Deployment Bot (from Travis CI) | 6d7e6e9 | 2021-06-14 19:18:41 +0000 | [diff] [blame] | 1 | |
| 2 | <!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" |
| 3 | "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> |
| 4 | |
| 5 | <html xmlns="http://www.w3.org/1999/xhtml"> |
| 6 | <head> |
| 7 | <meta http-equiv="X-UA-Compatible" content="IE=Edge" /> |
| 8 | <meta http-equiv="Content-Type" content="text/html; charset=utf-8" /> |
| 9 | <title>Release Notes for OpenPower Firmware v1.22-rc1 — OpenPOWER Firmware v2.6-257-g5b5624c2 |
| 10 | documentation</title> |
| 11 | <link rel="stylesheet" href="../_static/alabaster.css" type="text/css" /> |
| 12 | <link rel="stylesheet" href="../_static/pygments.css" type="text/css" /> |
| 13 | <script type="text/javascript" id="documentation_options" data-url_root="../" src="../_static/documentation_options.js"></script> |
| 14 | <script type="text/javascript" src="../_static/jquery.js"></script> |
| 15 | <script type="text/javascript" src="../_static/underscore.js"></script> |
| 16 | <script type="text/javascript" src="../_static/doctools.js"></script> |
| 17 | <link rel="index" title="Index" href="../genindex.html" /> |
| 18 | <link rel="search" title="Search" href="../search.html" /> |
| 19 | <link rel="next" title="Release Notes for OpenPower Firmware v1.22" href="v1.22.html" /> |
| 20 | <link rel="prev" title="Release Notes for OpenPower Firmware v1.21.2" href="v1.21.2.html" /> |
| 21 | |
| 22 | <link rel="stylesheet" href="../_static/custom.css" type="text/css" /> |
| 23 | |
| 24 | |
| 25 | <meta name="viewport" content="width=device-width, initial-scale=0.9, maximum-scale=0.9" /> |
| 26 | |
| 27 | </head><body> |
| 28 | |
| 29 | |
| 30 | <div class="document"> |
| 31 | <div class="documentwrapper"> |
| 32 | <div class="bodywrapper"> |
| 33 | |
| 34 | |
| 35 | <div class="body" role="main"> |
| 36 | |
| 37 | <div class="section" id="release-notes-for-openpower-firmware-v1-22-rc1"> |
| 38 | <h1>Release Notes for OpenPower Firmware v1.22-rc1<a class="headerlink" href="#release-notes-for-openpower-firmware-v1-22-rc1" title="Permalink to this headline">¶</a></h1> |
| 39 | <p>Please note that this is a RELEASE CANDIDATE and not the final v1.22 |
| 40 | release. We expect to do a final v1.21 tagged release before the |
| 41 | first week of April is done.</p> |
| 42 | <p>This release (including the final v1.21) is NOT intended for GA POWER9 |
| 43 | platforms. For that, you will need the (future) op-build v2.0.</p> |
| 44 | <div class="section" id="known-issues"> |
| 45 | <h2>Known Issues<a class="headerlink" href="#known-issues" title="Permalink to this headline">¶</a></h2> |
| 46 | <p>The following stop states are disabled: 4,5,11. We believe all the bugs |
| 47 | have been shaken out of stop4 and stop5, and they will be enabled immediately |
| 48 | after v1.22.</p> |
| 49 | </div> |
| 50 | <div class="section" id="new-platforms"> |
| 51 | <h2>New platforms<a class="headerlink" href="#new-platforms" title="Permalink to this headline">¶</a></h2> |
| 52 | <ul> |
| 53 | <li><p class="first">vesnin</p> |
| 54 | <p>A 4 socket 2U POWER8 system with up to 8TB of memory from YADRO. |
| 55 | There are still some outstanding hostboot patches that are currently |
| 56 | being reviewed in order to have full Vesnin support upstream.</p> |
| 57 | </li> |
| 58 | </ul> |
| 59 | </div> |
| 60 | <div class="section" id="updated-packages"> |
| 61 | <h2>Updated Packages<a class="headerlink" href="#updated-packages" title="Permalink to this headline">¶</a></h2> |
| 62 | <table border="1" class="docutils"> |
| 63 | <colgroup> |
| 64 | <col width="8%" /> |
| 65 | <col width="21%" /> |
| 66 | <col width="21%" /> |
| 67 | <col width="51%" /> |
| 68 | </colgroup> |
| 69 | <thead valign="bottom"> |
| 70 | <tr class="row-odd"><th class="head">Pack |
| 71 | age</th> |
| 72 | <th class="head">Old Version</th> |
| 73 | <th class="head">New Version</th> |
| 74 | <th class="head">Platforms</th> |
| 75 | </tr> |
| 76 | </thead> |
| 77 | <tbody valign="top"> |
| 78 | <tr class="row-even"><td>glib |
| 79 | c</td> |
| 80 | <td>glibc-2.26-73- |
| 81 | g4b692dffb95ac |
| 82 | 4812b161eb6a16 |
| 83 | 113d7e824982e</td> |
| 84 | <td>glibc-2.26-107 |
| 85 | -g73a92363619e |
| 86 | 52c458146e903d |
| 87 | fb9b1ba823aa40</td> |
| 88 | <td>barreleye, firenze, firestone, |
| 89 | garrison, habanero, openpower_mambo, |
| 90 | openpower_p9_mambo, p9dsu, |
| 91 | palmetto, pseries, romulus, |
| 92 | witherspoon, zaius, zz</td> |
| 93 | </tr> |
| 94 | <tr class="row-odd"><td>host |
| 95 | boot</td> |
| 96 | <td>28927a78ca4144 |
| 97 | aa8214d35b7ad7 |
| 98 | e2ddba5ada4e</td> |
| 99 | <td>6eaa4575c95a2a |
| 100 | 5bccfad3e861a8 |
| 101 | 55ffd8446aa3</td> |
| 102 | <td>p9dsu, romulus, witherspoon, zaius</td> |
| 103 | </tr> |
| 104 | <tr class="row-even"><td>host |
| 105 | boot |
| 106 | -bin |
| 107 | arie |
| 108 | s</td> |
| 109 | <td>6924d6b711ba7b |
| 110 | 1d4c47346c9a8d |
| 111 | ff88cfaaf4c8</td> |
| 112 | <td>2657e58ac28a32 |
| 113 | c73a3002c715b6 |
| 114 | ea9d8880f112</td> |
| 115 | <td>barreleye, firestone, garrison, |
| 116 | habanero, p9dsu, palmetto, romulus, |
| 117 | witherspoon, zaius</td> |
| 118 | </tr> |
| 119 | <tr class="row-odd"><td>ima- |
| 120 | cata |
| 121 | log</td> |
| 122 | <td>01b26a136da16a |
| 123 | 87c0b6b3c4d9f2 |
| 124 | 7555dca104dc</td> |
| 125 | <td>90237254664cad |
| 126 | ab529a39796508 |
| 127 | 3e38806d92e6</td> |
| 128 | <td>barreleye, firestone, garrison, |
| 129 | habanero, p9dsu, palmetto, romulus, |
| 130 | witherspoon, zaius</td> |
| 131 | </tr> |
| 132 | <tr class="row-even"><td>libf |
| 133 | lash</td> |
| 134 | <td>v5.9-166-g70f1 |
| 135 | 4f4dd86e</td> |
| 136 | <td>v5.10.1</td> |
| 137 | <td>barreleye, firenze, firestone, |
| 138 | garrison, habanero, p9dsu, palmetto, |
| 139 | pseries, romulus, witherspoon, zaius, |
| 140 | zz</td> |
| 141 | </tr> |
| 142 | <tr class="row-odd"><td>linu |
| 143 | x</td> |
| 144 | <td>4.14.20</td> |
| 145 | <td>4.15.9</td> |
| 146 | <td>barreleye, firenze, firestone, |
| 147 | garrison, habanero, openpower_mambo, |
| 148 | openpower_p9_mambo, p9dsu, |
| 149 | palmetto, pseries, romulus, |
| 150 | witherspoon, zaius, zz</td> |
| 151 | </tr> |
| 152 | <tr class="row-even"><td>linu |
| 153 | x-he |
| 154 | ader |
| 155 | s</td> |
| 156 | <td>4.14.20</td> |
| 157 | <td>4.15.9</td> |
| 158 | <td>barreleye, firenze, firestone, |
| 159 | garrison, habanero, openpower_mambo, |
| 160 | openpower_p9_mambo, p9dsu, |
| 161 | palmetto, pseries, romulus, |
| 162 | witherspoon, zaius, zz</td> |
| 163 | </tr> |
| 164 | <tr class="row-odd"><td>mach |
| 165 | ine- |
| 166 | xml</td> |
| 167 | <td>58554bfabd7f35 |
| 168 | 6bc9db3e493816 |
| 169 | 2acd445fc559</td> |
| 170 | <td>c10638fa2a834c |
| 171 | 216f28da7705da |
| 172 | 331bc0bad4bf</td> |
| 173 | <td>witherspoon</td> |
| 174 | </tr> |
| 175 | <tr class="row-even"><td>mach |
| 176 | ine- |
| 177 | xml</td> |
| 178 | <td>b0884b3032df60 |
| 179 | e49eff4b212719 |
| 180 | f8d49a5d6be7</td> |
| 181 | <td>4b012a3d1da538 |
| 182 | b3fb97c332b6fc |
| 183 | e51a6cffaf9a</td> |
| 184 | <td>zaius</td> |
| 185 | </tr> |
| 186 | <tr class="row-odd"><td>occ</td> |
| 187 | <td>f72f857b7e5ab2 |
| 188 | 5a5616b1655005 |
| 189 | b963405eb350</td> |
| 190 | <td>768466b31e853c |
| 191 | b11dfa90dbfc15 |
| 192 | 65a21ee9646e</td> |
| 193 | <td>p9dsu, romulus, witherspoon, zaius</td> |
| 194 | </tr> |
| 195 | <tr class="row-even"><td>open |
| 196 | powe |
| 197 | r-pn |
| 198 | or</td> |
| 199 | <td>b210f15c69933e |
| 200 | 21494323a8f501 |
| 201 | 7501e7b2c1de</td> |
| 202 | <td>824b1bf91c6f03 |
| 203 | 0e696c1a4d72b7 |
| 204 | 311985006705</td> |
| 205 | <td>barreleye, firestone, garrison, |
| 206 | habanero, p9dsu, palmetto, romulus, |
| 207 | witherspoon, zaius</td> |
| 208 | </tr> |
| 209 | <tr class="row-odd"><td>peti |
| 210 | tboo |
| 211 | t</td> |
| 212 | <td>v1.6.6</td> |
| 213 | <td>v1.7.1</td> |
| 214 | <td>barreleye, firenze, firestone, |
| 215 | garrison, habanero, openpower_mambo, |
| 216 | openpower_p9_mambo, p9dsu, |
| 217 | palmetto, pseries, romulus, |
| 218 | witherspoon, zaius, zz</td> |
| 219 | </tr> |
| 220 | <tr class="row-even"><td>sbe</td> |
| 221 | <td>0aae9a8e68abb5 |
| 222 | 5110bee2d7bd2f |
| 223 | be49a4a11e70</td> |
| 224 | <td>5c0363924c7d71 |
| 225 | 0146155b3354b2 |
| 226 | 36012372dd24</td> |
| 227 | <td>p9dsu, romulus, witherspoon, zaius</td> |
| 228 | </tr> |
| 229 | <tr class="row-odd"><td>skib |
| 230 | oot</td> |
| 231 | <td>v5.10</td> |
| 232 | <td>v5.11-rc1</td> |
| 233 | <td>barreleye, firenze, firestone, |
| 234 | garrison, habanero, openpower_mambo, |
| 235 | openpower_p9_mambo, p9dsu, |
| 236 | palmetto, pseries, romulus, |
| 237 | witherspoon, zaius, zz</td> |
| 238 | </tr> |
| 239 | </tbody> |
| 240 | </table> |
| 241 | </div> |
| 242 | <div class="section" id="new-packages"> |
| 243 | <h2>New Packages<a class="headerlink" href="#new-packages" title="Permalink to this headline">¶</a></h2> |
| 244 | <table border="1" class="docutils"> |
| 245 | <colgroup> |
| 246 | <col width="31%" /> |
| 247 | <col width="31%" /> |
| 248 | <col width="37%" /> |
| 249 | </colgroup> |
| 250 | <thead valign="bottom"> |
| 251 | <tr class="row-odd"><th class="head">Package</th> |
| 252 | <th class="head">Version</th> |
| 253 | <th class="head">Platforms</th> |
| 254 | </tr> |
| 255 | </thead> |
| 256 | <tbody valign="top"> |
| 257 | <tr class="row-even"><td> </td> |
| 258 | <td> </td> |
| 259 | <td> </td> |
| 260 | </tr> |
| 261 | </tbody> |
| 262 | </table> |
| 263 | </div> |
| 264 | <div class="section" id="removed-packages"> |
| 265 | <h2>Removed Packages<a class="headerlink" href="#removed-packages" title="Permalink to this headline">¶</a></h2> |
| 266 | <table border="1" class="docutils"> |
| 267 | <colgroup> |
| 268 | <col width="16%" /> |
| 269 | <col width="65%" /> |
| 270 | <col width="19%" /> |
| 271 | </colgroup> |
| 272 | <thead valign="bottom"> |
| 273 | <tr class="row-odd"><th class="head">Package</th> |
| 274 | <th class="head">Version</th> |
| 275 | <th class="head">Platforms</th> |
| 276 | </tr> |
| 277 | </thead> |
| 278 | <tbody valign="top"> |
| 279 | <tr class="row-even"><td>sbe</td> |
| 280 | <td>0aae9a8e68abb55110bee2d7bd2fbe49a4a11e70</td> |
| 281 | <td>zz</td> |
| 282 | </tr> |
| 283 | </tbody> |
| 284 | </table> |
| 285 | </div> |
| 286 | <div class="section" id="package-barreleye-xml"> |
| 287 | <h2>Package: barreleye-xml<a class="headerlink" href="#package-barreleye-xml" title="Permalink to this headline">¶</a></h2> |
| 288 | <p><a class="reference external" href="https://github.com/open-power/barreleye-xml">Repository</a></p> |
| 289 | <div class="section" id="patches"> |
| 290 | <h3>Patches<a class="headerlink" href="#patches" title="Permalink to this headline">¶</a></h3> |
| 291 | </div> |
| 292 | <div class="section" id="commits"> |
| 293 | <h3>Commits<a class="headerlink" href="#commits" title="Permalink to this headline">¶</a></h3> |
| 294 | <p>No changes.</p> |
| 295 | </div> |
| 296 | </div> |
| 297 | <div class="section" id="package-firestone-xml"> |
| 298 | <h2>Package: firestone-xml<a class="headerlink" href="#package-firestone-xml" title="Permalink to this headline">¶</a></h2> |
| 299 | <p><a class="reference external" href="https://github.com/open-power/firestone-xml">Repository</a></p> |
| 300 | <div class="section" id="id1"> |
| 301 | <h3>Patches<a class="headerlink" href="#id1" title="Permalink to this headline">¶</a></h3> |
| 302 | </div> |
| 303 | <div class="section" id="id2"> |
| 304 | <h3>Commits<a class="headerlink" href="#id2" title="Permalink to this headline">¶</a></h3> |
| 305 | <p>No changes.</p> |
| 306 | </div> |
| 307 | </div> |
| 308 | <div class="section" id="package-garrison-xml"> |
| 309 | <h2>Package: garrison-xml<a class="headerlink" href="#package-garrison-xml" title="Permalink to this headline">¶</a></h2> |
| 310 | <p><a class="reference external" href="https://github.com/open-power/garrison-xml">Repository</a></p> |
| 311 | <div class="section" id="id3"> |
| 312 | <h3>Patches<a class="headerlink" href="#id3" title="Permalink to this headline">¶</a></h3> |
| 313 | </div> |
| 314 | <div class="section" id="id4"> |
| 315 | <h3>Commits<a class="headerlink" href="#id4" title="Permalink to this headline">¶</a></h3> |
| 316 | <p>No changes.</p> |
| 317 | </div> |
| 318 | </div> |
| 319 | <div class="section" id="package-habanero-xml"> |
| 320 | <h2>Package: habanero-xml<a class="headerlink" href="#package-habanero-xml" title="Permalink to this headline">¶</a></h2> |
| 321 | <p><a class="reference external" href="https://github.com/open-power/habanero-xml">Repository</a></p> |
| 322 | <div class="section" id="id5"> |
| 323 | <h3>Patches<a class="headerlink" href="#id5" title="Permalink to this headline">¶</a></h3> |
| 324 | </div> |
| 325 | <div class="section" id="id6"> |
| 326 | <h3>Commits<a class="headerlink" href="#id6" title="Permalink to this headline">¶</a></h3> |
| 327 | <p>No changes.</p> |
| 328 | </div> |
| 329 | </div> |
| 330 | <div class="section" id="package-hostboot"> |
| 331 | <h2>Package: hostboot<a class="headerlink" href="#package-hostboot" title="Permalink to this headline">¶</a></h2> |
| 332 | <p><a class="reference external" href="https://github.com/open-power/hostboot">Repository</a></p> |
| 333 | <div class="section" id="id7"> |
| 334 | <h3>Patches<a class="headerlink" href="#id7" title="Permalink to this headline">¶</a></h3> |
| 335 | </div> |
| 336 | <div class="section" id="id8"> |
| 337 | <h3>Commits<a class="headerlink" href="#id8" title="Permalink to this headline">¶</a></h3> |
| 338 | <p>Abhishek Agarwal (1):</p> |
| 339 | <ul class="simple"> |
| 340 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/fdbb8517ab31">fdbb8517ab31</a> |
| 341 | ATTR_CHIP_EC_FEATURE_HW406337 support for Axone</li> |
| 342 | </ul> |
| 343 | <p>Alex Taft (4):</p> |
| 344 | <ul class="simple"> |
| 345 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c078ed5d8667">c078ed5d8667</a> |
| 346 | New dummy pulse pok bits (for L2/L3)</li> |
| 347 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/da32698522da">da32698522da</a> |
| 348 | HW405413 : NCU sends data out of order</li> |
| 349 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/e8c20a22ad09">e8c20a22ad09</a> |
| 350 | L3 initfile updates</li> |
| 351 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/7dea31a9b0b0">7dea31a9b0b0</a> |
| 352 | L3 Initfile: Qualify divide_minor setting</li> |
| 353 | </ul> |
| 354 | <p>Alpana Kumari (1):</p> |
| 355 | <ul class="simple"> |
| 356 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/bd85928cb6ab">bd85928cb6ab</a> |
| 357 | Fix enum in dimmConsts.H</li> |
| 358 | </ul> |
| 359 | <p>Amit Tendolkar (3):</p> |
| 360 | <ul class="simple"> |
| 361 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a2c708da6e1a">a2c708da6e1a</a> |
| 362 | Add PGPE XIRs to Special Wakeup Failure FFDC</li> |
| 363 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/def84fb4f740">def84fb4f740</a> |
| 364 | Enable setting the stop recovery enabled/disable policy in SGPE Init</li> |
| 365 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/18d91f4a458f">18d91f4a458f</a> |
| 366 | Update p9_collect_ppe_state to dynamically collect PPE FFDC</li> |
| 367 | </ul> |
| 368 | <p>Andre Marin (14):</p> |
| 369 | <ul class="simple"> |
| 370 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/f595ecf7f9d0">f595ecf7f9d0</a> |
| 371 | Add address translation (xlate) support for 4Gbx8 and unit tests</li> |
| 372 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/443282a786ee">443282a786ee</a> |
| 373 | Fixes memdiags broadcast mode address check bug</li> |
| 374 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c50ad6201b4a">c50ad6201b4a</a> |
| 375 | Add base spd decoder to share among controllers</li> |
| 376 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/157d87dcea5a">157d87dcea5a</a> |
| 377 | Change base decoder, add ddr4 namespace, and common API btw modules</li> |
| 378 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b0eb26a290f0">b0eb26a290f0</a> |
| 379 | Add const to the end of spd decoder methods to denote unchanged mem |
| 380 | vars</li> |
| 381 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/e1e78b687d15">e1e78b687d15</a> |
| 382 | Add Connector to SDRAM Bit Mapping to the SPD decoder and unit tests</li> |
| 383 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b6de6f7655df">b6de6f7655df</a> |
| 384 | Split SPD Connector to SDRAM fields, add unit tests</li> |
| 385 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d9cde7352d62">d9cde7352d62</a> |
| 386 | Remove override flag for ATTR_MSS_MRW_ALLOW_UNSUPPORTED_RCW, |
| 387 | deconfig update</li> |
