9.int.scan.initfile -- init PSIHB to LSI mode |
| 699 | - `527165381939 <https://github.com/open-power/hostboot/commit/527165381939>`__ |
| 700 | L3 updates -- p9\_build\_smp, p9\_fbc\_utils |
| 701 | - `3a26100f62ca <https://github.com/open-power/hostboot/commit/3a26100f62ca>`__ |
| 702 | future proof EC feature attributes, add missing P9N DD2 inits |
| 703 | - `78bf7f9a76b2 <https://github.com/open-power/hostboot/commit/78bf7f9a76b2>`__ |
| 704 | L3 update -- p9\_pcie\_config |
| 705 | - `4831e12ea20e <https://github.com/open-power/hostboot/commit/4831e12ea20e>`__ |
| 706 | p9.core.scan.initfile -- set disable 241 for Nimbus DD2 |
| 707 | - `e4229a61632a <https://github.com/open-power/hostboot/commit/e4229a61632a>`__ |
| 708 | PCIe updates for Nimbus DD2 GEN4 operation |
| 709 | - `ddefc592366e <https://github.com/open-power/hostboot/commit/ddefc592366e>`__ |
| 710 | p9.pci.scan.initfile -- initial release |
| 711 | - `6752509378f2 <https://github.com/open-power/hostboot/commit/6752509378f2>`__ |
| 712 | p9.npu.scom.initfile -- Nimbus DD2 updates |
| 713 | - `02e1726c4962 <https://github.com/open-power/hostboot/commit/02e1726c4962>`__ |
| 714 | TP, Nest FIR updates -- DD2 updates to match RAS XML |
| 715 | - `3ce08029e577 <https://github.com/open-power/hostboot/commit/3ce08029e577>`__ |
| 716 | p9.npu.scom.initfile -- FIR updates to align with RAS XML |
| 717 | documentation |
| 718 | - `7f0a49f50d87 <https://github.com/open-power/hostboot/commit/7f0a49f50d87>`__ |
| 719 | p9.int.scom.initfile -- mask SUE FIR for Nimbus DD2 |
| 720 | - `a0df90732994 <https://github.com/open-power/hostboot/commit/a0df90732994>`__ |
| 721 | resolve Zeppelin DMI channel framelock issues |
| 722 | - `e5e2af0f5eed <https://github.com/open-power/hostboot/commit/e5e2af0f5eed>`__ |
| 723 | updates for NPU errata |
| 724 | - `8e0f3a8ad787 <https://github.com/open-power/hostboot/commit/8e0f3a8ad787>`__ |
| 725 | PLL updates for filter BG, BW including OBUS tank coreqs |
| 726 | - `3d3f11dbddd5 <https://github.com/open-power/hostboot/commit/3d3f11dbddd5>`__ |
| 727 | IO, FBC updates to enable ABUS for Fleetwood |
| 728 | - `75c7fd666460 <https://github.com/open-power/hostboot/commit/75c7fd666460>`__ |
| 729 | p9.filter.pll.scan.intifile -- set 0 BGoffset for P9C DD1.1 |
| 730 | - `f20b37d483c4 <https://github.com/open-power/hostboot/commit/f20b37d483c4>`__ |
| 731 | remove NV iovalid assertion from FW and add scan inits to resolve |
| 732 | glsmux xstate |
| 733 | - `f0d08f111980 <https://github.com/open-power/hostboot/commit/f0d08f111980>`__ |
| 734 | Chip address extension workaround for HW423589 (option2), part1 |
| 735 | - `a94bc7eedf31 <https://github.com/open-power/hostboot/commit/a94bc7eedf31>`__ |
| 736 | disable ECC bypass for Cumulus DD1.0 |
| 737 | - `01a6a43e9020 <https://github.com/open-power/hostboot/commit/01a6a43e9020>`__ |
| 738 | MCD disable workaround for HW423589 (option1) |
| 739 | - `7221c41d5f7f <https://github.com/open-power/hostboot/commit/7221c41d5f7f>`__ |
| 740 | Disable read data delay for Cumulus DD1.0, enable for DD1.1 |
| 741 | - `e07cb2f93ac8 <https://github.com/open-power/hostboot/commit/e07cb2f93ac8>`__ |
| 742 | p9.npu.scom.initfile -- limit DCP0 credits for HW437173 |
| 743 | - `69bd6e497bfd <https://github.com/open-power/hostboot/commit/69bd6e497bfd>`__ |
| 744 | L2 - Fabric updates for multi-chip support |
| 745 | - `225f4090804f <https://github.com/open-power/hostboot/commit/225f4090804f>`__ |
| 746 | update HWP level metadata for nest, common files |
| 747 | - `5139c57aa414 <https://github.com/open-power/hostboot/commit/5139c57aa414>`__ |
| 748 | create shells for IO OBUS pre, post training HWPs |
| 749 | |
| 750 | John Rell (4): |
| 751 | |
| 752 | - `366a4efdf50b <https://github.com/open-power/hostboot/commit/366a4efdf50b>`__ |
| 753 | jgr18022000 Fix for typo in changes for HW430958 |
| 754 | - `d12852b6fa1a <https://github.com/open-power/hostboot/commit/d12852b6fa1a>`__ |
| 755 | jgr17050500 Added Centaur and DMI IO SCOM initfiles |
| 756 | - `55e4a228b65f <https://github.com/open-power/hostboot/commit/55e4a228b65f>`__ |
| 757 | jgr17082300 Setting changes for HW41801 HW419305 |
| 758 | - `9af3fc295e1e <https://github.com/open-power/hostboot/commit/9af3fc295e1e>`__ |
| 759 | jgr171017 Setting changes for Obus boardwire vs cable |
| 760 | |
| 761 | Joshua Hannan (1): |
| 762 | |
| 763 | - `4c9b0d832610 <https://github.com/open-power/hostboot/commit/4c9b0d832610>`__ |
| 764 | adding insert for soft fail threshold for dd1 and dd2 |
| 765 | |
| 766 | Juan Medina (2): |
| 767 | |
| 768 | - `727e9397fd73 <https://github.com/open-power/hostboot/commit/727e9397fd73>`__ |
| 769 | reverting FIRs to master values, setting only bit 8 |
| 770 | - `ca235d62a2fe <https://github.com/open-power/hostboot/commit/ca235d62a2fe>`__ |
| 771 | Scrubbing needs to stay off for DD2, bug HW405443 |
| 772 | |
| 773 | Lennard Streat (6): |
| 774 | |
| 775 | - `d3593cc766ca <https://github.com/open-power/hostboot/commit/d3593cc766ca>`__ |
| 776 | Temporary workaround for HW412197 |
| 777 | - `75823b14fb47 <https://github.com/open-power/hostboot/commit/75823b14fb47>`__ |
| 778 | HW439321 - Trusty Birthday Alternative Workaround |
| 779 | - `968b1746f9e7 <https://github.com/open-power/hostboot/commit/968b1746f9e7>`__ |
| 780 | HW439321 - Disable CRC Performance Degradation |
| 781 | - `77309f6630fa <https://github.com/open-power/hostboot/commit/77309f6630fa>`__ |
| 782 | Expanding MCU tag fifo settings to be freq dependent. |
| 783 | - `3d12277f2397 <https://github.com/open-power/hostboot/commit/3d12277f2397>`__ |
| 784 | Workaround for Warlike Parasite (HW430546) |
| 785 | - `f24037b86d27 <https://github.com/open-power/hostboot/commit/f24037b86d27>`__ |
| 786 | Protect Firmware from exposure to HW423533 |
| 787 | |
| 788 | Louis Stermole (4): |
| 789 | |
| 790 | - `9900129f86ae <https://github.com/open-power/hostboot/commit/9900129f86ae>`__ |
| 791 | Fix command gap calculation for MSS scrub to prevent truncation |
| 792 | - `d64041888fed <https://github.com/open-power/hostboot/commit/d64041888fed>`__ |
| 793 | Add callout for when the DIMM to NEST freq ratio exceeds 1.5 |
| 794 | - `e4ed25ed886c <https://github.com/open-power/hostboot/commit/e4ed25ed886c>`__ |
| 795 | Add workaround for DDRPHY ODT config register erratum (ODT2, ODT3 |
| 796 | bits swapped) |
| 797 | - `46b6c6815aa0 <https://github.com/open-power/hostboot/commit/46b6c6815aa0>`__ |
| 798 | Add empty p9c delayRegs.H for hostboot |
| 799 | |
| 800 | Luke C. Murray (7): |
| 801 | |
| 802 | - `908eda4b3845 <https://github.com/open-power/hostboot/commit/908eda4b3845>`__ |
| 803 | Disabling LVext for all P9 parts |
| 804 | - `2921d0d9066c <https://github.com/open-power/hostboot/commit/2921d0d9066c>`__ |
| 805 | HW414700 checkstop on UEs and disable core ECC counter |
| 806 | - `15d21760fbaa <https://github.com/open-power/hostboot/commit/15d21760fbaa>`__ |
| 807 | Workaround for HW421347 Scandalous Pie |
| 808 | - `b5b8ae989e51 <https://github.com/open-power/hostboot/commit/b5b8ae989e51>`__ |
| 809 | Updating L2 re-request jitter settings for Cumulus |
| 810 | - `1b1226daa961 <https://github.com/open-power/hostboot/commit/1b1226daa961>`__ |
| 811 | Turning on NCU tlbie pacing by default |
| 812 | - `fb21d847fbea <https://github.com/open-power/hostboot/commit/fb21d847fbea>`__ |
| 813 | Adding attribute to turn memory early data on |
| 814 | - `f5759559a60d <https://github.com/open-power/hostboot/commit/f5759559a60d>`__ |
| 815 | Enabling L2 64B store prediction |
| 816 | |
| 817 | Luke Murray (8): |
| 818 | |
| 819 | - `0964a5b2fd09 <https://github.com/open-power/hostboot/commit/0964a5b2fd09>`__ |
| 820 | Adding skip group dials for cache when chip=group |
| 821 | - `f5bc1a24f10a <https://github.com/open-power/hostboot/commit/f5bc1a24f10a>`__ |
| 822 | Updating P9 L2 scan initfile to use attributes |
| 823 | - `7d0c68704298 <https://github.com/open-power/hostboot/commit/7d0c68704298>`__ |
| 824 | Adding good LCO settings to initfile |
| 825 | - `54067398177d <https://github.com/open-power/hostboot/commit/54067398177d>`__ |
| 826 | Updating L3 LCO watermarks for HW406803 |
| 827 | - `0c1a9c38bba5 <https://github.com/open-power/hostboot/commit/0c1a9c38bba5>`__ |
| 828 | Updating optimal larx/stcx dials for performance |
| 829 | - `2e3a8e66a7f7 <https://github.com/open-power/hostboot/commit/2e3a8e66a7f7>`__ |
| 830 | Disable cp\_me from the L3 for Nimbus DD1 and DD2.0. |
| 831 | - `f44af3ce268c <https://github.com/open-power/hostboot/commit/f44af3ce268c>`__ |
| 832 | Updating HW363605 workaround to be applied to all chips |
| 833 | - `340b1d5748c8 <https://github.com/open-power/hostboot/commit/340b1d5748c8>`__ |
| 834 | Performance updates for HW409069 |
| 835 | |
| 836 | Markus Dobler (1): |
| 837 | |
| 838 | - `ce033a30cb69 <https://github.com/open-power/hostboot/commit/ce033a30cb69>`__ |
| 839 | p9\_abist: Support for p9ndd2 |
| 840 | |
| 841 | Marty Gloff (5): |
| 842 | |
| 843 | - `d01ca15eccee <https://github.com/open-power/hostboot/commit/d01ca15eccee>`__ |
| 844 | Support multiple nodes in HBRT - Add Node Container |
| 845 | - `40c3350ff928 <https://github.com/open-power/hostboot/commit/40c3350ff928>`__ |
| 846 | Support multiple nodes in HBRT - Support Multiple Nodes in |
| 847 | TargetService |
| 848 | - `27755fae1059 <https://github.com/open-power/hostboot/commit/27755fae1059>`__ |
| 849 | Support multiple nodes in HBRT - Attribute Overrides |
| 850 | - `5fc3b529c692 <https://github.com/open-power/hostboot/commit/5fc3b529c692>`__ |
| 851 | Support multiple nodes in HBRT - VPD Image |
| 852 | - `bca54fb07d0e <https://github.com/open-power/hostboot/commit/bca54fb07d0e>`__ |
| 853 | Support multiple nodes in HBRT - Sync System Attribute Data |
| 854 | |
| 855 | Matt Derksen (10): |
| 856 | |
| 857 | - `80819cf5302b <https://github.com/open-power/hostboot/commit/80819cf5302b>`__ |
| 858 | Fix rollover of PLID numbers |
| 859 | - `d6d402588868 <https://github.com/open-power/hostboot/commit/d6d402588868>`__ |
| 860 | Cleanup hbrt msg code to be easier to understand and update |
| 861 | - `3b5f10fdf6a7 <https://github.com/open-power/hostboot/commit/3b5f10fdf6a7>`__ |
| 862 | Include WOF power mode explicitly inside tables |
| 863 | - `b31ac249651c <https://github.com/open-power/hostboot/commit/b31ac249651c>`__ |
| 864 | Trace cleanup: do not look for parent chip on non-parent chip targets |
| 865 | - `843b9e02e55d <https://github.com/open-power/hostboot/commit/843b9e02e55d>`__ |
| 866 | Initialize FIRDATA section and ErrlManager just incase BMC resets |
| 867 | - `647eb6eae52c <https://github.com/open-power/hostboot/commit/647eb6eae52c>`__ |
| 868 | Only call PNOR::init() on systems with BMC |
| 869 | - `75c7aea07bcb <https://github.com/open-power/hostboot/commit/75c7aea07bcb>`__ |
| 870 | Fix setting plid to the lastest one available at hbrt start |
| 871 | - `8692b24a1ec0 <https://github.com/open-power/hostboot/commit/8692b24a1ec0>`__ |
| 872 | Include WOF power mode explicitly inside tables |
| 873 | - `6eaa4575c95a <https://github.com/open-power/hostboot/commit/6eaa4575c95a>`__ |
| 874 | Handle new version of WOF tables that includes power mode |
| 875 | - `284cebd97cf0 <https://github.com/open-power/hostboot/commit/284cebd97cf0>`__ |
| 876 | Change deconfig rules to allow for Zeppelin proc config |
| 877 | |
| 878 | Matt K. Light (1): |
| 879 | |
| 880 | - `288ca88910b6 <https://github.com/open-power/hostboot/commit/288ca88910b6>`__ |
| 881 | adding fapi2::putSpyWithCare() |
| 882 | |
| 883 | Matthew Hickman (4): |
| 884 | |
| 885 | - `1b11547e01a8 <https://github.com/open-power/hostboot/commit/1b11547e01a8>`__ |
| 886 | Fixed Maint IUE unmasked with mnfg flags |
| 887 | - `f6b7234d960a <https://github.com/open-power/hostboot/commit/f6b7234d960a>`__ |
| 888 | Fixed port fail SUE bug for DD2 modules |
| 889 | - `48d464158bc3 <https://github.com/open-power/hostboot/commit/48d464158bc3>`__ |
| 890 | Fixed MNFG Attribute handing for TCE Corrections |
| 891 | - `90ef1f6dbd59 <https://github.com/open-power/hostboot/commit/90ef1f6dbd59>`__ |
| 892 | Fixed unmasking of BRODCAST\_OUT\_OF\_SYNC fir after memdiags |
| 893 | handling |
| 894 | |
| 895 | Michael Koch (1): |
| 896 | |
| 897 | - `8b34665d2794 <https://github.com/open-power/hostboot/commit/8b34665d2794>`__ |
| 898 | Implementing Michael Floyds improvements. |
| 899 | |
| 900 | Mike Baiocchi (5): |
| 901 | |
| 902 | - `eeadfb7bf985 <https://github.com/open-power/hostboot/commit/eeadfb7bf985>`__ |
| 903 | Add Reset to TPM's I2C Bus for MPIPLs |
| 904 | - `234ef44536ae <https://github.com/open-power/hostboot/commit/234ef44536ae>`__ |
| 905 | Add FFDC to 'No Functional TPM' Fails |
| 906 | - `fe61cf0701e0 <https://github.com/open-power/hostboot/commit/fe61cf0701e0>`__ |
| 907 | Setup Node-Level Attributes for Multinode TCE Support |
| 908 | - `95c1dd78c27a <https://github.com/open-power/hostboot/commit/95c1dd78c27a>`__ |
| 909 | Close and Disable TCEs on Non-Master Nodes |
| 910 | - `55f0053bc34e <https://github.com/open-power/hostboot/commit/55f0053bc34e>`__ |
| 911 | Reset Host-mode Processor I2C Masters connected to the TPMs |
| 912 | |
| 913 | Nicholas E. Bofferding (1): |
| 914 | |
| 915 | - `a7decd2eeff5 <https://github.com/open-power/hostboot/commit/a7decd2eeff5>`__ |
| 916 | Revert "Check the Section Headers in Non-Secure Mode" |
| 917 | |
| 918 | Nick Bofferding (9): |
| 919 | |
| 920 | - `55e51a61f985 <https://github.com/open-power/hostboot/commit/55e51a61f985>`__ |
| 921 | Delayed deconfig any DIMM on a failing voltage domain |
| 922 | - `afc4bd08c5bf <https://github.com/open-power/hostboot/commit/afc4bd08c5bf>`__ |
| 923 | Documentation: Stop withholding various SRCs from pubs |
| 924 | - `24bc6a1bee51 <https://github.com/open-power/hostboot/commit/24bc6a1bee51>`__ |
| 925 | Secure Boot: On get jumper state error path, save PLID before |
| 926 | committing |
| 927 | - `a8b0039d4e3a <https://github.com/open-power/hostboot/commit/a8b0039d4e3a>`__ |
| 928 | Clear FCO deconfigures before applying gard records |
| 929 | - `bd1cd3c7d1fb <https://github.com/open-power/hostboot/commit/bd1cd3c7d1fb>`__ |
| 930 | Secure Boot: Detach secure PNOR provider task |
| 931 | - `0b02cc8314be <https://github.com/open-power/hostboot/commit/0b02cc8314be>`__ |
| 932 | Secure Boot: Check integrity of dynamically sized secure header |
| 933 | copies |
| 934 | - `24929fd8ab96 <https://github.com/open-power/hostboot/commit/24929fd8ab96>`__ |
| 935 | Secure Boot: Dynamically set TPM I2C master path in MRW parser |
| 936 | - `aa5d9565d0d1 <https://github.com/open-power/hostboot/commit/aa5d9565d0d1>`__ |
| 937 | Secure Boot: Mark redundant TPM not present until SMP is enabled |
| 938 | - `5660e6b0e4a2 <https://github.com/open-power/hostboot/commit/5660e6b0e4a2>`__ |
| 939 | Secure Boot: Populate master node TPM info in HDAT until multinode |
| 940 | supported |
| 941 | |
| 942 | Nick Klazynski (36): |
| 943 | |
| 944 | - `07fd08d22744 <https://github.com/open-power/hostboot/commit/07fd08d22744>`__ |
| 945 | Add Cumulus DD1.1 inits |
| 946 | - `36573c1d29c9 <https://github.com/open-power/hostboot/commit/36573c1d29c9>`__ |
| 947 | Enable risklevel2, match v44 of security wiki |
| 948 | - `d78c726ee7c2 <https://github.com/open-power/hostboot/commit/d78c726ee7c2>`__ |
| 949 | workarounds for HW399919 HW400898 HW398269 HW398269 HW399765 |
| 950 | - `9388b61a676d <https://github.com/open-power/hostboot/commit/9388b61a676d>`__ |
| 951 | WAs for HW401811 HW402145 HW403465; DIS\_MULTIPLE\_TBLW on all modes |
| 952 | - `fc03d06f35ac <https://github.com/open-power/hostboot/commit/fc03d06f35ac>`__ |
| 953 | Add three WATs, remove IMC2, replace stop2 workaround |
| 954 | - `633abb448897 <https://github.com/open-power/hostboot/commit/633abb448897>`__ |
| 955 | Add risklevel for HW399624 due to perf penalty; Add HW405851 |
| 956 | - `5db603045222 <https://github.com/open-power/hostboot/commit/5db603045222>`__ |
| 957 | Update core inits for DD2 |
| 958 | - `6914d4009233 <https://github.com/open-power/hostboot/commit/6914d4009233>`__ |
| 959 | Add core workaround for HW407136 |
| 960 | - `0fd907828b92 <https://github.com/open-power/hostboot/commit/0fd907828b92>`__ |
| 961 | Workarounds for HW407385 HW408629 HW410389 HW408901 |
| 962 | - `1a54f8f27c08 <https://github.com/open-power/hostboot/commit/1a54f8f27c08>`__ |
| 963 | Add WAs for HW413799 HW413853 HW413917 HW414249 HW414375 HW414871 |
| 964 | HW414829 |
| 965 | - `c4b31c72c8c9 <https://github.com/open-power/hostboot/commit/c4b31c72c8c9>`__ |
| 966 | Add Workarounds for HW415114 HW415013 HW413853 HW414384 |
| 967 | - `ffbc1b8d89b0 <https://github.com/open-power/hostboot/commit/ffbc1b8d89b0>`__ |
| 968 | Add WA for HW415236 |
| 969 | - `7627769e5c9f <https://github.com/open-power/hostboot/commit/7627769e5c9f>`__ |
| 970 | Add WA for HW415988 |
| 971 | - `b69116dcd8d6 <https://github.com/open-power/hostboot/commit/b69116dcd8d6>`__ |
| 972 | Add additional dials to risklevel |
| 973 | - `8d360860742b <https://github.com/open-power/hostboot/commit/8d360860742b>`__ |
| 974 | Update core initfiles for Cumulus DD1.0 |
| 975 | - `fe20d009372f <https://github.com/open-power/hostboot/commit/fe20d009372f>`__ |
| 976 | Reverting chickenswitches for issues fixed in Cumulus DD1.0 |
| 977 | - `efda1e06c616 <https://github.com/open-power/hostboot/commit/efda1e06c616>`__ |
| 978 | Mistakenly pulled workaround for HW410212 - readd for CDD1.0 |
| 979 | - `f6df718a76fb <https://github.com/open-power/hostboot/commit/f6df718a76fb>`__ |
| 980 | Add perf inits: HW418850,HW418789; Add clockgate issue HW418738 |
| 981 | - `3883490ddec9 <https://github.com/open-power/hostboot/commit/3883490ddec9>`__ |
| 982 | Add updates for NDD2.1, Serialize TB, Perf workarounds |
| 983 | - `14f465d741f8 <https://github.com/open-power/hostboot/commit/14f465d741f8>`__ |
| 984 | HW415528 and HW419742 |
| 985 | - `78801d7a4ae7 <https://github.com/open-power/hostboot/commit/78801d7a4ae7>`__ |
| 986 | Core workarounds for multiple issues. |
| 987 | - `647eee8c1825 <https://github.com/open-power/hostboot/commit/647eee8c1825>`__ |
| 988 | Add workarounds for HW421426 and HW422629, Swap IMCs around |
| 989 | - `3df6589cb9fb <https://github.com/open-power/hostboot/commit/3df6589cb9fb>`__ |
| 990 | HW415883 applies to NDD2.1, Add JellyVector WAT, add HW422495, add |
| 991 | HW421831 |
| 992 | - `90a3867252a8 <https://github.com/open-power/hostboot/commit/90a3867252a8>`__ |
| 993 | Add HW425526 and HW425027 |
| 994 | - `0e5d5b750aba <https://github.com/open-power/hostboot/commit/0e5d5b750aba>`__ |
| 995 | HW403465 applies to all chips; Revert NDD2.1 RL; add SW406970 |
| 996 | - `4c248c90a305 <https://github.com/open-power/hostboot/commit/4c248c90a305>`__ |
| 997 | Nimbus DD2.2 core chickenswitches |
| 998 | - `a55bc817001f <https://github.com/open-power/hostboot/commit/a55bc817001f>`__ |
| 999 | Large update for security |
| 1000 | - `db5f940f71b4 <https://github.com/open-power/hostboot/commit/db5f940f71b4>`__ |
| 1001 | Fix three NDD2.1 dials and add new NDD2.2 workarounds |
| 1002 | - `9deb5fc4a4f7 <https://github.com/open-power/hostboot/commit/9deb5fc4a4f7>`__ |
| 1003 | Add new TM IMC, Add TLBIE hangbuster |
| 1004 | - `2cdaf3a7743f <https://github.com/open-power/hostboot/commit/2cdaf3a7743f>`__ |
| 1005 | Implement security IMCs, based on v29 of wiki |
| 1006 | - `029552241239 <https://github.com/open-power/hostboot/commit/029552241239>`__ |
| 1007 | Two LTPTR workarounds, remove LTPTR serialization, Fix TB IMC |
| 1008 | - `3a66a14710fe <https://github.com/open-power/hostboot/commit/3a66a14710fe>`__ |
| 1009 | Enable mixed core xlate; Enable xlate protection feature; Disable LSU |
| 1010 | clockgate |