| 388 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3ffad4a09011">3ffad4a09011</a> |
| 389 | Remove mss::c_str dependency for SPD decoder for future reuse</li> |
| 390 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/71987fc9ba5a">71987fc9ba5a</a> |
| 391 | Add DLL workaround and unit tests</li> |
| 392 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3eb1f8ab1705">3eb1f8ab1705</a> |
| 393 | Disable mem clk stop when in STR for DD2.* only</li> |
| 394 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/e9b81f6e0311">e9b81f6e0311</a> |
| 395 | Remove reset_dll from scominit, enable delay line tap points</li> |
| 396 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/04088f2ddf58">04088f2ddf58</a> |
| 397 | Modified gen_accessors script for greater support</li> |
| 398 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ab7f5582fdba">ab7f5582fdba</a> |
| 399 | Remove logic to disable memory clocks in STR if in |
| 400 | PD_AND_STR_CLK_STOP mode</li> |
| 401 | </ul> |
| 402 | <p>Anusha Reddy Rangareddygari (7):</p> |
| 403 | <ul class="simple"> |
| 404 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/37f1636463ec">37f1636463ec</a> |
| 405 | Ec_level attribute support for DD1 attributes</li> |
| 406 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b722a87509e1">b722a87509e1</a> |
| 407 | DD2 updates:p9_sbe_arrayinit,p9_sbe_tp_arrayinit</li> |
| 408 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/9194b0c4c0cc">9194b0c4c0cc</a> |
| 409 | VITAL cleaning for DD2</li> |
| 410 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/313d850ed60d">313d850ed60d</a> |
| 411 | p9_start_cbs updates</li> |
| 412 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/37f0ec3dddbd">37f0ec3dddbd</a> |
| 413 | p9_sbe_chiplet_reset,p9_sbe_arrayinit</li> |
| 414 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/5ac11d13ae61">5ac11d13ae61</a> |
| 415 | Cumulus proc updates</li> |
| 416 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/156a0bd71156">156a0bd71156</a> |
| 417 | Axone Update</li> |
| 418 | </ul> |
| 419 | <p>Ben Gass (15):</p> |
| 420 | <ul class="simple"> |
| 421 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/5ebf782126ac">5ebf782126ac</a> |
| 422 | Add support for p9c 1.2</li> |
| 423 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a8bf720f6890">a8bf720f6890</a> |
| 424 | Turn off 64byte checkbit inversion for simulation in |
| 425 | centaur.mbs.scom.initfile</li> |
| 426 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ef607c81e101">ef607c81e101</a> |
| 427 | Axone MC uses same pll/clock setup as in Cumulus.</li> |
| 428 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3877eeac3ff3">3877eeac3ff3</a> |
| 429 | Remove PROC_FABRIC_LINK_ACTIVE from OBUS_FBC_ENABLED in |
| 430 | p9.obus.scom.initfile</li> |
| 431 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8aefe57f98f5">8aefe57f98f5</a> |
| 432 | Adding chip_ec_feature attributes for dd2 build</li> |
| 433 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/21200ba766f3">21200ba766f3</a> |
| 434 | Set NDL IOValids based on configured NV links.</li> |
| 435 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/7375de1dcebd">7375de1dcebd</a> |
| 436 | Update filter pll settings as per HW407180</li> |
| 437 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/749693530aed">749693530aed</a> |
| 438 | Use obus p9ndd1 spy name attribute for obus initfile</li> |
| 439 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/f52bb2280385">f52bb2280385</a> |
| 440 | Create dmi.pll.scan.initfile</li> |
| 441 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a69039374bbe">a69039374bbe</a> |
| 442 | Updates for HW416934 and HW417233</li> |
| 443 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/0844be4f3967">0844be4f3967</a> |
| 444 | Adding p9a support.</li> |
| 445 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/5b9b993f082c">5b9b993f082c</a> |
| 446 | Re-submit Axone updates</li> |
| 447 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d3594cc4abcb">d3594cc4abcb</a> |
| 448 | Add support for p9c 1.2</li> |
| 449 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/277e5d2085cd">277e5d2085cd</a> |
| 450 | Axone MC uses same pll/clock setup as in Cumulus.</li> |
| 451 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/9bea281bae99">9bea281bae99</a> |
| 452 | Add p9n 2.3 to p9_frequency_buckets.H</li> |
| 453 | </ul> |
| 454 | <p>Benjamin Weisenbeck (1):</p> |
| 455 | <ul class="simple"> |
| 456 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/24bcf5732469">24bcf5732469</a> |
| 457 | PRD: Fix data storage exception in PLL analysis</li> |
| 458 | </ul> |
| 459 | <p>Bill Hoffa (5):</p> |
| 460 | <ul class="simple"> |
| 461 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/014e0ae7136c">014e0ae7136c</a> |
| 462 | Add Kernel Debug Trace for Out of Memory condition</li> |
| 463 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ddb2012f39d5">ddb2012f39d5</a> |
| 464 | Enable Cumulus CDIMM Config</li> |
| 465 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a2dc8952afa9">a2dc8952afa9</a> |
| 466 | Deliver cumulus_cdimm pnor image to fips for Simics regression |
| 467 | testing</li> |
| 468 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/9de67e525158">9de67e525158</a> |
| 469 | Update Bbuild to b0316a_1813.920</li> |
| 470 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/425eb895f440">425eb895f440</a> |
| 471 | Add ATTR_ prefix to attributes missing it in |
| 472 | hb_customized_attrs.xml</li> |
| 473 | </ul> |
| 474 | <p>Brian Bakke (2):</p> |
| 475 | <ul class="simple"> |
| 476 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3403445e2f75">3403445e2f75</a> |
| 477 | Fix and codify how system and node targets are handled by attribute |
| 478 | overrides</li> |
| 479 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/bb0dc7d71263">bb0dc7d71263</a> |
| 480 | Add common XSCOM error literals to HBRT</li> |
| 481 | </ul> |
| 482 | <p>Brian Silver (3):</p> |
| 483 | <ul class="simple"> |
| 484 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/57808f6af451">57808f6af451</a> |
| 485 | Add EC feature levels to MSS workarounds</li> |
| 486 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b76592c3358c">b76592c3358c</a> |
| 487 | Add EC workaround for PHY training bad bit processing</li> |
| 488 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8ccd1b475062">8ccd1b475062</a> |
| 489 | Add Memory Subsystem FIR support</li> |
| 490 | </ul> |
| 491 | <p>Brian Stegmiller (3):</p> |
| 492 | <ul class="simple"> |
| 493 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/2993c5b32a67">2993c5b32a67</a> |
| 494 | PRD: Add regs to capture list for NVLINK analysis</li> |
| 495 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8cf2925f7e01">8cf2925f7e01</a> |
| 496 | Monitor threads for HB TI to work</li> |
| 497 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/0e69501ebe5b">0e69501ebe5b</a> |
| 498 | Simics: Skip mem diag due to intermittent action file issues</li> |
| 499 | </ul> |
| 500 | <p>Brian Vanderpool (1):</p> |
| 501 | <ul class="simple"> |
| 502 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/551d7e678a8e">551d7e678a8e</a> |
| 503 | PM: Ignore allow_reg_wakeup in cache contained mode</li> |
| 504 | </ul> |
| 505 | <p>CHRISTINA L. GRAVES (3):</p> |
| 506 | <ul class="simple"> |
| 507 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/316f190cdeac">316f190cdeac</a> |
| 508 | p9_sbe_lpc_init fix with GPIO reset</li> |
| 509 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a7f98e8fe346">a7f98e8fe346</a> |
| 510 | Fix for HW397129-set bit 52 in the ALTD_OPTION reg to keep MC |
| 511 | fastpath enabled</li> |
| 512 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/6567fe47ef12">6567fe47ef12</a> |
| 513 | p9_setup_bars – support DD2 NPU SCOM address changes</li> |
| 514 | </ul> |
| 515 | <p>Caleb Palmer (6):</p> |
| 516 | <ul class="simple"> |
| 517 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/1467cbcb8be5">1467cbcb8be5</a> |
| 518 | Fix target type check in bad dq helper function</li> |
| 519 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/18a73baccdc2">18a73baccdc2</a> |
| 520 | PRD: Don’t skip TPS after failed MemDealloc calls</li> |
| 521 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d2fd055febb7">d2fd055febb7</a> |
| 522 | Free mem and fix dimm trgt in bad dq accessors</li> |
| 523 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/83933bedd3ce">83933bedd3ce</a> |
| 524 | MDIA: Cut mdia patterns from 9 to 4</li> |
| 525 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8f68014a90f6">8f68014a90f6</a> |
| 526 | MDIA: ensure full MBA target support for P9</li> |
| 527 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4bc416f75e08">4bc416f75e08</a> |
| 528 | MDIA: command cleanup support</li> |
| 529 | </ul> |
| 530 | <p>Chris Cain (1):</p> |
| 531 | <ul class="simple"> |
| 532 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/24780f003a4b">24780f003a4b</a> |
| 533 | HTMGT: Cache user power limit from BMC and add proc callout for 2AEx |
| 534 | errors</li> |
| 535 | </ul> |
| 536 | <p>Chris Hanudel (1):</p> |
| 537 | <ul class="simple"> |
| 538 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8dba9b43bdc9">8dba9b43bdc9</a> |
| 539 | Updates for P9 NX DD2 initfiles</li> |
| 540 | </ul> |
| 541 | <p>Christian Geddes (8):</p> |
| 542 | <ul class="simple"> |
| 543 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8d28433bcc3c">8d28433bcc3c</a> |
| 544 | Fix bugs in FSP->HBRT message path for SBE errors</li> |
| 545 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4a60925ef57e">4a60925ef57e</a> |
| 546 | Fix trace bug for error path in rt_fwnotify</li> |
| 547 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/2c4b416ae0cf">2c4b416ae0cf</a> |
| 548 | Remove if that was catching SBE chipop err logs and forcing reboot</li> |
| 549 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c5983ddc3585">c5983ddc3585</a> |
| 550 | Skip attempting sbe_retry when HBRT receives SBE_ERR from HWSV</li> |
| 551 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/10aa31b32fc0">10aa31b32fc0</a> |
| 552 | Re-order sbex calls in presimsetup to get paths updated correctly</li> |
| 553 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/04ba8e387d32">04ba8e387d32</a> |
| 554 | Update autocitest to collect all hostboot dump info prior to failure</li> |
| 555 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/74156401d2fb">74156401d2fb</a> |
| 556 | Don’t include duplicate connections when looking up xbus mapping</li> |
| 557 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/05cda10a435a">05cda10a435a</a> |
| 558 | Update backing build to be b0222a_1810.911</li> |
| 559 | </ul> |
| 560 | <p>Christopher Riedl (1):</p> |
| 561 | <ul class="simple"> |
| 562 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8d3671f0c224">8d3671f0c224</a> |
| 563 | PPM reg collision (HW389511) work-around: Special Wake-up</li> |
| 564 | </ul> |
| 565 | <p>Claus Michael Olsen (4):</p> |
| 566 | <ul class="simple"> |
| 567 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3fbe556d9d69">3fbe556d9d69</a> |
| 568 | Additional risk level support - (step 2) Updating the image w/RL2</li> |
| 569 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a563b914d6dc">a563b914d6dc</a> |
| 570 | xip_customize: GPTR/overlays stage 1 support</li> |
| 571 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/50a391ac5965">50a391ac5965</a> |
| 572 | HW425038 INT ARX timeout workaround - Updated initfiles to 49241</li> |
| 573 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/68f67bd7aab5">68f67bd7aab5</a> |
| 574 | Update to putRingUtils to proper scanning of perv_pll_bndy_flt |
| 575 | rings</li> |
| 576 | </ul> |
| 577 | <p>Corey Swenson (4):</p> |
| 578 | <ul class="simple"> |
| 579 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4cf79f8dc40b">4cf79f8dc40b</a> |
| 580 | Changes to Inband SCOM MMIO ranges for Cumulus</li> |
| 581 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/53635aee4925">53635aee4925</a> |
| 582 | Delete ATTR_DMI_INBAND_BAR_ENABLE when processing MRW attributes</li> |
| 583 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ed84b08afa87">ed84b08afa87</a> |
| 584 | Inband SCOM clean up</li> |
| 585 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b4699ae10c2a">b4699ae10c2a</a> |
| 586 | Add inband bar address to simics xml</li> |
| 587 | </ul> |
| 588 | <p>Dan Crowell (16):</p> |
| 589 | <ul class="simple"> |
| 590 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b47f658c6e96">b47f658c6e96</a> |
| 591 | Pull ATTR_MSS_MRW_FORCE_BCMODE_OFF from MRW if it exists</li> |
| 592 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/431a3cc0aa10">431a3cc0aa10</a> |
| 593 | Bug fixes for concurrent update of HBRT</li> |
| 594 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4a0eb030e761">4a0eb030e761</a> |
| 595 | Mirror fixup - spd_decoder_base.H</li> |
| 596 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/36766721c030">36766721c030</a> |
| 597 | Disable WOF for Cumulus DD1.0</li> |
| 598 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4f43040cb271">4f43040cb271</a> |
| 599 | Enable WOF_VRATIO on ZZ</li> |
| 600 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/f5d2c874d072">f5d2c874d072</a> |
| 601 | Removing old TODO for dropped requirement</li> |
| 602 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/309422a68f39">309422a68f39</a> |
| 603 | Fix EID range for HBRT logs</li> |
| 604 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/586b8b1e6088">586b8b1e6088</a> |
| 605 | Do not elevate severity of reconfig error log</li> |
| 606 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/e4a7de38d08d">e4a7de38d08d</a> |
| 607 | No longer include BAR attributes in ServerWiz2 export</li> |
| 608 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/5683e4887711">5683e4887711</a> |
| 609 | Remirror chip_ec_attributes.xml</li> |
| 610 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/7b96070e5a1f">7b96070e5a1f</a> |
| 611 | Disabling WOF and VDM for Nimbus DD2.0</li> |
| 612 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/eb7c0e1f8327">eb7c0e1f8327</a> |
| 613 | Disable WOF for Cumulus DD1.0</li> |
| 614 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/945553cc05cf">945553cc05cf</a> |
| 615 | Force single-threaded access to HWPs in PRD</li> |
| 616 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/54d16a1476fe">54d16a1476fe</a> |
| 617 | Add proc huid to PSU trace</li> |
| 618 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/bbe9dd41d809">bbe9dd41d809</a> |
| 619 | Fix FFDC for FW Request Errors</li> |
| 620 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4d755323a660">4d755323a660</a> |
| 621 | Completely hide attributes that have no value</li> |
| 622 | </ul> |
| 623 | <p>Daniel Howe (3):</p> |
| 624 | <ul class="simple"> |
| 625 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/928dab2ae2c2">928dab2ae2c2</a> |
| 626 | Allow lpc_ed for p9n 2.2 per HW418117 fix</li> |
| 627 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/55b4dac7353b">55b4dac7353b</a> |
| 628 | update data token init to use scans on p9c 1.1</li> |
| 629 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/acd49fe41045">acd49fe41045</a> |
| 630 | dd1.1+ DL training procedure updates</li> |
| 631 | </ul> |
| 632 | <p>Daniel M. Crowell (1):</p> |
| 633 | <ul class="simple"> |
| 634 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/2fd3b08eed59">2fd3b08eed59</a> |
| 635 | Revert “Adds self time refresh entry and exit helper functions”</li> |
| 636 | </ul> |
| 637 | <p>David Kauer (4):</p> |
| 638 | <ul class="simple"> |
| 639 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/112c8bd6e114">112c8bd6e114</a> |
| 640 | Update INT DD2 initfiles</li> |
| 641 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/e53b287b70c0">e53b287b70c0</a> |
| 642 | Added Nimbus & Cumulus attributes for INT initfiles</li> |
| 643 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/128afcc6737f">128afcc6737f</a> |
| 644 | HW425038 INT ARX timeout workaround</li> |
| 645 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/240defa5f9b2">240defa5f9b2</a> |
| 646 | Modify INT FIR configuration settings</li> |
| 647 | </ul> |
| 648 | <p>Dean Sanner (2):</p> |
| 649 | <ul class="simple"> |
| 650 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/2414e7c8e5de">2414e7c8e5de</a> |
| 651 | Support sending chip info to SBEs on multinode</li> |
| 652 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d6f9a2206311">d6f9a2206311</a> |
| 653 | Force 25G Nvlink speed on P9N DD2.1</li> |
| 654 | </ul> |
| 655 | <p>Elizabeth Liner (3):</p> |
| 656 | <ul class="simple"> |