| 1011 | - `0bb20d099e65 <https://github.com/open-power/hostboot/commit/0bb20d099e65>`__ |
| 1012 | Add TM WAT workaround; NDD2.2 and CDD1.1 only |
| 1013 | - `368e3ac318fa <https://github.com/open-power/hostboot/commit/368e3ac318fa>`__ |
| 1014 | Add Cumulus DD1.1 inits |
| 1015 | - `2c08db3b8536 <https://github.com/open-power/hostboot/commit/2c08db3b8536>`__ |
| 1016 | Enable risklevel2, match v44 of security wiki |
| 1017 | - `d08fdc0ee514 <https://github.com/open-power/hostboot/commit/d08fdc0ee514>`__ |
| 1018 | Remove CDD1.1 security IMC; Apply indirect branch serialization to |
| 1019 | HV=0 only |
| 1020 | |
| 1021 | Prachi Gupta (9): |
| 1022 | |
| 1023 | - `5c78bbd873e9 <https://github.com/open-power/hostboot/commit/5c78bbd873e9>`__ |
| 1024 | checkHbResMemLimit -- change to check correctly on multi-node |
| 1025 | - `33725d24db91 <https://github.com/open-power/hostboot/commit/33725d24db91>`__ |
| 1026 | hbfw makefile changes to add p9c dd1.1 sbe to pnor |
| 1027 | - `5ca1d497141a <https://github.com/open-power/hostboot/commit/5ca1d497141a>`__ |
| 1028 | changes to move configureHbrt target type to IPC path to run on slave |
| 1029 | nodes |
| 1030 | - `fdbf7156982e <https://github.com/open-power/hostboot/commit/fdbf7156982e>`__ |
| 1031 | HBRT: Fix targeting to work on multi-node |
| 1032 | - `b98f4c6b59fa <https://github.com/open-power/hostboot/commit/b98f4c6b59fa>`__ |
| 1033 | ATTR\_PBAX\_GROUPID: add global tag |
| 1034 | - `54cc57dd329e <https://github.com/open-power/hostboot/commit/54cc57dd329e>`__ |
| 1035 | add global tag to EI\_BUS\_TX\_MSBSWAP for serverwiz2 consumption |
| 1036 | - `7ce93122ca1e <https://github.com/open-power/hostboot/commit/7ce93122ca1e>`__ |
| 1037 | ATTR\_CEN\_VPD\_DRAM\_ADDRESS\_MIRRORING: Remove writable tag |
| 1038 | - `3f639460a8f1 <https://github.com/open-power/hostboot/commit/3f639460a8f1>`__ |
| 1039 | ATTR\_CEN\_VPD\_DRAM\_ADDRESS\_MIRRORING: add function backed to this |
| 1040 | attribute |
| 1041 | - `94408620cf26 <https://github.com/open-power/hostboot/commit/94408620cf26>`__ |
| 1042 | attrrp\_rt.C: translateAddr returns input address by default |
| 1043 | |
| 1044 | Prasad Bg Ranganath (5): |
| 1045 | |
| 1046 | - `0d7e62667706 <https://github.com/open-power/hostboot/commit/0d7e62667706>`__ |
| 1047 | PM: Fix Global Parameter Block and PGPE size checks in |
| 1048 | p9\_hcode\_image\_build |
| 1049 | - `e80082e3a96a <https://github.com/open-power/hostboot/commit/e80082e3a96a>`__ |
| 1050 | SBE:Putring: Added more debug information |
| 1051 | - `e86fa9f6d5a9 <https://github.com/open-power/hostboot/commit/e86fa9f6d5a9>`__ |
| 1052 | PSTATE\_PARAMETER\_BLOCK structure alignment and error handling |
| 1053 | - `3bb61aa58087 <https://github.com/open-power/hostboot/commit/3bb61aa58087>`__ |
| 1054 | Zepplin:Remove dd level check for cumulus under PPB code |
| 1055 | - `ec53527cf636 <https://github.com/open-power/hostboot/commit/ec53527cf636>`__ |
| 1056 | PPB: Update occ min frequency with real driven value |
| 1057 | |
| 1058 | Prem Shanker Jha (1): |
| 1059 | |
| 1060 | - `2e0c75fb9d8c <https://github.com/open-power/hostboot/commit/2e0c75fb9d8c>`__ |
| 1061 | PM: Added support for HWP p9\_pm\_callout. |
| 1062 | |
| 1063 | Raja Das (1): |
| 1064 | |
| 1065 | - `338fce09ddad <https://github.com/open-power/hostboot/commit/338fce09ddad>`__ |
| 1066 | Workaround to fix issue where Powerbus loses track of EQs in DD1 |
| 1067 | |
| 1068 | Ricardo Mata (1): |
| 1069 | |
| 1070 | - `b5986b2c0d1a <https://github.com/open-power/hostboot/commit/b5986b2c0d1a>`__ |
| 1071 | Added CI throttling support, HW init updates, and fixed a bug with |
| 1072 | tce arb. |
| 1073 | |
| 1074 | Richard J. Knight (6): |
| 1075 | |
| 1076 | - `221f05613499 <https://github.com/open-power/hostboot/commit/221f05613499>`__ |
| 1077 | Introduce new shared library for image processing fucntions |
| 1078 | - `48235812776d <https://github.com/open-power/hostboot/commit/48235812776d>`__ |
| 1079 | SW414905: Mcs, Mba and L4 targets are not displayed in gard --gc mem |
| 1080 | output |
| 1081 | - `b456c82ad820 <https://github.com/open-power/hostboot/commit/b456c82ad820>`__ |
| 1082 | Modify putrRing code to pull rings from centaur hw image |
| 1083 | - `967e9a084bbe <https://github.com/open-power/hostboot/commit/967e9a084bbe>`__ |
| 1084 | Wait for responses from all nodes for IPC\_POPULATE\_ATTRIBUTES msg |
| 1085 | - `d72d87900b44 <https://github.com/open-power/hostboot/commit/d72d87900b44>`__ |
| 1086 | Procedure crashes when trying to query an EC feature |
| 1087 | - `eea4b09a3e85 <https://github.com/open-power/hostboot/commit/eea4b09a3e85>`__ |
| 1088 | Fix missing set\_XX method for sbeTarget callout |
| 1089 | |
| 1090 | Rick Ward (1): |
| 1091 | |
| 1092 | - `a48f950445f1 <https://github.com/open-power/hostboot/commit/a48f950445f1>`__ |
| 1093 | Dump collection should only be run on the master node and skipped on |
| 1094 | slaves. |
| 1095 | |
| 1096 | Roland Veloz (4): |
| 1097 | |
| 1098 | - `b6e41fc3329e <https://github.com/open-power/hostboot/commit/b6e41fc3329e>`__ |
| 1099 | Force an SBE update upon boot failure as well as break out common |
| 1100 | data |
| 1101 | - `0dbb06308565 <https://github.com/open-power/hostboot/commit/0dbb06308565>`__ |
| 1102 | Fixed both NIMBUS and CUMULUS. They are now making the call to |
| 1103 | mss\_thermal\_init |
| 1104 | - `5a9355062b71 <https://github.com/open-power/hostboot/commit/5a9355062b71>`__ |
| 1105 | Created individual update flags for both SEEPROM 0 and SEEPROM 1 |
| 1106 | - `3d7aee811e82 <https://github.com/open-power/hostboot/commit/3d7aee811e82>`__ |
| 1107 | Inform OPAL of the state of the SBE after an attempt to restart |
| 1108 | |
| 1109 | Ryan Black (3): |
| 1110 | |
| 1111 | - `63c767d5679c <https://github.com/open-power/hostboot/commit/63c767d5679c>`__ |
| 1112 | reduce number of non-zero npu error collection registers |
| 1113 | - `1b4fa572716e <https://github.com/open-power/hostboot/commit/1b4fa572716e>`__ |
| 1114 | NPU scan/scom init updates |
| 1115 | - `17165d955d01 <https://github.com/open-power/hostboot/commit/17165d955d01>`__ |
| 1116 | p9.npu.scom.initfile -- fix cq\_sm allocation issue at low water mark |
| 1117 | |
| 1118 | Sachin Gupta (2): |
| 1119 | |
| 1120 | - `899054484ef2 <https://github.com/open-power/hostboot/commit/899054484ef2>`__ |
| 1121 | Support cumulus 1.1 getPllBucket |
| 1122 | - `4340a6da7949 <https://github.com/open-power/hostboot/commit/4340a6da7949>`__ |
| 1123 | Remove workaround for DD1 SW reset for XIVE |
| 1124 | |
| 1125 | Sameer Veer (4): |
| 1126 | |
| 1127 | - `25e991e8b352 <https://github.com/open-power/hostboot/commit/25e991e8b352>`__ |
| 1128 | New functions added for automating mustfix releases |
| 1129 | - `2ae2bffe88b5 <https://github.com/open-power/hostboot/commit/2ae2bffe88b5>`__ |
| 1130 | Added cmvcCheckinForceFlag to break links for new releases |
| 1131 | - `9ef8d33eaeb4 <https://github.com/open-power/hostboot/commit/9ef8d33eaeb4>`__ |
| 1132 | Integrate track before fsp-CI run triggers |
| 1133 | - `0bd003abad5f <https://github.com/open-power/hostboot/commit/0bd003abad5f>`__ |
| 1134 | Code cleanup - removed test-code not required in prod |
| 1135 | |
| 1136 | Shelton Leung (9): |
| 1137 | |
| 1138 | - `44bd1c4678da <https://github.com/open-power/hostboot/commit/44bd1c4678da>`__ |
| 1139 | scan inits for lab workaround for DI bug HW392781 |
| 1140 | - `be9b22ecd3fc <https://github.com/open-power/hostboot/commit/be9b22ecd3fc>`__ |
| 1141 | dd1 workaround for hw400075 coherency error |
| 1142 | - `c40f090b3c4e <https://github.com/open-power/hostboot/commit/c40f090b3c4e>`__ |
| 1143 | workaround for hw400932 atag corruptin in presp |
| 1144 | - `c3869410785b <https://github.com/open-power/hostboot/commit/c3869410785b>`__ |
| 1145 | amo cache disabled for dd1 for HW401780 |
| 1146 | - `bce1c27699b3 <https://github.com/open-power/hostboot/commit/bce1c27699b3>`__ |
| 1147 | enable prefetch drop for better MC fairness |
| 1148 | - `2aad82e12497 <https://github.com/open-power/hostboot/commit/2aad82e12497>`__ |
| 1149 | disable noise window for DD1 HW406577 |
| 1150 | - `ad8cf02d85d0 <https://github.com/open-power/hostboot/commit/ad8cf02d85d0>`__ |
| 1151 | dd2 inits |
| 1152 | - `e3f6f99840e4 <https://github.com/open-power/hostboot/commit/e3f6f99840e4>`__ |
| 1153 | adjusted mem 2400 nest 1600 workaround and make dd1 only |
| 1154 | - `125f42a04372 <https://github.com/open-power/hostboot/commit/125f42a04372>`__ |
| 1155 | dd2 phy scom inits |
| 1156 | |
| 1157 | Soma BhanuTej (8): |
| 1158 | |
| 1159 | - `a41ddc53f979 <https://github.com/open-power/hostboot/commit/a41ddc53f979>`__ |
| 1160 | Axone support to TP stopclocks |
| 1161 | - `91d24ca4cc09 <https://github.com/open-power/hostboot/commit/91d24ca4cc09>`__ |
| 1162 | Change chip to unsecure always for DD1 chips |
| 1163 | - `ed093a87011d <https://github.com/open-power/hostboot/commit/ed093a87011d>`__ |
| 1164 | Security control override disable support - p9\_setup\_sbe\_config |
| 1165 | - `8f803dfea438 <https://github.com/open-power/hostboot/commit/8f803dfea438>`__ |
| 1166 | Cumulus initfile update for OBUS & XBUS PLLs |
| 1167 | - `c586a6b41c0f <https://github.com/open-power/hostboot/commit/c586a6b41c0f>`__ |
| 1168 | Additional checks to p9\_extract\_sbe\_rc |
| 1169 | - `00c3e73d16ee <https://github.com/open-power/hostboot/commit/00c3e73d16ee>`__ |
| 1170 | Axone support to TP stopclocks |
| 1171 | - `c09c372348bd <https://github.com/open-power/hostboot/commit/c09c372348bd>`__ |
| 1172 | Change TP FIR bits 38, 39, 40 as recoverable & Masked |
| 1173 | - `c4bd7604071f <https://github.com/open-power/hostboot/commit/c4bd7604071f>`__ |
| 1174 | Mask off bit 26 of TP\_LFIR on FSP machines |
| 1175 | |
| 1176 | Stephen Glancy (18): |
| 1177 | |
| 1178 | - `000f358355b2 <https://github.com/open-power/hostboot/commit/000f358355b2>`__ |
| 1179 | Updates broadcast mode attributes |
| 1180 | - `2674db2b85b4 <https://github.com/open-power/hostboot/commit/2674db2b85b4>`__ |
| 1181 | Adds blank NVDIMM utility files for HB to mirror |
| 1182 | - `b5c57afe40a8 <https://github.com/open-power/hostboot/commit/b5c57afe40a8>`__ |
| 1183 | Fixes tDLLK timing for 2666 |
| 1184 | - `c03b84b93467 <https://github.com/open-power/hostboot/commit/c03b84b93467>`__ |
| 1185 | Fixes broadcast mode address check for deconfigured ports |
| 1186 | - `719c8a64fb72 <https://github.com/open-power/hostboot/commit/719c8a64fb72>`__ |
| 1187 | Adds DDR4 hybrid NV-RDIMM support |
| 1188 | - `7b475151599d <https://github.com/open-power/hostboot/commit/7b475151599d>`__ |
| 1189 | Removes overrideonly in a broadcast mode MRW attribute |
| 1190 | - `a61200c516f7 <https://github.com/open-power/hostboot/commit/a61200c516f7>`__ |
| 1191 | Adds power control access functions for NVDIMM |
| 1192 | - `5e42a73c3de9 <https://github.com/open-power/hostboot/commit/5e42a73c3de9>`__ |
| 1193 | Added periodic cal fix - fixes bad delays |
| 1194 | - `ad869ece5cae <https://github.com/open-power/hostboot/commit/ad869ece5cae>`__ |
| 1195 | Updates to run HW VREF cal by default |
| 1196 | - `556caf56c9ec <https://github.com/open-power/hostboot/commit/556caf56c9ec>`__ |
| 1197 | Added read ctr bad delay workaround |
| 1198 | - `4e9ff980c520 <https://github.com/open-power/hostboot/commit/4e9ff980c520>`__ |
| 1199 | Added DQS alignment workaround |
| 1200 | - `ad43d96deda9 <https://github.com/open-power/hostboot/commit/ad43d96deda9>`__ |
| 1201 | Adds DCD calibration control attributes |
| 1202 | - `4b9d8a1bd726 <https://github.com/open-power/hostboot/commit/4b9d8a1bd726>`__ |
| 1203 | Updated memory DD1 vs DD2 attribute |
| 1204 | - `edca64c2b22b <https://github.com/open-power/hostboot/commit/edca64c2b22b>`__ |
| 1205 | Fixed DLL workarounds to always run |
| 1206 | - `b1e597ec9bdb <https://github.com/open-power/hostboot/commit/b1e597ec9bdb>`__ |
| 1207 | Adds blank files for centaur secure mode boot |
| 1208 | - `013207df79b3 <https://github.com/open-power/hostboot/commit/013207df79b3>`__ |
| 1209 | Updates p9c SPD read to include DDR3 |
| 1210 | - `43904dc3b8a4 <https://github.com/open-power/hostboot/commit/43904dc3b8a4>`__ |
| 1211 | Adds dynamic voltage blank files for HB |
| 1212 | - `218a4862f0d0 <https://github.com/open-power/hostboot/commit/218a4862f0d0>`__ |
| 1213 | Adds secure mode boot for memory buffer chips |
| 1214 | |
| 1215 | Steven Janssen (1): |
| 1216 | |
| 1217 | - `6d57e7720db9 <https://github.com/open-power/hostboot/commit/6d57e7720db9>`__ |
| 1218 | Change memory cleanup to use correct method |
| 1219 | |
| 1220 | Sumit Kumar (1): |
| 1221 | |
| 1222 | - `00c730b5ebef <https://github.com/open-power/hostboot/commit/00c730b5ebef>`__ |
| 1223 | GPTR/Overlays stage-2 support |
| 1224 | |
| 1225 | Sunil.Kumar (1): |
| 1226 | |
| 1227 | - `8240f5a4c1e0 <https://github.com/open-power/hostboot/commit/8240f5a4c1e0>`__ |
| 1228 | Procedures modified for DD1 changes |
| 1229 | |
| 1230 | Swathi Madhuri Bhattiprolu (1): |
| 1231 | |
| 1232 | - `2958d02ae126 <https://github.com/open-power/hostboot/commit/2958d02ae126>`__ |
| 1233 | Create Initial Cumulus CDIMM sim configuration |
| 1234 | |
| 1235 | Thi Tran (6): |
| 1236 | |
| 1237 | - `231f4e404b04 <https://github.com/open-power/hostboot/commit/231f4e404b04>`__ |
| 1238 | Add ec\_abst ring to p9n.hw\_image |
| 1239 | - `71fc3db015e6 <https://github.com/open-power/hostboot/commit/71fc3db015e6>`__ |
| 1240 | Attribute support of customization of Nimbus DD1 PCI reference clock |
| 1241 | speed. |
| 1242 | - `2764678bf004 <https://github.com/open-power/hostboot/commit/2764678bf004>`__ |
| 1243 | P9 Cumulus InitCompiler supportis - Part 3 |
| 1244 | - `227a32f926d3 <https://github.com/open-power/hostboot/commit/227a32f926d3>`__ |
| 1245 | Undo some p9 Cumulus spy workarounds in initfiles |
| 1246 | - `cc1ac14babe2 <https://github.com/open-power/hostboot/commit/cc1ac14babe2>`__ |
| 1247 | Fix MFG P9 ZZ: BC70E540 (MCFIR[8]) command list timeout |
| 1248 | - `3d9454e64478 <https://github.com/open-power/hostboot/commit/3d9454e64478>`__ |
| 1249 | Do not apply HW414958 to Axone |
| 1250 | |
| 1251 | Tsung Yeung (2): |
| 1252 | |
| 1253 | - `1d2a73892341 <https://github.com/open-power/hostboot/commit/1d2a73892341>`__ |
| 1254 | Adds self time refresh entry and exit helper functions |
| 1255 | - `3a4d0639d249 <https://github.com/open-power/hostboot/commit/3a4d0639d249>`__ |
| 1256 | Adds STR entry and exit functions to support NVDIMM |
| 1257 | |
| 1258 | Venkatesh Sainath (2): |
| 1259 | |
| 1260 | - `44087e0148ad <https://github.com/open-power/hostboot/commit/44087e0148ad>`__ |
| 1261 | Enabling FSP-B IPL as primary |
| 1262 | - `13de75c05e7d <https://github.com/open-power/hostboot/commit/13de75c05e7d>`__ |
| 1263 | Fixing flipport attribute for processors |
| 1264 | |
| 1265 | Yue Du (5): |
| 1266 | |
| 1267 | - `3afac7911fa4 <https://github.com/open-power/hostboot/commit/3afac7911fa4>`__ |
| 1268 | STOP: Support Suspend Entry/Exit and Fix Pig Collision |
| 1269 | - `40121d5b91e6 <https://github.com/open-power/hostboot/commit/40121d5b91e6>`__ |
| 1270 | Cache HWP: DD1 VCS Workaround |
| 1271 | - `89135c06eabc <https://github.com/open-power/hostboot/commit/89135c06eabc>`__ |
| 1272 | Istep4: Enable poll for DPLL lock in p9\_hcd\_cache\_dpll\_setup |
| 1273 | - `1db94c26ffaa <https://github.com/open-power/hostboot/commit/1db94c26ffaa>`__ |
| 1274 | HW396520: DD1 workaround skip flushmode inhibit drop in cache hwp |
| 1275 | - `ee172729c85d <https://github.com/open-power/hostboot/commit/ee172729c85d>`__ |
| 1276 | STOP: Fix Wakeup terminate prematurely with mixed stop2 and stop4 |
| 1277 | |
| 1278 | Zane Shelley (16): |
| 1279 | |
| 1280 | - `1275d064b04f <https://github.com/open-power/hostboot/commit/1275d064b04f>`__ |
| 1281 | PRD: Fixed address translation for Dynamic Memory Deallocation |
| 1282 | - `5324435b6d27 <https://github.com/open-power/hostboot/commit/5324435b6d27>`__ |
| 1283 | PRD: initializing MemTdCtlr variables for broadcast mode |
| 1284 | - `fed203b290c1 <https://github.com/open-power/hostboot/commit/fed203b290c1>`__ |
| 1285 | PRD: added full IPL config support into getHwConfig() |
| 1286 | - `0c2ad40218ec <https://github.com/open-power/hostboot/commit/0c2ad40218ec>`__ |
| 1287 | PRD: removed NPUFIR workaround for DD1.0 to enable default capture |
| 1288 | - `9aa046413267 <https://github.com/open-power/hostboot/commit/9aa046413267>`__ |
| 1289 | PRD: NPU0FIR checkstop isolation issue |
| 1290 | - `9abf4f390cca <https://github.com/open-power/hostboot/commit/9abf4f390cca>`__ |
| 1291 | PRD: getConnectedParent() issue in MemDealloc::dimmList() |
| 1292 | - `5aa7128d4aaa <https://github.com/open-power/hostboot/commit/5aa7128d4aaa>`__ |
| 1293 | PRD: add DMD support for 3 and 6 MC channels per group |
| 1294 | - `82aaa7df696a <https://github.com/open-power/hostboot/commit/82aaa7df696a>`__ |
| 1295 | PRD: initialize PRD objects for Restore DRAM Repairs |
| 1296 | - `f10101dc6c7e <https://github.com/open-power/hostboot/commit/f10101dc6c7e>`__ |
| 1297 | PRD: DMD address translation bug. |
| 1298 | - `08379ab81944 <https://github.com/open-power/hostboot/commit/08379ab81944>`__ |
| 1299 | PRD: extra FFDC for NPU0FIR |
| 1300 | - `5353bb457253 <https://github.com/open-power/hostboot/commit/5353bb457253>`__ |
| 1301 | PRD: remove some NPUFIR bits from cs\_root\_cause list |
| 1302 | - `d69704d2fd07 <https://github.com/open-power/hostboot/commit/d69704d2fd07>`__ |
| 1303 | PRD: updates to XBUS interface callouts |
| 1304 | - `87e454859985 <https://github.com/open-power/hostboot/commit/87e454859985>`__ |
| 1305 | PRD: add c\_err\_rpt registers for INTCQFIR |
| 1306 | - `42e4c422f63b <https://github.com/open-power/hostboot/commit/42e4c422f63b>`__ |
| 1307 | PRD: moved prdfCenMbaDataBundle.H to common code |
| 1308 | - `46cd9952ddff <https://github.com/open-power/hostboot/commit/46cd9952ddff>`__ |
| 1309 | PRD: Disable Dynamic Memory Deallocation for MBA |
| 1310 | - `a219839511f6 <https://github.com/open-power/hostboot/commit/a219839511f6>`__ |
| 1311 | PRD: support getMemAddrRange() for MBA ranks |
| 1312 | |
| 1313 | aravnair-in (1): |
| 1314 | |
| 1315 | - `8e01c68dc70d <https://github.com/open-power/hostboot/commit/8e01c68dc70d>`__ |
| 1316 | Fix a couple of EKB files to prevent CMVC quirk |
| 1317 | |
| 1318 | crgeddes (1): |
| 1319 | |
| 1320 | - `345c40eb09f2 <https://github.com/open-power/hostboot/commit/345c40eb09f2>`__ |
| 1321 | Use DD1 SW reset for XIVE unit until we get HW reset working in DD2 |
| 1322 | |
| 1323 | dchowe (4): |
| 1324 | |
| 1325 | - `666e095a50be <https://github.com/open-power/hostboot/commit/666e095a50be>`__ |
| 1326 | Initfile updates for FBC DD2 |
| 1327 | - `fdb995c8d77c <https://github.com/open-power/hostboot/commit/fdb995c8d77c>`__ |
| 1328 | DD2 updated scan overrides, Cumulus DD1 initfile updates |
| 1329 | - `281b63f10d73 <https://github.com/open-power/hostboot/commit/281b63f10d73>`__ |
| 1330 | Update FBC cd\_hp initfile to reference serial mode spys directly |
| 1331 | - `8711f1044943 <https://github.com/open-power/hostboot/commit/8711f1044943>`__ |
| 1332 | disable lpc\_ed in fbc to match mc setting |
| 1333 | |
| 1334 | Package: occ |
| 1335 | ------------ |
| 1336 | |
| 1337 | `Repository <https://github.com/open-power/occ>`__ |
| 1338 | |
| 1339 | Patches |
| 1340 | ~~~~~~~ |
| 1341 | |
| 1342 | Commits |
| 1343 | ~~~~~~~ |
| 1344 | |
| 1345 | Andres Lugo-Reyes (4): |
| 1346 | |
| 1347 | - `fca494dbdcf9 <https://github.com/open-power/occ/commit/fca494dbdcf9>`__ |
| 1348 | Replace Firmware Level with FClip History in error log |
| 1349 | - `bf6e716d3289 <https://github.com/open-power/occ/commit/bf6e716d3289>`__ |
| 1350 | Look at OCCFLG[30] to see if PGPE needs a new VFRT |