| 657 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8f1ef46890d9">8f1ef46890d9</a> |
| 658 | Adding visible error once we know that the SBE is erroring</li> |
| 659 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c142eb850380">c142eb850380</a> |
| 660 | Adding attribute to detect which processor we can use for alt-memory</li> |
| 661 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4761f0cf880a">4761f0cf880a</a> |
| 662 | Updating HWP’s to use PROC_CHIP_MEM_TO_USE attribute</li> |
| 663 | </ul> |
| 664 | <p>Emmanuel Sacristan (1):</p> |
| 665 | <ul class="simple"> |
| 666 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/7a09b00b1558">7a09b00b1558</a> |
| 667 | NMMU Nimbus dd2 scom/scan updates, updated comments</li> |
| 668 | </ul> |
| 669 | <p>Greg Still (7):</p> |
| 670 | <ul class="simple"> |
| 671 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/f9b500d310ee">f9b500d310ee</a> |
| 672 | PM: GPE timer fix (HW389045 - Update Shadow copy of TSEL)</li> |
| 673 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/420c26669087">420c26669087</a> |
| 674 | PM: refine enablement attributes for advanced functions |
| 675 | (VDM,RESCLK,WOF,IVRM)</li> |
| 676 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/52074db64a3d">52074db64a3d</a> |
| 677 | PM: Move to chip EC based #V validity checking in |
| 678 | p9_pstate_parameter_block</li> |
| 679 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a2a54161270c">a2a54161270c</a> |
| 680 | VDM: p9_pstate_parameter_block check for VDM Large threshold < |
| 681 | -32mV</li> |
| 682 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/cbcd27d3a629">cbcd27d3a629</a> |
| 683 | PM: p9_setup_evid steps voltage to avoid Fleetwood VRM limitations</li> |
| 684 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c3364dfd2650">c3364dfd2650</a> |
| 685 | PM: p9_setup_evid - deal with attribute clearing during MPIPL</li> |
| 686 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/9b5cfe7260ef">9b5cfe7260ef</a> |
| 687 | PM: Enhance p9_pm_pss_init for reset error logging</li> |
| 688 | </ul> |
| 689 | <p>Ilya Smirnov (5):</p> |
| 690 | <ul class="simple"> |
| 691 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a681d519d4dc">a681d519d4dc</a> |
| 692 | Pass i_skipComm to _buildOccs</li> |
| 693 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/299023edd66f">299023edd66f</a> |
| 694 | Reload OCC and HCODE LIDs in OCC Reload Path</li> |
| 695 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/95c3ddc9290b">95c3ddc9290b</a> |
| 696 | Insert Debug Data Into hb prime Code Path</li> |
| 697 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c82b626e6ea1">c82b626e6ea1</a> |
| 698 | Check the Section Headers in Non-Secure Mode</li> |
| 699 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ec645465cdae">ec645465cdae</a> |
| 700 | Flush TMP Daemon Traces Prior to Shutdown</li> |
| 701 | </ul> |
| 702 | <p>Jacob Harvey (3):</p> |
| 703 | <ul class="simple"> |
| 704 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/052142a41cd0">052142a41cd0</a> |
| 705 | Add in RCD attributes for DD2 debug</li> |
| 706 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/e5ca1ace470e">e5ca1ace470e</a> |
| 707 | Change RD_CTR workaround val and update attr name</li> |
| 708 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/9abf780c9305">9abf780c9305</a> |
| 709 | Increment red_waterfall for low vdn fix</li> |
| 710 | </ul> |
| 711 | <p>Jaymes Wilks (4):</p> |
| 712 | <ul class="simple"> |
| 713 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8ea7d7ed5db4">8ea7d7ed5db4</a> |
| 714 | Change FCO distribution to ensure master chip has at least one core</li> |
| 715 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/13dd75dd4dc3">13dd75dd4dc3</a> |
| 716 | Support TPM in CUMULUS standalone SIMICS boot</li> |
| 717 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4f5c0b932724">4f5c0b932724</a> |
| 718 | Add TPM to the CUMULUS CDIMM model</li> |
| 719 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4eaf644dbf1b">4eaf644dbf1b</a> |
| 720 | Remove code flows that use non-open signing tools</li> |
| 721 | </ul> |
| 722 | <p>Jennifer A. Stofer (1):</p> |
| 723 | <ul class="simple"> |
| 724 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/7728cc84c782">7728cc84c782</a> |
| 725 | Revert “Adding p9a support.”</li> |
| 726 | </ul> |
| 727 | <p>Jenny Huynh (12):</p> |
| 728 | <ul class="simple"> |
| 729 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3d8051b7b2e7">3d8051b7b2e7</a> |
| 730 | Reset L3 error status register for next CE/UE capture</li> |
| 731 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c27a8bd5fb97">c27a8bd5fb97</a> |
| 732 | Adding workaround for HW930007 and HW386013</li> |
| 733 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/793f58e194db">793f58e194db</a> |
| 734 | Adding in defect HW395947,HW930007 to INT initfiles</li> |
| 735 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d0d88fcce2d4">d0d88fcce2d4</a> |
| 736 | Adding HW363780 to NPU scom initfiles</li> |
| 737 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a42eb15a2cc9">a42eb15a2cc9</a> |
| 738 | Reducing rng pace rate from 2000 -> 300 for HW403701</li> |
| 739 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4b6b29be4ff5">4b6b29be4ff5</a> |
| 740 | HW406130: Reduce dma read requests from 16->8 in NX inits</li> |
| 741 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/6ec839acf46f">6ec839acf46f</a> |
| 742 | HW407123: Slow down xlink command rate for Nimbus DD1/2</li> |
| 743 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a1635526313e">a1635526313e</a> |
| 744 | INT scan initfile change to add workaround for HW408972</li> |
| 745 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/e7db59ec919d">e7db59ec919d</a> |
| 746 | Adding HW401552 to cxa initfile to workaround clockgating bug</li> |
| 747 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/9b84a7e90001">9b84a7e90001</a> |
| 748 | Adding HW414702 workaround to INT scan initfiles</li> |
| 749 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ddf01705dda7">ddf01705dda7</a> |
| 750 | Workaround for Quaint Gate, Angry Reindeer</li> |
| 751 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b79417a6c766">b79417a6c766</a> |
| 752 | Updating HW414700 to also apply to Cumulus DD10</li> |
| 753 | </ul> |
| 754 | <p>Joachim Fenkes (6):</p> |
| 755 | <ul class="simple"> |
| 756 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c0967b7fb152">c0967b7fb152</a> |
| 757 | LPC: Add empty files for mirroring to HB, PPE, HWSV</li> |
| 758 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/1141d3f0a51e">1141d3f0a51e</a> |
| 759 | FFDC: Add empty new helper procedure for mirroring to HB, HWSV</li> |
| 760 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d4ea0e36be37">d4ea0e36be37</a> |
| 761 | Add p9_proc_gettracearray procedure</li> |
| 762 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/6f16f1f33d3e">6f16f1f33d3e</a> |
| 763 | p9_sbe_tracearray: Nimbus DD2 updates</li> |
| 764 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d61bf78fca7d">d61bf78fca7d</a> |
| 765 | HW415692: Make workaround permanent</li> |
| 766 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/efc02485efbd">efc02485efbd</a> |
| 767 | HDCT: Remove core trace arrays, permanent P9 erratum</li> |
| 768 | </ul> |
| 769 | <p>Joe McGill (40):</p> |
| 770 | <ul class="simple"> |
| 771 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/90a2c95eb96c">90a2c95eb96c</a> |
| 772 | p9_tod_move_tod_to_tb – correct TOD state checks</li> |
| 773 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4d23f6873114">4d23f6873114</a> |
| 774 | p9_sbe_tracearray – satsify PRD calls to manage core trace arrays</li> |
| 775 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ac0c8f0e7bdb">ac0c8f0e7bdb</a> |
| 776 | resolve Zeppelin DMI channel framelock issues</li> |
| 777 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c0fce11639f7">c0fce11639f7</a> |
| 778 | enforce strict 512 GB per socket limit on Witherspoon memory map |
| 779 | (part2)</li> |
| 780 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/92f6bd045cb1">92f6bd045cb1</a> |
| 781 | HW388878 VCS workaround</li> |
| 782 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/9c189e8e26a7">9c189e8e26a7</a> |
| 783 | p9.fbc.scan.initfile – create initfile, add workaround for HW376651</li> |
| 784 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/5ba30ede4f3a">5ba30ede4f3a</a> |
| 785 | p9_psi_init – parametrize link speed (half/full)</li> |
| 786 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/398408a979d7">398408a979d7</a> |
| 787 | p9.fbc.scan.initfile – clock off MCSYNC staging latches</li> |
| 788 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/12ea45b365cf">12ea45b365cf</a> |
| 789 | Add MSS customization support from CRP0 Lx MVPD</li> |
| 790 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b02210a00b1e">b02210a00b1e</a> |
| 791 | p9_getecid – set PCIE DD1.0x workaround attributes</li> |
| 792 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/65076c196163">65076c196163</a> |
| 793 | add SS PLL settings to support 94 MHz PCI operation</li> |
| 794 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a2c5ab1977ee">a2c5ab1977ee</a> |
| 795 | FBC updates for HW383616, HW384245</li> |
| 796 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ee3924e0c243">ee3924e0c243</a> |
| 797 | p9_sbe_tp_chiplet_init3 – disable TP TOD hang pulse</li> |
| 798 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4bdb5fa7a80f">4bdb5fa7a80f</a> |
| 799 | p9.core.scan.initfile – mask local error from CC in EC perv LFIR</li> |
| 800 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c526478a6ce3">c526478a6ce3</a> |
| 801 | adjust SRAM timings</li> |
| 802 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8d707e8c9223">8d707e8c9223</a> |
| 803 | update DPLL and IVRM inits</li> |
| 804 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d615502799c0">d615502799c0</a> |
| 805 | derate NVLINK frequency for Nimbus DD1</li> |
| 806 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/40c1bf0cfb1b">40c1bf0cfb1b</a> |
| 807 | p9.xbus.pll.scan.initfile – restore full frequency settings for |
| 808 | Nimbus DD2+</li> |
| 809 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8c2cd3174256">8c2cd3174256</a> |
| 810 | p9.int.scan.initfile – init PSIHB to LSI mode</li> |
| 811 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/527165381939">527165381939</a> |
| 812 | L3 updates – p9_build_smp, p9_fbc_utils</li> |
| 813 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3a26100f62ca">3a26100f62ca</a> |
| 814 | future proof EC feature attributes, add missing P9N DD2 inits</li> |
| 815 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/78bf7f9a76b2">78bf7f9a76b2</a> |
| 816 | L3 update – p9_pcie_config</li> |
| 817 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4831e12ea20e">4831e12ea20e</a> |
| 818 | p9.core.scan.initfile – set disable 241 for Nimbus DD2</li> |
| 819 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/e4229a61632a">e4229a61632a</a> |
| 820 | PCIe updates for Nimbus DD2 GEN4 operation</li> |
| 821 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ddefc592366e">ddefc592366e</a> |
| 822 | p9.pci.scan.initfile – initial release</li> |
| 823 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/6752509378f2">6752509378f2</a> |
| 824 | p9.npu.scom.initfile – Nimbus DD2 updates</li> |
| 825 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/02e1726c4962">02e1726c4962</a> |
| 826 | TP, Nest FIR updates – DD2 updates to match RAS XML</li> |
| 827 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3ce08029e577">3ce08029e577</a> |
| 828 | p9.npu.scom.initfile – FIR updates to align with RAS XML |
| 829 | documentation</li> |
| 830 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/7f0a49f50d87">7f0a49f50d87</a> |
| 831 | p9.int.scom.initfile – mask SUE FIR for Nimbus DD2</li> |
| 832 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a0df90732994">a0df90732994</a> |
| 833 | resolve Zeppelin DMI channel framelock issues</li> |
| 834 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/e5e2af0f5eed">e5e2af0f5eed</a> |
| 835 | updates for NPU errata</li> |
| 836 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8e0f3a8ad787">8e0f3a8ad787</a> |
| 837 | PLL updates for filter BG, BW including OBUS tank coreqs</li> |
| 838 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3d3f11dbddd5">3d3f11dbddd5</a> |
| 839 | IO, FBC updates to enable ABUS for Fleetwood</li> |
| 840 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/75c7fd666460">75c7fd666460</a> |
| 841 | p9.filter.pll.scan.intifile – set 0 BGoffset for P9C DD1.1</li> |
| 842 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/f20b37d483c4">f20b37d483c4</a> |
| 843 | remove NV iovalid assertion from FW and add scan inits to resolve |
| 844 | glsmux xstate</li> |
| 845 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/f0d08f111980">f0d08f111980</a> |
| 846 | Chip address extension workaround for HW423589 (option2), part1</li> |
| 847 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a94bc7eedf31">a94bc7eedf31</a> |
| 848 | disable ECC bypass for Cumulus DD1.0</li> |
| 849 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/01a6a43e9020">01a6a43e9020</a> |
| 850 | MCD disable workaround for HW423589 (option1)</li> |
| 851 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/7221c41d5f7f">7221c41d5f7f</a> |
| 852 | Disable read data delay for Cumulus DD1.0, enable for DD1.1</li> |
| 853 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/e07cb2f93ac8">e07cb2f93ac8</a> |
| 854 | p9.npu.scom.initfile – limit DCP0 credits for HW437173</li> |
| 855 | </ul> |
| 856 | <p>John Rell (4):</p> |
| 857 | <ul class="simple"> |
| 858 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/366a4efdf50b">366a4efdf50b</a> |
| 859 | jgr18022000 Fix for typo in changes for HW430958</li> |
| 860 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d12852b6fa1a">d12852b6fa1a</a> |
| 861 | jgr17050500 Added Centaur and DMI IO SCOM initfiles</li> |
| 862 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/55e4a228b65f">55e4a228b65f</a> |
| 863 | jgr17082300 Setting changes for HW41801 HW419305</li> |
| 864 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/9af3fc295e1e">9af3fc295e1e</a> |
| 865 | jgr171017 Setting changes for Obus boardwire vs cable</li> |
| 866 | </ul> |
| 867 | <p>Joshua Hannan (1):</p> |
| 868 | <ul class="simple"> |
| 869 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4c9b0d832610">4c9b0d832610</a> |
| 870 | adding insert for soft fail threshold for dd1 and dd2</li> |
| 871 | </ul> |
| 872 | <p>Juan Medina (2):</p> |
| 873 | <ul class="simple"> |
| 874 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/727e9397fd73">727e9397fd73</a> |
| 875 | reverting FIRs to master values, setting only bit 8</li> |
| 876 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ca235d62a2fe">ca235d62a2fe</a> |
| 877 | Scrubbing needs to stay off for DD2, bug HW405443</li> |
| 878 | </ul> |
| 879 | <p>Lennard Streat (6):</p> |
| 880 | <ul class="simple"> |
| 881 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d3593cc766ca">d3593cc766ca</a> |
| 882 | Temporary workaround for HW412197</li> |
| 883 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/75823b14fb47">75823b14fb47</a> |
| 884 | HW439321 - Trusty Birthday Alternative Workaround</li> |
| 885 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/968b1746f9e7">968b1746f9e7</a> |
| 886 | HW439321 - Disable CRC Performance Degradation</li> |
| 887 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/77309f6630fa">77309f6630fa</a> |
| 888 | Expanding MCU tag fifo settings to be freq dependent.</li> |
| 889 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3d12277f2397">3d12277f2397</a> |
| 890 | Workaround for Warlike Parasite (HW430546)</li> |
| 891 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/f24037b86d27">f24037b86d27</a> |
| 892 | Protect Firmware from exposure to HW423533</li> |
| 893 | </ul> |
| 894 | <p>Louis Stermole (3):</p> |
| 895 | <ul class="simple"> |
| 896 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/9900129f86ae">9900129f86ae</a> |
| 897 | Fix command gap calculation for MSS scrub to prevent truncation</li> |
| 898 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d64041888fed">d64041888fed</a> |
| 899 | Add callout for when the DIMM to NEST freq ratio exceeds 1.5</li> |
| 900 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/e4ed25ed886c">e4ed25ed886c</a> |
| 901 | Add workaround for DDRPHY ODT config register erratum (ODT2, ODT3 |
| 902 | bits swapped)</li> |
| 903 | </ul> |
| 904 | <p>Luke C. Murray (7):</p> |
| 905 | <ul class="simple"> |