| 1351 | - `cb3f5cf6a5b9 <https://github.com/open-power/occ/commit/cb3f5cf6a5b9>`__ |
| 1352 | WOF: Phase 2 Vratio calculation correction |
| 1353 | - `1c7b23cc6b8f <https://github.com/open-power/occ/commit/1c7b23cc6b8f>`__ |
| 1354 | WOF: Force ceff\_ratio to 0% if voltage component is 0 |
| 1355 | |
| 1356 | William Bryan (3): |
| 1357 | |
| 1358 | - `2fe8f2c01e62 <https://github.com/open-power/occ/commit/2fe8f2c01e62>`__ |
| 1359 | Buildname 3/1 |
| 1360 | - `81196c350c52 <https://github.com/open-power/occ/commit/81196c350c52>`__ |
| 1361 | Try to PCAP GPU again after busy failure CQ:SW414846 |
| 1362 | - `768466b31e85 <https://github.com/open-power/occ/commit/768466b31e85>`__ |
| 1363 | GPE1 Binary 3/8 |
| 1364 | |
| 1365 | mbroyles (5): |
| 1366 | |
| 1367 | - `c9954444fc8d <https://github.com/open-power/occ/commit/c9954444fc8d>`__ |
| 1368 | Calculate Pstate from a frequency starting at max frequency instead |
| 1369 | of min |
| 1370 | - `ccdb19fba8c7 <https://github.com/open-power/occ/commit/ccdb19fba8c7>`__ |
| 1371 | Enable 24x7 on FSP systems |
| 1372 | - `919b78927d26 <https://github.com/open-power/occ/commit/919b78927d26>`__ |
| 1373 | Characterization state meltbox support |
| 1374 | - `e4bc12d978ab <https://github.com/open-power/occ/commit/e4bc12d978ab>`__ |
| 1375 | Correct ASM WOF enable adjusted value |
| 1376 | - `c44bd0f660c7 <https://github.com/open-power/occ/commit/c44bd0f660c7>`__ |
| 1377 | Support set data length command to improve AMESTER performance with |
| 1378 | Open BMC |
| 1379 | |
| 1380 | Package: op-build |
| 1381 | ----------------- |
| 1382 | |
| 1383 | `Repository <https://github.com/open-power/op-build>`__ |
| 1384 | |
| 1385 | Patches |
| 1386 | ~~~~~~~ |
| 1387 | |
| 1388 | Commits |
| 1389 | ~~~~~~~ |
| 1390 | |
| 1391 | No changes. |
| 1392 | |
| 1393 | Package: p9dsu-xml |
| 1394 | ------------------ |
| 1395 | |
| 1396 | `Repository <https://github.com/open-power/p9dsu-xml>`__ |
| 1397 | |
| 1398 | Patches |
| 1399 | ~~~~~~~ |
| 1400 | |
| 1401 | Commits |
| 1402 | ~~~~~~~ |
| 1403 | |
| 1404 | No changes. |
| 1405 | |
| 1406 | Package: palmetto-xml |
| 1407 | --------------------- |
| 1408 | |
| 1409 | `Repository <https://github.com/open-power/palmetto-xml>`__ |
| 1410 | |
| 1411 | Patches |
| 1412 | ~~~~~~~ |
| 1413 | |
| 1414 | Commits |
| 1415 | ~~~~~~~ |
| 1416 | |
| 1417 | No changes. |
| 1418 | |
| 1419 | Package: petitboot |
| 1420 | ------------------ |
| 1421 | |
| 1422 | `Repository <https://github.com/open-power/petitboot>`__ |
| 1423 | |
| 1424 | Patches |
| 1425 | ~~~~~~~ |
| 1426 | |
| 1427 | - `petitboot-01-autotools-Add-autopoint-generated-files.patch <https://github.com/open-power/op-build/tree/v1.22/openpower/package/petitboot/petitboot-01-autotools-Add-autopoint-generated-files.patch>`__ |
| 1428 | |
| 1429 | Commits |
| 1430 | ~~~~~~~ |
| 1431 | |
| 1432 | Brett Grandbois (7): |
| 1433 | |
| 1434 | - `8f09986340e6 <https://github.com/open-power/petitboot/commit/8f09986340e6>`__ |
| 1435 | discover/pb-discover: #include <locale.h> for musl libc |
| 1436 | - `44ab15ff671f <https://github.com/open-power/petitboot/commit/44ab15ff671f>`__ |
| 1437 | ncurses/nc-cui: musl libc fixes |
| 1438 | - `b63b778e7feb <https://github.com/open-power/petitboot/commit/b63b778e7feb>`__ |
| 1439 | ncurses/nc-cui: fix unreferenced assertion variable |
| 1440 | - `a80b3cac1053 <https://github.com/open-power/petitboot/commit/a80b3cac1053>`__ |
| 1441 | grub2/grub2-parser: accept no whitespace in grub menuentry |
| 1442 | - `b6e83bb17299 <https://github.com/open-power/petitboot/commit/b6e83bb17299>`__ |
| 1443 | grub2/grub2: add Yocto paths to default grub2 conf search paths |
| 1444 | - `c8ba7b32759f <https://github.com/open-power/petitboot/commit/c8ba7b32759f>`__ |
| 1445 | test/parser: test no whitespace on grub menuentry |
| 1446 | - `02af1caf9df8 <https://github.com/open-power/petitboot/commit/02af1caf9df8>`__ |
| 1447 | syslinux: add syslinux parser support |
| 1448 | |
| 1449 | Cyril Bur (7): |
| 1450 | |
| 1451 | - `b2bc013b1413 <https://github.com/open-power/petitboot/commit/b2bc013b1413>`__ |
| 1452 | configure.ac: Fix unmatched brackets |
| 1453 | - `817e6698bcbb <https://github.com/open-power/petitboot/commit/817e6698bcbb>`__ |
| 1454 | Fix bootstrap warning: noinst\_PROGRAMS was already defined |
| 1455 | - `117a75f95ec3 <https://github.com/open-power/petitboot/commit/117a75f95ec3>`__ |
| 1456 | Better recognition of ncurses header files |
| 1457 | - `3a76e4214d5c <https://github.com/open-power/petitboot/commit/3a76e4214d5c>`__ |
| 1458 | discover/pxe-parser: Fine grained proxy control |
| 1459 | - `eb9c570fa13b <https://github.com/open-power/petitboot/commit/eb9c570fa13b>`__ |
| 1460 | configure.ac: Fix unmatched brackets |
| 1461 | - `17f04cb4d3d8 <https://github.com/open-power/petitboot/commit/17f04cb4d3d8>`__ |
| 1462 | Fix bootstrap warning: noinst\_PROGRAMS was already defined |
| 1463 | - `bc8b183fbea6 <https://github.com/open-power/petitboot/commit/bc8b183fbea6>`__ |
| 1464 | Better recognition of ncurses header files |
| 1465 | |
| 1466 | Daniel Axtens (2): |
| 1467 | |
| 1468 | - `591b8b6d39b2 <https://github.com/open-power/petitboot/commit/591b8b6d39b2>`__ |
| 1469 | Use --no-location instead of --add-location=never |
| 1470 | - `865097ff2cbb <https://github.com/open-power/petitboot/commit/865097ff2cbb>`__ |
| 1471 | Test with .travis.yml |
| 1472 | |
| 1473 | Geoff Levand (4): |
| 1474 | |
| 1475 | - `7aa2d8a3aefc <https://github.com/open-power/petitboot/commit/7aa2d8a3aefc>`__ |
| 1476 | bootstrap: Add dependency checks |
| 1477 | - `e3f78333a2a1 <https://github.com/open-power/petitboot/commit/e3f78333a2a1>`__ |
| 1478 | configure: Add check for lex, yacc |
| 1479 | - `c462aa6f8e46 <https://github.com/open-power/petitboot/commit/c462aa6f8e46>`__ |
| 1480 | configure: Update AC\_PACKAGE\_BUGREPORT |
| 1481 | - `41caf09e98b1 <https://github.com/open-power/petitboot/commit/41caf09e98b1>`__ |
| 1482 | printf: Fix format type warnings |
| 1483 | |
| 1484 | Joel Stanley (5): |
| 1485 | |
| 1486 | - `a5f80e0a9a40 <https://github.com/open-power/petitboot/commit/a5f80e0a9a40>`__ |
| 1487 | discover: Fix bad check of version string |
| 1488 | - `352f5c2729dc <https://github.com/open-power/petitboot/commit/352f5c2729dc>`__ |
| 1489 | ncurses: Fix bad strncmp |
| 1490 | - `2b86765dfa37 <https://github.com/open-power/petitboot/commit/2b86765dfa37>`__ |
| 1491 | discover: Fix unused function warning |
| 1492 | - `2c97f136757b <https://github.com/open-power/petitboot/commit/2c97f136757b>`__ |
| 1493 | test/parser: Fixed uninitialized variable warning |
| 1494 | - `47d0601affe8 <https://github.com/open-power/petitboot/commit/47d0601affe8>`__ |
| 1495 | discover: pxe: Avoid dereferencing null pointer |
| 1496 | |
| 1497 | Samuel Mendoza-Jonas (17): |
| 1498 | |
| 1499 | - `33a0f544151f <https://github.com/open-power/petitboot/commit/33a0f544151f>`__ |
| 1500 | ui/ncurses: Handle arrow key variants |
| 1501 | - `3af2c04787af <https://github.com/open-power/petitboot/commit/3af2c04787af>`__ |
| 1502 | ui/ncurses: Handle arrow key variants |
| 1503 | - `c916e1333676 <https://github.com/open-power/petitboot/commit/c916e1333676>`__ |
| 1504 | ui/ncurses: Always cancel autoboot on exit |
| 1505 | - `f18998f6aac3 <https://github.com/open-power/petitboot/commit/f18998f6aac3>`__ |
| 1506 | ui/ncurses: Always cancel autoboot on exit |
| 1507 | - `a2d5a3e3cb55 <https://github.com/open-power/petitboot/commit/a2d5a3e3cb55>`__ |
| 1508 | discover/pxe-parser: Fix relative parsing for manual config files |
| 1509 | - `1ad12fe5b75e <https://github.com/open-power/petitboot/commit/1ad12fe5b75e>`__ |
| 1510 | discover/pxe-parser: Fix relative parsing for manual config files |
| 1511 | - `2dfbd9811d1e <https://github.com/open-power/petitboot/commit/2dfbd9811d1e>`__ |
| 1512 | ui/ncurses: Allow multiple hot key handlers per pmenu |
| 1513 | - `11c43508e436 <https://github.com/open-power/petitboot/commit/11c43508e436>`__ |
| 1514 | ui/ncurses: Clear remaining space when drawing help line |
| 1515 | - `ef13876e9fea <https://github.com/open-power/petitboot/commit/ef13876e9fea>`__ |
| 1516 | discover/device-handler: Treat empty boot order as 'boot any' |
| 1517 | - `aa23987dd043 <https://github.com/open-power/petitboot/commit/aa23987dd043>`__ |
| 1518 | discover/syslinux-parser: Fix missing comma in ignored names. |
| 1519 | - `dc85de97c79c <https://github.com/open-power/petitboot/commit/dc85de97c79c>`__ |
| 1520 | discover: Allow load\_async\_url() to call callback for local paths |
| 1521 | - `d63bacef37d6 <https://github.com/open-power/petitboot/commit/d63bacef37d6>`__ |
| 1522 | ui/ncurses: Fix boot editor segfault on update |
| 1523 | - `7e0b9da2ae2f <https://github.com/open-power/petitboot/commit/7e0b9da2ae2f>`__ |
| 1524 | discover/platform-powerpc: Avoid confusing gateway and URL |
| 1525 | - `fb8dbd274b4b <https://github.com/open-power/petitboot/commit/fb8dbd274b4b>`__ |
| 1526 | ui/ncurses: Validate URL field |
| 1527 | - `e6407ab0ae61 <https://github.com/open-power/petitboot/commit/e6407ab0ae61>`__ |
| 1528 | lib: Fix gpg.h path |
| 1529 | - `526d4b3d959d <https://github.com/open-power/petitboot/commit/526d4b3d959d>`__ |
| 1530 | utils/hooks: Set stdout-path property |
| 1531 | - `c208aa42024f <https://github.com/open-power/petitboot/commit/c208aa42024f>`__ |
| 1532 | discover/boot: Fix stale boot cancellation code |
| 1533 | |
| 1534 | Package: pnor |
| 1535 | ------------- |
| 1536 | |
| 1537 | `Repository <https://github.com/open-power/pnor>`__ |
| 1538 | |
| 1539 | Patches |
| 1540 | ~~~~~~~ |
| 1541 | |
| 1542 | Commits |
| 1543 | ~~~~~~~ |
| 1544 | |
| 1545 | No changes. |
| 1546 | |
| 1547 | Package: romulus-xml |
| 1548 | -------------------- |
| 1549 | |
| 1550 | `Repository <https://github.com/open-power/romulus-xml>`__ |
| 1551 | |
| 1552 | Patches |