| 906 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/908eda4b3845">908eda4b3845</a> |
| 907 | Disabling LVext for all P9 parts</li> |
| 908 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/2921d0d9066c">2921d0d9066c</a> |
| 909 | HW414700 checkstop on UEs and disable core ECC counter</li> |
| 910 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/15d21760fbaa">15d21760fbaa</a> |
| 911 | Workaround for HW421347 Scandalous Pie</li> |
| 912 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b5b8ae989e51">b5b8ae989e51</a> |
| 913 | Updating L2 re-request jitter settings for Cumulus</li> |
| 914 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/1b1226daa961">1b1226daa961</a> |
| 915 | Turning on NCU tlbie pacing by default</li> |
| 916 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/fb21d847fbea">fb21d847fbea</a> |
| 917 | Adding attribute to turn memory early data on</li> |
| 918 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/f5759559a60d">f5759559a60d</a> |
| 919 | Enabling L2 64B store prediction</li> |
| 920 | </ul> |
| 921 | <p>Luke Murray (8):</p> |
| 922 | <ul class="simple"> |
| 923 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/0964a5b2fd09">0964a5b2fd09</a> |
| 924 | Adding skip group dials for cache when chip=group</li> |
| 925 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/f5bc1a24f10a">f5bc1a24f10a</a> |
| 926 | Updating P9 L2 scan initfile to use attributes</li> |
| 927 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/7d0c68704298">7d0c68704298</a> |
| 928 | Adding good LCO settings to initfile</li> |
| 929 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/54067398177d">54067398177d</a> |
| 930 | Updating L3 LCO watermarks for HW406803</li> |
| 931 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/0c1a9c38bba5">0c1a9c38bba5</a> |
| 932 | Updating optimal larx/stcx dials for performance</li> |
| 933 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/2e3a8e66a7f7">2e3a8e66a7f7</a> |
| 934 | Disable cp_me from the L3 for Nimbus DD1 and DD2.0.</li> |
| 935 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/f44af3ce268c">f44af3ce268c</a> |
| 936 | Updating HW363605 workaround to be applied to all chips</li> |
| 937 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/340b1d5748c8">340b1d5748c8</a> |
| 938 | Performance updates for HW409069</li> |
| 939 | </ul> |
| 940 | <p>Markus Dobler (1):</p> |
| 941 | <ul class="simple"> |
| 942 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ce033a30cb69">ce033a30cb69</a> |
| 943 | p9_abist: Support for p9ndd2</li> |
| 944 | </ul> |
| 945 | <p>Marty Gloff (4):</p> |
| 946 | <ul class="simple"> |
| 947 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d01ca15eccee">d01ca15eccee</a> |
| 948 | Support multiple nodes in HBRT - Add Node Container</li> |
| 949 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/40c3350ff928">40c3350ff928</a> |
| 950 | Support multiple nodes in HBRT - Support Multiple Nodes in |
| 951 | TargetService</li> |
| 952 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/27755fae1059">27755fae1059</a> |
| 953 | Support multiple nodes in HBRT - Attribute Overrides</li> |
| 954 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/5fc3b529c692">5fc3b529c692</a> |
| 955 | Support multiple nodes in HBRT - VPD Image</li> |
| 956 | </ul> |
| 957 | <p>Matt Derksen (9):</p> |
| 958 | <ul class="simple"> |
| 959 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/80819cf5302b">80819cf5302b</a> |
| 960 | Fix rollover of PLID numbers</li> |
| 961 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d6d402588868">d6d402588868</a> |
| 962 | Cleanup hbrt msg code to be easier to understand and update</li> |
| 963 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3b5f10fdf6a7">3b5f10fdf6a7</a> |
| 964 | Include WOF power mode explicitly inside tables</li> |
| 965 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b31ac249651c">b31ac249651c</a> |
| 966 | Trace cleanup: do not look for parent chip on non-parent chip targets</li> |
| 967 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/843b9e02e55d">843b9e02e55d</a> |
| 968 | Initialize FIRDATA section and ErrlManager just incase BMC resets</li> |
| 969 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/647eb6eae52c">647eb6eae52c</a> |
| 970 | Only call PNOR::init() on systems with BMC</li> |
| 971 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/75c7aea07bcb">75c7aea07bcb</a> |
| 972 | Fix setting plid to the lastest one available at hbrt start</li> |
| 973 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8692b24a1ec0">8692b24a1ec0</a> |
| 974 | Include WOF power mode explicitly inside tables</li> |
| 975 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/6eaa4575c95a">6eaa4575c95a</a> |
| 976 | Handle new version of WOF tables that includes power mode</li> |
| 977 | </ul> |
| 978 | <p>Matt K. Light (1):</p> |
| 979 | <ul class="simple"> |
| 980 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/288ca88910b6">288ca88910b6</a> |
| 981 | adding fapi2::putSpyWithCare()</li> |
| 982 | </ul> |
| 983 | <p>Matthew Hickman (4):</p> |
| 984 | <ul class="simple"> |
| 985 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/1b11547e01a8">1b11547e01a8</a> |
| 986 | Fixed Maint IUE unmasked with mnfg flags</li> |
| 987 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/f6b7234d960a">f6b7234d960a</a> |
| 988 | Fixed port fail SUE bug for DD2 modules</li> |
| 989 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/48d464158bc3">48d464158bc3</a> |
| 990 | Fixed MNFG Attribute handing for TCE Corrections</li> |
| 991 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/90ef1f6dbd59">90ef1f6dbd59</a> |
| 992 | Fixed unmasking of BRODCAST_OUT_OF_SYNC fir after memdiags |
| 993 | handling</li> |
| 994 | </ul> |
| 995 | <p>Michael Koch (1):</p> |
| 996 | <ul class="simple"> |
| 997 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8b34665d2794">8b34665d2794</a> |
| 998 | Implementing Michael Floyds improvements.</li> |
| 999 | </ul> |
| 1000 | <p>Mike Baiocchi (2):</p> |
| 1001 | <ul class="simple"> |
| 1002 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/eeadfb7bf985">eeadfb7bf985</a> |
| 1003 | Add Reset to TPM’s I2C Bus for MPIPLs</li> |
| 1004 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/234ef44536ae">234ef44536ae</a> |
| 1005 | Add FFDC to ‘No Functional TPM’ Fails</li> |
| 1006 | </ul> |
| 1007 | <p>Nick Bofferding (9):</p> |
| 1008 | <ul class="simple"> |
| 1009 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/55e51a61f985">55e51a61f985</a> |
| 1010 | Delayed deconfig any DIMM on a failing voltage domain</li> |
| 1011 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/afc4bd08c5bf">afc4bd08c5bf</a> |
| 1012 | Documentation: Stop withholding various SRCs from pubs</li> |
| 1013 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/24bc6a1bee51">24bc6a1bee51</a> |
| 1014 | Secure Boot: On get jumper state error path, save PLID before |
| 1015 | committing</li> |
| 1016 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a8b0039d4e3a">a8b0039d4e3a</a> |
| 1017 | Clear FCO deconfigures before applying gard records</li> |
| 1018 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/bd1cd3c7d1fb">bd1cd3c7d1fb</a> |
| 1019 | Secure Boot: Detach secure PNOR provider task</li> |
| 1020 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/0b02cc8314be">0b02cc8314be</a> |
| 1021 | Secure Boot: Check integrity of dynamically sized secure header |
| 1022 | copies</li> |
| 1023 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/24929fd8ab96">24929fd8ab96</a> |
| 1024 | Secure Boot: Dynamically set TPM I2C master path in MRW parser</li> |
| 1025 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/aa5d9565d0d1">aa5d9565d0d1</a> |
| 1026 | Secure Boot: Mark redundant TPM not present until SMP is enabled</li> |
| 1027 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/5660e6b0e4a2">5660e6b0e4a2</a> |
| 1028 | Secure Boot: Populate master node TPM info in HDAT until multinode |
| 1029 | supported</li> |
| 1030 | </ul> |
| 1031 | <p>Nick Klazynski (35):</p> |
| 1032 | <ul class="simple"> |
| 1033 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/07fd08d22744">07fd08d22744</a> |
| 1034 | Add Cumulus DD1.1 inits</li> |
| 1035 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/36573c1d29c9">36573c1d29c9</a> |
| 1036 | Enable risklevel2, match v44 of security wiki</li> |
| 1037 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d78c726ee7c2">d78c726ee7c2</a> |
| 1038 | workarounds for HW399919 HW400898 HW398269 HW398269 HW399765</li> |
| 1039 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/9388b61a676d">9388b61a676d</a> |
| 1040 | WAs for HW401811 HW402145 HW403465; DIS_MULTIPLE_TBLW on all modes</li> |
| 1041 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/fc03d06f35ac">fc03d06f35ac</a> |
| 1042 | Add three WATs, remove IMC2, replace stop2 workaround</li> |
| 1043 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/633abb448897">633abb448897</a> |
| 1044 | Add risklevel for HW399624 due to perf penalty; Add HW405851</li> |
| 1045 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/5db603045222">5db603045222</a> |
| 1046 | Update core inits for DD2</li> |
| 1047 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/6914d4009233">6914d4009233</a> |
| 1048 | Add core workaround for HW407136</li> |
| 1049 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/0fd907828b92">0fd907828b92</a> |
| 1050 | Workarounds for HW407385 HW408629 HW410389 HW408901</li> |
| 1051 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/1a54f8f27c08">1a54f8f27c08</a> |
| 1052 | Add WAs for HW413799 HW413853 HW413917 HW414249 HW414375 HW414871 |
| 1053 | HW414829</li> |
| 1054 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c4b31c72c8c9">c4b31c72c8c9</a> |
| 1055 | Add Workarounds for HW415114 HW415013 HW413853 HW414384</li> |
| 1056 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ffbc1b8d89b0">ffbc1b8d89b0</a> |
| 1057 | Add WA for HW415236</li> |
| 1058 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/7627769e5c9f">7627769e5c9f</a> |
| 1059 | Add WA for HW415988</li> |
| 1060 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b69116dcd8d6">b69116dcd8d6</a> |
| 1061 | Add additional dials to risklevel</li> |
| 1062 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8d360860742b">8d360860742b</a> |
| 1063 | Update core initfiles for Cumulus DD1.0</li> |
| 1064 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/fe20d009372f">fe20d009372f</a> |
| 1065 | Reverting chickenswitches for issues fixed in Cumulus DD1.0</li> |
| 1066 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/efda1e06c616">efda1e06c616</a> |
| 1067 | Mistakenly pulled workaround for HW410212 - readd for CDD1.0</li> |
| 1068 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/f6df718a76fb">f6df718a76fb</a> |
| 1069 | Add perf inits: HW418850,HW418789; Add clockgate issue HW418738</li> |
| 1070 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3883490ddec9">3883490ddec9</a> |
| 1071 | Add updates for NDD2.1, Serialize TB, Perf workarounds</li> |
| 1072 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/14f465d741f8">14f465d741f8</a> |
| 1073 | HW415528 and HW419742</li> |
| 1074 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/78801d7a4ae7">78801d7a4ae7</a> |
| 1075 | Core workarounds for multiple issues.</li> |
| 1076 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/647eee8c1825">647eee8c1825</a> |
| 1077 | Add workarounds for HW421426 and HW422629, Swap IMCs around</li> |
| 1078 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3df6589cb9fb">3df6589cb9fb</a> |
| 1079 | HW415883 applies to NDD2.1, Add JellyVector WAT, add HW422495, add |
| 1080 | HW421831</li> |
| 1081 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/90a3867252a8">90a3867252a8</a> |
| 1082 | Add HW425526 and HW425027</li> |
| 1083 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/0e5d5b750aba">0e5d5b750aba</a> |
| 1084 | HW403465 applies to all chips; Revert NDD2.1 RL; add SW406970</li> |
| 1085 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4c248c90a305">4c248c90a305</a> |
| 1086 | Nimbus DD2.2 core chickenswitches</li> |
| 1087 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a55bc817001f">a55bc817001f</a> |
| 1088 | Large update for security</li> |
| 1089 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/db5f940f71b4">db5f940f71b4</a> |
| 1090 | Fix three NDD2.1 dials and add new NDD2.2 workarounds</li> |
| 1091 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/9deb5fc4a4f7">9deb5fc4a4f7</a> |
| 1092 | Add new TM IMC, Add TLBIE hangbuster</li> |
| 1093 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/2cdaf3a7743f">2cdaf3a7743f</a> |
| 1094 | Implement security IMCs, based on v29 of wiki</li> |
| 1095 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/029552241239">029552241239</a> |
| 1096 | Two LTPTR workarounds, remove LTPTR serialization, Fix TB IMC</li> |
| 1097 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3a66a14710fe">3a66a14710fe</a> |
| 1098 | Enable mixed core xlate; Enable xlate protection feature; Disable LSU |
| 1099 | clockgate</li> |
| 1100 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/0bb20d099e65">0bb20d099e65</a> |
| 1101 | Add TM WAT workaround; NDD2.2 and CDD1.1 only</li> |
| 1102 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/368e3ac318fa">368e3ac318fa</a> |
| 1103 | Add Cumulus DD1.1 inits</li> |
| 1104 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/2c08db3b8536">2c08db3b8536</a> |
| 1105 | Enable risklevel2, match v44 of security wiki</li> |
| 1106 | </ul> |
| 1107 | <p>Prachi Gupta (8):</p> |
| 1108 | <ul class="simple"> |
| 1109 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/5c78bbd873e9">5c78bbd873e9</a> |
| 1110 | checkHbResMemLimit – change to check correctly on multi-node</li> |
| 1111 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/33725d24db91">33725d24db91</a> |
| 1112 | hbfw makefile changes to add p9c dd1.1 sbe to pnor</li> |
| 1113 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/5ca1d497141a">5ca1d497141a</a> |
| 1114 | changes to move configureHbrt target type to IPC path to run on slave |
| 1115 | nodes</li> |
| 1116 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/fdbf7156982e">fdbf7156982e</a> |
| 1117 | HBRT: Fix targeting to work on multi-node</li> |
| 1118 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b98f4c6b59fa">b98f4c6b59fa</a> |
| 1119 | ATTR_PBAX_GROUPID: add global tag</li> |
| 1120 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/54cc57dd329e">54cc57dd329e</a> |
| 1121 | add global tag to EI_BUS_TX_MSBSWAP for serverwiz2 consumption</li> |
| 1122 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/7ce93122ca1e">7ce93122ca1e</a> |
| 1123 | ATTR_CEN_VPD_DRAM_ADDRESS_MIRRORING: Remove writable tag</li> |
| 1124 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3f639460a8f1">3f639460a8f1</a> |
| 1125 | ATTR_CEN_VPD_DRAM_ADDRESS_MIRRORING: add function backed to this |
| 1126 | attribute</li> |
| 1127 | </ul> |
| 1128 | <p>Prasad Bg Ranganath (4):</p> |
| 1129 | <ul class="simple"> |
| 1130 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/0d7e62667706">0d7e62667706</a> |
| 1131 | PM: Fix Global Parameter Block and PGPE size checks in |
| 1132 | p9_hcode_image_build</li> |
| 1133 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/e80082e3a96a">e80082e3a96a</a> |
| 1134 | SBE:Putring: Added more debug information</li> |
| 1135 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/e86fa9f6d5a9">e86fa9f6d5a9</a> |
| 1136 | PSTATE_PARAMETER_BLOCK structure alignment and error handling</li> |
| 1137 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3bb61aa58087">3bb61aa58087</a> |
| 1138 | Zepplin:Remove dd level check for cumulus under PPB code</li> |
| 1139 | </ul> |
| 1140 | <p>Prem Shanker Jha (1):</p> |
| 1141 | <ul class="simple"> |
| 1142 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/2e0c75fb9d8c">2e0c75fb9d8c</a> |
| 1143 | PM: Added support for HWP p9_pm_callout.</li> |
| 1144 | </ul> |
| 1145 | <p>Raja Das (1):</p> |
| 1146 | <ul class="simple"> |
| 1147 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/338fce09ddad">338fce09ddad</a> |
| 1148 | Workaround to fix issue where Powerbus loses track of EQs in DD1</li> |
| 1149 | </ul> |
| 1150 | <p>Ricardo Mata (1):</p> |
| 1151 | <ul class="simple"> |
| 1152 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b5986b2c0d1a">b5986b2c0d1a</a> |
| 1153 | Added CI throttling support, HW init updates, and fixed a bug with |
| 1154 | tce arb.</li> |
| 1155 | </ul> |
| 1156 | <p>Richard J. Knight (5):</p> |
| 1157 | <ul class="simple"> |
| 1158 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/221f05613499">221f05613499</a> |
| 1159 | Introduce new shared library for image processing fucntions</li> |
| 1160 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/48235812776d">48235812776d</a> |
| 1161 | SW414905: Mcs, Mba and L4 targets are not displayed in gard –gc mem |
| 1162 | output</li> |
| 1163 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b456c82ad820">b456c82ad820</a> |
| 1164 | Modify putrRing code to pull rings from centaur hw image</li> |
| 1165 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/967e9a084bbe">967e9a084bbe</a> |
| 1166 | Wait for responses from all nodes for IPC_POPULATE_ATTRIBUTES msg</li> |
| 1167 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d72d87900b44">d72d87900b44</a> |
| 1168 | Procedure crashes when trying to query an EC feature</li> |
| 1169 | </ul> |
| 1170 | <p>Rick Ward (1):</p> |
| 1171 | <ul class="simple"> |
| 1172 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a48f950445f1">a48f950445f1</a> |
| 1173 | Dump collection should only be run on the master node and skipped on |
| 1174 | slaves.</li> |
| 1175 | </ul> |
| 1176 | <p>Roland Veloz (4):</p> |
| 1177 | <ul class="simple"> |
| 1178 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b6e41fc3329e">b6e41fc3329e</a> |
| 1179 | Force an SBE update upon boot failure as well as break out common |
| 1180 | data</li> |
| 1181 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/0dbb06308565">0dbb06308565</a> |
| 1182 | Fixed both NIMBUS and CUMULUS. They are now making the call to |
| 1183 | mss_thermal_init</li> |
| 1184 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/5a9355062b71">5a9355062b71</a> |
| 1185 | Created individual update flags for both SEEPROM 0 and SEEPROM 1</li> |
| 1186 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3d7aee811e82">3d7aee811e82</a> |
| 1187 | Inform OPAL of the state of the SBE after an attempt to restart</li> |
| 1188 | </ul> |
| 1189 | <p>Ryan Black (3):</p> |
| 1190 | <ul class="simple"> |
| 1191 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/63c767d5679c">63c767d5679c</a> |
| 1192 | reduce number of non-zero npu error collection registers</li> |
| 1193 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/1b4fa572716e">1b4fa572716e</a> |
| 1194 | NPU scan/scom init updates</li> |
| 1195 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/17165d955d01">17165d955d01</a> |
| 1196 | p9.npu.scom.initfile – fix cq_sm allocation issue at low water mark</li> |
| 1197 | </ul> |
| 1198 | <p>Sachin Gupta (2):</p> |
| 1199 | <ul class="simple"> |
| 1200 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/899054484ef2">899054484ef2</a> |
| 1201 | Support cumulus 1.1 getPllBucket</li> |
| 1202 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4340a6da7949">4340a6da7949</a> |
| 1203 | Remove workaround for DD1 SW reset for XIVE</li> |
| 1204 | </ul> |
| 1205 | <p>Sameer Veer (2):</p> |
| 1206 | <ul class="simple"> |
| 1207 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/25e991e8b352">25e991e8b352</a> |
| 1208 | New functions added for automating mustfix releases</li> |
| 1209 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/2ae2bffe88b5">2ae2bffe88b5</a> |
| 1210 | Added cmvcCheckinForceFlag to break links for new releases</li> |
| 1211 | </ul> |
| 1212 | <p>Shelton Leung (9):</p> |
| 1213 | <ul class="simple"> |
| 1214 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/44bd1c4678da">44bd1c4678da</a> |
| 1215 | scan inits for lab workaround for DI bug HW392781</li> |
| 1216 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/be9b22ecd3fc">be9b22ecd3fc</a> |
| 1217 | dd1 workaround for hw400075 coherency error</li> |
| 1218 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c40f090b3c4e">c40f090b3c4e</a> |
| 1219 | workaround for hw400932 atag corruptin in presp</li> |
| 1220 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c3869410785b">c3869410785b</a> |
| 1221 | amo cache disabled for dd1 for HW401780</li> |
| 1222 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/bce1c27699b3">bce1c27699b3</a> |
| 1223 | enable prefetch drop for better MC fairness</li> |
| 1224 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/2aad82e12497">2aad82e12497</a> |
| 1225 | disable noise window for DD1 HW406577</li> |
| 1226 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ad8cf02d85d0">ad8cf02d85d0</a> |
| 1227 | dd2 inits</li> |
| 1228 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/e3f6f99840e4">e3f6f99840e4</a> |
| 1229 | adjusted mem 2400 nest 1600 workaround and make dd1 only</li> |
| 1230 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/125f42a04372">125f42a04372</a> |
| 1231 | dd2 phy scom inits</li> |
| 1232 | </ul> |
| 1233 | <p>Soma BhanuTej (7):</p> |
| 1234 | <ul class="simple"> |
| 1235 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a41ddc53f979">a41ddc53f979</a> |
| 1236 | Axone support to TP stopclocks</li> |
| 1237 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/91d24ca4cc09">91d24ca4cc09</a> |
| 1238 | Change chip to unsecure always for DD1 chips</li> |
| 1239 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ed093a87011d">ed093a87011d</a> |
| 1240 | Security control override disable support - p9_setup_sbe_config</li> |
| 1241 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8f803dfea438">8f803dfea438</a> |
| 1242 | Cumulus initfile update for OBUS & XBUS PLLs</li> |
| 1243 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c586a6b41c0f">c586a6b41c0f</a> |
| 1244 | Additional checks to p9_extract_sbe_rc</li> |
| 1245 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/00c3e73d16ee">00c3e73d16ee</a> |
| 1246 | Axone support to TP stopclocks</li> |
| 1247 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c09c372348bd">c09c372348bd</a> |
| 1248 | Change TP FIR bits 38, 39, 40 as recoverable & Masked</li> |
| 1249 | </ul> |
| 1250 | <p>Stephen Glancy (18):</p> |
| 1251 | <ul class="simple"> |
| 1252 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/000f358355b2">000f358355b2</a> |
| 1253 | Updates broadcast mode attributes</li> |
| 1254 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/2674db2b85b4">2674db2b85b4</a> |
| 1255 | Adds blank NVDIMM utility files for HB to mirror</li> |
| 1256 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b5c57afe40a8">b5c57afe40a8</a> |
| 1257 | Fixes tDLLK timing for 2666</li> |
| 1258 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/c03b84b93467">c03b84b93467</a> |
| 1259 | Fixes broadcast mode address check for deconfigured ports</li> |
| 1260 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/719c8a64fb72">719c8a64fb72</a> |
| 1261 | Adds DDR4 hybrid NV-RDIMM support</li> |
| 1262 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/7b475151599d">7b475151599d</a> |
| 1263 | Removes overrideonly in a broadcast mode MRW attribute</li> |
| 1264 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/a61200c516f7">a61200c516f7</a> |
| 1265 | Adds power control access functions for NVDIMM</li> |
| 1266 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/5e42a73c3de9">5e42a73c3de9</a> |
| 1267 | Added periodic cal fix - fixes bad delays</li> |
| 1268 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ad869ece5cae">ad869ece5cae</a> |
| 1269 | Updates to run HW VREF cal by default</li> |
| 1270 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/556caf56c9ec">556caf56c9ec</a> |
| 1271 | Added read ctr bad delay workaround</li> |
| 1272 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4e9ff980c520">4e9ff980c520</a> |
| 1273 | Added DQS alignment workaround</li> |
| 1274 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ad43d96deda9">ad43d96deda9</a> |
| 1275 | Adds DCD calibration control attributes</li> |
| 1276 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/4b9d8a1bd726">4b9d8a1bd726</a> |
| 1277 | Updated memory DD1 vs DD2 attribute</li> |
| 1278 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/edca64c2b22b">edca64c2b22b</a> |
| 1279 | Fixed DLL workarounds to always run</li> |
| 1280 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/b1e597ec9bdb">b1e597ec9bdb</a> |
| 1281 | Adds blank files for centaur secure mode boot</li> |
| 1282 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/013207df79b3">013207df79b3</a> |
| 1283 | Updates p9c SPD read to include DDR3</li> |
| 1284 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/43904dc3b8a4">43904dc3b8a4</a> |
| 1285 | Adds dynamic voltage blank files for HB</li> |
| 1286 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/218a4862f0d0">218a4862f0d0</a> |
| 1287 | Adds secure mode boot for memory buffer chips</li> |
| 1288 | </ul> |
| 1289 | <p>Steven Janssen (1):</p> |
| 1290 | <ul class="simple"> |
| 1291 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/6d57e7720db9">6d57e7720db9</a> |
| 1292 | Change memory cleanup to use correct method</li> |
| 1293 | </ul> |
| 1294 | <p>Sumit Kumar (1):</p> |
| 1295 | <ul class="simple"> |
| 1296 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/00c730b5ebef">00c730b5ebef</a> |
| 1297 | GPTR/Overlays stage-2 support</li> |
| 1298 | </ul> |
| 1299 | <p>Sunil.Kumar (1):</p> |
| 1300 | <ul class="simple"> |
| 1301 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8240f5a4c1e0">8240f5a4c1e0</a> |
| 1302 | Procedures modified for DD1 changes</li> |
| 1303 | </ul> |
| 1304 | <p>Swathi Madhuri Bhattiprolu (1):</p> |
| 1305 | <ul class="simple"> |
| 1306 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/2958d02ae126">2958d02ae126</a> |
| 1307 | Create Initial Cumulus CDIMM sim configuration</li> |
| 1308 | </ul> |
| 1309 | <p>Thi Tran (5):</p> |
| 1310 | <ul class="simple"> |
| 1311 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/231f4e404b04">231f4e404b04</a> |
| 1312 | Add ec_abst ring to p9n.hw_image</li> |
| 1313 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/71fc3db015e6">71fc3db015e6</a> |
| 1314 | Attribute support of customization of Nimbus DD1 PCI reference clock |
| 1315 | speed.</li> |
| 1316 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/2764678bf004">2764678bf004</a> |
| 1317 | P9 Cumulus InitCompiler supportis - Part 3</li> |
| 1318 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/227a32f926d3">227a32f926d3</a> |
| 1319 | Undo some p9 Cumulus spy workarounds in initfiles</li> |
| 1320 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/cc1ac14babe2">cc1ac14babe2</a> |
| 1321 | Fix MFG P9 ZZ: BC70E540 (MCFIR[8]) command list timeout</li> |
| 1322 | </ul> |
| 1323 | <p>Tsung Yeung (1):</p> |
| 1324 | <ul class="simple"> |
| 1325 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/1d2a73892341">1d2a73892341</a> |
| 1326 | Adds self time refresh entry and exit helper functions</li> |
| 1327 | </ul> |
| 1328 | <p>Venkatesh Sainath (2):</p> |
| 1329 | <ul class="simple"> |
| 1330 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/44087e0148ad">44087e0148ad</a> |
| 1331 | Enabling FSP-B IPL as primary</li> |
| 1332 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/13de75c05e7d">13de75c05e7d</a> |
| 1333 | Fixing flipport attribute for processors</li> |
| 1334 | </ul> |
| 1335 | <p>Yue Du (5):</p> |
| 1336 | <ul class="simple"> |
| 1337 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/3afac7911fa4">3afac7911fa4</a> |
| 1338 | STOP: Support Suspend Entry/Exit and Fix Pig Collision</li> |
| 1339 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/40121d5b91e6">40121d5b91e6</a> |
| 1340 | Cache HWP: DD1 VCS Workaround</li> |
| 1341 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/89135c06eabc">89135c06eabc</a> |
| 1342 | Istep4: Enable poll for DPLL lock in p9_hcd_cache_dpll_setup</li> |
| 1343 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/1db94c26ffaa">1db94c26ffaa</a> |
| 1344 | HW396520: DD1 workaround skip flushmode inhibit drop in cache hwp</li> |
| 1345 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/ee172729c85d">ee172729c85d</a> |
| 1346 | STOP: Fix Wakeup terminate prematurely with mixed stop2 and stop4</li> |
| 1347 | </ul> |
| 1348 | <p>Zane Shelley (13):</p> |
| 1349 | <ul class="simple"> |
| 1350 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/1275d064b04f">1275d064b04f</a> |
| 1351 | PRD: Fixed address translation for Dynamic Memory Deallocation</li> |
| 1352 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/5324435b6d27">5324435b6d27</a> |
| 1353 | PRD: initializing MemTdCtlr variables for broadcast mode</li> |
| 1354 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/fed203b290c1">fed203b290c1</a> |
| 1355 | PRD: added full IPL config support into getHwConfig()</li> |
| 1356 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/0c2ad40218ec">0c2ad40218ec</a> |
| 1357 | PRD: removed NPUFIR workaround for DD1.0 to enable default capture</li> |
| 1358 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/9aa046413267">9aa046413267</a> |
| 1359 | PRD: NPU0FIR checkstop isolation issue</li> |
| 1360 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/9abf4f390cca">9abf4f390cca</a> |
| 1361 | PRD: getConnectedParent() issue in MemDealloc::dimmList()</li> |
| 1362 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/5aa7128d4aaa">5aa7128d4aaa</a> |
| 1363 | PRD: add DMD support for 3 and 6 MC channels per group</li> |
| 1364 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/82aaa7df696a">82aaa7df696a</a> |
| 1365 | PRD: initialize PRD objects for Restore DRAM Repairs</li> |
| 1366 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/f10101dc6c7e">f10101dc6c7e</a> |
| 1367 | PRD: DMD address translation bug.</li> |
| 1368 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/08379ab81944">08379ab81944</a> |
| 1369 | PRD: extra FFDC for NPU0FIR</li> |
| 1370 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/5353bb457253">5353bb457253</a> |
| 1371 | PRD: remove some NPUFIR bits from cs_root_cause list</li> |
| 1372 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/d69704d2fd07">d69704d2fd07</a> |
| 1373 | PRD: updates to XBUS interface callouts</li> |
| 1374 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/87e454859985">87e454859985</a> |
| 1375 | PRD: add c_err_rpt registers for INTCQFIR</li> |
| 1376 | </ul> |
| 1377 | <p>aravnair-in (1):</p> |
| 1378 | <ul class="simple"> |
| 1379 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8e01c68dc70d">8e01c68dc70d</a> |
| 1380 | Fix a couple of EKB files to prevent CMVC quirk</li> |
| 1381 | </ul> |
| 1382 | <p>crgeddes (1):</p> |
| 1383 | <ul class="simple"> |
| 1384 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/345c40eb09f2">345c40eb09f2</a> |
| 1385 | Use DD1 SW reset for XIVE unit until we get HW reset working in DD2</li> |
| 1386 | </ul> |
| 1387 | <p>dchowe (4):</p> |
| 1388 | <ul class="simple"> |
| 1389 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/666e095a50be">666e095a50be</a> |
| 1390 | Initfile updates for FBC DD2</li> |
| 1391 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/fdb995c8d77c">fdb995c8d77c</a> |
| 1392 | DD2 updated scan overrides, Cumulus DD1 initfile updates</li> |
| 1393 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/281b63f10d73">281b63f10d73</a> |
| 1394 | Update FBC cd_hp initfile to reference serial mode spys directly</li> |
| 1395 | <li><a class="reference external" href="https://github.com/open-power/hostboot/commit/8711f1044943">8711f1044943</a> |
| 1396 | disable lpc_ed in fbc to match mc setting</li> |
| 1397 | </ul> |
| 1398 | </div> |
| 1399 | </div> |
| 1400 | <div class="section" id="package-occ"> |
| 1401 | <h2>Package: occ<a class="headerlink" href="#package-occ" title="Permalink to this headline">¶</a></h2> |
| 1402 | <p><a class="reference external" href="https://github.com/open-power/occ">Repository</a></p> |
| 1403 | <div class="section" id="id9"> |
| 1404 | <h3>Patches<a class="headerlink" href="#id9" title="Permalink to this headline">¶</a></h3> |
| 1405 | </div> |
| 1406 | <div class="section" id="id10"> |
| 1407 | <h3>Commits<a class="headerlink" href="#id10" title="Permalink to this headline">¶</a></h3> |
| 1408 | <p>Andres Lugo-Reyes (4):</p> |
| 1409 | <ul class="simple"> |
| 1410 | <li><a class="reference external" href="https://github.com/open-power/occ/commit/fca494dbdcf9">fca494dbdcf9</a> |
| 1411 | Replace Firmware Level with FClip History in error log</li> |
| 1412 | <li><a class="reference external" href="https://github.com/open-power/occ/commit/bf6e716d3289">bf6e716d3289</a> |
| 1413 | Look at OCCFLG[30] to see if PGPE needs a new VFRT</li> |
| 1414 | <li><a class="reference external" href="https://github.com/open-power/occ/commit/cb3f5cf6a5b9">cb3f5cf6a5b9</a> |
| 1415 | WOF: Phase 2 Vratio calculation correction</li> |
| 1416 | <li><a class="reference external" href="https://github.com/open-power/occ/commit/1c7b23cc6b8f">1c7b23cc6b8f</a> |