| 1553 | ~~~~~~~ |
| 1554 | |
| 1555 | Commits |
| 1556 | ~~~~~~~ |
| 1557 | |
| 1558 | No changes. |
| 1559 | |
| 1560 | Package: sbe |
| 1561 | ------------ |
| 1562 | |
| 1563 | `Repository <https://github.com/open-power/sbe>`__ |
| 1564 | |
| 1565 | Patches |
| 1566 | ~~~~~~~ |
| 1567 | |
| 1568 | Commits |
| 1569 | ~~~~~~~ |
| 1570 | |
| 1571 | Amit Tendolkar (3): |
| 1572 | |
| 1573 | - `731439265743 <https://github.com/open-power/sbe/commit/731439265743>`__ |
| 1574 | Extend PM Reset flow to collect PM FFDC to HOMER |
| 1575 | - `8b75ed9d8f43 <https://github.com/open-power/sbe/commit/8b75ed9d8f43>`__ |
| 1576 | Add EQ ATOMIC LOCK SCOM to security write whitelist for FFDC |
| 1577 | - `1384ebc764ac <https://github.com/open-power/sbe/commit/1384ebc764ac>`__ |
| 1578 | Update p9\_collect\_ppe\_state to dynamically collect PPE FFDC |
| 1579 | |
| 1580 | Andre Marin (2): |
| 1581 | |
| 1582 | - `92ababe68288 <https://github.com/open-power/sbe/commit/92ababe68288>`__ |
| 1583 | Add initial p9c ddr\_phy\_reset, dimmBadDqBitmapAccessHwp, slew, & |
| 1584 | unmask\_errors |
| 1585 | - `0ac911461767 <https://github.com/open-power/sbe/commit/0ac911461767>`__ |
| 1586 | Modified gen\_accessors script for greater support |
| 1587 | |
| 1588 | Anusha Reddy Rangareddygari (1): |
| 1589 | |
| 1590 | - `3a8884d192b1 <https://github.com/open-power/sbe/commit/3a8884d192b1>`__ |
| 1591 | Adding output\_path option for sbe-debug.py |
| 1592 | |
| 1593 | Ben Gass (5): |
| 1594 | |
| 1595 | - `9f5ce40fd271 <https://github.com/open-power/sbe/commit/9f5ce40fd271>`__ |
| 1596 | Re-submit Axone updates |
| 1597 | - `75ddac2a41a9 <https://github.com/open-power/sbe/commit/75ddac2a41a9>`__ |
| 1598 | Add support for p9c 1.2 |
| 1599 | - `2b432b15cbe8 <https://github.com/open-power/sbe/commit/2b432b15cbe8>`__ |
| 1600 | Axone MC uses same pll/clock setup as in Cumulus. |
| 1601 | - `1410d7f9ee83 <https://github.com/open-power/sbe/commit/1410d7f9ee83>`__ |
| 1602 | Add p9n 2.3 to p9\_frequency\_buckets.H |
| 1603 | - `a347254a3aec <https://github.com/open-power/sbe/commit/a347254a3aec>`__ |
| 1604 | Removing trailing comma in system\_attributes.xml |
| 1605 | |
| 1606 | Brian Silver (1): |
| 1607 | |
| 1608 | - `da9b63d6c024 <https://github.com/open-power/sbe/commit/da9b63d6c024>`__ |
| 1609 | Change p9\_mss\_freq\_system to write attributes, errors for Cronus |
| 1610 | |
| 1611 | Brian Vanderpool (1): |
| 1612 | |
| 1613 | - `2a438c9dd4b2 <https://github.com/open-power/sbe/commit/2a438c9dd4b2>`__ |
| 1614 | Improve power and clock checking when checking for stop states |
| 1615 | |
| 1616 | CHRISTINA L. GRAVES (1): |
| 1617 | |
| 1618 | - `b65fd5bcb57d <https://github.com/open-power/sbe/commit/b65fd5bcb57d>`__ |
| 1619 | p9\_query\_cache\_access\_state L2 |
| 1620 | |
| 1621 | Christian Geddes (1): |
| 1622 | |
| 1623 | - `f058c9945a4f <https://github.com/open-power/sbe/commit/f058c9945a4f>`__ |
| 1624 | Add attribute to give platform more control over PM\_RESET |
| 1625 | |
| 1626 | Claus Michael Olsen (2): |
| 1627 | |
| 1628 | - `b82c9d49c743 <https://github.com/open-power/sbe/commit/b82c9d49c743>`__ |
| 1629 | Additional risk level support - (step 2) Updating the image w/RL2 |
| 1630 | - `54f0bc5c31d3 <https://github.com/open-power/sbe/commit/54f0bc5c31d3>`__ |
| 1631 | Update to putRingUtils to proper scanning of perv\_pll\_bndy\_flt |
| 1632 | rings |
| 1633 | |
| 1634 | Dan Crowell (2): |
| 1635 | |
| 1636 | - `ba6f0c6d234e <https://github.com/open-power/sbe/commit/ba6f0c6d234e>`__ |
| 1637 | Disabling WOF and VDM for Nimbus DD2.0 |
| 1638 | - `c821b84e4ff5 <https://github.com/open-power/sbe/commit/c821b84e4ff5>`__ |
| 1639 | Disable WOF for Cumulus DD1.0 |
| 1640 | |
| 1641 | Dean Sanner (2): |
| 1642 | |
| 1643 | - `d50cc1394696 <https://github.com/open-power/sbe/commit/d50cc1394696>`__ |
| 1644 | Run lpc\_init on all processors |
| 1645 | - `e962f1e8c736 <https://github.com/open-power/sbe/commit/e962f1e8c736>`__ |
| 1646 | Honor STOP Gated bit when checking access states |
| 1647 | |
| 1648 | Elizabeth Liner (1): |
| 1649 | |
| 1650 | - `29b11603626f <https://github.com/open-power/sbe/commit/29b11603626f>`__ |
| 1651 | Adding attribute to detect which processor we can use for alt-memory |
| 1652 | |
| 1653 | Greg Still (2): |
| 1654 | |
| 1655 | - `b1386622238e <https://github.com/open-power/sbe/commit/b1386622238e>`__ |
| 1656 | PM\_SPWKUP: Clear wakeup notify select bit to enable auto special |
| 1657 | wakeup |
| 1658 | - `cc59dcd72f9d <https://github.com/open-power/sbe/commit/cc59dcd72f9d>`__ |
| 1659 | PM: p9\_setup\_evid steps voltage to avoid Fleetwood VRM limitations |
| 1660 | |
| 1661 | Joachim Fenkes (3): |
| 1662 | |
| 1663 | - `cce76062ef2f <https://github.com/open-power/sbe/commit/cce76062ef2f>`__ |
| 1664 | hwpErrors: Use wildcard instead of explicit list |
| 1665 | - `d1da43c4e54d <https://github.com/open-power/sbe/commit/d1da43c4e54d>`__ |
| 1666 | LPC: Add empty files for mirroring to HB, PPE, HWSV |
| 1667 | - `da13fade1742 <https://github.com/open-power/sbe/commit/da13fade1742>`__ |
| 1668 | p9\_sbe\_lpc\_init: Fix timeout setup |
| 1669 | |
| 1670 | Joe McGill (3): |
| 1671 | |
| 1672 | - `d2a0b0c1617c <https://github.com/open-power/sbe/commit/d2a0b0c1617c>`__ |
| 1673 | FIR + RAS XML updates |
| 1674 | - `4d30a3d9b261 <https://github.com/open-power/sbe/commit/4d30a3d9b261>`__ |
| 1675 | p9\_sbe\_tracearray -- satsify PRD calls to manage core trace arrays |
| 1676 | - `9da1175ad43a <https://github.com/open-power/sbe/commit/9da1175ad43a>`__ |
| 1677 | Add base FAPI2 attribute definitions |
| 1678 | |
| 1679 | Lennard Streat (1): |
| 1680 | |
| 1681 | - `ffd086397fb0 <https://github.com/open-power/sbe/commit/ffd086397fb0>`__ |
| 1682 | Protect Firmware from exposure to HW423533 |
| 1683 | |
| 1684 | Luke C. Murray (1): |
| 1685 | |
| 1686 | - `c955a5c32115 <https://github.com/open-power/sbe/commit/c955a5c32115>`__ |
| 1687 | Updating NCU tlbie pacing dials |
| 1688 | |
| 1689 | Luke Mulkey (2): |
| 1690 | |
| 1691 | - `e275751a409c <https://github.com/open-power/sbe/commit/e275751a409c>`__ |
| 1692 | Existing code changes for ddr\_phy\_reset HB mirror |
| 1693 | - `2cd7837eb2ec <https://github.com/open-power/sbe/commit/2cd7837eb2ec>`__ |
| 1694 | p9c\_mss\_memdiags and p9c\_mss\_maint\_cmds |
| 1695 | |
| 1696 | Matt K. Light (1): |
| 1697 | |
| 1698 | - `efcd5ec67072 <https://github.com/open-power/sbe/commit/efcd5ec67072>`__ |
| 1699 | adding fapi2::putSpyWithCare() |
| 1700 | |
| 1701 | Matthew Hickman (1): |
| 1702 | |
| 1703 | - `8e7dbfd13ce4 <https://github.com/open-power/sbe/commit/8e7dbfd13ce4>`__ |
| 1704 | Added RCD Protect time and MNFG Flag check to unmask function |
| 1705 | |
| 1706 | Nick Klazynski (4): |
| 1707 | |
| 1708 | - `ace31fa4b8c6 <https://github.com/open-power/sbe/commit/ace31fa4b8c6>`__ |
| 1709 | Add TM WAT workaround; NDD2.2 and CDD1.1 only |
| 1710 | - `1fb2cb5cb795 <https://github.com/open-power/sbe/commit/1fb2cb5cb795>`__ |
| 1711 | Add Cumulus DD1.1 inits |
| 1712 | - `b51252885ec6 <https://github.com/open-power/sbe/commit/b51252885ec6>`__ |
| 1713 | Enable risklevel2, match v44 of security wiki |
| 1714 | - `00bb7b34d2a8 <https://github.com/open-power/sbe/commit/00bb7b34d2a8>`__ |
| 1715 | Remove CDD1.1 security IMC; Apply indirect branch serialization to |
| 1716 | HV=0 only |
| 1717 | |
| 1718 | Oliver Morlok (1): |
| 1719 | |
| 1720 | - `56e408e085ca <https://github.com/open-power/sbe/commit/56e408e085ca>`__ |
| 1721 | Get a z compile working |
| 1722 | |
| 1723 | Prasad Bg Ranganath (1): |
| 1724 | |
| 1725 | - `69bc840ab99a <https://github.com/open-power/sbe/commit/69bc840ab99a>`__ |
| 1726 | Fix bug in cache query state procedure |
| 1727 | |
| 1728 | Raja Das (2): |
| 1729 | |
| 1730 | - `2dce1d2d7fbb <https://github.com/open-power/sbe/commit/2dce1d2d7fbb>`__ |
| 1731 | SBE Space optimisation |
| 1732 | - `9b7838172f0b <https://github.com/open-power/sbe/commit/9b7838172f0b>`__ |
| 1733 | SBE Regression |
| 1734 | |
| 1735 | Sachin Gupta (5): |
| 1736 | |
| 1737 | - `d27218491dda <https://github.com/open-power/sbe/commit/d27218491dda>`__ |
| 1738 | Retry multicast chiplet offline errors. |
| 1739 | - `ab0fc4ba6ffb <https://github.com/open-power/sbe/commit/ab0fc4ba6ffb>`__ |
| 1740 | Update backing build |
| 1741 | - `967fefdf8af1 <https://github.com/open-power/sbe/commit/967fefdf8af1>`__ |
| 1742 | Fix test sequence |
| 1743 | - `321de657b979 <https://github.com/open-power/sbe/commit/321de657b979>`__ |
| 1744 | Update backing build |
| 1745 | - `5c0363924c7d <https://github.com/open-power/sbe/commit/5c0363924c7d>`__ |
| 1746 | Handle race condition between PSU/FIFO interface. |
| 1747 | |
| 1748 | Soma BhanuTej (3): |
| 1749 | |
| 1750 | - `55603147cd5b <https://github.com/open-power/sbe/commit/55603147cd5b>`__ |
| 1751 | Mask TP LFIR for non PPE mode - p9\_sbe\_common |
| 1752 | - `ace2c563f607 <https://github.com/open-power/sbe/commit/ace2c563f607>`__ |
| 1753 | Axone support to TP stopclocks |
| 1754 | - `4e41a9415858 <https://github.com/open-power/sbe/commit/4e41a9415858>`__ |
| 1755 | Change TP FIR bits 38, 39, 40 as recoverable & Masked |
| 1756 | |
| 1757 | Sumit Kumar (1): |
| 1758 | |
| 1759 | - `2b29de060c3e <https://github.com/open-power/sbe/commit/2b29de060c3e>`__ |
| 1760 | Erepair HWP p9\_io\_erepair procedure |
| 1761 | |
| 1762 | Yue Du (2): |
| 1763 | |
| 1764 | - `20c449a70cde <https://github.com/open-power/sbe/commit/20c449a70cde>`__ |
| 1765 | STOP: Support Suspend Entry/Exit and Fix Pig Collision |
| 1766 | - `148a8c9278b9 <https://github.com/open-power/sbe/commit/148a8c9278b9>`__ |
| 1767 | STOP: Fix Wakeup terminate prematurely with mixed stop2 and stop4 |
| 1768 | |
| 1769 | aravnair-in (1): |
| 1770 | |
| 1771 | - `160637c9e837 <https://github.com/open-power/sbe/commit/160637c9e837>`__ |
| 1772 | Fix a couple of EKB files to prevent CMVC quirk |