| 1417 | WOF: Force ceff_ratio to 0% if voltage component is 0</li> |
| 1418 | </ul> |
| 1419 | <p>William Bryan (3):</p> |
| 1420 | <ul class="simple"> |
| 1421 | <li><a class="reference external" href="https://github.com/open-power/occ/commit/2fe8f2c01e62">2fe8f2c01e62</a> |
| 1422 | Buildname 3/1</li> |
| 1423 | <li><a class="reference external" href="https://github.com/open-power/occ/commit/81196c350c52">81196c350c52</a> |
| 1424 | Try to PCAP GPU again after busy failure CQ:SW414846</li> |
| 1425 | <li><a class="reference external" href="https://github.com/open-power/occ/commit/768466b31e85">768466b31e85</a> |
| 1426 | GPE1 Binary 3/8</li> |
| 1427 | </ul> |
| 1428 | <p>mbroyles (5):</p> |
| 1429 | <ul class="simple"> |
| 1430 | <li><a class="reference external" href="https://github.com/open-power/occ/commit/c9954444fc8d">c9954444fc8d</a> |
| 1431 | Calculate Pstate from a frequency starting at max frequency instead |
| 1432 | of min</li> |
| 1433 | <li><a class="reference external" href="https://github.com/open-power/occ/commit/ccdb19fba8c7">ccdb19fba8c7</a> |
| 1434 | Enable 24x7 on FSP systems</li> |
| 1435 | <li><a class="reference external" href="https://github.com/open-power/occ/commit/919b78927d26">919b78927d26</a> |
| 1436 | Characterization state meltbox support</li> |
| 1437 | <li><a class="reference external" href="https://github.com/open-power/occ/commit/e4bc12d978ab">e4bc12d978ab</a> |
| 1438 | Correct ASM WOF enable adjusted value</li> |
| 1439 | <li><a class="reference external" href="https://github.com/open-power/occ/commit/c44bd0f660c7">c44bd0f660c7</a> |
| 1440 | Support set data length command to improve AMESTER performance with |
| 1441 | Open BMC</li> |
| 1442 | </ul> |
| 1443 | </div> |
| 1444 | </div> |
| 1445 | <div class="section" id="package-op-build"> |
| 1446 | <h2>Package: op-build<a class="headerlink" href="#package-op-build" title="Permalink to this headline">¶</a></h2> |
| 1447 | <p><a class="reference external" href="https://github.com/open-power/op-build">Repository</a></p> |
| 1448 | <div class="section" id="id11"> |
| 1449 | <h3>Patches<a class="headerlink" href="#id11" title="Permalink to this headline">¶</a></h3> |
| 1450 | </div> |
| 1451 | <div class="section" id="id12"> |
| 1452 | <h3>Commits<a class="headerlink" href="#id12" title="Permalink to this headline">¶</a></h3> |
| 1453 | <p>No changes.</p> |
| 1454 | </div> |
| 1455 | </div> |
| 1456 | <div class="section" id="package-p9dsu-xml"> |
| 1457 | <h2>Package: p9dsu-xml<a class="headerlink" href="#package-p9dsu-xml" title="Permalink to this headline">¶</a></h2> |
| 1458 | <p><a class="reference external" href="https://github.com/open-power/p9dsu-xml">Repository</a></p> |
| 1459 | <div class="section" id="id13"> |
| 1460 | <h3>Patches<a class="headerlink" href="#id13" title="Permalink to this headline">¶</a></h3> |
| 1461 | </div> |
| 1462 | <div class="section" id="id14"> |
| 1463 | <h3>Commits<a class="headerlink" href="#id14" title="Permalink to this headline">¶</a></h3> |
| 1464 | <p>No changes.</p> |
| 1465 | </div> |
| 1466 | </div> |
| 1467 | <div class="section" id="package-palmetto-xml"> |
| 1468 | <h2>Package: palmetto-xml<a class="headerlink" href="#package-palmetto-xml" title="Permalink to this headline">¶</a></h2> |
| 1469 | <p><a class="reference external" href="https://github.com/open-power/palmetto-xml">Repository</a></p> |
| 1470 | <div class="section" id="id15"> |
| 1471 | <h3>Patches<a class="headerlink" href="#id15" title="Permalink to this headline">¶</a></h3> |
| 1472 | </div> |
| 1473 | <div class="section" id="id16"> |
| 1474 | <h3>Commits<a class="headerlink" href="#id16" title="Permalink to this headline">¶</a></h3> |
| 1475 | <p>No changes.</p> |
| 1476 | </div> |
| 1477 | </div> |
| 1478 | <div class="section" id="package-petitboot"> |
| 1479 | <h2>Package: petitboot<a class="headerlink" href="#package-petitboot" title="Permalink to this headline">¶</a></h2> |
| 1480 | <p><a class="reference external" href="https://github.com/open-power/petitboot">Repository</a></p> |
| 1481 | <div class="section" id="id17"> |
| 1482 | <h3>Patches<a class="headerlink" href="#id17" title="Permalink to this headline">¶</a></h3> |
| 1483 | <ul class="simple"> |
| 1484 | <li><a class="reference external" href="https://github.com/open-power/op-build/tree/v1.22-rc1/openpower/package/petitboot/petitboot-01-autotools-Add-autopoint-generated-files.patch">petitboot-01-autotools-Add-autopoint-generated-files.patch</a></li> |
| 1485 | </ul> |
| 1486 | </div> |
| 1487 | <div class="section" id="id18"> |
| 1488 | <h3>Commits<a class="headerlink" href="#id18" title="Permalink to this headline">¶</a></h3> |
| 1489 | <p>Brett Grandbois (7):</p> |
| 1490 | <ul class="simple"> |
| 1491 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/8f09986340e6">8f09986340e6</a> |
| 1492 | discover/pb-discover: #include <locale.h> for musl libc</li> |
| 1493 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/44ab15ff671f">44ab15ff671f</a> |
| 1494 | ncurses/nc-cui: musl libc fixes</li> |
| 1495 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/b63b778e7feb">b63b778e7feb</a> |
| 1496 | ncurses/nc-cui: fix unreferenced assertion variable</li> |
| 1497 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/a80b3cac1053">a80b3cac1053</a> |
| 1498 | grub2/grub2-parser: accept no whitespace in grub menuentry</li> |
| 1499 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/b6e83bb17299">b6e83bb17299</a> |
| 1500 | grub2/grub2: add Yocto paths to default grub2 conf search paths</li> |
| 1501 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/c8ba7b32759f">c8ba7b32759f</a> |
| 1502 | test/parser: test no whitespace on grub menuentry</li> |
| 1503 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/02af1caf9df8">02af1caf9df8</a> |
| 1504 | syslinux: add syslinux parser support</li> |
| 1505 | </ul> |
| 1506 | <p>Cyril Bur (7):</p> |
| 1507 | <ul class="simple"> |
| 1508 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/b2bc013b1413">b2bc013b1413</a> |
| 1509 | configure.ac: Fix unmatched brackets</li> |
| 1510 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/817e6698bcbb">817e6698bcbb</a> |
| 1511 | Fix bootstrap warning: noinst_PROGRAMS was already defined</li> |
| 1512 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/117a75f95ec3">117a75f95ec3</a> |
| 1513 | Better recognition of ncurses header files</li> |
| 1514 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/3a76e4214d5c">3a76e4214d5c</a> |
| 1515 | discover/pxe-parser: Fine grained proxy control</li> |
| 1516 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/eb9c570fa13b">eb9c570fa13b</a> |
| 1517 | configure.ac: Fix unmatched brackets</li> |
| 1518 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/17f04cb4d3d8">17f04cb4d3d8</a> |
| 1519 | Fix bootstrap warning: noinst_PROGRAMS was already defined</li> |
| 1520 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/bc8b183fbea6">bc8b183fbea6</a> |
| 1521 | Better recognition of ncurses header files</li> |
| 1522 | </ul> |
| 1523 | <p>Daniel Axtens (2):</p> |
| 1524 | <ul class="simple"> |
| 1525 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/591b8b6d39b2">591b8b6d39b2</a> |
| 1526 | Use –no-location instead of –add-location=never</li> |
| 1527 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/865097ff2cbb">865097ff2cbb</a> |
| 1528 | Test with .travis.yml</li> |
| 1529 | </ul> |
| 1530 | <p>Geoff Levand (4):</p> |
| 1531 | <ul class="simple"> |
| 1532 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/7aa2d8a3aefc">7aa2d8a3aefc</a> |
| 1533 | bootstrap: Add dependency checks</li> |
| 1534 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/e3f78333a2a1">e3f78333a2a1</a> |
| 1535 | configure: Add check for lex, yacc</li> |
| 1536 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/c462aa6f8e46">c462aa6f8e46</a> |
| 1537 | configure: Update AC_PACKAGE_BUGREPORT</li> |
| 1538 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/41caf09e98b1">41caf09e98b1</a> |
| 1539 | printf: Fix format type warnings</li> |
| 1540 | </ul> |
| 1541 | <p>Joel Stanley (5):</p> |
| 1542 | <ul class="simple"> |
| 1543 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/a5f80e0a9a40">a5f80e0a9a40</a> |
| 1544 | discover: Fix bad check of version string</li> |
| 1545 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/352f5c2729dc">352f5c2729dc</a> |
| 1546 | ncurses: Fix bad strncmp</li> |
| 1547 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/2b86765dfa37">2b86765dfa37</a> |
| 1548 | discover: Fix unused function warning</li> |
| 1549 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/2c97f136757b">2c97f136757b</a> |
| 1550 | test/parser: Fixed uninitialized variable warning</li> |
| 1551 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/47d0601affe8">47d0601affe8</a> |
| 1552 | discover: pxe: Avoid dereferencing null pointer</li> |
| 1553 | </ul> |
| 1554 | <p>Samuel Mendoza-Jonas (17):</p> |
| 1555 | <ul class="simple"> |
| 1556 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/33a0f544151f">33a0f544151f</a> |
| 1557 | ui/ncurses: Handle arrow key variants</li> |
| 1558 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/3af2c04787af">3af2c04787af</a> |
| 1559 | ui/ncurses: Handle arrow key variants</li> |
| 1560 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/c916e1333676">c916e1333676</a> |
| 1561 | ui/ncurses: Always cancel autoboot on exit</li> |
| 1562 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/f18998f6aac3">f18998f6aac3</a> |
| 1563 | ui/ncurses: Always cancel autoboot on exit</li> |
| 1564 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/a2d5a3e3cb55">a2d5a3e3cb55</a> |
| 1565 | discover/pxe-parser: Fix relative parsing for manual config files</li> |
| 1566 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/1ad12fe5b75e">1ad12fe5b75e</a> |
| 1567 | discover/pxe-parser: Fix relative parsing for manual config files</li> |
| 1568 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/2dfbd9811d1e">2dfbd9811d1e</a> |
| 1569 | ui/ncurses: Allow multiple hot key handlers per pmenu</li> |
| 1570 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/11c43508e436">11c43508e436</a> |
| 1571 | ui/ncurses: Clear remaining space when drawing help line</li> |
| 1572 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/ef13876e9fea">ef13876e9fea</a> |
| 1573 | discover/device-handler: Treat empty boot order as ‘boot any’</li> |
| 1574 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/aa23987dd043">aa23987dd043</a> |
| 1575 | discover/syslinux-parser: Fix missing comma in ignored names.</li> |
| 1576 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/dc85de97c79c">dc85de97c79c</a> |
| 1577 | discover: Allow load_async_url() to call callback for local paths</li> |
| 1578 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/d63bacef37d6">d63bacef37d6</a> |
| 1579 | ui/ncurses: Fix boot editor segfault on update</li> |
| 1580 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/7e0b9da2ae2f">7e0b9da2ae2f</a> |
| 1581 | discover/platform-powerpc: Avoid confusing gateway and URL</li> |
| 1582 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/fb8dbd274b4b">fb8dbd274b4b</a> |
| 1583 | ui/ncurses: Validate URL field</li> |
| 1584 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/e6407ab0ae61">e6407ab0ae61</a> |
| 1585 | lib: Fix gpg.h path</li> |
| 1586 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/526d4b3d959d">526d4b3d959d</a> |
| 1587 | utils/hooks: Set stdout-path property</li> |
| 1588 | <li><a class="reference external" href="https://github.com/open-power/petitboot/commit/c208aa42024f">c208aa42024f</a> |
| 1589 | discover/boot: Fix stale boot cancellation code</li> |
| 1590 | </ul> |
| 1591 | </div> |
| 1592 | </div> |
| 1593 | <div class="section" id="package-pnor"> |
| 1594 | <h2>Package: pnor<a class="headerlink" href="#package-pnor" title="Permalink to this headline">¶</a></h2> |
| 1595 | <p><a class="reference external" href="https://github.com/open-power/pnor">Repository</a></p> |
| 1596 | <div class="section" id="id19"> |
| 1597 | <h3>Patches<a class="headerlink" href="#id19" title="Permalink to this headline">¶</a></h3> |
| 1598 | </div> |
| 1599 | <div class="section" id="id20"> |
| 1600 | <h3>Commits<a class="headerlink" href="#id20" title="Permalink to this headline">¶</a></h3> |
| 1601 | <p>No changes.</p> |
| 1602 | </div> |
| 1603 | </div> |
| 1604 | <div class="section" id="package-romulus-xml"> |
| 1605 | <h2>Package: romulus-xml<a class="headerlink" href="#package-romulus-xml" title="Permalink to this headline">¶</a></h2> |
| 1606 | <p><a class="reference external" href="https://github.com/open-power/romulus-xml">Repository</a></p> |
| 1607 | <div class="section" id="id21"> |
| 1608 | <h3>Patches<a class="headerlink" href="#id21" title="Permalink to this headline">¶</a></h3> |
| 1609 | </div> |
| 1610 | <div class="section" id="id22"> |
| 1611 | <h3>Commits<a class="headerlink" href="#id22" title="Permalink to this headline">¶</a></h3> |
| 1612 | <p>No changes.</p> |
| 1613 | </div> |
| 1614 | </div> |
| 1615 | <div class="section" id="package-sbe"> |
| 1616 | <h2>Package: sbe<a class="headerlink" href="#package-sbe" title="Permalink to this headline">¶</a></h2> |
| 1617 | <p><a class="reference external" href="https://github.com/open-power/sbe">Repository</a></p> |
| 1618 | <div class="section" id="id23"> |
| 1619 | <h3>Patches<a class="headerlink" href="#id23" title="Permalink to this headline">¶</a></h3> |
| 1620 | </div> |
| 1621 | <div class="section" id="id24"> |
| 1622 | <h3>Commits<a class="headerlink" href="#id24" title="Permalink to this headline">¶</a></h3> |
| 1623 | <p>Amit Tendolkar (3):</p> |
| 1624 | <ul class="simple"> |
| 1625 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/731439265743">731439265743</a> |
| 1626 | Extend PM Reset flow to collect PM FFDC to HOMER</li> |
| 1627 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/8b75ed9d8f43">8b75ed9d8f43</a> |
| 1628 | Add EQ ATOMIC LOCK SCOM to security write whitelist for FFDC</li> |
| 1629 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/1384ebc764ac">1384ebc764ac</a> |
| 1630 | Update p9_collect_ppe_state to dynamically collect PPE FFDC</li> |
| 1631 | </ul> |
| 1632 | <p>Andre Marin (2):</p> |
| 1633 | <ul class="simple"> |
| 1634 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/92ababe68288">92ababe68288</a> |
| 1635 | Add initial p9c ddr_phy_reset, dimmBadDqBitmapAccessHwp, slew, & |
| 1636 | unmask_errors</li> |
| 1637 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/0ac911461767">0ac911461767</a> |
| 1638 | Modified gen_accessors script for greater support</li> |
| 1639 | </ul> |
| 1640 | <p>Anusha Reddy Rangareddygari (1):</p> |
| 1641 | <ul class="simple"> |
| 1642 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/3a8884d192b1">3a8884d192b1</a> |
| 1643 | Adding output_path option for sbe-debug.py</li> |
| 1644 | </ul> |
| 1645 | <p>Ben Gass (5):</p> |
| 1646 | <ul class="simple"> |
| 1647 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/9f5ce40fd271">9f5ce40fd271</a> |
| 1648 | Re-submit Axone updates</li> |
| 1649 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/75ddac2a41a9">75ddac2a41a9</a> |
| 1650 | Add support for p9c 1.2</li> |
| 1651 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/2b432b15cbe8">2b432b15cbe8</a> |
| 1652 | Axone MC uses same pll/clock setup as in Cumulus.</li> |
| 1653 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/1410d7f9ee83">1410d7f9ee83</a> |
| 1654 | Add p9n 2.3 to p9_frequency_buckets.H</li> |
| 1655 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/a347254a3aec">a347254a3aec</a> |
| 1656 | Removing trailing comma in system_attributes.xml</li> |
| 1657 | </ul> |
| 1658 | <p>Brian Silver (1):</p> |
| 1659 | <ul class="simple"> |
| 1660 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/da9b63d6c024">da9b63d6c024</a> |
| 1661 | Change p9_mss_freq_system to write attributes, errors for Cronus</li> |
| 1662 | </ul> |
| 1663 | <p>Brian Vanderpool (1):</p> |
| 1664 | <ul class="simple"> |
| 1665 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/2a438c9dd4b2">2a438c9dd4b2</a> |
| 1666 | Improve power and clock checking when checking for stop states</li> |
| 1667 | </ul> |
| 1668 | <p>CHRISTINA L. GRAVES (1):</p> |
| 1669 | <ul class="simple"> |
| 1670 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/b65fd5bcb57d">b65fd5bcb57d</a> |
| 1671 | p9_query_cache_access_state L2</li> |
| 1672 | </ul> |
| 1673 | <p>Christian Geddes (1):</p> |
| 1674 | <ul class="simple"> |
| 1675 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/f058c9945a4f">f058c9945a4f</a> |
| 1676 | Add attribute to give platform more control over PM_RESET</li> |