| 1773 | |
| 1774 | crgeddes (3): |
| 1775 | |
| 1776 | - `7808b4fe065e <https://github.com/open-power/sbe/commit/7808b4fe065e>`__ |
| 1777 | Update p9\_query\_cache\_access\_state to use the correct scom |
| 1778 | register |
| 1779 | - `49613ee7ed9e <https://github.com/open-power/sbe/commit/49613ee7ed9e>`__ |
| 1780 | Skip EQ\_CLOCK\_STAT\_SL scom is we are in stop 11 or greater |
| 1781 | - `2c07fd2bbb9d <https://github.com/open-power/sbe/commit/2c07fd2bbb9d>`__ |
| 1782 | Add RCD\_PARITY\_ERROR enum value to ATTR\_RECONFIGURE\_LOOP |
| 1783 | |
| 1784 | spashabk-in (7): |
| 1785 | |
| 1786 | - `ffa97b5fd9ff <https://github.com/open-power/sbe/commit/ffa97b5fd9ff>`__ |
| 1787 | Fix missing sbe traces in errorlog |
| 1788 | - `6526984e4ae4 <https://github.com/open-power/sbe/commit/6526984e4ae4>`__ |
| 1789 | Extend sbe-debug.py to get ppe register ffdc |
| 1790 | - `8e9d92bf3c8f <https://github.com/open-power/sbe/commit/8e9d92bf3c8f>`__ |
| 1791 | Check for disable scom filtering bit |
| 1792 | - `9355a3505c0a <https://github.com/open-power/sbe/commit/9355a3505c0a>`__ |
| 1793 | Cleanup generic chipop files |
| 1794 | - `6699e49f885f <https://github.com/open-power/sbe/commit/6699e49f885f>`__ |
| 1795 | Dump transition during continuous ipl |
| 1796 | - `9e30f6413207 <https://github.com/open-power/sbe/commit/9e30f6413207>`__ |
| 1797 | Check for checkstop during mpipl |
| 1798 | - `26fbcbed7c36 <https://github.com/open-power/sbe/commit/26fbcbed7c36>`__ |
| 1799 | Restructure sbe-debug.py |
| 1800 | |
| 1801 | whs (1): |
| 1802 | |
| 1803 | - `90316ae6f36a <https://github.com/open-power/sbe/commit/90316ae6f36a>`__ |
| 1804 | Changes related to packaging of memory vpd on Nimbus |
| 1805 | |
| 1806 | Package: skiboot |
| 1807 | ---------------- |
| 1808 | |
| 1809 | `Repository <https://github.com/open-power/skiboot>`__ |
| 1810 | |
| 1811 | Patches |
| 1812 | ~~~~~~~ |
| 1813 | |
| 1814 | Commits |
| 1815 | ~~~~~~~ |
| 1816 | |
| 1817 | Akshay Adiga (1): |
| 1818 | |
| 1819 | - `87f33f499061 <https://github.com/open-power/skiboot/commit/87f33f499061>`__ |
| 1820 | SLW: Increase stop4-5 residency by 10x |
| 1821 | |
| 1822 | Alistair Popple (1): |
| 1823 | |
| 1824 | - `759c23acb4b6 <https://github.com/open-power/skiboot/commit/759c23acb4b6>`__ |
| 1825 | hw/npu2: Assign a unique LPARSHORTID per GPU |
| 1826 | |
| 1827 | Andrew Donnellan (12): |
| 1828 | |
| 1829 | - `399151e1425e <https://github.com/open-power/skiboot/commit/399151e1425e>`__ |
| 1830 | npu2: Split out common helper functions into separate file |
| 1831 | - `11b46291111a <https://github.com/open-power/skiboot/commit/11b46291111a>`__ |
| 1832 | npu2: Rework NPU data structures for OpenCAPI |
| 1833 | - `3603f474e566 <https://github.com/open-power/skiboot/commit/3603f474e566>`__ |
| 1834 | platform: Add fields for OpenCAPI platform data |
| 1835 | - `b5f1fd30ef56 <https://github.com/open-power/skiboot/commit/b5f1fd30ef56>`__ |
| 1836 | npu2-opencapi: Configure NPU for OpenCAPI |
| 1837 | - `9db58b1e5c03 <https://github.com/open-power/skiboot/commit/9db58b1e5c03>`__ |
| 1838 | npu2-hw-procedures: Add support for OpenCAPI PHY link training |
| 1839 | - `6b1cdedcef1d <https://github.com/open-power/skiboot/commit/6b1cdedcef1d>`__ |
| 1840 | npu2-opencapi: Train OpenCAPI links and setup devices |
| 1841 | - `5b72a43c59cb <https://github.com/open-power/skiboot/commit/5b72a43c59cb>`__ |
| 1842 | platforms: Add OpenCAPI platform data and device tree nodes |
| 1843 | - `f2e637b802e3 <https://github.com/open-power/skiboot/commit/f2e637b802e3>`__ |
| 1844 | doc/device-tree: Add PCI bindings stub |
| 1845 | - `bd6194f5a864 <https://github.com/open-power/skiboot/commit/bd6194f5a864>`__ |
| 1846 | doc/device-tree: Add OpenCAPI device tree bindings |
| 1847 | - `9972229b6b11 <https://github.com/open-power/skiboot/commit/9972229b6b11>`__ |
| 1848 | gitignore: Add \*.a |
| 1849 | - `d8c596368279 <https://github.com/open-power/skiboot/commit/d8c596368279>`__ |
| 1850 | npu2: Remove unused fields in struct npu2 |
| 1851 | - `87145c6bad5b <https://github.com/open-power/skiboot/commit/87145c6bad5b>`__ |
| 1852 | npu2: Remove DD1 support |
| 1853 | |
| 1854 | Artem Senichev (1): |
| 1855 | |
| 1856 | - `bfdf5787b9d8 <https://github.com/open-power/skiboot/commit/bfdf5787b9d8>`__ |
| 1857 | Add VESNIN platform support |
| 1858 | |
| 1859 | Christophe Lombard (1): |
| 1860 | |
| 1861 | - `0180de29859b <https://github.com/open-power/skiboot/commit/0180de29859b>`__ |
| 1862 | capp: Add lid definition for P9 DD-2.2 |
| 1863 | |
| 1864 | Cyril Bur (10): |
| 1865 | |
| 1866 | - `682e196627a0 <https://github.com/open-power/skiboot/commit/682e196627a0>`__ |
| 1867 | libflash/blocklevel: Correct miscalculation in |
| 1868 | blocklevel\_smart\_erase() |
| 1869 | - `70166b34238e <https://github.com/open-power/skiboot/commit/70166b34238e>`__ |
| 1870 | mbox: Harden against BMC daemon errors |
| 1871 | - `8c0224322650 <https://github.com/open-power/skiboot/commit/8c0224322650>`__ |
| 1872 | mbox: Reduce default BMC timeouts |
| 1873 | - `5630c819b3cb <https://github.com/open-power/skiboot/commit/5630c819b3cb>`__ |
| 1874 | occ-sensors: Remove NULL checks after dereference |
| 1875 | - `f4f88196aec7 <https://github.com/open-power/skiboot/commit/f4f88196aec7>`__ |
| 1876 | npu2: Fix possible NULL dereference |
| 1877 | - `4599a8bdf9de <https://github.com/open-power/skiboot/commit/4599a8bdf9de>`__ |
| 1878 | npu2-opencapi: Fix memory leak |
| 1879 | - `3c3b809cb8ba <https://github.com/open-power/skiboot/commit/3c3b809cb8ba>`__ |
| 1880 | libstb/create-container: munmap() signature file address |
| 1881 | - `7598ed90a670 <https://github.com/open-power/skiboot/commit/7598ed90a670>`__ |
| 1882 | fast-reboot: occ: Only delete /ibm, opal/power-mgt nodes if they |
| 1883 | exist |
| 1884 | - `35f003a01174 <https://github.com/open-power/skiboot/commit/35f003a01174>`__ |
| 1885 | hw/imc: Don't dereference possible NULL |
| 1886 | - `351b05be3d40 <https://github.com/open-power/skiboot/commit/351b05be3d40>`__ |
| 1887 | dts: Zero struct to avoid using uninitialised value |
| 1888 | |
| 1889 | Cédric Le Goater (2): |
| 1890 | |
| 1891 | - `dcbf18c1f0e1 <https://github.com/open-power/skiboot/commit/dcbf18c1f0e1>`__ |
| 1892 | xive: fix opal\_xive\_set\_vp\_info() error path |
| 1893 | - `19335bbf77d8 <https://github.com/open-power/skiboot/commit/19335bbf77d8>`__ |
| 1894 | xive: disable store EOI support |
| 1895 | |
| 1896 | Dan Crowell (1): |
| 1897 | |
| 1898 | - `4fcf4549d168 <https://github.com/open-power/skiboot/commit/4fcf4549d168>`__ |
| 1899 | Make gard display show that a record is cleared |
| 1900 | |
| 1901 | Frederic Barrat (2): |
| 1902 | |
| 1903 | - `cd8b82a8e83e <https://github.com/open-power/skiboot/commit/cd8b82a8e83e>`__ |
| 1904 | npu2-opencapi: Add OpenCAPI OPAL API calls |
| 1905 | - `48dd5f7b9fbb <https://github.com/open-power/skiboot/commit/48dd5f7b9fbb>`__ |
| 1906 | npu2-opencapi: Fix assert on link reset during init |
| 1907 | |
| 1908 | Joel Stanley (1): |
| 1909 | |
| 1910 | - `0df891697d24 <https://github.com/open-power/skiboot/commit/0df891697d24>`__ |
| 1911 | README: document output files |
| 1912 | |
| 1913 | Mahesh Salgaonkar (1): |
| 1914 | |
| 1915 | - `603beb4500f5 <https://github.com/open-power/skiboot/commit/603beb4500f5>`__ |
| 1916 | Reserve OPAL API number for opal\_handle\_hmi2 function. |
| 1917 | |
| 1918 | Matt Brown (3): |
| 1919 | |
| 1920 | - `2d4c774c2a3a <https://github.com/open-power/skiboot/commit/2d4c774c2a3a>`__ |
| 1921 | core/lock: Add deadlock detection |
| 1922 | - `84186ef0944c <https://github.com/open-power/skiboot/commit/84186ef0944c>`__ |
| 1923 | core/lock: Add lock timeout warnings |
| 1924 | - `8d0f41e021b3 <https://github.com/open-power/skiboot/commit/8d0f41e021b3>`__ |
| 1925 | gcov: Add gcov data struct to sysfs |
| 1926 | |
| 1927 | Michael Ellerman (1): |
| 1928 | |
| 1929 | - `f30286c49431 <https://github.com/open-power/skiboot/commit/f30286c49431>`__ |
| 1930 | mambo: Add fw-feature flags for security related settings |
| 1931 | |
| 1932 | Michael Neuling (6): |
| 1933 | |
| 1934 | - `bb3348c865a8 <https://github.com/open-power/skiboot/commit/bb3348c865a8>`__ |
| 1935 | core/pci-dt-slot: Fix booting with no slot map |
| 1936 | - `fa03921a9aa6 <https://github.com/open-power/skiboot/commit/fa03921a9aa6>`__ |
| 1937 | pci: Move code around |
| 1938 | - `fe6d86b92a00 <https://github.com/open-power/skiboot/commit/fe6d86b92a00>`__ |
| 1939 | pci: Make fast reboot creset PHBs in parallel |
| 1940 | - `18d7ee718bef <https://github.com/open-power/skiboot/commit/18d7ee718bef>`__ |
| 1941 | core/init: Assert when kernel not found |
| 1942 | - `730bccbbb615 <https://github.com/open-power/skiboot/commit/730bccbbb615>`__ |
| 1943 | Tie tm-suspend fw-feature and opal\_reinit\_cpus() together |
| 1944 | - `75a89e61c9d9 <https://github.com/open-power/skiboot/commit/75a89e61c9d9>`__ |
| 1945 | pci: Reduce log level of error message |
| 1946 | |
| 1947 | Murilo Opsfelder Araujo (1): |
| 1948 | |
| 1949 | - `f23240f50653 <https://github.com/open-power/skiboot/commit/f23240f50653>`__ |
| 1950 | skiboot.spec: Update to v5.10 release |
| 1951 | |
| 1952 | Nicholas Piggin (13): |
| 1953 | |
| 1954 | - `8cbd3880c321 <https://github.com/open-power/skiboot/commit/8cbd3880c321>`__ |
| 1955 | direct-controls: mambo fix for multiple chips |
| 1956 | - `f6159cff5d91 <https://github.com/open-power/skiboot/commit/f6159cff5d91>`__ |
| 1957 | build: use thin archives rather than incremental linking |
| 1958 | - `56a85b41d231 <https://github.com/open-power/skiboot/commit/56a85b41d231>`__ |
| 1959 | core/hmi: report processor recovery reason from core FIR bits on P9 |
| 1960 | - `884f97b25b49 <https://github.com/open-power/skiboot/commit/884f97b25b49>`__ |
| 1961 | core/opal: abort in case of re-entrant OPAL call |