| 1677 | </ul> |
| 1678 | <p>Claus Michael Olsen (2):</p> |
| 1679 | <ul class="simple"> |
| 1680 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/b82c9d49c743">b82c9d49c743</a> |
| 1681 | Additional risk level support - (step 2) Updating the image w/RL2</li> |
| 1682 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/54f0bc5c31d3">54f0bc5c31d3</a> |
| 1683 | Update to putRingUtils to proper scanning of perv_pll_bndy_flt |
| 1684 | rings</li> |
| 1685 | </ul> |
| 1686 | <p>Dan Crowell (2):</p> |
| 1687 | <ul class="simple"> |
| 1688 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/ba6f0c6d234e">ba6f0c6d234e</a> |
| 1689 | Disabling WOF and VDM for Nimbus DD2.0</li> |
| 1690 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/c821b84e4ff5">c821b84e4ff5</a> |
| 1691 | Disable WOF for Cumulus DD1.0</li> |
| 1692 | </ul> |
| 1693 | <p>Dean Sanner (2):</p> |
| 1694 | <ul class="simple"> |
| 1695 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/d50cc1394696">d50cc1394696</a> |
| 1696 | Run lpc_init on all processors</li> |
| 1697 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/e962f1e8c736">e962f1e8c736</a> |
| 1698 | Honor STOP Gated bit when checking access states</li> |
| 1699 | </ul> |
| 1700 | <p>Elizabeth Liner (1):</p> |
| 1701 | <ul class="simple"> |
| 1702 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/29b11603626f">29b11603626f</a> |
| 1703 | Adding attribute to detect which processor we can use for alt-memory</li> |
| 1704 | </ul> |
| 1705 | <p>Greg Still (2):</p> |
| 1706 | <ul class="simple"> |
| 1707 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/b1386622238e">b1386622238e</a> |
| 1708 | PM_SPWKUP: Clear wakeup notify select bit to enable auto special |
| 1709 | wakeup</li> |
| 1710 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/cc59dcd72f9d">cc59dcd72f9d</a> |
| 1711 | PM: p9_setup_evid steps voltage to avoid Fleetwood VRM limitations</li> |
| 1712 | </ul> |
| 1713 | <p>Joachim Fenkes (3):</p> |
| 1714 | <ul class="simple"> |
| 1715 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/cce76062ef2f">cce76062ef2f</a> |
| 1716 | hwpErrors: Use wildcard instead of explicit list</li> |
| 1717 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/d1da43c4e54d">d1da43c4e54d</a> |
| 1718 | LPC: Add empty files for mirroring to HB, PPE, HWSV</li> |
| 1719 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/da13fade1742">da13fade1742</a> |
| 1720 | p9_sbe_lpc_init: Fix timeout setup</li> |
| 1721 | </ul> |
| 1722 | <p>Joe McGill (3):</p> |
| 1723 | <ul class="simple"> |
| 1724 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/d2a0b0c1617c">d2a0b0c1617c</a> |
| 1725 | FIR + RAS XML updates</li> |
| 1726 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/4d30a3d9b261">4d30a3d9b261</a> |
| 1727 | p9_sbe_tracearray – satsify PRD calls to manage core trace arrays</li> |
| 1728 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/9da1175ad43a">9da1175ad43a</a> |
| 1729 | Add base FAPI2 attribute definitions</li> |
| 1730 | </ul> |
| 1731 | <p>Lennard Streat (1):</p> |
| 1732 | <ul class="simple"> |
| 1733 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/ffd086397fb0">ffd086397fb0</a> |
| 1734 | Protect Firmware from exposure to HW423533</li> |
| 1735 | </ul> |
| 1736 | <p>Luke C. Murray (1):</p> |
| 1737 | <ul class="simple"> |
| 1738 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/c955a5c32115">c955a5c32115</a> |
| 1739 | Updating NCU tlbie pacing dials</li> |
| 1740 | </ul> |
| 1741 | <p>Luke Mulkey (2):</p> |
| 1742 | <ul class="simple"> |
| 1743 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/e275751a409c">e275751a409c</a> |
| 1744 | Existing code changes for ddr_phy_reset HB mirror</li> |
| 1745 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/2cd7837eb2ec">2cd7837eb2ec</a> |
| 1746 | p9c_mss_memdiags and p9c_mss_maint_cmds</li> |
| 1747 | </ul> |
| 1748 | <p>Matt K. Light (1):</p> |
| 1749 | <ul class="simple"> |
| 1750 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/efcd5ec67072">efcd5ec67072</a> |
| 1751 | adding fapi2::putSpyWithCare()</li> |
| 1752 | </ul> |
| 1753 | <p>Matthew Hickman (1):</p> |
| 1754 | <ul class="simple"> |
| 1755 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/8e7dbfd13ce4">8e7dbfd13ce4</a> |
| 1756 | Added RCD Protect time and MNFG Flag check to unmask function</li> |
| 1757 | </ul> |
| 1758 | <p>Nick Klazynski (4):</p> |
| 1759 | <ul class="simple"> |
| 1760 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/ace31fa4b8c6">ace31fa4b8c6</a> |
| 1761 | Add TM WAT workaround; NDD2.2 and CDD1.1 only</li> |
| 1762 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/1fb2cb5cb795">1fb2cb5cb795</a> |
| 1763 | Add Cumulus DD1.1 inits</li> |
| 1764 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/b51252885ec6">b51252885ec6</a> |
| 1765 | Enable risklevel2, match v44 of security wiki</li> |
| 1766 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/00bb7b34d2a8">00bb7b34d2a8</a> |
| 1767 | Remove CDD1.1 security IMC; Apply indirect branch serialization to |
| 1768 | HV=0 only</li> |
| 1769 | </ul> |
| 1770 | <p>Oliver Morlok (1):</p> |
| 1771 | <ul class="simple"> |
| 1772 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/56e408e085ca">56e408e085ca</a> |
| 1773 | Get a z compile working</li> |
| 1774 | </ul> |
| 1775 | <p>Prasad Bg Ranganath (1):</p> |
| 1776 | <ul class="simple"> |
| 1777 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/69bc840ab99a">69bc840ab99a</a> |
| 1778 | Fix bug in cache query state procedure</li> |
| 1779 | </ul> |
| 1780 | <p>Raja Das (2):</p> |
| 1781 | <ul class="simple"> |
| 1782 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/2dce1d2d7fbb">2dce1d2d7fbb</a> |
| 1783 | SBE Space optimisation</li> |
| 1784 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/9b7838172f0b">9b7838172f0b</a> |
| 1785 | SBE Regression</li> |
| 1786 | </ul> |
| 1787 | <p>Sachin Gupta (5):</p> |
| 1788 | <ul class="simple"> |
| 1789 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/d27218491dda">d27218491dda</a> |
| 1790 | Retry multicast chiplet offline errors.</li> |
| 1791 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/ab0fc4ba6ffb">ab0fc4ba6ffb</a> |
| 1792 | Update backing build</li> |
| 1793 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/967fefdf8af1">967fefdf8af1</a> |
| 1794 | Fix test sequence</li> |
| 1795 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/321de657b979">321de657b979</a> |
| 1796 | Update backing build</li> |
| 1797 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/5c0363924c7d">5c0363924c7d</a> |
| 1798 | Handle race condition between PSU/FIFO interface.</li> |
| 1799 | </ul> |
| 1800 | <p>Soma BhanuTej (3):</p> |
| 1801 | <ul class="simple"> |
| 1802 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/55603147cd5b">55603147cd5b</a> |
| 1803 | Mask TP LFIR for non PPE mode - p9_sbe_common</li> |
| 1804 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/ace2c563f607">ace2c563f607</a> |
| 1805 | Axone support to TP stopclocks</li> |
| 1806 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/4e41a9415858">4e41a9415858</a> |
| 1807 | Change TP FIR bits 38, 39, 40 as recoverable & Masked</li> |
| 1808 | </ul> |
| 1809 | <p>Sumit Kumar (1):</p> |
| 1810 | <ul class="simple"> |
| 1811 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/2b29de060c3e">2b29de060c3e</a> |
| 1812 | Erepair HWP p9_io_erepair procedure</li> |
| 1813 | </ul> |
| 1814 | <p>Yue Du (2):</p> |
| 1815 | <ul class="simple"> |
| 1816 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/20c449a70cde">20c449a70cde</a> |
| 1817 | STOP: Support Suspend Entry/Exit and Fix Pig Collision</li> |
| 1818 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/148a8c9278b9">148a8c9278b9</a> |
| 1819 | STOP: Fix Wakeup terminate prematurely with mixed stop2 and stop4</li> |
| 1820 | </ul> |
| 1821 | <p>aravnair-in (1):</p> |
| 1822 | <ul class="simple"> |
| 1823 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/160637c9e837">160637c9e837</a> |
| 1824 | Fix a couple of EKB files to prevent CMVC quirk</li> |
| 1825 | </ul> |
| 1826 | <p>crgeddes (3):</p> |
| 1827 | <ul class="simple"> |
| 1828 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/7808b4fe065e">7808b4fe065e</a> |
| 1829 | Update p9_query_cache_access_state to use the correct scom |
| 1830 | register</li> |
| 1831 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/49613ee7ed9e">49613ee7ed9e</a> |
| 1832 | Skip EQ_CLOCK_STAT_SL scom is we are in stop 11 or greater</li> |
| 1833 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/2c07fd2bbb9d">2c07fd2bbb9d</a> |
| 1834 | Add RCD_PARITY_ERROR enum value to ATTR_RECONFIGURE_LOOP</li> |
| 1835 | </ul> |
| 1836 | <p>spashabk-in (7):</p> |
| 1837 | <ul class="simple"> |
| 1838 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/ffa97b5fd9ff">ffa97b5fd9ff</a> |
| 1839 | Fix missing sbe traces in errorlog</li> |
| 1840 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/6526984e4ae4">6526984e4ae4</a> |
| 1841 | Extend sbe-debug.py to get ppe register ffdc</li> |
| 1842 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/8e9d92bf3c8f">8e9d92bf3c8f</a> |
| 1843 | Check for disable scom filtering bit</li> |
| 1844 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/9355a3505c0a">9355a3505c0a</a> |
| 1845 | Cleanup generic chipop files</li> |
| 1846 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/6699e49f885f">6699e49f885f</a> |
| 1847 | Dump transition during continuous ipl</li> |
| 1848 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/9e30f6413207">9e30f6413207</a> |
| 1849 | Check for checkstop during mpipl</li> |
| 1850 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/26fbcbed7c36">26fbcbed7c36</a> |
| 1851 | Restructure sbe-debug.py</li> |
| 1852 | </ul> |
| 1853 | <p>whs (1):</p> |
| 1854 | <ul class="simple"> |
| 1855 | <li><a class="reference external" href="https://github.com/open-power/sbe/commit/90316ae6f36a">90316ae6f36a</a> |
| 1856 | Changes related to packaging of memory vpd on Nimbus</li> |
| 1857 | </ul> |
| 1858 | </div> |
| 1859 | </div> |
| 1860 | <div class="section" id="package-skiboot"> |
| 1861 | <h2>Package: skiboot<a class="headerlink" href="#package-skiboot" title="Permalink to this headline">¶</a></h2> |
| 1862 | <p><a class="reference external" href="https://github.com/open-power/skiboot">Repository</a></p> |
| 1863 | <div class="section" id="id25"> |
| 1864 | <h3>Patches<a class="headerlink" href="#id25" title="Permalink to this headline">¶</a></h3> |
| 1865 | </div> |
| 1866 | <div class="section" id="id26"> |
| 1867 | <h3>Commits<a class="headerlink" href="#id26" title="Permalink to this headline">¶</a></h3> |
| 1868 | <p>Akshay Adiga (1):</p> |
| 1869 | <ul class="simple"> |
| 1870 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/87f33f499061">87f33f499061</a> |
| 1871 | SLW: Increase stop4-5 residency by 10x</li> |
| 1872 | </ul> |
| 1873 | <p>Alistair Popple (1):</p> |
| 1874 | <ul class="simple"> |
| 1875 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/759c23acb4b6">759c23acb4b6</a> |
| 1876 | hw/npu2: Assign a unique LPARSHORTID per GPU</li> |
| 1877 | </ul> |
| 1878 | <p>Andrew Donnellan (12):</p> |
| 1879 | <ul class="simple"> |
| 1880 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/399151e1425e">399151e1425e</a> |
| 1881 | npu2: Split out common helper functions into separate file</li> |
| 1882 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/11b46291111a">11b46291111a</a> |
| 1883 | npu2: Rework NPU data structures for OpenCAPI</li> |
| 1884 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/3603f474e566">3603f474e566</a> |
| 1885 | platform: Add fields for OpenCAPI platform data</li> |
| 1886 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/b5f1fd30ef56">b5f1fd30ef56</a> |
| 1887 | npu2-opencapi: Configure NPU for OpenCAPI</li> |
| 1888 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/9db58b1e5c03">9db58b1e5c03</a> |
| 1889 | npu2-hw-procedures: Add support for OpenCAPI PHY link training</li> |
| 1890 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/6b1cdedcef1d">6b1cdedcef1d</a> |
| 1891 | npu2-opencapi: Train OpenCAPI links and setup devices</li> |
| 1892 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/5b72a43c59cb">5b72a43c59cb</a> |
| 1893 | platforms: Add OpenCAPI platform data and device tree nodes</li> |
| 1894 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/f2e637b802e3">f2e637b802e3</a> |
| 1895 | doc/device-tree: Add PCI bindings stub</li> |
| 1896 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/bd6194f5a864">bd6194f5a864</a> |
| 1897 | doc/device-tree: Add OpenCAPI device tree bindings</li> |
| 1898 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/9972229b6b11">9972229b6b11</a> |
| 1899 | gitignore: Add *.a</li> |
| 1900 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/d8c596368279">d8c596368279</a> |
| 1901 | npu2: Remove unused fields in struct npu2</li> |
| 1902 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/87145c6bad5b">87145c6bad5b</a> |
| 1903 | npu2: Remove DD1 support</li> |
| 1904 | </ul> |
| 1905 | <p>Artem Senichev (1):</p> |
| 1906 | <ul class="simple"> |
| 1907 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/bfdf5787b9d8">bfdf5787b9d8</a> |
| 1908 | Add VESNIN platform support</li> |
| 1909 | </ul> |
| 1910 | <p>Christophe Lombard (1):</p> |
| 1911 | <ul class="simple"> |
| 1912 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/0180de29859b">0180de29859b</a> |
| 1913 | capp: Add lid definition for P9 DD-2.2</li> |
| 1914 | </ul> |
| 1915 | <p>Cyril Bur (10):</p> |
| 1916 | <ul class="simple"> |
| 1917 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/682e196627a0">682e196627a0</a> |
| 1918 | libflash/blocklevel: Correct miscalculation in |
| 1919 | blocklevel_smart_erase()</li> |
| 1920 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/70166b34238e">70166b34238e</a> |
| 1921 | mbox: Harden against BMC daemon errors</li> |
| 1922 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/8c0224322650">8c0224322650</a> |
| 1923 | mbox: Reduce default BMC timeouts</li> |
| 1924 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/5630c819b3cb">5630c819b3cb</a> |
| 1925 | occ-sensors: Remove NULL checks after dereference</li> |
| 1926 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/f4f88196aec7">f4f88196aec7</a> |
| 1927 | npu2: Fix possible NULL dereference</li> |
| 1928 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/4599a8bdf9de">4599a8bdf9de</a> |
| 1929 | npu2-opencapi: Fix memory leak</li> |
| 1930 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/3c3b809cb8ba">3c3b809cb8ba</a> |
| 1931 | libstb/create-container: munmap() signature file address</li> |
| 1932 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/7598ed90a670">7598ed90a670</a> |
| 1933 | fast-reboot: occ: Only delete /ibm, opal/power-mgt nodes if they |
| 1934 | exist</li> |
| 1935 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/35f003a01174">35f003a01174</a> |
| 1936 | hw/imc: Don’t dereference possible NULL</li> |
| 1937 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/351b05be3d40">351b05be3d40</a> |
| 1938 | dts: Zero struct to avoid using uninitialised value</li> |
| 1939 | </ul> |
| 1940 | <p>Cédric Le Goater (1):</p> |
| 1941 | <ul class="simple"> |
| 1942 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/dcbf18c1f0e1">dcbf18c1f0e1</a> |
| 1943 | xive: fix opal_xive_set_vp_info() error path</li> |
| 1944 | </ul> |
| 1945 | <p>Dan Crowell (1):</p> |
| 1946 | <ul class="simple"> |
| 1947 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/4fcf4549d168">4fcf4549d168</a> |
| 1948 | Make gard display show that a record is cleared</li> |
| 1949 | </ul> |
| 1950 | <p>Frederic Barrat (2):</p> |
| 1951 | <ul class="simple"> |
| 1952 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/cd8b82a8e83e">cd8b82a8e83e</a> |
| 1953 | npu2-opencapi: Add OpenCAPI OPAL API calls</li> |
| 1954 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/48dd5f7b9fbb">48dd5f7b9fbb</a> |
| 1955 | npu2-opencapi: Fix assert on link reset during init</li> |
| 1956 | </ul> |
| 1957 | <p>Joel Stanley (1):</p> |
| 1958 | <ul class="simple"> |
| 1959 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/0df891697d24">0df891697d24</a> |
| 1960 | README: document output files</li> |
| 1961 | </ul> |
| 1962 | <p>Mahesh Salgaonkar (1):</p> |
| 1963 | <ul class="simple"> |
| 1964 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/603beb4500f5">603beb4500f5</a> |
| 1965 | Reserve OPAL API number for opal_handle_hmi2 function.</li> |
| 1966 | </ul> |
| 1967 | <p>Matt Brown (3):</p> |
| 1968 | <ul class="simple"> |
| 1969 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/2d4c774c2a3a">2d4c774c2a3a</a> |
| 1970 | core/lock: Add deadlock detection</li> |
| 1971 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/84186ef0944c">84186ef0944c</a> |
| 1972 | core/lock: Add lock timeout warnings</li> |
| 1973 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/8d0f41e021b3">8d0f41e021b3</a> |
| 1974 | gcov: Add gcov data struct to sysfs</li> |
| 1975 | </ul> |
| 1976 | <p>Michael Ellerman (1):</p> |
| 1977 | <ul class="simple"> |
| 1978 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/f30286c49431">f30286c49431</a> |
| 1979 | mambo: Add fw-feature flags for security related settings</li> |
| 1980 | </ul> |
| 1981 | <p>Michael Neuling (6):</p> |
| 1982 | <ul class="simple"> |
| 1983 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/bb3348c865a8">bb3348c865a8</a> |
| 1984 | core/pci-dt-slot: Fix booting with no slot map</li> |
| 1985 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/fa03921a9aa6">fa03921a9aa6</a> |
| 1986 | pci: Move code around</li> |
| 1987 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/fe6d86b92a00">fe6d86b92a00</a> |
| 1988 | pci: Make fast reboot creset PHBs in parallel</li> |
| 1989 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/18d7ee718bef">18d7ee718bef</a> |
| 1990 | core/init: Assert when kernel not found</li> |
| 1991 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/730bccbbb615">730bccbbb615</a> |
| 1992 | Tie tm-suspend fw-feature and opal_reinit_cpus() together</li> |
| 1993 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/75a89e61c9d9">75a89e61c9d9</a> |
| 1994 | pci: Reduce log level of error message</li> |
| 1995 | </ul> |
| 1996 | <p>Murilo Opsfelder Araujo (1):</p> |
| 1997 | <ul class="simple"> |
| 1998 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/f23240f50653">f23240f50653</a> |
| 1999 | skiboot.spec: Update to v5.10 release</li> |
| 2000 | </ul> |
| 2001 | <p>Nicholas Piggin (12):</p> |
| 2002 | <ul class="simple"> |
| 2003 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/8cbd3880c321">8cbd3880c321</a> |
| 2004 | direct-controls: mambo fix for multiple chips</li> |
| 2005 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/f6159cff5d91">f6159cff5d91</a> |
| 2006 | build: use thin archives rather than incremental linking</li> |
| 2007 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/56a85b41d231">56a85b41d231</a> |
| 2008 | core/hmi: report processor recovery reason from core FIR bits on P9</li> |
| 2009 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/884f97b25b49">884f97b25b49</a> |
| 2010 | core/opal: abort in case of re-entrant OPAL call</li> |
| 2011 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/82fd5d06beee">82fd5d06beee</a> |
| 2012 | core/opal: allow some re-entrant calls</li> |
| 2013 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/1f53f9fa766f">1f53f9fa766f</a> |
| 2014 | core/fast-reboot: disable fast reboot upon fundamental |
| 2015 | entry/exit/locking errors</li> |
| 2016 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/8cabd06243ac">8cabd06243ac</a> |
| 2017 | core/fast-reboot: verify mem regions before fast reboot</li> |
| 2018 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/336f306555d0">336f306555d0</a> |
| 2019 | mem-map: Use a symbolic constant for exception vector size</li> |
| 2020 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/c32943bfc1e2">c32943bfc1e2</a> |
| 2021 | core/fast-reboot: zero memory after fast reboot</li> |
| 2022 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/a1c3dcca81ce">a1c3dcca81ce</a> |
| 2023 | nvram: run nvram_validate() after nvram_reformat()</li> |
| 2024 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/103f67fe83f1">103f67fe83f1</a> |
| 2025 | hw/imc: don’t access homer memory if it was not initialised</li> |
| 2026 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/90d53934c2da">90d53934c2da</a> |
| 2027 | core/cpu: discover stack region size before initialising memory |
| 2028 | regions</li> |
| 2029 | </ul> |
| 2030 | <p>Oliver O’Halloran (1):</p> |
| 2031 | <ul class="simple"> |
| 2032 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/3e74805702f6">3e74805702f6</a> |
| 2033 | phb*: Remove the state field in the various phb structures</li> |
| 2034 | </ul> |
| 2035 | <p>Philippe Bergheaud (2):</p> |
| 2036 | <ul class="simple"> |
| 2037 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/a8cfb0906643">a8cfb0906643</a> |
| 2038 | phb4: set PHB CMPM registers for tunneled operations</li> |
| 2039 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/0f3584d84662">0f3584d84662</a> |
| 2040 | phb4: set PBCQ Tunnel BAR for tunneled operations</li> |
| 2041 | </ul> |
| 2042 | <p>Pridhiviraj Paidipeddi (5):</p> |
| 2043 | <ul class="simple"> |
| 2044 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/f24db9e5c8c4">f24db9e5c8c4</a> |
| 2045 | libstb/secureboot: Fix logging of secure verify messages.</li> |
| 2046 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/20f685a3627a">20f685a3627a</a> |
| 2047 | console(lpc/fsp-console): Use only stdout-path property on P9 and |
| 2048 | above</li> |
| 2049 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/28a414b3e4c5">28a414b3e4c5</a> |
| 2050 | doc/opal-api: Document using stdout-path property</li> |
| 2051 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/f69d2ac579b6">f69d2ac579b6</a> |
| 2052 | core/ipmi-opal: Add interrupt-parent property for ipmi node on P9 and |
| 2053 | above.</li> |
| 2054 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/8ea3ac76137b">8ea3ac76137b</a> |
| 2055 | doc/opal-api: Document changes of adding interrupt-parent property |
| 2056 | under /ibm, opal/ipmi node on POWER9 and above.</li> |
| 2057 | </ul> |
| 2058 | <p>Reza Arbab (3):</p> |
| 2059 | <ul class="simple"> |
| 2060 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/105d80f85b07">105d80f85b07</a> |
| 2061 | npu2: Use unfiltered mode in XTS tables</li> |
| 2062 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/773836f3424d">773836f3424d</a> |
| 2063 | npu2: Disable fast reboot</li> |
| 2064 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/0ce7482fb650">0ce7482fb650</a> |
| 2065 | npu2: Add performance tuning SCOM inits</li> |
| 2066 | </ul> |
| 2067 | <p>Shilpasri G Bhat (2):</p> |
| 2068 | <ul class="simple"> |
| 2069 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/ac4272bf5e73">ac4272bf5e73</a> |
| 2070 | fast-reboot: occ: Delete OCC child nodes in /ibm, opal/power-mgt</li> |
| 2071 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/b5c9d09d0677">b5c9d09d0677</a> |
| 2072 | dts: spl_wakeup: Remove all workarounds in the spl wakeup logic</li> |
| 2073 | </ul> |
| 2074 | <p>Stewart Smith (16):</p> |
| 2075 | <ul class="simple"> |
| 2076 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/fbdc91e693fc">fbdc91e693fc</a> |
| 2077 | NPU2 HMIs: dump out a <em>LOT</em> of npu2 registers for debugging</li> |
| 2078 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/fa1eeea2e987">fa1eeea2e987</a> |
| 2079 | doc: skiboot 5.10.1 release notes</li> |
| 2080 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/785b35d18808">785b35d18808</a> |
| 2081 | fast-reboot: enable by default for POWER9</li> |
| 2082 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/5ba69bb62ca2">5ba69bb62ca2</a> |
| 2083 | skiboot 5.10.2 release notes</li> |
| 2084 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/217f74b0c40e">217f74b0c40e</a> |
| 2085 | Revert “console(lpc/fsp-console): Use only stdout-path property on P9 |
| 2086 | and above”</li> |
| 2087 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/b71db454f703">b71db454f703</a> |
| 2088 | Keep constructors with priorities</li> |
| 2089 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/2d75b9439f66">2d75b9439f66</a> |
| 2090 | gcov: Another GCC, another gcov tweak</li> |
| 2091 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/f88ffa66d1b4">f88ffa66d1b4</a> |
| 2092 | cpu_idle_job: relax a bit</li> |
| 2093 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/a8e6cc3f4752">a8e6cc3f4752</a> |
| 2094 | Don’t detect lock timeouts when timebase is invalid</li> |
| 2095 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/1090f346713a">1090f346713a</a> |
| 2096 | Revert “platforms/astbmc/slots.c: Allow comparison of bus numbers |
| 2097 | when matching slots”</li> |
| 2098 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/547377ddcd93">547377ddcd93</a> |
| 2099 | occ: Set up OCC messaging even if we fail to setup pstates</li> |
| 2100 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/80452d2cf2ce">80452d2cf2ce</a> |
| 2101 | Revert “NPU2 HMIs: dump out a <em>LOT</em> of npu2 registers for debugging”</li> |
| 2102 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/215a7ce1f186">215a7ce1f186</a> |
| 2103 | NPU2: dump NPU2 registers on npu2 HMI</li> |
| 2104 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/c05a8178dffa">c05a8178dffa</a> |
| 2105 | Fix ‘make check’ compile for mem_clear_range</li> |
| 2106 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/5771b85b1bc2">5771b85b1bc2</a> |
| 2107 | skiboot 5.10.3 release notes</li> |
| 2108 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/0a1d25fbae1a">0a1d25fbae1a</a> |
| 2109 | skiboot 5.11-rc1 release notes</li> |
| 2110 | </ul> |
| 2111 | <p>Vaibhav Jain (3):</p> |
| 2112 | <ul class="simple"> |
| 2113 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/53c4553dd767">53c4553dd767</a> |
| 2114 | capp: Disable fast-reboot when capp is enabled</li> |
| 2115 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/a72d055d9337">a72d055d9337</a> |
| 2116 | capp: Make error in capp timebase sync a non-fatal error</li> |
| 2117 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/b1190f403248">b1190f403248</a> |
| 2118 | capp: Disable fast-reboot whenever enable_capi_mode() is called</li> |
| 2119 | </ul> |
| 2120 | <p>Vasant Hegde (1):</p> |
| 2121 | <ul class="simple"> |
| 2122 | <li><a class="reference external" href="https://github.com/open-power/skiboot/commit/1dacecd2b28b">1dacecd2b28b</a> |
| 2123 | core: Fix ‘opal-runtime-size’ property</li> |
| 2124 | </ul> |
| 2125 | </div> |
| 2126 | </div> |
| 2127 | <div class="section" id="package-witherspoon-xml"> |
| 2128 | <h2>Package: witherspoon-xml<a class="headerlink" href="#package-witherspoon-xml" title="Permalink to this headline">¶</a></h2> |
| 2129 | <p><a class="reference external" href="https://github.com/open-power/witherspoon-xml">Repository</a></p> |
| 2130 | <div class="section" id="id27"> |
| 2131 | <h3>Patches<a class="headerlink" href="#id27" title="Permalink to this headline">¶</a></h3> |
| 2132 | </div> |
| 2133 | <div class="section" id="id28"> |
| 2134 | <h3>Commits<a class="headerlink" href="#id28" title="Permalink to this headline">¶</a></h3> |
| 2135 | <p>Erich Hauptli (2):</p> |
| 2136 | <ul class="simple"> |
| 2137 | <li><a class="reference external" href="https://github.com/open-power/witherspoon-xml/commit/6ca015dbd3e1">6ca015dbd3e1</a> |
| 2138 | Syncing MRW with op-release</li> |
| 2139 | <li><a class="reference external" href="https://github.com/open-power/witherspoon-xml/commit/c10638fa2a83">c10638fa2a83</a> |
| 2140 | Switching back to OBus bucket 1</li> |
| 2141 | </ul> |
| 2142 | </div> |
| 2143 | </div> |
| 2144 | <div class="section" id="package-zaius-xml"> |
| 2145 | <h2>Package: zaius-xml<a class="headerlink" href="#package-zaius-xml" title="Permalink to this headline">¶</a></h2> |
| 2146 | <p><a class="reference external" href="https://github.com/open-power/zaius-xml">Repository</a></p> |
| 2147 | <div class="section" id="id29"> |
| 2148 | <h3>Patches<a class="headerlink" href="#id29" title="Permalink to this headline">¶</a></h3> |
| 2149 | </div> |
| 2150 | <div class="section" id="id30"> |
| 2151 | <h3>Commits<a class="headerlink" href="#id30" title="Permalink to this headline">¶</a></h3> |
| 2152 | <p>Adrian Barrera (4):</p> |
| 2153 | <ul class="simple"> |
| 2154 | <li><a class="reference external" href="https://github.com/open-power/zaius-xml/commit/ca689febb5a6">ca689febb5a6</a> |
| 2155 | Update EREPAIR attributes</li> |
| 2156 | <li><a class="reference external" href="https://github.com/open-power/zaius-xml/commit/5e48835aacb1">5e48835aacb1</a> |
| 2157 | Update Obus PLL bucket to 25G</li> |
| 2158 | <li><a class="reference external" href="https://github.com/open-power/zaius-xml/commit/a426841eeba2">a426841eeba2</a> |
| 2159 | Set Obus channel type to cable</li> |
| 2160 | <li><a class="reference external" href="https://github.com/open-power/zaius-xml/commit/4b012a3d1da5">4b012a3d1da5</a> |
| 2161 | Add new 23c WOF table</li> |
| 2162 | </ul> |
| 2163 | </div> |
| 2164 | </div> |
| 2165 | </div> |
| 2166 | |
| 2167 | |
| 2168 | </div> |
| 2169 | |
| 2170 | </div> |
| 2171 | </div> |
| 2172 | <div class="sphinxsidebar" role="navigation" aria-label="main navigation"> |
| 2173 | <div class="sphinxsidebarwrapper"> |
| 2174 | <h1 class="logo"><a href="../index.html">OpenPOWER Firmware</a></h1> |
| 2175 | |
| 2176 | |
| 2177 | |
| 2178 | |
| 2179 | |
| 2180 | |
| 2181 | |
| 2182 | |
| 2183 | <h3>Navigation</h3> |
| 2184 | <p class="caption"><span class="caption-text">Contents:</span></p> |
| 2185 | <ul class="current"> |
| 2186 | <li class="toctree-l1"><a class="reference internal" href="../introduction.html">Introduction to OpenPOWER Firmware</a></li> |
| 2187 | <li class="toctree-l1"><a class="reference internal" href="../testing.html">Testing op-build</a></li> |
| 2188 | <li class="toctree-l1"><a class="reference internal" href="../process/index.html">Development Process</a></li> |
| 2189 | <li class="toctree-l1"><a class="reference internal" href="../boot-devices.html">Supported Boot Devices</a></li> |
| 2190 | <li class="toctree-l1"><a class="reference internal" href="../versioning.html">Version Scheme</a></li> |
| 2191 | <li class="toctree-l1 current"><a class="reference internal" href="index.html">op-build Release Notes</a><ul class="current"> |
| 2192 | <li class="toctree-l2"><a class="reference internal" href="index.html#v1-21">v1.21</a></li> |
| 2193 | <li class="toctree-l2 current"><a class="reference internal" href="index.html#v1-22">v1.22</a></li> |
| 2194 | <li class="toctree-l2"><a class="reference internal" href="index.html#v2-0">v2.0</a></li> |
| 2195 | <li class="toctree-l2"><a class="reference internal" href="index.html#v2-1">v2.1</a></li> |
| 2196 | <li class="toctree-l2"><a class="reference internal" href="index.html#v2-2">v2.2</a></li> |
| 2197 | <li class="toctree-l2"><a class="reference internal" href="index.html#v2-3">v2.3</a></li> |
| 2198 | <li class="toctree-l2"><a class="reference internal" href="index.html#v2-4">v2.4</a></li> |
| 2199 | <li class="toctree-l2"><a class="reference internal" href="index.html#v2-5">v2.5</a></li> |
| 2200 | <li class="toctree-l2"><a class="reference internal" href="index.html#v2-6">v2.6</a></li> |
| 2201 | </ul> |
| 2202 | </li> |
| 2203 | </ul> |
| 2204 | |
| 2205 | <div class="relations"> |
| 2206 | <h3>Related Topics</h3> |
| 2207 | <ul> |
| 2208 | <li><a href="../index.html">Documentation overview</a><ul> |
| 2209 | <li><a href="index.html">op-build Release Notes</a><ul> |
| 2210 | <li>Previous: <a href="v1.21.2.html" title="previous chapter">Release Notes for OpenPower Firmware v1.21.2</a></li> |
| 2211 | <li>Next: <a href="v1.22.html" title="next chapter">Release Notes for OpenPower Firmware v1.22</a></li> |
| 2212 | </ul></li> |
| 2213 | </ul></li> |
| 2214 | </ul> |
| 2215 | </div> |
| 2216 | <div id="searchbox" style="display: none" role="search"> |
| 2217 | <h3>Quick search</h3> |
| 2218 | <div class="searchformwrapper"> |
| 2219 | <form class="search" action="../search.html" method="get"> |
| 2220 | <input type="text" name="q" /> |
| 2221 | <input type="submit" value="Go" /> |
| 2222 | <input type="hidden" name="check_keywords" value="yes" /> |
| 2223 | <input type="hidden" name="area" value="default" /> |
| 2224 | </form> |
| 2225 | </div> |
| 2226 | </div> |
| 2227 | <script type="text/javascript">$('#searchbox').show(0);</script> |
| 2228 | |
| 2229 | |
| 2230 | |
| 2231 | |
| 2232 | |
| 2233 | |
| 2234 | |
| 2235 | |
| 2236 | </div> |
| 2237 | </div> |
| 2238 | <div class="clearer"></div> |
| 2239 | </div> |
| 2240 | <div class="footer"> |
| 2241 | ©2017, OpenPOWER Foundation System Software Work Group. |
| 2242 | |
| 2243 | | |
| 2244 | Powered by <a href="http://sphinx-doc.org/">Sphinx 1.7.9</a> |
| 2245 | & <a href="https://github.com/bitprophet/alabaster">Alabaster 0.7.12</a> |
| 2246 | |
| 2247 | | |
| 2248 | <a href="../_sources/release-notes/v1.22-rc1.rst.txt" |
| 2249 | rel="nofollow">Page source</a> |
| 2250 | </div> |
| 2251 | |
| 2252 | |
| 2253 | |
| 2254 | |
| 2255 | </body> |
| 2256 | </html> |