| 1962 | - `82fd5d06beee <https://github.com/open-power/skiboot/commit/82fd5d06beee>`__ |
| 1963 | core/opal: allow some re-entrant calls |
| 1964 | - `1f53f9fa766f <https://github.com/open-power/skiboot/commit/1f53f9fa766f>`__ |
| 1965 | core/fast-reboot: disable fast reboot upon fundamental |
| 1966 | entry/exit/locking errors |
| 1967 | - `8cabd06243ac <https://github.com/open-power/skiboot/commit/8cabd06243ac>`__ |
| 1968 | core/fast-reboot: verify mem regions before fast reboot |
| 1969 | - `336f306555d0 <https://github.com/open-power/skiboot/commit/336f306555d0>`__ |
| 1970 | mem-map: Use a symbolic constant for exception vector size |
| 1971 | - `c32943bfc1e2 <https://github.com/open-power/skiboot/commit/c32943bfc1e2>`__ |
| 1972 | core/fast-reboot: zero memory after fast reboot |
| 1973 | - `a1c3dcca81ce <https://github.com/open-power/skiboot/commit/a1c3dcca81ce>`__ |
| 1974 | nvram: run nvram\_validate() after nvram\_reformat() |
| 1975 | - `103f67fe83f1 <https://github.com/open-power/skiboot/commit/103f67fe83f1>`__ |
| 1976 | hw/imc: don't access homer memory if it was not initialised |
| 1977 | - `90d53934c2da <https://github.com/open-power/skiboot/commit/90d53934c2da>`__ |
| 1978 | core/cpu: discover stack region size before initialising memory |
| 1979 | regions |
| 1980 | - `e0c7c89b7483 <https://github.com/open-power/skiboot/commit/e0c7c89b7483>`__ |
| 1981 | core/cpufeatures: Fix setting DARN and SCV HWCAP feature bits |
| 1982 | |
| 1983 | Oliver O'Halloran (1): |
| 1984 | |
| 1985 | - `3e74805702f6 <https://github.com/open-power/skiboot/commit/3e74805702f6>`__ |
| 1986 | phb\*: Remove the state field in the various phb structures |
| 1987 | |
| 1988 | Philippe Bergheaud (2): |
| 1989 | |
| 1990 | - `a8cfb0906643 <https://github.com/open-power/skiboot/commit/a8cfb0906643>`__ |
| 1991 | phb4: set PHB CMPM registers for tunneled operations |
| 1992 | - `0f3584d84662 <https://github.com/open-power/skiboot/commit/0f3584d84662>`__ |
| 1993 | phb4: set PBCQ Tunnel BAR for tunneled operations |
| 1994 | |
| 1995 | Pridhiviraj Paidipeddi (5): |
| 1996 | |
| 1997 | - `f24db9e5c8c4 <https://github.com/open-power/skiboot/commit/f24db9e5c8c4>`__ |
| 1998 | libstb/secureboot: Fix logging of secure verify messages. |
| 1999 | - `20f685a3627a <https://github.com/open-power/skiboot/commit/20f685a3627a>`__ |
| 2000 | console(lpc/fsp-console): Use only stdout-path property on P9 and |
| 2001 | above |
| 2002 | - `28a414b3e4c5 <https://github.com/open-power/skiboot/commit/28a414b3e4c5>`__ |
| 2003 | doc/opal-api: Document using stdout-path property |
| 2004 | - `f69d2ac579b6 <https://github.com/open-power/skiboot/commit/f69d2ac579b6>`__ |
| 2005 | core/ipmi-opal: Add interrupt-parent property for ipmi node on P9 and |
| 2006 | above. |
| 2007 | - `8ea3ac76137b <https://github.com/open-power/skiboot/commit/8ea3ac76137b>`__ |
| 2008 | doc/opal-api: Document changes of adding interrupt-parent property |
| 2009 | under /ibm, opal/ipmi node on POWER9 and above. |
| 2010 | |
| 2011 | Reza Arbab (3): |
| 2012 | |
| 2013 | - `105d80f85b07 <https://github.com/open-power/skiboot/commit/105d80f85b07>`__ |
| 2014 | npu2: Use unfiltered mode in XTS tables |
| 2015 | - `773836f3424d <https://github.com/open-power/skiboot/commit/773836f3424d>`__ |
| 2016 | npu2: Disable fast reboot |
| 2017 | - `0ce7482fb650 <https://github.com/open-power/skiboot/commit/0ce7482fb650>`__ |
| 2018 | npu2: Add performance tuning SCOM inits |
| 2019 | |
| 2020 | Shilpasri G Bhat (2): |
| 2021 | |
| 2022 | - `ac4272bf5e73 <https://github.com/open-power/skiboot/commit/ac4272bf5e73>`__ |
| 2023 | fast-reboot: occ: Delete OCC child nodes in /ibm, opal/power-mgt |
| 2024 | - `b5c9d09d0677 <https://github.com/open-power/skiboot/commit/b5c9d09d0677>`__ |
| 2025 | dts: spl\_wakeup: Remove all workarounds in the spl wakeup logic |
| 2026 | |
| 2027 | Stewart Smith (21): |
| 2028 | |
| 2029 | - `fbdc91e693fc <https://github.com/open-power/skiboot/commit/fbdc91e693fc>`__ |
| 2030 | NPU2 HMIs: dump out a *LOT* of npu2 registers for debugging |
| 2031 | - `fa1eeea2e987 <https://github.com/open-power/skiboot/commit/fa1eeea2e987>`__ |
| 2032 | doc: skiboot 5.10.1 release notes |
| 2033 | - `785b35d18808 <https://github.com/open-power/skiboot/commit/785b35d18808>`__ |
| 2034 | fast-reboot: enable by default for POWER9 |
| 2035 | - `5ba69bb62ca2 <https://github.com/open-power/skiboot/commit/5ba69bb62ca2>`__ |
| 2036 | skiboot 5.10.2 release notes |
| 2037 | - `217f74b0c40e <https://github.com/open-power/skiboot/commit/217f74b0c40e>`__ |
| 2038 | Revert "console(lpc/fsp-console): Use only stdout-path property on P9 |
| 2039 | and above" |
| 2040 | - `b71db454f703 <https://github.com/open-power/skiboot/commit/b71db454f703>`__ |
| 2041 | Keep constructors with priorities |
| 2042 | - `2d75b9439f66 <https://github.com/open-power/skiboot/commit/2d75b9439f66>`__ |
| 2043 | gcov: Another GCC, another gcov tweak |
| 2044 | - `f88ffa66d1b4 <https://github.com/open-power/skiboot/commit/f88ffa66d1b4>`__ |
| 2045 | cpu\_idle\_job: relax a bit |
| 2046 | - `a8e6cc3f4752 <https://github.com/open-power/skiboot/commit/a8e6cc3f4752>`__ |
| 2047 | Don't detect lock timeouts when timebase is invalid |
| 2048 | - `1090f346713a <https://github.com/open-power/skiboot/commit/1090f346713a>`__ |
| 2049 | Revert "platforms/astbmc/slots.c: Allow comparison of bus numbers |
| 2050 | when matching slots" |
| 2051 | - `547377ddcd93 <https://github.com/open-power/skiboot/commit/547377ddcd93>`__ |
| 2052 | occ: Set up OCC messaging even if we fail to setup pstates |
| 2053 | - `80452d2cf2ce <https://github.com/open-power/skiboot/commit/80452d2cf2ce>`__ |
| 2054 | Revert "NPU2 HMIs: dump out a *LOT* of npu2 registers for debugging" |
| 2055 | - `215a7ce1f186 <https://github.com/open-power/skiboot/commit/215a7ce1f186>`__ |
| 2056 | NPU2: dump NPU2 registers on npu2 HMI |
| 2057 | - `c05a8178dffa <https://github.com/open-power/skiboot/commit/c05a8178dffa>`__ |
| 2058 | Fix 'make check' compile for mem\_clear\_range |
| 2059 | - `5771b85b1bc2 <https://github.com/open-power/skiboot/commit/5771b85b1bc2>`__ |
| 2060 | skiboot 5.10.3 release notes |
| 2061 | - `0a1d25fbae1a <https://github.com/open-power/skiboot/commit/0a1d25fbae1a>`__ |
| 2062 | skiboot 5.11-rc1 release notes |
| 2063 | - `36f6c25c7314 <https://github.com/open-power/skiboot/commit/36f6c25c7314>`__ |
| 2064 | core/lock.c: ensure valid start value for lock spin duration warning |
| 2065 | - `6bfe04890f09 <https://github.com/open-power/skiboot/commit/6bfe04890f09>`__ |
| 2066 | doc: Document ibm,heartbeat-ms |
| 2067 | - `9cd6646d25b5 <https://github.com/open-power/skiboot/commit/9cd6646d25b5>`__ |
| 2068 | skiboot 5.10.4 release notes |
| 2069 | - `1b526d85edb2 <https://github.com/open-power/skiboot/commit/1b526d85edb2>`__ |
| 2070 | travis: add -L to all curl invocations to follow redirects |
| 2071 | - `6c53bb6db7f6 <https://github.com/open-power/skiboot/commit/6c53bb6db7f6>`__ |
| 2072 | skiboot-5.11 release notes |
| 2073 | |
| 2074 | Vaibhav Jain (6): |
| 2075 | |
| 2076 | - `53c4553dd767 <https://github.com/open-power/skiboot/commit/53c4553dd767>`__ |
| 2077 | capp: Disable fast-reboot when capp is enabled |
| 2078 | - `a72d055d9337 <https://github.com/open-power/skiboot/commit/a72d055d9337>`__ |
| 2079 | capp: Make error in capp timebase sync a non-fatal error |
| 2080 | - `b1190f403248 <https://github.com/open-power/skiboot/commit/b1190f403248>`__ |
| 2081 | capp: Disable fast-reboot whenever enable\_capi\_mode() is called |
| 2082 | - `09b853cae0aa <https://github.com/open-power/skiboot/commit/09b853cae0aa>`__ |
| 2083 | capi: Poll Err/Status register during CAPP recovery |
| 2084 | - `1d7067e7a3f5 <https://github.com/open-power/skiboot/commit/1d7067e7a3f5>`__ |
| 2085 | phb4: Reset FIR/NFIR registers before PHB4 probe |
| 2086 | - `cfe9d4416aab <https://github.com/open-power/skiboot/commit/cfe9d4416aab>`__ |
| 2087 | core/cpu: Prevent clobbering of stack guard for boot-cpu |
| 2088 | |
| 2089 | Vasant Hegde (1): |
| 2090 | |
| 2091 | - `1dacecd2b28b <https://github.com/open-power/skiboot/commit/1dacecd2b28b>`__ |
| 2092 | core: Fix 'opal-runtime-size' property |
| 2093 | |
| 2094 | Package: witherspoon-xml |
| 2095 | ------------------------ |
| 2096 | |
| 2097 | `Repository <https://github.com/open-power/witherspoon-xml>`__ |
| 2098 | |
| 2099 | Patches |
| 2100 | ~~~~~~~ |
| 2101 | |
| 2102 | Commits |
| 2103 | ~~~~~~~ |
| 2104 | |
| 2105 | Erich Hauptli (4): |
| 2106 | |
| 2107 | - `6ca015dbd3e1 <https://github.com/open-power/witherspoon-xml/commit/6ca015dbd3e1>`__ |
| 2108 | Syncing MRW with op-release |
| 2109 | - `c10638fa2a83 <https://github.com/open-power/witherspoon-xml/commit/c10638fa2a83>`__ |
| 2110 | Switching back to OBus bucket 1 |
| 2111 | - `500533412079 <https://github.com/open-power/witherspoon-xml/commit/500533412079>`__ |
| 2112 | TPM FRU Addition and WOF p2 enablement |
| 2113 | - `18591a3eba4f <https://github.com/open-power/witherspoon-xml/commit/18591a3eba4f>`__ |
| 2114 | Enabling OCC telemetry data logs |
| 2115 | |
| 2116 | Package: zaius-xml |
| 2117 | ------------------ |
| 2118 | |
| 2119 | `Repository <https://github.com/open-power/zaius-xml>`__ |
| 2120 | |
| 2121 | Patches |
| 2122 | ~~~~~~~ |
| 2123 | |
| 2124 | Commits |
| 2125 | ~~~~~~~ |
| 2126 | |
| 2127 | Adrian Barrera (4): |
| 2128 | |
| 2129 | - `ca689febb5a6 <https://github.com/open-power/zaius-xml/commit/ca689febb5a6>`__ |
| 2130 | Update EREPAIR attributes |
| 2131 | - `5e48835aacb1 <https://github.com/open-power/zaius-xml/commit/5e48835aacb1>`__ |
| 2132 | Update Obus PLL bucket to 25G |
| 2133 | - `a426841eeba2 <https://github.com/open-power/zaius-xml/commit/a426841eeba2>`__ |
| 2134 | Set Obus channel type to cable |
| 2135 | - `4b012a3d1da5 <https://github.com/open-power/zaius-xml/commit/4b012a3d1da5>`__ |
| 2136 | Add new 23c WOF table |